diff --git a/portal-ui/build/asset-manifest.json b/portal-ui/build/asset-manifest.json index 0d732c883..39a8d661d 100644 --- a/portal-ui/build/asset-manifest.json +++ b/portal-ui/build/asset-manifest.json @@ -1,25 +1,25 @@ { "files": { "main.css": "/static/css/main.8cfac526.chunk.css", - "main.js": "/static/js/main.7915d40b.chunk.js", - "main.js.map": "/static/js/main.7915d40b.chunk.js.map", + "main.js": "/static/js/main.e8f37b3e.chunk.js", + "main.js.map": "/static/js/main.e8f37b3e.chunk.js.map", "runtime-main.js": "/static/js/runtime-main.43a31377.js", "runtime-main.js.map": "/static/js/runtime-main.43a31377.js.map", - "static/css/2.60e04a19.chunk.css": "/static/css/2.60e04a19.chunk.css", - "static/js/2.06e58ba0.chunk.js": "/static/js/2.06e58ba0.chunk.js", - "static/js/2.06e58ba0.chunk.js.map": "/static/js/2.06e58ba0.chunk.js.map", + "static/css/2.8d89c2a5.chunk.css": "/static/css/2.8d89c2a5.chunk.css", + "static/js/2.df28ebd3.chunk.js": "/static/js/2.df28ebd3.chunk.js", + "static/js/2.df28ebd3.chunk.js.map": "/static/js/2.df28ebd3.chunk.js.map", "index.html": "/index.html", - "static/css/2.60e04a19.chunk.css.map": "/static/css/2.60e04a19.chunk.css.map", + "static/css/2.8d89c2a5.chunk.css.map": "/static/css/2.8d89c2a5.chunk.css.map", "static/css/main.8cfac526.chunk.css.map": "/static/css/main.8cfac526.chunk.css.map", - "static/js/2.06e58ba0.chunk.js.LICENSE.txt": "/static/js/2.06e58ba0.chunk.js.LICENSE.txt", + "static/js/2.df28ebd3.chunk.js.LICENSE.txt": "/static/js/2.df28ebd3.chunk.js.LICENSE.txt", "static/media/minio_console_logo.0837460e.svg": "/static/media/minio_console_logo.0837460e.svg", "static/media/minio_operator_logo.1312b7c9.svg": "/static/media/minio_operator_logo.1312b7c9.svg" }, "entrypoints": [ "static/js/runtime-main.43a31377.js", - "static/css/2.60e04a19.chunk.css", - "static/js/2.06e58ba0.chunk.js", + "static/css/2.8d89c2a5.chunk.css", + "static/js/2.df28ebd3.chunk.js", "static/css/main.8cfac526.chunk.css", - "static/js/main.7915d40b.chunk.js" + "static/js/main.e8f37b3e.chunk.js" ] } \ No newline at end of file diff --git a/portal-ui/build/index.html b/portal-ui/build/index.html index 8ba2f5d8e..e5a18f82f 100644 --- a/portal-ui/build/index.html +++ b/portal-ui/build/index.html @@ -1 +1 @@ -
1&&($=!0),M.subtract(a,e),P.subtract(a,e),{rawValue:n,wholeValue:a,decimalValue:r?l:0,isSmallest:r,isLargest:i,type:e,tokenLength:u.length}}));var Se=B?Math.floor:Math.round,Te=function(e,t){var n=Math.pow(10,t);return Se(e*n)/n},Oe=!1,_e=!1,xe=function(e,t){var n={useGrouping:A,groupingSeparator:ne,decimalSeparator:re,grouping:oe,useToLocaleString:te};return K&&(Y<=0?(e.rawValue=0,e.wholeValue=0,e.decimalValue=0):(n.maximumSignificantDigits=Y,e.significantDigits=Y)),ee&&!_e&&(e.isLargest?(e.wholeValue=Z,e.decimalValue=0):(e.wholeValue=0,e.decimalValue=0)),X&&!_e&&(e.isSmallest?(e.wholeValue=Q,e.decimalValue=0):(e.wholeValue=0,e.decimalValue=0)),e.isSmallest||e.significantDigits&&e.significantDigits-e.wholeValue.toString().length<=0?W<0?e.value=Te(e.wholeValue,W):0===W?e.value=Se(e.wholeValue+e.decimalValue):K?(e.value=B?Te(e.rawValue,Y-e.wholeValue.toString().length):e.rawValue,e.wholeValue&&(Y-=e.wholeValue.toString().length)):(n.fractionDigits=W,e.value=B?e.wholeValue+Te(e.decimalValue,W):e.wholeValue+e.decimalValue):K&&e.wholeValue?(e.value=Math.round(Te(e.wholeValue,e.significantDigits-e.wholeValue.toString().length)),Y-=e.wholeValue.toString().length):e.value=e.wholeValue,e.tokenLength>1&&($||Oe)&&(n.minimumIntegerDigits=e.tokenLength,_e&&n.maximumSignificantDigits0||\"\"===ie||h(G,e.type)||h(N,e.type))&&(Oe=!0),e.formattedValue=c(e.value,n,q),n.useGrouping=!1,n.decimalSeparator=\".\",e.formattedValueEn=c(e.value,n,\"en\"),2===e.tokenLength&&\"milliseconds\"===e.type&&(e.formattedValueMS=c(e.value,{minimumIntegerDigits:3,useGrouping:!1},\"en\").slice(0,2)),e};if((we=w(we=v(we,xe))).length>1){var Ve=function(e){return h(we,(function(t){return t.type===e}))},De=function(e){var t=Ve(e.type);t&&d(e.targets,(function(e){var n=Ve(e.type);n&&parseInt(t.formattedValueEn,10)===e.value&&(t.rawValue=0,t.wholeValue=0,t.decimalValue=0,n.rawValue+=1,n.wholeValue+=1,n.decimalValue=0,n.formattedValueEn=n.wholeValue.toString(),_e=!0)}))};d(a,De)}return _e&&(Oe=!1,Y=J,we=w(we=v(we,xe))),!N||ee&&!o.trim?(pe&&(we=O(we,(function(e){return!e.isSmallest&&!e.wholeValue&&!h(G,e.type)}))),R&&we.length&&(we=we.slice(0,R)),ge&&we.length>1&&(we=_(we,(function(e){return!e.wholeValue&&!h(G,e.type)&&!e.isLargest}))),ye&&(we=w(we=v(we,(function(e,t){return t>0&&t \",ee=!1,X=!1),j&&(t.value>0||\"\"===ie||h(G,t.type)||h(N,t.type))&&(n+=\"-\",j=!1),\"milliseconds\"===e.type&&t.formattedValueMS?n+=t.formattedValueMS:n+=t.formattedValue,z||(n+=e.text),n}))).join(\"\").replace(/(,| |:|\\.)*$/,\"\").replace(/^(,| |:|\\.)*/,\"\"))}function L(){var e=this.duration,t=function(t){return e._data[t]},n=h(this.types,t),r=function(e,t){for(var n=e.length;n-=1;)if(t(e[n]))return e[n]}(this.types,t);switch(n){case\"milliseconds\":return\"S __\";case\"seconds\":case\"minutes\":return\"*_MS_\";case\"hours\":return\"_HMS_\";case\"days\":if(n===r)return\"d __\";case\"weeks\":return n===r?\"w __\":(null===this.trim&&(this.trim=\"both\"),\"w __, d __, h __\");case\"months\":if(n===r)return\"M __\";case\"years\":return n===r?\"y __\":(null===this.trim&&(this.trim=\"both\"),\"y __, M __, d __\");default:return null===this.trim&&(this.trim=\"both\"),\"y __, d __, h __, m __, s __\"}}function F(e){if(!e)throw\"Moment Duration Format init cannot find moment instance.\";e.duration.format=k,e.duration.fn.format=E,e.duration.fn.format.defaults={trim:null,stopTrim:null,largest:null,maxValue:null,minValue:null,precision:0,trunc:!1,forceLength:null,userLocale:null,usePlural:!0,useLeftUnits:!1,useGrouping:!0,useSignificantDigits:!1,template:L,useToLocaleString:!0,groupingSeparator:\",\",decimalSeparator:\".\",grouping:[3]},e.updateLocale(\"en\",p)}var I=function(e,t,n){return e.toLocaleString(t,n)};t=function(){try{(0).toLocaleString(\"i\")}catch(e){return\"RangeError\"===e.name}return!1}()&&P(I),n=t&&M(I);var N=function(e,t,n){if(\"undefined\"!=typeof window&&window&&window.Intl&&window.Intl.NumberFormat)return window.Intl.NumberFormat(t,n).format(e)};return r=P(N),o=r&&M(N),F(e),F},o=[n(1)],void 0===(i=\"function\"==typeof(r=l)?r.apply(t,o):r)||(e.exports=i),a&&(a.momentDurationFormatSetup=a.moment?l(a.moment):l)},function(e,t,n){\"use strict\";n.r(t),n.d(t,\"default\",(function(){return _}));var r=n(2),o=n.n(r),i=n(0),a=n.n(i),l=n(1),u=n.n(l);n(5);function s(e){return(s=\"function\"==typeof Symbol&&\"symbol\"==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&\"function\"==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?\"symbol\":typeof e})(e)}function c(e,t){var n=Object.keys(e);if(Object.getOwnPropertySymbols){var r=Object.getOwnPropertySymbols(e);t&&(r=r.filter((function(t){return Object.getOwnPropertyDescriptor(e,t).enumerable}))),n.push.apply(n,r)}return n}function f(e,t){if(null==e)return{};var n,r,o=function(e,t){if(null==e)return{};var n,r,o={},i=Object.keys(e);for(r=0;r =0||(o[n]=e[n]);return o}(e,t);if(Object.getOwnPropertySymbols){var i=Object.getOwnPropertySymbols(e);for(r=0;r =0||Object.prototype.propertyIsEnumerable.call(e,n)&&(o[n]=e[n])}return o}function m(e,t){for(var n=0;n 0&&void 0!==arguments[0]?arguments[0]:6e4;n.clearPooledTimer(),n.pooledTimer=setInterval((function(){n.pooledElements.forEach((function(e){0!==e.props.interval&&e.update()}))}),e)}},{key:\"clearPooledTimer\",value:function(){n.pooledTimer&&(clearInterval(n.pooledTimer),n.pooledTimer=null,n.pooledElements=[])}},{key:\"pushPooledElement\",value:function(e){e instanceof n?-1===n.pooledElements.indexOf(e)&&n.pooledElements.push(e):console.error(\"Element not an instance of Moment.\")}},{key:\"removePooledElement\",value:function(e){var t=n.pooledElements.indexOf(e);-1!==t&&n.pooledElements.splice(t,1)}},{key:\"getDatetime\",value:function(e){var t=e.utc,r=e.unix,o=e.date,i=e.locale,a=e.parse,l=e.tz,u=e.local;o=o||e.children,a=a||n.globalParse,u=u||n.globalLocal,l=l||n.globalTimezone,i=n.globalLocale?n.globalLocale:i||n.globalMoment.locale();var s=null;return s=t?n.globalMoment.utc(o,a,i):r?n.globalMoment(1e3*o,a,i):n.globalMoment(o,a,i),l?s=s.tz(l):u&&(s=s.local()),s}},{key:\"getContent\",value:function(e){var t=e.fromNow,r=e.fromNowDuring,o=e.from,i=e.add,a=e.subtract,l=e.toNow,s=e.to,c=e.ago,f=e.calendar,m=e.diff,p=e.duration,g=e.durationFromNow,y=e.unit,h=e.decimal,d=e.trim,v=e.format;v=v||n.globalFormat;var b=n.getDatetime(e);i&&b.add(i),a&&b.subtract(a);var w=Boolean(r)&&-b.diff(u()()) true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\nfunction isObject(value) {\n var type = typeof value;\n return value != null && (type == 'object' || type == 'function');\n}\n\nmodule.exports = isObject;\n","import {ticks, tickIncrement} from \"d3-array\";\nimport continuous, {copy} from \"./continuous.js\";\nimport {initRange} from \"./init.js\";\nimport tickFormat from \"./tickFormat.js\";\n\nexport function linearish(scale) {\n var domain = scale.domain;\n\n scale.ticks = function(count) {\n var d = domain();\n return ticks(d[0], d[d.length - 1], count == null ? 10 : count);\n };\n\n scale.tickFormat = function(count, specifier) {\n var d = domain();\n return tickFormat(d[0], d[d.length - 1], count == null ? 10 : count, specifier);\n };\n\n scale.nice = function(count) {\n if (count == null) count = 10;\n\n var d = domain();\n var i0 = 0;\n var i1 = d.length - 1;\n var start = d[i0];\n var stop = d[i1];\n var prestep;\n var step;\n var maxIter = 10;\n\n if (stop < start) {\n step = start, start = stop, stop = step;\n step = i0, i0 = i1, i1 = step;\n }\n \n while (maxIter-- > 0) {\n step = tickIncrement(start, stop, count);\n if (step === prestep) {\n d[i0] = start\n d[i1] = stop\n return domain(d);\n } else if (step > 0) {\n start = Math.floor(start / step) * step;\n stop = Math.ceil(stop / step) * step;\n } else if (step < 0) {\n start = Math.ceil(start * step) / step;\n stop = Math.floor(stop * step) / step;\n } else {\n break;\n }\n prestep = step;\n }\n\n return scale;\n };\n\n return scale;\n}\n\nexport default function linear() {\n var scale = continuous();\n\n scale.copy = function() {\n return copy(scale, linear());\n };\n\n initRange.apply(scale, arguments);\n\n return linearish(scale);\n}\n","function _extends() {\n module.exports = _extends = Object.assign || function (target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i];\n\n for (var key in source) {\n if (Object.prototype.hasOwnProperty.call(source, key)) {\n target[key] = source[key];\n }\n }\n }\n\n return target;\n };\n\n module.exports[\"default\"] = module.exports, module.exports.__esModule = true;\n return _extends.apply(this, arguments);\n}\n\nmodule.exports = _extends;\nmodule.exports[\"default\"] = module.exports, module.exports.__esModule = true;","var baseGetTag = require('./_baseGetTag'),\n isArray = require('./isArray'),\n isObjectLike = require('./isObjectLike');\n\n/** `Object#toString` result references. */\nvar stringTag = '[object String]';\n\n/**\n * Checks if `value` is classified as a `String` primitive or object.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a string, else `false`.\n * @example\n *\n * _.isString('abc');\n * // => true\n *\n * _.isString(1);\n * // => false\n */\nfunction isString(value) {\n return typeof value == 'string' ||\n (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);\n}\n\nmodule.exports = isString;\n","/**\n * Safe chained function\n *\n * Will only create a new function if needed,\n * otherwise will pass back existing functions or null.\n *\n * @param {function} functions to chain\n * @returns {function|null}\n */\nexport default function createChainedFunction() {\n for (var _len = arguments.length, funcs = new Array(_len), _key = 0; _key < _len; _key++) {\n funcs[_key] = arguments[_key];\n }\n\n return funcs.reduce(function (acc, func) {\n if (func == null) {\n return acc;\n }\n\n if (process.env.NODE_ENV !== 'production') {\n if (typeof func !== 'function') {\n console.error('Material-UI: Invalid Argument Type, must only provide functions, undefined, or null.');\n }\n }\n\n return function chainedFunction() {\n for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\n args[_key2] = arguments[_key2];\n }\n\n acc.apply(this, args);\n func.apply(this, args);\n };\n }, function () {});\n}","import _isObject from \"lodash/isObject\";\nimport _isFunction from \"lodash/isFunction\";\nimport _isNil from \"lodash/isNil\";\n\nfunction _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nimport React, { cloneElement, isValidElement, createElement } from 'react';\nimport classNames from 'classnames';\nimport { Text } from './Text';\nimport { findAllByType } from '../util/ReactUtils';\nimport { isNumOrStr, isNumber, isPercent, getPercentValue, uniqueId, mathSign } from '../util/DataUtils';\nimport { polarToCartesian } from '../util/PolarUtils';\nimport { filterProps } from '../util/types';\n\nvar getLabel = function getLabel(props) {\n var value = props.value,\n formatter = props.formatter;\n var label = _isNil(props.children) ? value : props.children;\n\n if (_isFunction(formatter)) {\n return formatter(label);\n }\n\n return label;\n};\n\nvar getDeltaAngle = function getDeltaAngle(startAngle, endAngle) {\n var sign = mathSign(endAngle - startAngle);\n var deltaAngle = Math.min(Math.abs(endAngle - startAngle), 360);\n return sign * deltaAngle;\n};\n\nvar renderRadialLabel = function renderRadialLabel(labelProps, label, attrs) {\n var position = labelProps.position,\n viewBox = labelProps.viewBox,\n offset = labelProps.offset,\n className = labelProps.className;\n var _ref = viewBox,\n cx = _ref.cx,\n cy = _ref.cy,\n innerRadius = _ref.innerRadius,\n outerRadius = _ref.outerRadius,\n startAngle = _ref.startAngle,\n endAngle = _ref.endAngle,\n clockWise = _ref.clockWise;\n var radius = (innerRadius + outerRadius) / 2;\n var deltaAngle = getDeltaAngle(startAngle, endAngle);\n var sign = deltaAngle >= 0 ? 1 : -1;\n var labelAngle, direction;\n\n if (position === 'insideStart') {\n labelAngle = startAngle + sign * offset;\n direction = clockWise;\n } else if (position === 'insideEnd') {\n labelAngle = endAngle - sign * offset;\n direction = !clockWise;\n } else if (position === 'end') {\n labelAngle = endAngle + sign * offset;\n direction = clockWise;\n }\n\n direction = deltaAngle <= 0 ? direction : !direction;\n var startPoint = polarToCartesian(cx, cy, radius, labelAngle);\n var endPoint = polarToCartesian(cx, cy, radius, labelAngle + (direction ? 1 : -1) * 359);\n var path = \"M\".concat(startPoint.x, \",\").concat(startPoint.y, \"\\n A\").concat(radius, \",\").concat(radius, \",0,1,\").concat(direction ? 0 : 1, \",\\n \").concat(endPoint.x, \",\").concat(endPoint.y);\n var id = _isNil(labelProps.id) ? uniqueId('recharts-radial-line-') : labelProps.id;\n return /*#__PURE__*/React.createElement(\"text\", _extends({}, attrs, {\n dominantBaseline: \"central\",\n className: classNames('recharts-radial-bar-label', className)\n }), /*#__PURE__*/React.createElement(\"defs\", null, /*#__PURE__*/React.createElement(\"path\", {\n id: id,\n d: path\n })), /*#__PURE__*/React.createElement(\"textPath\", {\n xlinkHref: \"#\".concat(id)\n }, label));\n};\n\nvar getAttrsOfPolarLabel = function getAttrsOfPolarLabel(props) {\n var viewBox = props.viewBox,\n offset = props.offset,\n position = props.position;\n var _ref2 = viewBox,\n cx = _ref2.cx,\n cy = _ref2.cy,\n innerRadius = _ref2.innerRadius,\n outerRadius = _ref2.outerRadius,\n startAngle = _ref2.startAngle,\n endAngle = _ref2.endAngle;\n var midAngle = (startAngle + endAngle) / 2;\n\n if (position === 'outside') {\n var _polarToCartesian = polarToCartesian(cx, cy, outerRadius + offset, midAngle),\n _x = _polarToCartesian.x,\n _y = _polarToCartesian.y;\n\n return {\n x: _x,\n y: _y,\n textAnchor: _x >= cx ? 'start' : 'end',\n verticalAnchor: 'middle'\n };\n }\n\n if (position === 'center') {\n return {\n x: cx,\n y: cy,\n textAnchor: 'middle',\n verticalAnchor: 'middle'\n };\n }\n\n if (position === 'centerTop') {\n return {\n x: cx,\n y: cy,\n textAnchor: 'middle',\n verticalAnchor: 'start'\n };\n }\n\n if (position === 'centerBottom') {\n return {\n x: cx,\n y: cy,\n textAnchor: 'middle',\n verticalAnchor: 'end'\n };\n }\n\n var r = (innerRadius + outerRadius) / 2;\n\n var _polarToCartesian2 = polarToCartesian(cx, cy, r, midAngle),\n x = _polarToCartesian2.x,\n y = _polarToCartesian2.y;\n\n return {\n x: x,\n y: y,\n textAnchor: 'middle',\n verticalAnchor: 'middle'\n };\n};\n\nvar getAttrsOfCartesianLabel = function getAttrsOfCartesianLabel(props) {\n var viewBox = props.viewBox,\n parentViewBox = props.parentViewBox,\n offset = props.offset,\n position = props.position;\n var _ref3 = viewBox,\n x = _ref3.x,\n y = _ref3.y,\n width = _ref3.width,\n height = _ref3.height; // Define vertical offsets and position inverts based on the value being positive or negative\n\n var verticalSign = height >= 0 ? 1 : -1;\n var verticalOffset = verticalSign * offset;\n var verticalEnd = verticalSign > 0 ? 'end' : 'start';\n var verticalStart = verticalSign > 0 ? 'start' : 'end'; // Define horizontal offsets and position inverts based on the value being positive or negative\n\n var horizontalSign = width >= 0 ? 1 : -1;\n var horizontalOffset = horizontalSign * offset;\n var horizontalEnd = horizontalSign > 0 ? 'end' : 'start';\n var horizontalStart = horizontalSign > 0 ? 'start' : 'end';\n\n if (position === 'top') {\n var attrs = {\n x: x + width / 2,\n y: y - verticalSign * offset,\n textAnchor: 'middle',\n verticalAnchor: verticalEnd\n };\n return _objectSpread(_objectSpread({}, attrs), parentViewBox ? {\n height: Math.max(y - parentViewBox.y, 0),\n width: width\n } : {});\n }\n\n if (position === 'bottom') {\n var _attrs = {\n x: x + width / 2,\n y: y + height + verticalOffset,\n textAnchor: 'middle',\n verticalAnchor: verticalStart\n };\n return _objectSpread(_objectSpread({}, _attrs), parentViewBox ? {\n height: Math.max(parentViewBox.y + parentViewBox.height - (y + height), 0),\n width: width\n } : {});\n }\n\n if (position === 'left') {\n var _attrs2 = {\n x: x - horizontalOffset,\n y: y + height / 2,\n textAnchor: horizontalEnd,\n verticalAnchor: 'middle'\n };\n return _objectSpread(_objectSpread({}, _attrs2), parentViewBox ? {\n width: Math.max(_attrs2.x - parentViewBox.x, 0),\n height: height\n } : {});\n }\n\n if (position === 'right') {\n var _attrs3 = {\n x: x + width + horizontalOffset,\n y: y + height / 2,\n textAnchor: horizontalStart,\n verticalAnchor: 'middle'\n };\n return _objectSpread(_objectSpread({}, _attrs3), parentViewBox ? {\n width: Math.max(parentViewBox.x + parentViewBox.width - _attrs3.x, 0),\n height: height\n } : {});\n }\n\n var sizeAttrs = parentViewBox ? {\n width: width,\n height: height\n } : {};\n\n if (position === 'insideLeft') {\n return _objectSpread({\n x: x + horizontalOffset,\n y: y + height / 2,\n textAnchor: horizontalStart,\n verticalAnchor: 'middle'\n }, sizeAttrs);\n }\n\n if (position === 'insideRight') {\n return _objectSpread({\n x: x + width - horizontalOffset,\n y: y + height / 2,\n textAnchor: horizontalEnd,\n verticalAnchor: 'middle'\n }, sizeAttrs);\n }\n\n if (position === 'insideTop') {\n return _objectSpread({\n x: x + width / 2,\n y: y + verticalOffset,\n textAnchor: 'middle',\n verticalAnchor: verticalStart\n }, sizeAttrs);\n }\n\n if (position === 'insideBottom') {\n return _objectSpread({\n x: x + width / 2,\n y: y + height - verticalOffset,\n textAnchor: 'middle',\n verticalAnchor: verticalEnd\n }, sizeAttrs);\n }\n\n if (position === 'insideTopLeft') {\n return _objectSpread({\n x: x + horizontalOffset,\n y: y + verticalOffset,\n textAnchor: horizontalStart,\n verticalAnchor: verticalStart\n }, sizeAttrs);\n }\n\n if (position === 'insideTopRight') {\n return _objectSpread({\n x: x + width - horizontalOffset,\n y: y + verticalOffset,\n textAnchor: horizontalEnd,\n verticalAnchor: verticalStart\n }, sizeAttrs);\n }\n\n if (position === 'insideBottomLeft') {\n return _objectSpread({\n x: x + horizontalOffset,\n y: y + height - verticalOffset,\n textAnchor: horizontalStart,\n verticalAnchor: verticalEnd\n }, sizeAttrs);\n }\n\n if (position === 'insideBottomRight') {\n return _objectSpread({\n x: x + width - horizontalOffset,\n y: y + height - verticalOffset,\n textAnchor: horizontalEnd,\n verticalAnchor: verticalEnd\n }, sizeAttrs);\n }\n\n if (_isObject(position) && (isNumber(position.x) || isPercent(position.x)) && (isNumber(position.y) || isPercent(position.y))) {\n return _objectSpread({\n x: x + getPercentValue(position.x, width),\n y: y + getPercentValue(position.y, height),\n textAnchor: 'end',\n verticalAnchor: 'end'\n }, sizeAttrs);\n }\n\n return _objectSpread({\n x: x + width / 2,\n y: y + height / 2,\n textAnchor: 'middle',\n verticalAnchor: 'middle'\n }, sizeAttrs);\n};\n\nvar isPolar = function isPolar(viewBox) {\n return isNumber(viewBox.cx);\n};\n\nexport function Label(props) {\n var viewBox = props.viewBox,\n position = props.position,\n value = props.value,\n children = props.children,\n content = props.content,\n _props$className = props.className,\n className = _props$className === void 0 ? '' : _props$className,\n textBreakAll = props.textBreakAll;\n\n if (!viewBox || _isNil(value) && _isNil(children) && ! /*#__PURE__*/isValidElement(content) && !_isFunction(content)) {\n return null;\n }\n\n if ( /*#__PURE__*/isValidElement(content)) {\n return /*#__PURE__*/cloneElement(content, props);\n }\n\n var label;\n\n if (_isFunction(content)) {\n label = /*#__PURE__*/createElement(content, props);\n\n if ( /*#__PURE__*/isValidElement(label)) {\n return label;\n }\n } else {\n label = getLabel(props);\n }\n\n var isPolarLabel = isPolar(viewBox);\n var attrs = filterProps(props, true);\n\n if (isPolarLabel && (position === 'insideStart' || position === 'insideEnd' || position === 'end')) {\n return renderRadialLabel(props, label, attrs);\n }\n\n var positionAttrs = isPolarLabel ? getAttrsOfPolarLabel(props) : getAttrsOfCartesianLabel(props);\n return /*#__PURE__*/React.createElement(Text, _extends({\n className: classNames('recharts-label', className)\n }, attrs, positionAttrs, {\n breakAll: textBreakAll\n }), label);\n}\nLabel.displayName = 'Label';\nLabel.defaultProps = {\n offset: 5\n};\n\nvar parseViewBox = function parseViewBox(props) {\n var cx = props.cx,\n cy = props.cy,\n angle = props.angle,\n startAngle = props.startAngle,\n endAngle = props.endAngle,\n r = props.r,\n radius = props.radius,\n innerRadius = props.innerRadius,\n outerRadius = props.outerRadius,\n x = props.x,\n y = props.y,\n top = props.top,\n left = props.left,\n width = props.width,\n height = props.height,\n clockWise = props.clockWise,\n labelViewBox = props.labelViewBox;\n\n if (labelViewBox) {\n return labelViewBox;\n }\n\n if (isNumber(width) && isNumber(height)) {\n if (isNumber(x) && isNumber(y)) {\n return {\n x: x,\n y: y,\n width: width,\n height: height\n };\n }\n\n if (isNumber(top) && isNumber(left)) {\n return {\n x: top,\n y: left,\n width: width,\n height: height\n };\n }\n }\n\n if (isNumber(x) && isNumber(y)) {\n return {\n x: x,\n y: y,\n width: 0,\n height: 0\n };\n }\n\n if (isNumber(cx) && isNumber(cy)) {\n return {\n cx: cx,\n cy: cy,\n startAngle: startAngle || angle || 0,\n endAngle: endAngle || angle || 0,\n innerRadius: innerRadius || 0,\n outerRadius: outerRadius || radius || r || 0,\n clockWise: clockWise\n };\n }\n\n if (props.viewBox) {\n return props.viewBox;\n }\n\n return {};\n};\n\nvar parseLabel = function parseLabel(label, viewBox) {\n if (!label) {\n return null;\n }\n\n if (label === true) {\n return /*#__PURE__*/React.createElement(Label, {\n key: \"label-implicit\",\n viewBox: viewBox\n });\n }\n\n if (isNumOrStr(label)) {\n return /*#__PURE__*/React.createElement(Label, {\n key: \"label-implicit\",\n viewBox: viewBox,\n value: label\n });\n }\n\n if ( /*#__PURE__*/isValidElement(label)) {\n if (label.type === Label) {\n return /*#__PURE__*/cloneElement(label, {\n key: 'label-implicit',\n viewBox: viewBox\n });\n }\n\n return /*#__PURE__*/React.createElement(Label, {\n key: \"label-implicit\",\n content: label,\n viewBox: viewBox\n });\n }\n\n if (_isFunction(label)) {\n return /*#__PURE__*/React.createElement(Label, {\n key: \"label-implicit\",\n content: label,\n viewBox: viewBox\n });\n }\n\n if (_isObject(label)) {\n return /*#__PURE__*/React.createElement(Label, _extends({\n viewBox: viewBox\n }, label, {\n key: \"label-implicit\"\n }));\n }\n\n return null;\n};\n\nvar renderCallByParent = function renderCallByParent(parentProps, viewBox) {\n var checkPropsLabel = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;\n\n if (!parentProps || !parentProps.children && checkPropsLabel && !parentProps.label) {\n return null;\n }\n\n var children = parentProps.children;\n var parentViewBox = parseViewBox(parentProps);\n var explicitChildren = findAllByType(children, Label.displayName).map(function (child, index) {\n return /*#__PURE__*/cloneElement(child, {\n viewBox: viewBox || parentViewBox,\n key: \"label-\".concat(index)\n });\n });\n\n if (!checkPropsLabel) {\n return explicitChildren;\n }\n\n var implicitLabel = parseLabel(parentProps.label, viewBox || parentViewBox);\n return [implicitLabel].concat(_toConsumableArray(explicitChildren));\n};\n\nLabel.parseViewBox = parseViewBox;\nLabel.renderCallByParent = renderCallByParent;","export var reflow = function reflow(node) {\n return node.scrollTop;\n};\nexport function getTransitionProps(props, options) {\n var timeout = props.timeout,\n _props$style = props.style,\n style = _props$style === void 0 ? {} : _props$style;\n return {\n duration: style.transitionDuration || typeof timeout === 'number' ? timeout : timeout[options.mode] || 0,\n delay: style.transitionDelay\n };\n}","import EventEmitter from 'eventemitter3';\nvar eventCenter = new EventEmitter();\n\nif (eventCenter.setMaxListeners) {\n eventCenter.setMaxListeners(10);\n}\n\nexport { eventCenter };\nexport var SYNC_EVENT = 'recharts.syncMouseEvents'; // eslint-disable-next-line no-redeclare","// TODO v5: consider to make it private\nexport default function setRef(ref, value) {\n if (typeof ref === 'function') {\n ref(value);\n } else if (ref) {\n ref.current = value;\n }\n}","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\");\n\nvar _interopRequireWildcard = require(\"@babel/runtime/helpers/interopRequireWildcard\");\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\n\nvar React = _interopRequireWildcard(require(\"react\"));\n\nvar _createSvgIcon = _interopRequireDefault(require(\"./utils/createSvgIcon\"));\n\nvar _default = (0, _createSvgIcon.default)( /*#__PURE__*/React.createElement(\"path\", {\n d: \"M17.65 6.35C16.2 4.9 14.21 4 12 4c-4.42 0-7.99 3.58-7.99 8s3.57 8 7.99 8c3.73 0 6.84-2.55 7.73-6h-2.08c-.82 2.33-3.04 4-5.65 4-3.31 0-6-2.69-6-6s2.69-6 6-6c1.66 0 3.14.69 4.22 1.78L13 11h7V4l-2.35 2.35z\"\n}), 'Refresh');\n\nexports.default = _default;","var parseIsSsrByDefault = function parseIsSsrByDefault() {\n return !(typeof window !== 'undefined' && window.document && window.document.createElement && window.setTimeout);\n};\n\nexport var Global = {\n isSsr: parseIsSsrByDefault(),\n get: function get(key) {\n return Global[key];\n },\n set: function set(key, value) {\n if (typeof key === 'string') {\n Global[key] = value;\n } else {\n var keys = Object.keys(key);\n\n if (keys && keys.length) {\n keys.forEach(function (k) {\n Global[k] = key[k];\n });\n }\n }\n }\n};","function isAbsolute(pathname) {\n return pathname.charAt(0) === '/';\n}\n\n// About 1.5x faster than the two-arg version of Array#splice()\nfunction spliceOne(list, index) {\n for (var i = index, k = i + 1, n = list.length; k < n; i += 1, k += 1) {\n list[i] = list[k];\n }\n\n list.pop();\n}\n\n// This implementation is based heavily on node's url.parse\nfunction resolvePathname(to, from) {\n if (from === undefined) from = '';\n\n var toParts = (to && to.split('/')) || [];\n var fromParts = (from && from.split('/')) || [];\n\n var isToAbs = to && isAbsolute(to);\n var isFromAbs = from && isAbsolute(from);\n var mustEndAbs = isToAbs || isFromAbs;\n\n if (to && isAbsolute(to)) {\n // to is absolute\n fromParts = toParts;\n } else if (toParts.length) {\n // to is relative, drop the filename\n fromParts.pop();\n fromParts = fromParts.concat(toParts);\n }\n\n if (!fromParts.length) return '/';\n\n var hasTrailingSlash;\n if (fromParts.length) {\n var last = fromParts[fromParts.length - 1];\n hasTrailingSlash = last === '.' || last === '..' || last === '';\n } else {\n hasTrailingSlash = false;\n }\n\n var up = 0;\n for (var i = fromParts.length; i >= 0; i--) {\n var part = fromParts[i];\n\n if (part === '.') {\n spliceOne(fromParts, i);\n } else if (part === '..') {\n spliceOne(fromParts, i);\n up++;\n } else if (up) {\n spliceOne(fromParts, i);\n up--;\n }\n }\n\n if (!mustEndAbs) for (; up--; up) fromParts.unshift('..');\n\n if (\n mustEndAbs &&\n fromParts[0] !== '' &&\n (!fromParts[0] || !isAbsolute(fromParts[0]))\n )\n fromParts.unshift('');\n\n var result = fromParts.join('/');\n\n if (hasTrailingSlash && result.substr(-1) !== '/') result += '/';\n\n return result;\n}\n\nexport default resolvePathname;\n","function valueOf(obj) {\n return obj.valueOf ? obj.valueOf() : Object.prototype.valueOf.call(obj);\n}\n\nfunction valueEqual(a, b) {\n // Test for strict equality first.\n if (a === b) return true;\n\n // Otherwise, if either of them == null they are not equal.\n if (a == null || b == null) return false;\n\n if (Array.isArray(a)) {\n return (\n Array.isArray(b) &&\n a.length === b.length &&\n a.every(function(item, index) {\n return valueEqual(item, b[index]);\n })\n );\n }\n\n if (typeof a === 'object' || typeof b === 'object') {\n var aValue = valueOf(a);\n var bValue = valueOf(b);\n\n if (aValue !== a || bValue !== b) return valueEqual(aValue, bValue);\n\n return Object.keys(Object.assign({}, a, b)).every(function(key) {\n return valueEqual(a[key], b[key]);\n });\n }\n\n return false;\n}\n\nexport default valueEqual;\n","import _extends from '@babel/runtime/helpers/esm/extends';\nimport resolvePathname from 'resolve-pathname';\nimport valueEqual from 'value-equal';\nimport warning from 'tiny-warning';\nimport invariant from 'tiny-invariant';\n\nfunction addLeadingSlash(path) {\n return path.charAt(0) === '/' ? path : '/' + path;\n}\nfunction stripLeadingSlash(path) {\n return path.charAt(0) === '/' ? path.substr(1) : path;\n}\nfunction hasBasename(path, prefix) {\n return path.toLowerCase().indexOf(prefix.toLowerCase()) === 0 && '/?#'.indexOf(path.charAt(prefix.length)) !== -1;\n}\nfunction stripBasename(path, prefix) {\n return hasBasename(path, prefix) ? path.substr(prefix.length) : path;\n}\nfunction stripTrailingSlash(path) {\n return path.charAt(path.length - 1) === '/' ? path.slice(0, -1) : path;\n}\nfunction parsePath(path) {\n var pathname = path || '/';\n var search = '';\n var hash = '';\n var hashIndex = pathname.indexOf('#');\n\n if (hashIndex !== -1) {\n hash = pathname.substr(hashIndex);\n pathname = pathname.substr(0, hashIndex);\n }\n\n var searchIndex = pathname.indexOf('?');\n\n if (searchIndex !== -1) {\n search = pathname.substr(searchIndex);\n pathname = pathname.substr(0, searchIndex);\n }\n\n return {\n pathname: pathname,\n search: search === '?' ? '' : search,\n hash: hash === '#' ? '' : hash\n };\n}\nfunction createPath(location) {\n var pathname = location.pathname,\n search = location.search,\n hash = location.hash;\n var path = pathname || '/';\n if (search && search !== '?') path += search.charAt(0) === '?' ? search : \"?\" + search;\n if (hash && hash !== '#') path += hash.charAt(0) === '#' ? hash : \"#\" + hash;\n return path;\n}\n\nfunction createLocation(path, state, key, currentLocation) {\n var location;\n\n if (typeof path === 'string') {\n // Two-arg form: push(path, state)\n location = parsePath(path);\n location.state = state;\n } else {\n // One-arg form: push(location)\n location = _extends({}, path);\n if (location.pathname === undefined) location.pathname = '';\n\n if (location.search) {\n if (location.search.charAt(0) !== '?') location.search = '?' + location.search;\n } else {\n location.search = '';\n }\n\n if (location.hash) {\n if (location.hash.charAt(0) !== '#') location.hash = '#' + location.hash;\n } else {\n location.hash = '';\n }\n\n if (state !== undefined && location.state === undefined) location.state = state;\n }\n\n try {\n location.pathname = decodeURI(location.pathname);\n } catch (e) {\n if (e instanceof URIError) {\n throw new URIError('Pathname \"' + location.pathname + '\" could not be decoded. ' + 'This is likely caused by an invalid percent-encoding.');\n } else {\n throw e;\n }\n }\n\n if (key) location.key = key;\n\n if (currentLocation) {\n // Resolve incomplete/relative pathname relative to current location.\n if (!location.pathname) {\n location.pathname = currentLocation.pathname;\n } else if (location.pathname.charAt(0) !== '/') {\n location.pathname = resolvePathname(location.pathname, currentLocation.pathname);\n }\n } else {\n // When there is no prior location and pathname is empty, set it to /\n if (!location.pathname) {\n location.pathname = '/';\n }\n }\n\n return location;\n}\nfunction locationsAreEqual(a, b) {\n return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash && a.key === b.key && valueEqual(a.state, b.state);\n}\n\nfunction createTransitionManager() {\n var prompt = null;\n\n function setPrompt(nextPrompt) {\n process.env.NODE_ENV !== \"production\" ? warning(prompt == null, 'A history supports only one prompt at a time') : void 0;\n prompt = nextPrompt;\n return function () {\n if (prompt === nextPrompt) prompt = null;\n };\n }\n\n function confirmTransitionTo(location, action, getUserConfirmation, callback) {\n // TODO: If another transition starts while we're still confirming\n // the previous one, we may end up in a weird state. Figure out the\n // best way to handle this.\n if (prompt != null) {\n var result = typeof prompt === 'function' ? prompt(location, action) : prompt;\n\n if (typeof result === 'string') {\n if (typeof getUserConfirmation === 'function') {\n getUserConfirmation(result, callback);\n } else {\n process.env.NODE_ENV !== \"production\" ? warning(false, 'A history needs a getUserConfirmation function in order to use a prompt message') : void 0;\n callback(true);\n }\n } else {\n // Return false from a transition hook to cancel the transition.\n callback(result !== false);\n }\n } else {\n callback(true);\n }\n }\n\n var listeners = [];\n\n function appendListener(fn) {\n var isActive = true;\n\n function listener() {\n if (isActive) fn.apply(void 0, arguments);\n }\n\n listeners.push(listener);\n return function () {\n isActive = false;\n listeners = listeners.filter(function (item) {\n return item !== listener;\n });\n };\n }\n\n function notifyListeners() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n listeners.forEach(function (listener) {\n return listener.apply(void 0, args);\n });\n }\n\n return {\n setPrompt: setPrompt,\n confirmTransitionTo: confirmTransitionTo,\n appendListener: appendListener,\n notifyListeners: notifyListeners\n };\n}\n\nvar canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement);\nfunction getConfirmation(message, callback) {\n callback(window.confirm(message)); // eslint-disable-line no-alert\n}\n/**\n * Returns true if the HTML5 history API is supported. Taken from Modernizr.\n *\n * https://github.com/Modernizr/Modernizr/blob/master/LICENSE\n * https://github.com/Modernizr/Modernizr/blob/master/feature-detects/history.js\n * changed to avoid false negatives for Windows Phones: https://github.com/reactjs/react-router/issues/586\n */\n\nfunction supportsHistory() {\n var ua = window.navigator.userAgent;\n if ((ua.indexOf('Android 2.') !== -1 || ua.indexOf('Android 4.0') !== -1) && ua.indexOf('Mobile Safari') !== -1 && ua.indexOf('Chrome') === -1 && ua.indexOf('Windows Phone') === -1) return false;\n return window.history && 'pushState' in window.history;\n}\n/**\n * Returns true if browser fires popstate on hash change.\n * IE10 and IE11 do not.\n */\n\nfunction supportsPopStateOnHashChange() {\n return window.navigator.userAgent.indexOf('Trident') === -1;\n}\n/**\n * Returns false if using go(n) with hash history causes a full page reload.\n */\n\nfunction supportsGoWithoutReloadUsingHash() {\n return window.navigator.userAgent.indexOf('Firefox') === -1;\n}\n/**\n * Returns true if a given popstate event is an extraneous WebKit event.\n * Accounts for the fact that Chrome on iOS fires real popstate events\n * containing undefined state when pressing the back button.\n */\n\nfunction isExtraneousPopstateEvent(event) {\n return event.state === undefined && navigator.userAgent.indexOf('CriOS') === -1;\n}\n\nvar PopStateEvent = 'popstate';\nvar HashChangeEvent = 'hashchange';\n\nfunction getHistoryState() {\n try {\n return window.history.state || {};\n } catch (e) {\n // IE 11 sometimes throws when accessing window.history.state\n // See https://github.com/ReactTraining/history/pull/289\n return {};\n }\n}\n/**\n * Creates a history object that uses the HTML5 history API including\n * pushState, replaceState, and the popstate event.\n */\n\n\nfunction createBrowserHistory(props) {\n if (props === void 0) {\n props = {};\n }\n\n !canUseDOM ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Browser history needs a DOM') : invariant(false) : void 0;\n var globalHistory = window.history;\n var canUseHistory = supportsHistory();\n var needsHashChangeListener = !supportsPopStateOnHashChange();\n var _props = props,\n _props$forceRefresh = _props.forceRefresh,\n forceRefresh = _props$forceRefresh === void 0 ? false : _props$forceRefresh,\n _props$getUserConfirm = _props.getUserConfirmation,\n getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm,\n _props$keyLength = _props.keyLength,\n keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength;\n var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : '';\n\n function getDOMLocation(historyState) {\n var _ref = historyState || {},\n key = _ref.key,\n state = _ref.state;\n\n var _window$location = window.location,\n pathname = _window$location.pathname,\n search = _window$location.search,\n hash = _window$location.hash;\n var path = pathname + search + hash;\n process.env.NODE_ENV !== \"production\" ? warning(!basename || hasBasename(path, basename), 'You are attempting to use a basename on a page whose URL path does not begin ' + 'with the basename. Expected path \"' + path + '\" to begin with \"' + basename + '\".') : void 0;\n if (basename) path = stripBasename(path, basename);\n return createLocation(path, state, key);\n }\n\n function createKey() {\n return Math.random().toString(36).substr(2, keyLength);\n }\n\n var transitionManager = createTransitionManager();\n\n function setState(nextState) {\n _extends(history, nextState);\n\n history.length = globalHistory.length;\n transitionManager.notifyListeners(history.location, history.action);\n }\n\n function handlePopState(event) {\n // Ignore extraneous popstate events in WebKit.\n if (isExtraneousPopstateEvent(event)) return;\n handlePop(getDOMLocation(event.state));\n }\n\n function handleHashChange() {\n handlePop(getDOMLocation(getHistoryState()));\n }\n\n var forceNextPop = false;\n\n function handlePop(location) {\n if (forceNextPop) {\n forceNextPop = false;\n setState();\n } else {\n var action = 'POP';\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (ok) {\n setState({\n action: action,\n location: location\n });\n } else {\n revertPop(location);\n }\n });\n }\n }\n\n function revertPop(fromLocation) {\n var toLocation = history.location; // TODO: We could probably make this more reliable by\n // keeping a list of keys we've seen in sessionStorage.\n // Instead, we just default to 0 for keys we don't know.\n\n var toIndex = allKeys.indexOf(toLocation.key);\n if (toIndex === -1) toIndex = 0;\n var fromIndex = allKeys.indexOf(fromLocation.key);\n if (fromIndex === -1) fromIndex = 0;\n var delta = toIndex - fromIndex;\n\n if (delta) {\n forceNextPop = true;\n go(delta);\n }\n }\n\n var initialLocation = getDOMLocation(getHistoryState());\n var allKeys = [initialLocation.key]; // Public interface\n\n function createHref(location) {\n return basename + createPath(location);\n }\n\n function push(path, state) {\n process.env.NODE_ENV !== \"production\" ? warning(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to push when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;\n var action = 'PUSH';\n var location = createLocation(path, state, createKey(), history.location);\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (!ok) return;\n var href = createHref(location);\n var key = location.key,\n state = location.state;\n\n if (canUseHistory) {\n globalHistory.pushState({\n key: key,\n state: state\n }, null, href);\n\n if (forceRefresh) {\n window.location.href = href;\n } else {\n var prevIndex = allKeys.indexOf(history.location.key);\n var nextKeys = allKeys.slice(0, prevIndex + 1);\n nextKeys.push(location.key);\n allKeys = nextKeys;\n setState({\n action: action,\n location: location\n });\n }\n } else {\n process.env.NODE_ENV !== \"production\" ? warning(state === undefined, 'Browser history cannot push state in browsers that do not support HTML5 history') : void 0;\n window.location.href = href;\n }\n });\n }\n\n function replace(path, state) {\n process.env.NODE_ENV !== \"production\" ? warning(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to replace when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;\n var action = 'REPLACE';\n var location = createLocation(path, state, createKey(), history.location);\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (!ok) return;\n var href = createHref(location);\n var key = location.key,\n state = location.state;\n\n if (canUseHistory) {\n globalHistory.replaceState({\n key: key,\n state: state\n }, null, href);\n\n if (forceRefresh) {\n window.location.replace(href);\n } else {\n var prevIndex = allKeys.indexOf(history.location.key);\n if (prevIndex !== -1) allKeys[prevIndex] = location.key;\n setState({\n action: action,\n location: location\n });\n }\n } else {\n process.env.NODE_ENV !== \"production\" ? warning(state === undefined, 'Browser history cannot replace state in browsers that do not support HTML5 history') : void 0;\n window.location.replace(href);\n }\n });\n }\n\n function go(n) {\n globalHistory.go(n);\n }\n\n function goBack() {\n go(-1);\n }\n\n function goForward() {\n go(1);\n }\n\n var listenerCount = 0;\n\n function checkDOMListeners(delta) {\n listenerCount += delta;\n\n if (listenerCount === 1 && delta === 1) {\n window.addEventListener(PopStateEvent, handlePopState);\n if (needsHashChangeListener) window.addEventListener(HashChangeEvent, handleHashChange);\n } else if (listenerCount === 0) {\n window.removeEventListener(PopStateEvent, handlePopState);\n if (needsHashChangeListener) window.removeEventListener(HashChangeEvent, handleHashChange);\n }\n }\n\n var isBlocked = false;\n\n function block(prompt) {\n if (prompt === void 0) {\n prompt = false;\n }\n\n var unblock = transitionManager.setPrompt(prompt);\n\n if (!isBlocked) {\n checkDOMListeners(1);\n isBlocked = true;\n }\n\n return function () {\n if (isBlocked) {\n isBlocked = false;\n checkDOMListeners(-1);\n }\n\n return unblock();\n };\n }\n\n function listen(listener) {\n var unlisten = transitionManager.appendListener(listener);\n checkDOMListeners(1);\n return function () {\n checkDOMListeners(-1);\n unlisten();\n };\n }\n\n var history = {\n length: globalHistory.length,\n action: 'POP',\n location: initialLocation,\n createHref: createHref,\n push: push,\n replace: replace,\n go: go,\n goBack: goBack,\n goForward: goForward,\n block: block,\n listen: listen\n };\n return history;\n}\n\nvar HashChangeEvent$1 = 'hashchange';\nvar HashPathCoders = {\n hashbang: {\n encodePath: function encodePath(path) {\n return path.charAt(0) === '!' ? path : '!/' + stripLeadingSlash(path);\n },\n decodePath: function decodePath(path) {\n return path.charAt(0) === '!' ? path.substr(1) : path;\n }\n },\n noslash: {\n encodePath: stripLeadingSlash,\n decodePath: addLeadingSlash\n },\n slash: {\n encodePath: addLeadingSlash,\n decodePath: addLeadingSlash\n }\n};\n\nfunction stripHash(url) {\n var hashIndex = url.indexOf('#');\n return hashIndex === -1 ? url : url.slice(0, hashIndex);\n}\n\nfunction getHashPath() {\n // We can't use window.location.hash here because it's not\n // consistent across browsers - Firefox will pre-decode it!\n var href = window.location.href;\n var hashIndex = href.indexOf('#');\n return hashIndex === -1 ? '' : href.substring(hashIndex + 1);\n}\n\nfunction pushHashPath(path) {\n window.location.hash = path;\n}\n\nfunction replaceHashPath(path) {\n window.location.replace(stripHash(window.location.href) + '#' + path);\n}\n\nfunction createHashHistory(props) {\n if (props === void 0) {\n props = {};\n }\n\n !canUseDOM ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Hash history needs a DOM') : invariant(false) : void 0;\n var globalHistory = window.history;\n var canGoWithoutReload = supportsGoWithoutReloadUsingHash();\n var _props = props,\n _props$getUserConfirm = _props.getUserConfirmation,\n getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm,\n _props$hashType = _props.hashType,\n hashType = _props$hashType === void 0 ? 'slash' : _props$hashType;\n var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : '';\n var _HashPathCoders$hashT = HashPathCoders[hashType],\n encodePath = _HashPathCoders$hashT.encodePath,\n decodePath = _HashPathCoders$hashT.decodePath;\n\n function getDOMLocation() {\n var path = decodePath(getHashPath());\n process.env.NODE_ENV !== \"production\" ? warning(!basename || hasBasename(path, basename), 'You are attempting to use a basename on a page whose URL path does not begin ' + 'with the basename. Expected path \"' + path + '\" to begin with \"' + basename + '\".') : void 0;\n if (basename) path = stripBasename(path, basename);\n return createLocation(path);\n }\n\n var transitionManager = createTransitionManager();\n\n function setState(nextState) {\n _extends(history, nextState);\n\n history.length = globalHistory.length;\n transitionManager.notifyListeners(history.location, history.action);\n }\n\n var forceNextPop = false;\n var ignorePath = null;\n\n function locationsAreEqual$$1(a, b) {\n return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash;\n }\n\n function handleHashChange() {\n var path = getHashPath();\n var encodedPath = encodePath(path);\n\n if (path !== encodedPath) {\n // Ensure we always have a properly-encoded hash.\n replaceHashPath(encodedPath);\n } else {\n var location = getDOMLocation();\n var prevLocation = history.location;\n if (!forceNextPop && locationsAreEqual$$1(prevLocation, location)) return; // A hashchange doesn't always == location change.\n\n if (ignorePath === createPath(location)) return; // Ignore this change; we already setState in push/replace.\n\n ignorePath = null;\n handlePop(location);\n }\n }\n\n function handlePop(location) {\n if (forceNextPop) {\n forceNextPop = false;\n setState();\n } else {\n var action = 'POP';\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (ok) {\n setState({\n action: action,\n location: location\n });\n } else {\n revertPop(location);\n }\n });\n }\n }\n\n function revertPop(fromLocation) {\n var toLocation = history.location; // TODO: We could probably make this more reliable by\n // keeping a list of paths we've seen in sessionStorage.\n // Instead, we just default to 0 for paths we don't know.\n\n var toIndex = allPaths.lastIndexOf(createPath(toLocation));\n if (toIndex === -1) toIndex = 0;\n var fromIndex = allPaths.lastIndexOf(createPath(fromLocation));\n if (fromIndex === -1) fromIndex = 0;\n var delta = toIndex - fromIndex;\n\n if (delta) {\n forceNextPop = true;\n go(delta);\n }\n } // Ensure the hash is encoded properly before doing anything else.\n\n\n var path = getHashPath();\n var encodedPath = encodePath(path);\n if (path !== encodedPath) replaceHashPath(encodedPath);\n var initialLocation = getDOMLocation();\n var allPaths = [createPath(initialLocation)]; // Public interface\n\n function createHref(location) {\n var baseTag = document.querySelector('base');\n var href = '';\n\n if (baseTag && baseTag.getAttribute('href')) {\n href = stripHash(window.location.href);\n }\n\n return href + '#' + encodePath(basename + createPath(location));\n }\n\n function push(path, state) {\n process.env.NODE_ENV !== \"production\" ? warning(state === undefined, 'Hash history cannot push state; it is ignored') : void 0;\n var action = 'PUSH';\n var location = createLocation(path, undefined, undefined, history.location);\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (!ok) return;\n var path = createPath(location);\n var encodedPath = encodePath(basename + path);\n var hashChanged = getHashPath() !== encodedPath;\n\n if (hashChanged) {\n // We cannot tell if a hashchange was caused by a PUSH, so we'd\n // rather setState here and ignore the hashchange. The caveat here\n // is that other hash histories in the page will consider it a POP.\n ignorePath = path;\n pushHashPath(encodedPath);\n var prevIndex = allPaths.lastIndexOf(createPath(history.location));\n var nextPaths = allPaths.slice(0, prevIndex + 1);\n nextPaths.push(path);\n allPaths = nextPaths;\n setState({\n action: action,\n location: location\n });\n } else {\n process.env.NODE_ENV !== \"production\" ? warning(false, 'Hash history cannot PUSH the same path; a new entry will not be added to the history stack') : void 0;\n setState();\n }\n });\n }\n\n function replace(path, state) {\n process.env.NODE_ENV !== \"production\" ? warning(state === undefined, 'Hash history cannot replace state; it is ignored') : void 0;\n var action = 'REPLACE';\n var location = createLocation(path, undefined, undefined, history.location);\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (!ok) return;\n var path = createPath(location);\n var encodedPath = encodePath(basename + path);\n var hashChanged = getHashPath() !== encodedPath;\n\n if (hashChanged) {\n // We cannot tell if a hashchange was caused by a REPLACE, so we'd\n // rather setState here and ignore the hashchange. The caveat here\n // is that other hash histories in the page will consider it a POP.\n ignorePath = path;\n replaceHashPath(encodedPath);\n }\n\n var prevIndex = allPaths.indexOf(createPath(history.location));\n if (prevIndex !== -1) allPaths[prevIndex] = path;\n setState({\n action: action,\n location: location\n });\n });\n }\n\n function go(n) {\n process.env.NODE_ENV !== \"production\" ? warning(canGoWithoutReload, 'Hash history go(n) causes a full page reload in this browser') : void 0;\n globalHistory.go(n);\n }\n\n function goBack() {\n go(-1);\n }\n\n function goForward() {\n go(1);\n }\n\n var listenerCount = 0;\n\n function checkDOMListeners(delta) {\n listenerCount += delta;\n\n if (listenerCount === 1 && delta === 1) {\n window.addEventListener(HashChangeEvent$1, handleHashChange);\n } else if (listenerCount === 0) {\n window.removeEventListener(HashChangeEvent$1, handleHashChange);\n }\n }\n\n var isBlocked = false;\n\n function block(prompt) {\n if (prompt === void 0) {\n prompt = false;\n }\n\n var unblock = transitionManager.setPrompt(prompt);\n\n if (!isBlocked) {\n checkDOMListeners(1);\n isBlocked = true;\n }\n\n return function () {\n if (isBlocked) {\n isBlocked = false;\n checkDOMListeners(-1);\n }\n\n return unblock();\n };\n }\n\n function listen(listener) {\n var unlisten = transitionManager.appendListener(listener);\n checkDOMListeners(1);\n return function () {\n checkDOMListeners(-1);\n unlisten();\n };\n }\n\n var history = {\n length: globalHistory.length,\n action: 'POP',\n location: initialLocation,\n createHref: createHref,\n push: push,\n replace: replace,\n go: go,\n goBack: goBack,\n goForward: goForward,\n block: block,\n listen: listen\n };\n return history;\n}\n\nfunction clamp(n, lowerBound, upperBound) {\n return Math.min(Math.max(n, lowerBound), upperBound);\n}\n/**\n * Creates a history object that stores locations in memory.\n */\n\n\nfunction createMemoryHistory(props) {\n if (props === void 0) {\n props = {};\n }\n\n var _props = props,\n getUserConfirmation = _props.getUserConfirmation,\n _props$initialEntries = _props.initialEntries,\n initialEntries = _props$initialEntries === void 0 ? ['/'] : _props$initialEntries,\n _props$initialIndex = _props.initialIndex,\n initialIndex = _props$initialIndex === void 0 ? 0 : _props$initialIndex,\n _props$keyLength = _props.keyLength,\n keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength;\n var transitionManager = createTransitionManager();\n\n function setState(nextState) {\n _extends(history, nextState);\n\n history.length = history.entries.length;\n transitionManager.notifyListeners(history.location, history.action);\n }\n\n function createKey() {\n return Math.random().toString(36).substr(2, keyLength);\n }\n\n var index = clamp(initialIndex, 0, initialEntries.length - 1);\n var entries = initialEntries.map(function (entry) {\n return typeof entry === 'string' ? createLocation(entry, undefined, createKey()) : createLocation(entry, undefined, entry.key || createKey());\n }); // Public interface\n\n var createHref = createPath;\n\n function push(path, state) {\n process.env.NODE_ENV !== \"production\" ? warning(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to push when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;\n var action = 'PUSH';\n var location = createLocation(path, state, createKey(), history.location);\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (!ok) return;\n var prevIndex = history.index;\n var nextIndex = prevIndex + 1;\n var nextEntries = history.entries.slice(0);\n\n if (nextEntries.length > nextIndex) {\n nextEntries.splice(nextIndex, nextEntries.length - nextIndex, location);\n } else {\n nextEntries.push(location);\n }\n\n setState({\n action: action,\n location: location,\n index: nextIndex,\n entries: nextEntries\n });\n });\n }\n\n function replace(path, state) {\n process.env.NODE_ENV !== \"production\" ? warning(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to replace when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;\n var action = 'REPLACE';\n var location = createLocation(path, state, createKey(), history.location);\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (!ok) return;\n history.entries[history.index] = location;\n setState({\n action: action,\n location: location\n });\n });\n }\n\n function go(n) {\n var nextIndex = clamp(history.index + n, 0, history.entries.length - 1);\n var action = 'POP';\n var location = history.entries[nextIndex];\n transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {\n if (ok) {\n setState({\n action: action,\n location: location,\n index: nextIndex\n });\n } else {\n // Mimic the behavior of DOM histories by\n // causing a render after a cancelled POP.\n setState();\n }\n });\n }\n\n function goBack() {\n go(-1);\n }\n\n function goForward() {\n go(1);\n }\n\n function canGo(n) {\n var nextIndex = history.index + n;\n return nextIndex >= 0 && nextIndex < history.entries.length;\n }\n\n function block(prompt) {\n if (prompt === void 0) {\n prompt = false;\n }\n\n return transitionManager.setPrompt(prompt);\n }\n\n function listen(listener) {\n return transitionManager.appendListener(listener);\n }\n\n var history = {\n length: entries.length,\n action: 'POP',\n location: entries[index],\n index: index,\n entries: entries,\n createHref: createHref,\n push: push,\n replace: replace,\n go: go,\n goBack: goBack,\n goForward: goForward,\n canGo: canGo,\n block: block,\n listen: listen\n };\n return history;\n}\n\nexport { createBrowserHistory, createHashHistory, createMemoryHistory, createLocation, locationsAreEqual, parsePath, createPath };\n","// Corresponds to 10 frames at 60 Hz.\n// A few bytes payload overhead when lodash/debounce is ~3 kB and debounce ~300 B.\nexport default function debounce(func) {\n var wait = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 166;\n var timeout;\n\n function debounced() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n // eslint-disable-next-line consistent-this\n var that = this;\n\n var later = function later() {\n func.apply(that, args);\n };\n\n clearTimeout(timeout);\n timeout = setTimeout(later, wait);\n }\n\n debounced.clear = function () {\n clearTimeout(timeout);\n };\n\n return debounced;\n}","function _defineProperties(target, props) {\n for (var i = 0; i < props.length; i++) {\n var descriptor = props[i];\n descriptor.enumerable = descriptor.enumerable || false;\n descriptor.configurable = true;\n if (\"value\" in descriptor) descriptor.writable = true;\n Object.defineProperty(target, descriptor.key, descriptor);\n }\n}\n\nexport default function _createClass(Constructor, protoProps, staticProps) {\n if (protoProps) _defineProperties(Constructor.prototype, protoProps);\n if (staticProps) _defineProperties(Constructor, staticProps);\n return Constructor;\n}","import * as React from 'react';\nimport FormControlContext from './FormControlContext';\nexport default function useFormControl() {\n return React.useContext(FormControlContext);\n}","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _isNil from \"lodash/isNil\";\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nfunction _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction _iterableToArrayLimit(arr, i) { if (typeof Symbol === \"undefined\" || !(Symbol.iterator in Object(arr))) return; var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport React, { Component } from 'react';\nimport reduceCSSCalc from 'reduce-css-calc';\nimport classNames from 'classnames';\nimport { isNumber, isNumOrStr } from '../util/DataUtils';\nimport { Global } from '../util/Global';\nimport { filterProps } from '../util/types';\nimport { getStringSize } from '../util/DOMUtils';\nvar BREAKING_SPACES = /[ \\f\\n\\r\\t\\v\\u2028\\u2029]+/;\n\nvar calculateWordWidths = function calculateWordWidths(props) {\n try {\n var words = [];\n\n if (!_isNil(props.children)) {\n if (props.breakAll) {\n words = props.children.toString().split('');\n } else {\n words = props.children.toString().split(BREAKING_SPACES);\n }\n }\n\n var wordsWithComputedWidth = words.map(function (word) {\n return {\n word: word,\n width: getStringSize(word, props.style).width\n };\n });\n var spaceWidth = props.breakAll ? 0 : getStringSize(\"\\xA0\", props.style).width;\n return {\n wordsWithComputedWidth: wordsWithComputedWidth,\n spaceWidth: spaceWidth\n };\n } catch (e) {\n return null;\n }\n};\n\nvar calculateWordsByLines = function calculateWordsByLines(props, initialWordsWithComputedWith, spaceWidth, lineWidth, scaleToFit) {\n var shouldLimitLines = isNumber(props.maxLines);\n var text = props.children;\n\n var calculate = function calculate() {\n var words = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];\n return words.reduce(function (result, _ref) {\n var word = _ref.word,\n width = _ref.width;\n var currentLine = result[result.length - 1];\n\n if (currentLine && (lineWidth == null || scaleToFit || currentLine.width + width + spaceWidth < lineWidth)) {\n // Word can be added to an existing line\n currentLine.words.push(word);\n currentLine.width += width + spaceWidth;\n } else {\n // Add first word to line or word is too long to scaleToFit on existing line\n var newLine = {\n words: [word],\n width: width\n };\n result.push(newLine);\n }\n\n return result;\n }, []);\n };\n\n var originalResult = calculate(initialWordsWithComputedWith);\n\n var findLongestLine = function findLongestLine(words) {\n return words.reduce(function (a, b) {\n return a.width > b.width ? a : b;\n });\n };\n\n if (!shouldLimitLines) {\n return originalResult;\n }\n\n var suffix = '…';\n\n var checkOverflow = function checkOverflow(index) {\n var tempText = text.slice(0, index);\n var words = calculateWordWidths(_objectSpread(_objectSpread({}, props), {}, {\n children: tempText + suffix\n })).wordsWithComputedWidth;\n var result = calculate(words);\n var doesOverflow = result.length > props.maxLines || findLongestLine(result).width > lineWidth;\n return [doesOverflow, result];\n };\n\n var start = 0;\n var end = text.length - 1;\n var iterations = 0;\n var trimmedResult;\n\n while (start <= end && iterations <= text.length - 1) {\n var middle = Math.floor((start + end) / 2);\n var prev = middle - 1;\n\n var _checkOverflow = checkOverflow(prev),\n _checkOverflow2 = _slicedToArray(_checkOverflow, 2),\n doesPrevOverflow = _checkOverflow2[0],\n result = _checkOverflow2[1];\n\n var _checkOverflow3 = checkOverflow(middle),\n _checkOverflow4 = _slicedToArray(_checkOverflow3, 1),\n doesMiddleOverflow = _checkOverflow4[0];\n\n if (!doesPrevOverflow && !doesMiddleOverflow) {\n start = middle + 1;\n }\n\n if (doesPrevOverflow && doesMiddleOverflow) {\n end = middle - 1;\n }\n\n if (!doesPrevOverflow && doesMiddleOverflow) {\n trimmedResult = result;\n break;\n }\n\n iterations++;\n } // Fallback to originalResult (result without trimming) if we cannot find the\n // where to trim. This should not happen :tm:\n\n\n return trimmedResult || originalResult;\n};\n\nvar getWordsWithoutCalculate = function getWordsWithoutCalculate(children) {\n var words = !_isNil(children) ? children.toString().split(BREAKING_SPACES) : [];\n return [{\n words: words\n }];\n};\n\nvar getWordsByLines = function getWordsByLines(props, needCalculate) {\n // Only perform calculations if using features that require them (multiline, scaleToFit)\n if ((props.width || props.scaleToFit) && !Global.isSsr) {\n var wordsWithComputedWidth, spaceWidth;\n\n if (needCalculate) {\n var wordWidths = calculateWordWidths(props);\n\n if (wordWidths) {\n var wcw = wordWidths.wordsWithComputedWidth,\n sw = wordWidths.spaceWidth;\n wordsWithComputedWidth = wcw;\n spaceWidth = sw;\n } else {\n return getWordsWithoutCalculate(props.children);\n }\n\n return calculateWordsByLines(props, wordsWithComputedWidth, spaceWidth, props.width, props.scaleToFit);\n }\n }\n\n return getWordsWithoutCalculate(props.children);\n};\n\nexport var Text = /*#__PURE__*/function (_Component) {\n _inherits(Text, _Component);\n\n var _super = _createSuper(Text);\n\n function Text() {\n var _this;\n\n _classCallCheck(this, Text);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _super.call.apply(_super, [this].concat(args));\n _this.state = {};\n return _this;\n }\n\n _createClass(Text, [{\n key: \"render\",\n value: function render() {\n var _this$props = this.props,\n dx = _this$props.dx,\n dy = _this$props.dy,\n textAnchor = _this$props.textAnchor,\n verticalAnchor = _this$props.verticalAnchor,\n scaleToFit = _this$props.scaleToFit,\n angle = _this$props.angle,\n lineHeight = _this$props.lineHeight,\n capHeight = _this$props.capHeight,\n className = _this$props.className,\n breakAll = _this$props.breakAll,\n textProps = _objectWithoutProperties(_this$props, [\"dx\", \"dy\", \"textAnchor\", \"verticalAnchor\", \"scaleToFit\", \"angle\", \"lineHeight\", \"capHeight\", \"className\", \"breakAll\"]);\n\n var wordsByLines = this.state.wordsByLines;\n\n if (!isNumOrStr(textProps.x) || !isNumOrStr(textProps.y)) {\n return null;\n }\n\n var x = textProps.x + (isNumber(dx) ? dx : 0);\n var y = textProps.y + (isNumber(dy) ? dy : 0);\n var startDy;\n\n switch (verticalAnchor) {\n case 'start':\n startDy = reduceCSSCalc(\"calc(\".concat(capHeight, \")\"));\n break;\n\n case 'middle':\n startDy = reduceCSSCalc(\"calc(\".concat((wordsByLines.length - 1) / 2, \" * -\").concat(lineHeight, \" + (\").concat(capHeight, \" / 2))\"));\n break;\n\n default:\n startDy = reduceCSSCalc(\"calc(\".concat(wordsByLines.length - 1, \" * -\").concat(lineHeight, \")\"));\n break;\n }\n\n var transforms = [];\n\n if (scaleToFit) {\n var lineWidth = wordsByLines[0].width;\n var width = this.props.width;\n transforms.push(\"scale(\".concat((isNumber(width) ? width / lineWidth : 1) / lineWidth, \")\"));\n }\n\n if (angle) {\n transforms.push(\"rotate(\".concat(angle, \", \").concat(x, \", \").concat(y, \")\"));\n }\n\n if (transforms.length) {\n textProps.transform = transforms.join(' ');\n }\n\n return /*#__PURE__*/React.createElement(\"text\", _extends({}, filterProps(textProps, true), {\n x: x,\n y: y,\n className: classNames('recharts-text', className),\n textAnchor: textAnchor\n }), wordsByLines.map(function (line, index) {\n return (\n /*#__PURE__*/\n // eslint-disable-next-line react/no-array-index-key\n React.createElement(\"tspan\", {\n x: x,\n dy: index === 0 ? startDy : lineHeight,\n key: index\n }, line.words.join(breakAll ? '' : ' '))\n );\n }));\n }\n }], [{\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n if (nextProps.width !== prevState.prevWidth || nextProps.scaleToFit !== prevState.prevScaleToFit || nextProps.children !== prevState.prevChildren || nextProps.style !== prevState.prevStyle || nextProps.breakAll !== prevState.prevBreakAll) {\n var needCalculate = nextProps.children !== prevState.prevChildren || nextProps.style !== prevState.prevStyle || nextProps.breakAll !== prevState.prevBreakAll;\n return {\n prevWidth: nextProps.width,\n prevScaleToFit: nextProps.scaleToFit,\n prevChildren: nextProps.children,\n prevStyle: nextProps.style,\n wordsByLines: getWordsByLines(nextProps, needCalculate)\n };\n }\n\n return null;\n }\n }]);\n\n return Text;\n}(Component);\nText.defaultProps = {\n x: 0,\n y: 0,\n lineHeight: '1em',\n capHeight: '0.71em',\n // Magic number from d3\n scaleToFit: false,\n textAnchor: 'start',\n verticalAnchor: 'end' // Maintain compat with existing charts / default SVG behavior\n\n};","/* eslint no-console: 0 */\nvar isDev = process.env.NODE_ENV !== 'production';\nexport var warn = function warn(condition, format) {\n for (var _len = arguments.length, args = new Array(_len > 2 ? _len - 2 : 0), _key = 2; _key < _len; _key++) {\n args[_key - 2] = arguments[_key];\n }\n\n if (isDev && typeof console !== 'undefined' && console.warn) {\n if (format === undefined) {\n console.warn('LogUtils requires an error message argument');\n }\n\n if (!condition) {\n if (format === undefined) {\n console.warn('Minified exception occurred; use the non-minified dev environment ' + 'for the full error message and additional helpful warnings.');\n } else {\n var argIndex = 0;\n console.warn(format.replace(/%s/g, function () {\n return args[argIndex++];\n }));\n }\n }\n }\n};","var isProduction = process.env.NODE_ENV === 'production';\nvar prefix = 'Invariant failed';\nfunction invariant(condition, message) {\n if (condition) {\n return;\n }\n if (isProduction) {\n throw new Error(prefix);\n }\n throw new Error(prefix + \": \" + (message || ''));\n}\n\nexport default invariant;\n","/**\n * Helper method that determines when to recalculate row or column metadata.\n */\nexport default function calculateSizeAndPositionDataAndUpdateScrollOffset(_ref) {\n var cellCount = _ref.cellCount,\n cellSize = _ref.cellSize,\n computeMetadataCallback = _ref.computeMetadataCallback,\n computeMetadataCallbackProps = _ref.computeMetadataCallbackProps,\n nextCellsCount = _ref.nextCellsCount,\n nextCellSize = _ref.nextCellSize,\n nextScrollToIndex = _ref.nextScrollToIndex,\n scrollToIndex = _ref.scrollToIndex,\n updateScrollOffsetForScrollToIndex = _ref.updateScrollOffsetForScrollToIndex;\n\n // Don't compare cell sizes if they are functions because inline functions would cause infinite loops.\n // In that event users should use the manual recompute methods to inform of changes.\n if (cellCount !== nextCellsCount || (typeof cellSize === 'number' || typeof nextCellSize === 'number') && cellSize !== nextCellSize) {\n computeMetadataCallback(computeMetadataCallbackProps); // Updated cell metadata may have hidden the previous scrolled-to item.\n // In this case we should also update the scrollTop to ensure it stays visible.\n\n if (scrollToIndex >= 0 && scrollToIndex === nextScrollToIndex) {\n updateScrollOffsetForScrollToIndex();\n }\n }\n}","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\n/**\n * Just-in-time calculates and caches size and position information for a collection of cells.\n */\nvar CellSizeAndPositionManager =\n/*#__PURE__*/\nfunction () {\n // Cache of size and position data for cells, mapped by cell index.\n // Note that invalid values may exist in this map so only rely on cells up to this._lastMeasuredIndex\n // Measurements for cells up to this index can be trusted; cells afterward should be estimated.\n // Used in deferred mode to track which cells have been queued for measurement.\n function CellSizeAndPositionManager(_ref) {\n var cellCount = _ref.cellCount,\n cellSizeGetter = _ref.cellSizeGetter,\n estimatedCellSize = _ref.estimatedCellSize;\n\n _classCallCheck(this, CellSizeAndPositionManager);\n\n _defineProperty(this, \"_cellSizeAndPositionData\", {});\n\n _defineProperty(this, \"_lastMeasuredIndex\", -1);\n\n _defineProperty(this, \"_lastBatchedIndex\", -1);\n\n _defineProperty(this, \"_cellCount\", void 0);\n\n _defineProperty(this, \"_cellSizeGetter\", void 0);\n\n _defineProperty(this, \"_estimatedCellSize\", void 0);\n\n this._cellSizeGetter = cellSizeGetter;\n this._cellCount = cellCount;\n this._estimatedCellSize = estimatedCellSize;\n }\n\n _createClass(CellSizeAndPositionManager, [{\n key: \"areOffsetsAdjusted\",\n value: function areOffsetsAdjusted() {\n return false;\n }\n }, {\n key: \"configure\",\n value: function configure(_ref2) {\n var cellCount = _ref2.cellCount,\n estimatedCellSize = _ref2.estimatedCellSize,\n cellSizeGetter = _ref2.cellSizeGetter;\n this._cellCount = cellCount;\n this._estimatedCellSize = estimatedCellSize;\n this._cellSizeGetter = cellSizeGetter;\n }\n }, {\n key: \"getCellCount\",\n value: function getCellCount() {\n return this._cellCount;\n }\n }, {\n key: \"getEstimatedCellSize\",\n value: function getEstimatedCellSize() {\n return this._estimatedCellSize;\n }\n }, {\n key: \"getLastMeasuredIndex\",\n value: function getLastMeasuredIndex() {\n return this._lastMeasuredIndex;\n }\n }, {\n key: \"getOffsetAdjustment\",\n value: function getOffsetAdjustment() {\n return 0;\n }\n /**\n * This method returns the size and position for the cell at the specified index.\n * It just-in-time calculates (or used cached values) for cells leading up to the index.\n */\n\n }, {\n key: \"getSizeAndPositionOfCell\",\n value: function getSizeAndPositionOfCell(index) {\n if (index < 0 || index >= this._cellCount) {\n throw Error(\"Requested index \".concat(index, \" is outside of range 0..\").concat(this._cellCount));\n }\n\n if (index > this._lastMeasuredIndex) {\n var lastMeasuredCellSizeAndPosition = this.getSizeAndPositionOfLastMeasuredCell();\n var offset = lastMeasuredCellSizeAndPosition.offset + lastMeasuredCellSizeAndPosition.size;\n\n for (var i = this._lastMeasuredIndex + 1; i <= index; i++) {\n var size = this._cellSizeGetter({\n index: i\n }); // undefined or NaN probably means a logic error in the size getter.\n // null means we're using CellMeasurer and haven't yet measured a given index.\n\n\n if (size === undefined || isNaN(size)) {\n throw Error(\"Invalid size returned for cell \".concat(i, \" of value \").concat(size));\n } else if (size === null) {\n this._cellSizeAndPositionData[i] = {\n offset: offset,\n size: 0\n };\n this._lastBatchedIndex = index;\n } else {\n this._cellSizeAndPositionData[i] = {\n offset: offset,\n size: size\n };\n offset += size;\n this._lastMeasuredIndex = index;\n }\n }\n }\n\n return this._cellSizeAndPositionData[index];\n }\n }, {\n key: \"getSizeAndPositionOfLastMeasuredCell\",\n value: function getSizeAndPositionOfLastMeasuredCell() {\n return this._lastMeasuredIndex >= 0 ? this._cellSizeAndPositionData[this._lastMeasuredIndex] : {\n offset: 0,\n size: 0\n };\n }\n /**\n * Total size of all cells being measured.\n * This value will be completely estimated initially.\n * As cells are measured, the estimate will be updated.\n */\n\n }, {\n key: \"getTotalSize\",\n value: function getTotalSize() {\n var lastMeasuredCellSizeAndPosition = this.getSizeAndPositionOfLastMeasuredCell();\n var totalSizeOfMeasuredCells = lastMeasuredCellSizeAndPosition.offset + lastMeasuredCellSizeAndPosition.size;\n var numUnmeasuredCells = this._cellCount - this._lastMeasuredIndex - 1;\n var totalSizeOfUnmeasuredCells = numUnmeasuredCells * this._estimatedCellSize;\n return totalSizeOfMeasuredCells + totalSizeOfUnmeasuredCells;\n }\n /**\n * Determines a new offset that ensures a certain cell is visible, given the current offset.\n * If the cell is already visible then the current offset will be returned.\n * If the current offset is too great or small, it will be adjusted just enough to ensure the specified index is visible.\n *\n * @param align Desired alignment within container; one of \"auto\" (default), \"start\", or \"end\"\n * @param containerSize Size (width or height) of the container viewport\n * @param currentOffset Container's current (x or y) offset\n * @param totalSize Total size (width or height) of all cells\n * @return Offset to use to ensure the specified cell is visible\n */\n\n }, {\n key: \"getUpdatedOffsetForIndex\",\n value: function getUpdatedOffsetForIndex(_ref3) {\n var _ref3$align = _ref3.align,\n align = _ref3$align === void 0 ? 'auto' : _ref3$align,\n containerSize = _ref3.containerSize,\n currentOffset = _ref3.currentOffset,\n targetIndex = _ref3.targetIndex;\n\n if (containerSize <= 0) {\n return 0;\n }\n\n var datum = this.getSizeAndPositionOfCell(targetIndex);\n var maxOffset = datum.offset;\n var minOffset = maxOffset - containerSize + datum.size;\n var idealOffset;\n\n switch (align) {\n case 'start':\n idealOffset = maxOffset;\n break;\n\n case 'end':\n idealOffset = minOffset;\n break;\n\n case 'center':\n idealOffset = maxOffset - (containerSize - datum.size) / 2;\n break;\n\n default:\n idealOffset = Math.max(minOffset, Math.min(maxOffset, currentOffset));\n break;\n }\n\n var totalSize = this.getTotalSize();\n return Math.max(0, Math.min(totalSize - containerSize, idealOffset));\n }\n }, {\n key: \"getVisibleCellRange\",\n value: function getVisibleCellRange(params) {\n var containerSize = params.containerSize,\n offset = params.offset;\n var totalSize = this.getTotalSize();\n\n if (totalSize === 0) {\n return {};\n }\n\n var maxOffset = offset + containerSize;\n\n var start = this._findNearestCell(offset);\n\n var datum = this.getSizeAndPositionOfCell(start);\n offset = datum.offset + datum.size;\n var stop = start;\n\n while (offset < maxOffset && stop < this._cellCount - 1) {\n stop++;\n offset += this.getSizeAndPositionOfCell(stop).size;\n }\n\n return {\n start: start,\n stop: stop\n };\n }\n /**\n * Clear all cached values for cells after the specified index.\n * This method should be called for any cell that has changed its size.\n * It will not immediately perform any calculations; they'll be performed the next time getSizeAndPositionOfCell() is called.\n */\n\n }, {\n key: \"resetCell\",\n value: function resetCell(index) {\n this._lastMeasuredIndex = Math.min(this._lastMeasuredIndex, index - 1);\n }\n }, {\n key: \"_binarySearch\",\n value: function _binarySearch(high, low, offset) {\n while (low <= high) {\n var middle = low + Math.floor((high - low) / 2);\n var currentOffset = this.getSizeAndPositionOfCell(middle).offset;\n\n if (currentOffset === offset) {\n return middle;\n } else if (currentOffset < offset) {\n low = middle + 1;\n } else if (currentOffset > offset) {\n high = middle - 1;\n }\n }\n\n if (low > 0) {\n return low - 1;\n } else {\n return 0;\n }\n }\n }, {\n key: \"_exponentialSearch\",\n value: function _exponentialSearch(index, offset) {\n var interval = 1;\n\n while (index < this._cellCount && this.getSizeAndPositionOfCell(index).offset < offset) {\n index += interval;\n interval *= 2;\n }\n\n return this._binarySearch(Math.min(index, this._cellCount - 1), Math.floor(index / 2), offset);\n }\n /**\n * Searches for the cell (index) nearest the specified offset.\n *\n * If no exact match is found the next lowest cell index will be returned.\n * This allows partially visible cells (with offsets just before/above the fold) to be visible.\n */\n\n }, {\n key: \"_findNearestCell\",\n value: function _findNearestCell(offset) {\n if (isNaN(offset)) {\n throw Error(\"Invalid offset \".concat(offset, \" specified\"));\n } // Our search algorithms find the nearest match at or below the specified offset.\n // So make sure the offset is at least 0 or no match will be found.\n\n\n offset = Math.max(0, offset);\n var lastMeasuredCellSizeAndPosition = this.getSizeAndPositionOfLastMeasuredCell();\n var lastMeasuredIndex = Math.max(0, this._lastMeasuredIndex);\n\n if (lastMeasuredCellSizeAndPosition.offset >= offset) {\n // If we've already measured cells within this range just use a binary search as it's faster.\n return this._binarySearch(lastMeasuredIndex, 0, offset);\n } else {\n // If we haven't yet measured this high, fallback to an exponential search with an inner binary search.\n // The exponential search avoids pre-computing sizes for the full set of cells as a binary search would.\n // The overall complexity for this approach is O(log n).\n return this._exponentialSearch(lastMeasuredIndex, offset);\n }\n }\n }]);\n\n return CellSizeAndPositionManager;\n}();\n\nexport { CellSizeAndPositionManager as default };\nimport { bpfrpt_proptype_Alignment } from \"../types\";\nimport { bpfrpt_proptype_CellSizeGetter } from \"../types\";\nimport { bpfrpt_proptype_VisibleCellRange } from \"../types\";","var DEFAULT_MAX_ELEMENT_SIZE = 1500000;\nvar CHROME_MAX_ELEMENT_SIZE = 1.67771e7;\n\nvar isBrowser = function isBrowser() {\n return typeof window !== 'undefined';\n};\n\nvar isChrome = function isChrome() {\n return !!window.chrome;\n};\n\nexport var getMaxElementSize = function getMaxElementSize() {\n if (isBrowser()) {\n if (isChrome()) {\n return CHROME_MAX_ELEMENT_SIZE;\n }\n }\n\n return DEFAULT_MAX_ELEMENT_SIZE;\n};","import _objectWithoutProperties from \"@babel/runtime/helpers/objectWithoutProperties\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nimport CellSizeAndPositionManager from './CellSizeAndPositionManager';\nimport { getMaxElementSize } from './maxElementSize.js';\n\n/**\n * Extends CellSizeAndPositionManager and adds scaling behavior for lists that are too large to fit within a browser's native limits.\n */\nvar ScalingCellSizeAndPositionManager =\n/*#__PURE__*/\nfunction () {\n function ScalingCellSizeAndPositionManager(_ref) {\n var _ref$maxScrollSize = _ref.maxScrollSize,\n maxScrollSize = _ref$maxScrollSize === void 0 ? getMaxElementSize() : _ref$maxScrollSize,\n params = _objectWithoutProperties(_ref, [\"maxScrollSize\"]);\n\n _classCallCheck(this, ScalingCellSizeAndPositionManager);\n\n _defineProperty(this, \"_cellSizeAndPositionManager\", void 0);\n\n _defineProperty(this, \"_maxScrollSize\", void 0);\n\n // Favor composition over inheritance to simplify IE10 support\n this._cellSizeAndPositionManager = new CellSizeAndPositionManager(params);\n this._maxScrollSize = maxScrollSize;\n }\n\n _createClass(ScalingCellSizeAndPositionManager, [{\n key: \"areOffsetsAdjusted\",\n value: function areOffsetsAdjusted() {\n return this._cellSizeAndPositionManager.getTotalSize() > this._maxScrollSize;\n }\n }, {\n key: \"configure\",\n value: function configure(params) {\n this._cellSizeAndPositionManager.configure(params);\n }\n }, {\n key: \"getCellCount\",\n value: function getCellCount() {\n return this._cellSizeAndPositionManager.getCellCount();\n }\n }, {\n key: \"getEstimatedCellSize\",\n value: function getEstimatedCellSize() {\n return this._cellSizeAndPositionManager.getEstimatedCellSize();\n }\n }, {\n key: \"getLastMeasuredIndex\",\n value: function getLastMeasuredIndex() {\n return this._cellSizeAndPositionManager.getLastMeasuredIndex();\n }\n /**\n * Number of pixels a cell at the given position (offset) should be shifted in order to fit within the scaled container.\n * The offset passed to this function is scaled (safe) as well.\n */\n\n }, {\n key: \"getOffsetAdjustment\",\n value: function getOffsetAdjustment(_ref2) {\n var containerSize = _ref2.containerSize,\n offset = _ref2.offset;\n\n var totalSize = this._cellSizeAndPositionManager.getTotalSize();\n\n var safeTotalSize = this.getTotalSize();\n\n var offsetPercentage = this._getOffsetPercentage({\n containerSize: containerSize,\n offset: offset,\n totalSize: safeTotalSize\n });\n\n return Math.round(offsetPercentage * (safeTotalSize - totalSize));\n }\n }, {\n key: \"getSizeAndPositionOfCell\",\n value: function getSizeAndPositionOfCell(index) {\n return this._cellSizeAndPositionManager.getSizeAndPositionOfCell(index);\n }\n }, {\n key: \"getSizeAndPositionOfLastMeasuredCell\",\n value: function getSizeAndPositionOfLastMeasuredCell() {\n return this._cellSizeAndPositionManager.getSizeAndPositionOfLastMeasuredCell();\n }\n /** See CellSizeAndPositionManager#getTotalSize */\n\n }, {\n key: \"getTotalSize\",\n value: function getTotalSize() {\n return Math.min(this._maxScrollSize, this._cellSizeAndPositionManager.getTotalSize());\n }\n /** See CellSizeAndPositionManager#getUpdatedOffsetForIndex */\n\n }, {\n key: \"getUpdatedOffsetForIndex\",\n value: function getUpdatedOffsetForIndex(_ref3) {\n var _ref3$align = _ref3.align,\n align = _ref3$align === void 0 ? 'auto' : _ref3$align,\n containerSize = _ref3.containerSize,\n currentOffset = _ref3.currentOffset,\n targetIndex = _ref3.targetIndex;\n currentOffset = this._safeOffsetToOffset({\n containerSize: containerSize,\n offset: currentOffset\n });\n\n var offset = this._cellSizeAndPositionManager.getUpdatedOffsetForIndex({\n align: align,\n containerSize: containerSize,\n currentOffset: currentOffset,\n targetIndex: targetIndex\n });\n\n return this._offsetToSafeOffset({\n containerSize: containerSize,\n offset: offset\n });\n }\n /** See CellSizeAndPositionManager#getVisibleCellRange */\n\n }, {\n key: \"getVisibleCellRange\",\n value: function getVisibleCellRange(_ref4) {\n var containerSize = _ref4.containerSize,\n offset = _ref4.offset;\n offset = this._safeOffsetToOffset({\n containerSize: containerSize,\n offset: offset\n });\n return this._cellSizeAndPositionManager.getVisibleCellRange({\n containerSize: containerSize,\n offset: offset\n });\n }\n }, {\n key: \"resetCell\",\n value: function resetCell(index) {\n this._cellSizeAndPositionManager.resetCell(index);\n }\n }, {\n key: \"_getOffsetPercentage\",\n value: function _getOffsetPercentage(_ref5) {\n var containerSize = _ref5.containerSize,\n offset = _ref5.offset,\n totalSize = _ref5.totalSize;\n return totalSize <= containerSize ? 0 : offset / (totalSize - containerSize);\n }\n }, {\n key: \"_offsetToSafeOffset\",\n value: function _offsetToSafeOffset(_ref6) {\n var containerSize = _ref6.containerSize,\n offset = _ref6.offset;\n\n var totalSize = this._cellSizeAndPositionManager.getTotalSize();\n\n var safeTotalSize = this.getTotalSize();\n\n if (totalSize === safeTotalSize) {\n return offset;\n } else {\n var offsetPercentage = this._getOffsetPercentage({\n containerSize: containerSize,\n offset: offset,\n totalSize: totalSize\n });\n\n return Math.round(offsetPercentage * (safeTotalSize - containerSize));\n }\n }\n }, {\n key: \"_safeOffsetToOffset\",\n value: function _safeOffsetToOffset(_ref7) {\n var containerSize = _ref7.containerSize,\n offset = _ref7.offset;\n\n var totalSize = this._cellSizeAndPositionManager.getTotalSize();\n\n var safeTotalSize = this.getTotalSize();\n\n if (totalSize === safeTotalSize) {\n return offset;\n } else {\n var offsetPercentage = this._getOffsetPercentage({\n containerSize: containerSize,\n offset: offset,\n totalSize: safeTotalSize\n });\n\n return Math.round(offsetPercentage * (totalSize - containerSize));\n }\n }\n }]);\n\n return ScalingCellSizeAndPositionManager;\n}();\n\nexport { ScalingCellSizeAndPositionManager as default };\nimport { bpfrpt_proptype_Alignment } from \"../types\";\nimport { bpfrpt_proptype_CellSizeGetter } from \"../types\";\nimport { bpfrpt_proptype_VisibleCellRange } from \"../types\";","/**\n * Helper utility that updates the specified callback whenever any of the specified indices have changed.\n */\nexport default function createCallbackMemoizer() {\n var requireAllKeys = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;\n var cachedIndices = {};\n return function (_ref) {\n var callback = _ref.callback,\n indices = _ref.indices;\n var keys = Object.keys(indices);\n var allInitialized = !requireAllKeys || keys.every(function (key) {\n var value = indices[key];\n return Array.isArray(value) ? value.length > 0 : value >= 0;\n });\n var indexChanged = keys.length !== Object.keys(cachedIndices).length || keys.some(function (key) {\n var cachedValue = cachedIndices[key];\n var value = indices[key];\n return Array.isArray(value) ? cachedValue.join(',') !== value.join(',') : cachedValue !== value;\n });\n cachedIndices = indices;\n\n if (allInitialized && indexChanged) {\n callback(indices);\n }\n };\n}","import ScalingCellSizeAndPositionManager from './ScalingCellSizeAndPositionManager.js';\n/**\n * Helper function that determines when to update scroll offsets to ensure that a scroll-to-index remains visible.\n * This function also ensures that the scroll ofset isn't past the last column/row of cells.\n */\n\nexport default function updateScrollIndexHelper(_ref) {\n var cellSize = _ref.cellSize,\n cellSizeAndPositionManager = _ref.cellSizeAndPositionManager,\n previousCellsCount = _ref.previousCellsCount,\n previousCellSize = _ref.previousCellSize,\n previousScrollToAlignment = _ref.previousScrollToAlignment,\n previousScrollToIndex = _ref.previousScrollToIndex,\n previousSize = _ref.previousSize,\n scrollOffset = _ref.scrollOffset,\n scrollToAlignment = _ref.scrollToAlignment,\n scrollToIndex = _ref.scrollToIndex,\n size = _ref.size,\n sizeJustIncreasedFromZero = _ref.sizeJustIncreasedFromZero,\n updateScrollIndexCallback = _ref.updateScrollIndexCallback;\n var cellCount = cellSizeAndPositionManager.getCellCount();\n var hasScrollToIndex = scrollToIndex >= 0 && scrollToIndex < cellCount;\n var sizeHasChanged = size !== previousSize || sizeJustIncreasedFromZero || !previousCellSize || typeof cellSize === 'number' && cellSize !== previousCellSize; // If we have a new scroll target OR if height/row-height has changed,\n // We should ensure that the scroll target is visible.\n\n if (hasScrollToIndex && (sizeHasChanged || scrollToAlignment !== previousScrollToAlignment || scrollToIndex !== previousScrollToIndex)) {\n updateScrollIndexCallback(scrollToIndex); // If we don't have a selected item but list size or number of children have decreased,\n // Make sure we aren't scrolled too far past the current content.\n } else if (!hasScrollToIndex && cellCount > 0 && (size < previousSize || cellCount < previousCellsCount)) {\n // We need to ensure that the current scroll offset is still within the collection's range.\n // To do this, we don't need to measure everything; CellMeasurer would perform poorly.\n // Just check to make sure we're still okay.\n // Only adjust the scroll position if we've scrolled below the last set of rows.\n if (scrollOffset > cellSizeAndPositionManager.getTotalSize() - size) {\n updateScrollIndexCallback(cellCount - 1);\n }\n }\n}\nimport { bpfrpt_proptype_Alignment } from \"../types\";\nimport { bpfrpt_proptype_CellSize } from \"../types\";","export default !!(typeof window !== 'undefined' && window.document && window.document.createElement);","import canUseDOM from './canUseDOM';\nvar size;\nexport default function scrollbarSize(recalc) {\n if (!size && size !== 0 || recalc) {\n if (canUseDOM) {\n var scrollDiv = document.createElement('div');\n scrollDiv.style.position = 'absolute';\n scrollDiv.style.top = '-9999px';\n scrollDiv.style.width = '50px';\n scrollDiv.style.height = '50px';\n scrollDiv.style.overflow = 'scroll';\n document.body.appendChild(scrollDiv);\n size = scrollDiv.offsetWidth - scrollDiv.clientWidth;\n document.body.removeChild(scrollDiv);\n }\n }\n\n return size;\n}","// Properly handle server-side rendering.\nvar win;\n\nif (typeof window !== 'undefined') {\n win = window;\n} else if (typeof self !== 'undefined') {\n win = self;\n} else {\n win = {};\n} // requestAnimationFrame() shim by Paul Irish\n// http://paulirish.com/2011/requestanimationframe-for-smart-animating/\n\n\nvar request = win.requestAnimationFrame || win.webkitRequestAnimationFrame || win.mozRequestAnimationFrame || win.oRequestAnimationFrame || win.msRequestAnimationFrame || function (callback) {\n return win.setTimeout(callback, 1000 / 60);\n};\n\nvar cancel = win.cancelAnimationFrame || win.webkitCancelAnimationFrame || win.mozCancelAnimationFrame || win.oCancelAnimationFrame || win.msCancelAnimationFrame || function (id) {\n win.clearTimeout(id);\n};\n\nexport var raf = request;\nexport var caf = cancel;","import _extends from \"@babel/runtime/helpers/extends\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nvar _class, _temp;\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport * as React from 'react';\nimport clsx from 'clsx';\nimport calculateSizeAndPositionDataAndUpdateScrollOffset from './utils/calculateSizeAndPositionDataAndUpdateScrollOffset';\nimport ScalingCellSizeAndPositionManager from './utils/ScalingCellSizeAndPositionManager';\nimport createCallbackMemoizer from '../utils/createCallbackMemoizer';\nimport defaultOverscanIndicesGetter, { SCROLL_DIRECTION_BACKWARD, SCROLL_DIRECTION_FORWARD } from './defaultOverscanIndicesGetter';\nimport updateScrollIndexHelper from './utils/updateScrollIndexHelper';\nimport defaultCellRangeRenderer from './defaultCellRangeRenderer';\nimport scrollbarSize from 'dom-helpers/scrollbarSize';\nimport { polyfill } from 'react-lifecycles-compat';\nimport { requestAnimationTimeout, cancelAnimationTimeout } from '../utils/requestAnimationTimeout';\n/**\n * Specifies the number of milliseconds during which to disable pointer events while a scroll is in progress.\n * This improves performance and makes scrolling smoother.\n */\n\nexport var DEFAULT_SCROLLING_RESET_TIME_INTERVAL = 150;\n/**\n * Controls whether the Grid updates the DOM element's scrollLeft/scrollTop based on the current state or just observes it.\n * This prevents Grid from interrupting mouse-wheel animations (see issue #2).\n */\n\nvar SCROLL_POSITION_CHANGE_REASONS = {\n OBSERVED: 'observed',\n REQUESTED: 'requested'\n};\n\nvar renderNull = function renderNull() {\n return null;\n};\n\n/**\n * Renders tabular data with virtualization along the vertical and horizontal axes.\n * Row heights and column widths must be known ahead of time and specified as properties.\n */\nvar Grid = (_temp = _class =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(Grid, _React$PureComponent);\n\n // Invokes onSectionRendered callback only when start/stop row or column indices change\n function Grid(props) {\n var _this;\n\n _classCallCheck(this, Grid);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(Grid).call(this, props));\n\n _defineProperty(_assertThisInitialized(_this), \"_onGridRenderedMemoizer\", createCallbackMemoizer());\n\n _defineProperty(_assertThisInitialized(_this), \"_onScrollMemoizer\", createCallbackMemoizer(false));\n\n _defineProperty(_assertThisInitialized(_this), \"_deferredInvalidateColumnIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_deferredInvalidateRowIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_recomputeScrollLeftFlag\", false);\n\n _defineProperty(_assertThisInitialized(_this), \"_recomputeScrollTopFlag\", false);\n\n _defineProperty(_assertThisInitialized(_this), \"_horizontalScrollBarSize\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_verticalScrollBarSize\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_scrollbarPresenceChanged\", false);\n\n _defineProperty(_assertThisInitialized(_this), \"_scrollingContainer\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_childrenToDisplay\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_columnStartIndex\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_columnStopIndex\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_rowStartIndex\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_rowStopIndex\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_renderedColumnStartIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_renderedColumnStopIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_renderedRowStartIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_renderedRowStopIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_initialScrollTop\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_initialScrollLeft\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_disablePointerEventsTimeoutId\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_styleCache\", {});\n\n _defineProperty(_assertThisInitialized(_this), \"_cellCache\", {});\n\n _defineProperty(_assertThisInitialized(_this), \"_debounceScrollEndedCallback\", function () {\n _this._disablePointerEventsTimeoutId = null; // isScrolling is used to determine if we reset styleCache\n\n _this.setState({\n isScrolling: false,\n needToResetStyleCache: false\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_invokeOnGridRenderedHelper\", function () {\n var onSectionRendered = _this.props.onSectionRendered;\n\n _this._onGridRenderedMemoizer({\n callback: onSectionRendered,\n indices: {\n columnOverscanStartIndex: _this._columnStartIndex,\n columnOverscanStopIndex: _this._columnStopIndex,\n columnStartIndex: _this._renderedColumnStartIndex,\n columnStopIndex: _this._renderedColumnStopIndex,\n rowOverscanStartIndex: _this._rowStartIndex,\n rowOverscanStopIndex: _this._rowStopIndex,\n rowStartIndex: _this._renderedRowStartIndex,\n rowStopIndex: _this._renderedRowStopIndex\n }\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_setScrollingContainerRef\", function (ref) {\n _this._scrollingContainer = ref;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScroll\", function (event) {\n // In certain edge-cases React dispatches an onScroll event with an invalid target.scrollLeft / target.scrollTop.\n // This invalid event can be detected by comparing event.target to this component's scrollable DOM element.\n // See issue #404 for more information.\n if (event.target === _this._scrollingContainer) {\n _this.handleScrollEvent(event.target);\n }\n });\n\n var columnSizeAndPositionManager = new ScalingCellSizeAndPositionManager({\n cellCount: props.columnCount,\n cellSizeGetter: function cellSizeGetter(params) {\n return Grid._wrapSizeGetter(props.columnWidth)(params);\n },\n estimatedCellSize: Grid._getEstimatedColumnSize(props)\n });\n var rowSizeAndPositionManager = new ScalingCellSizeAndPositionManager({\n cellCount: props.rowCount,\n cellSizeGetter: function cellSizeGetter(params) {\n return Grid._wrapSizeGetter(props.rowHeight)(params);\n },\n estimatedCellSize: Grid._getEstimatedRowSize(props)\n });\n _this.state = {\n instanceProps: {\n columnSizeAndPositionManager: columnSizeAndPositionManager,\n rowSizeAndPositionManager: rowSizeAndPositionManager,\n prevColumnWidth: props.columnWidth,\n prevRowHeight: props.rowHeight,\n prevColumnCount: props.columnCount,\n prevRowCount: props.rowCount,\n prevIsScrolling: props.isScrolling === true,\n prevScrollToColumn: props.scrollToColumn,\n prevScrollToRow: props.scrollToRow,\n scrollbarSize: 0,\n scrollbarSizeMeasured: false\n },\n isScrolling: false,\n scrollDirectionHorizontal: SCROLL_DIRECTION_FORWARD,\n scrollDirectionVertical: SCROLL_DIRECTION_FORWARD,\n scrollLeft: 0,\n scrollTop: 0,\n scrollPositionChangeReason: null,\n needToResetStyleCache: false\n };\n\n if (props.scrollToRow > 0) {\n _this._initialScrollTop = _this._getCalculatedScrollTop(props, _this.state);\n }\n\n if (props.scrollToColumn > 0) {\n _this._initialScrollLeft = _this._getCalculatedScrollLeft(props, _this.state);\n }\n\n return _this;\n }\n /**\n * Gets offsets for a given cell and alignment.\n */\n\n\n _createClass(Grid, [{\n key: \"getOffsetForCell\",\n value: function getOffsetForCell() {\n var _ref = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},\n _ref$alignment = _ref.alignment,\n alignment = _ref$alignment === void 0 ? this.props.scrollToAlignment : _ref$alignment,\n _ref$columnIndex = _ref.columnIndex,\n columnIndex = _ref$columnIndex === void 0 ? this.props.scrollToColumn : _ref$columnIndex,\n _ref$rowIndex = _ref.rowIndex,\n rowIndex = _ref$rowIndex === void 0 ? this.props.scrollToRow : _ref$rowIndex;\n\n var offsetProps = _objectSpread({}, this.props, {\n scrollToAlignment: alignment,\n scrollToColumn: columnIndex,\n scrollToRow: rowIndex\n });\n\n return {\n scrollLeft: this._getCalculatedScrollLeft(offsetProps),\n scrollTop: this._getCalculatedScrollTop(offsetProps)\n };\n }\n /**\n * Gets estimated total rows' height.\n */\n\n }, {\n key: \"getTotalRowsHeight\",\n value: function getTotalRowsHeight() {\n return this.state.instanceProps.rowSizeAndPositionManager.getTotalSize();\n }\n /**\n * Gets estimated total columns' width.\n */\n\n }, {\n key: \"getTotalColumnsWidth\",\n value: function getTotalColumnsWidth() {\n return this.state.instanceProps.columnSizeAndPositionManager.getTotalSize();\n }\n /**\n * This method handles a scroll event originating from an external scroll control.\n * It's an advanced method and should probably not be used unless you're implementing a custom scroll-bar solution.\n */\n\n }, {\n key: \"handleScrollEvent\",\n value: function handleScrollEvent(_ref2) {\n var _ref2$scrollLeft = _ref2.scrollLeft,\n scrollLeftParam = _ref2$scrollLeft === void 0 ? 0 : _ref2$scrollLeft,\n _ref2$scrollTop = _ref2.scrollTop,\n scrollTopParam = _ref2$scrollTop === void 0 ? 0 : _ref2$scrollTop;\n\n // On iOS, we can arrive at negative offsets by swiping past the start.\n // To prevent flicker here, we make playing in the negative offset zone cause nothing to happen.\n if (scrollTopParam < 0) {\n return;\n } // Prevent pointer events from interrupting a smooth scroll\n\n\n this._debounceScrollEnded();\n\n var _this$props = this.props,\n autoHeight = _this$props.autoHeight,\n autoWidth = _this$props.autoWidth,\n height = _this$props.height,\n width = _this$props.width;\n var instanceProps = this.state.instanceProps; // When this component is shrunk drastically, React dispatches a series of back-to-back scroll events,\n // Gradually converging on a scrollTop that is within the bounds of the new, smaller height.\n // This causes a series of rapid renders that is slow for long lists.\n // We can avoid that by doing some simple bounds checking to ensure that scroll offsets never exceed their bounds.\n\n var scrollbarSize = instanceProps.scrollbarSize;\n var totalRowsHeight = instanceProps.rowSizeAndPositionManager.getTotalSize();\n var totalColumnsWidth = instanceProps.columnSizeAndPositionManager.getTotalSize();\n var scrollLeft = Math.min(Math.max(0, totalColumnsWidth - width + scrollbarSize), scrollLeftParam);\n var scrollTop = Math.min(Math.max(0, totalRowsHeight - height + scrollbarSize), scrollTopParam); // Certain devices (like Apple touchpad) rapid-fire duplicate events.\n // Don't force a re-render if this is the case.\n // The mouse may move faster then the animation frame does.\n // Use requestAnimationFrame to avoid over-updating.\n\n if (this.state.scrollLeft !== scrollLeft || this.state.scrollTop !== scrollTop) {\n // Track scrolling direction so we can more efficiently overscan rows to reduce empty space around the edges while scrolling.\n // Don't change direction for an axis unless scroll offset has changed.\n var scrollDirectionHorizontal = scrollLeft !== this.state.scrollLeft ? scrollLeft > this.state.scrollLeft ? SCROLL_DIRECTION_FORWARD : SCROLL_DIRECTION_BACKWARD : this.state.scrollDirectionHorizontal;\n var scrollDirectionVertical = scrollTop !== this.state.scrollTop ? scrollTop > this.state.scrollTop ? SCROLL_DIRECTION_FORWARD : SCROLL_DIRECTION_BACKWARD : this.state.scrollDirectionVertical;\n var newState = {\n isScrolling: true,\n scrollDirectionHorizontal: scrollDirectionHorizontal,\n scrollDirectionVertical: scrollDirectionVertical,\n scrollPositionChangeReason: SCROLL_POSITION_CHANGE_REASONS.OBSERVED\n };\n\n if (!autoHeight) {\n newState.scrollTop = scrollTop;\n }\n\n if (!autoWidth) {\n newState.scrollLeft = scrollLeft;\n }\n\n newState.needToResetStyleCache = false;\n this.setState(newState);\n }\n\n this._invokeOnScrollMemoizer({\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n totalColumnsWidth: totalColumnsWidth,\n totalRowsHeight: totalRowsHeight\n });\n }\n /**\n * Invalidate Grid size and recompute visible cells.\n * This is a deferred wrapper for recomputeGridSize().\n * It sets a flag to be evaluated on cDM/cDU to avoid unnecessary renders.\n * This method is intended for advanced use-cases like CellMeasurer.\n */\n // @TODO (bvaughn) Add automated test coverage for this.\n\n }, {\n key: \"invalidateCellSizeAfterRender\",\n value: function invalidateCellSizeAfterRender(_ref3) {\n var columnIndex = _ref3.columnIndex,\n rowIndex = _ref3.rowIndex;\n this._deferredInvalidateColumnIndex = typeof this._deferredInvalidateColumnIndex === 'number' ? Math.min(this._deferredInvalidateColumnIndex, columnIndex) : columnIndex;\n this._deferredInvalidateRowIndex = typeof this._deferredInvalidateRowIndex === 'number' ? Math.min(this._deferredInvalidateRowIndex, rowIndex) : rowIndex;\n }\n /**\n * Pre-measure all columns and rows in a Grid.\n * Typically cells are only measured as needed and estimated sizes are used for cells that have not yet been measured.\n * This method ensures that the next call to getTotalSize() returns an exact size (as opposed to just an estimated one).\n */\n\n }, {\n key: \"measureAllCells\",\n value: function measureAllCells() {\n var _this$props2 = this.props,\n columnCount = _this$props2.columnCount,\n rowCount = _this$props2.rowCount;\n var instanceProps = this.state.instanceProps;\n instanceProps.columnSizeAndPositionManager.getSizeAndPositionOfCell(columnCount - 1);\n instanceProps.rowSizeAndPositionManager.getSizeAndPositionOfCell(rowCount - 1);\n }\n /**\n * Forced recompute of row heights and column widths.\n * This function should be called if dynamic column or row sizes have changed but nothing else has.\n * Since Grid only receives :columnCount and :rowCount it has no way of detecting when the underlying data changes.\n */\n\n }, {\n key: \"recomputeGridSize\",\n value: function recomputeGridSize() {\n var _ref4 = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},\n _ref4$columnIndex = _ref4.columnIndex,\n columnIndex = _ref4$columnIndex === void 0 ? 0 : _ref4$columnIndex,\n _ref4$rowIndex = _ref4.rowIndex,\n rowIndex = _ref4$rowIndex === void 0 ? 0 : _ref4$rowIndex;\n\n var _this$props3 = this.props,\n scrollToColumn = _this$props3.scrollToColumn,\n scrollToRow = _this$props3.scrollToRow;\n var instanceProps = this.state.instanceProps;\n instanceProps.columnSizeAndPositionManager.resetCell(columnIndex);\n instanceProps.rowSizeAndPositionManager.resetCell(rowIndex); // Cell sizes may be determined by a function property.\n // In this case the cDU handler can't know if they changed.\n // Store this flag to let the next cDU pass know it needs to recompute the scroll offset.\n\n this._recomputeScrollLeftFlag = scrollToColumn >= 0 && (this.state.scrollDirectionHorizontal === SCROLL_DIRECTION_FORWARD ? columnIndex <= scrollToColumn : columnIndex >= scrollToColumn);\n this._recomputeScrollTopFlag = scrollToRow >= 0 && (this.state.scrollDirectionVertical === SCROLL_DIRECTION_FORWARD ? rowIndex <= scrollToRow : rowIndex >= scrollToRow); // Clear cell cache in case we are scrolling;\n // Invalid row heights likely mean invalid cached content as well.\n\n this._styleCache = {};\n this._cellCache = {};\n this.forceUpdate();\n }\n /**\n * Ensure column and row are visible.\n */\n\n }, {\n key: \"scrollToCell\",\n value: function scrollToCell(_ref5) {\n var columnIndex = _ref5.columnIndex,\n rowIndex = _ref5.rowIndex;\n var columnCount = this.props.columnCount;\n var props = this.props; // Don't adjust scroll offset for single-column grids (eg List, Table).\n // This can cause a funky scroll offset because of the vertical scrollbar width.\n\n if (columnCount > 1 && columnIndex !== undefined) {\n this._updateScrollLeftForScrollToColumn(_objectSpread({}, props, {\n scrollToColumn: columnIndex\n }));\n }\n\n if (rowIndex !== undefined) {\n this._updateScrollTopForScrollToRow(_objectSpread({}, props, {\n scrollToRow: rowIndex\n }));\n }\n }\n }, {\n key: \"componentDidMount\",\n value: function componentDidMount() {\n var _this$props4 = this.props,\n getScrollbarSize = _this$props4.getScrollbarSize,\n height = _this$props4.height,\n scrollLeft = _this$props4.scrollLeft,\n scrollToColumn = _this$props4.scrollToColumn,\n scrollTop = _this$props4.scrollTop,\n scrollToRow = _this$props4.scrollToRow,\n width = _this$props4.width;\n var instanceProps = this.state.instanceProps; // Reset initial offsets to be ignored in browser\n\n this._initialScrollTop = 0;\n this._initialScrollLeft = 0; // If cell sizes have been invalidated (eg we are using CellMeasurer) then reset cached positions.\n // We must do this at the start of the method as we may calculate and update scroll position below.\n\n this._handleInvalidatedGridSize(); // If this component was first rendered server-side, scrollbar size will be undefined.\n // In that event we need to remeasure.\n\n\n if (!instanceProps.scrollbarSizeMeasured) {\n this.setState(function (prevState) {\n var stateUpdate = _objectSpread({}, prevState, {\n needToResetStyleCache: false\n });\n\n stateUpdate.instanceProps.scrollbarSize = getScrollbarSize();\n stateUpdate.instanceProps.scrollbarSizeMeasured = true;\n return stateUpdate;\n });\n }\n\n if (typeof scrollLeft === 'number' && scrollLeft >= 0 || typeof scrollTop === 'number' && scrollTop >= 0) {\n var stateUpdate = Grid._getScrollToPositionStateUpdate({\n prevState: this.state,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n });\n\n if (stateUpdate) {\n stateUpdate.needToResetStyleCache = false;\n this.setState(stateUpdate);\n }\n } // refs don't work in `react-test-renderer`\n\n\n if (this._scrollingContainer) {\n // setting the ref's scrollLeft and scrollTop.\n // Somehow in MultiGrid the main grid doesn't trigger a update on mount.\n if (this._scrollingContainer.scrollLeft !== this.state.scrollLeft) {\n this._scrollingContainer.scrollLeft = this.state.scrollLeft;\n }\n\n if (this._scrollingContainer.scrollTop !== this.state.scrollTop) {\n this._scrollingContainer.scrollTop = this.state.scrollTop;\n }\n } // Don't update scroll offset if the size is 0; we don't render any cells in this case.\n // Setting a state may cause us to later thing we've updated the offce when we haven't.\n\n\n var sizeIsBiggerThanZero = height > 0 && width > 0;\n\n if (scrollToColumn >= 0 && sizeIsBiggerThanZero) {\n this._updateScrollLeftForScrollToColumn();\n }\n\n if (scrollToRow >= 0 && sizeIsBiggerThanZero) {\n this._updateScrollTopForScrollToRow();\n } // Update onRowsRendered callback\n\n\n this._invokeOnGridRenderedHelper(); // Initialize onScroll callback\n\n\n this._invokeOnScrollMemoizer({\n scrollLeft: scrollLeft || 0,\n scrollTop: scrollTop || 0,\n totalColumnsWidth: instanceProps.columnSizeAndPositionManager.getTotalSize(),\n totalRowsHeight: instanceProps.rowSizeAndPositionManager.getTotalSize()\n });\n\n this._maybeCallOnScrollbarPresenceChange();\n }\n /**\n * @private\n * This method updates scrollLeft/scrollTop in state for the following conditions:\n * 1) New scroll-to-cell props have been set\n */\n\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps, prevState) {\n var _this2 = this;\n\n var _this$props5 = this.props,\n autoHeight = _this$props5.autoHeight,\n autoWidth = _this$props5.autoWidth,\n columnCount = _this$props5.columnCount,\n height = _this$props5.height,\n rowCount = _this$props5.rowCount,\n scrollToAlignment = _this$props5.scrollToAlignment,\n scrollToColumn = _this$props5.scrollToColumn,\n scrollToRow = _this$props5.scrollToRow,\n width = _this$props5.width;\n var _this$state = this.state,\n scrollLeft = _this$state.scrollLeft,\n scrollPositionChangeReason = _this$state.scrollPositionChangeReason,\n scrollTop = _this$state.scrollTop,\n instanceProps = _this$state.instanceProps; // If cell sizes have been invalidated (eg we are using CellMeasurer) then reset cached positions.\n // We must do this at the start of the method as we may calculate and update scroll position below.\n\n this._handleInvalidatedGridSize(); // Handle edge case where column or row count has only just increased over 0.\n // In this case we may have to restore a previously-specified scroll offset.\n // For more info see bvaughn/react-virtualized/issues/218\n\n\n var columnOrRowCountJustIncreasedFromZero = columnCount > 0 && prevProps.columnCount === 0 || rowCount > 0 && prevProps.rowCount === 0; // Make sure requested changes to :scrollLeft or :scrollTop get applied.\n // Assigning to scrollLeft/scrollTop tells the browser to interrupt any running scroll animations,\n // And to discard any pending async changes to the scroll position that may have happened in the meantime (e.g. on a separate scrolling thread).\n // So we only set these when we require an adjustment of the scroll position.\n // See issue #2 for more information.\n\n if (scrollPositionChangeReason === SCROLL_POSITION_CHANGE_REASONS.REQUESTED) {\n // @TRICKY :autoHeight and :autoWidth properties instructs Grid to leave :scrollTop and :scrollLeft management to an external HOC (eg WindowScroller).\n // In this case we should avoid checking scrollingContainer.scrollTop and scrollingContainer.scrollLeft since it forces layout/flow.\n if (!autoWidth && scrollLeft >= 0 && (scrollLeft !== this._scrollingContainer.scrollLeft || columnOrRowCountJustIncreasedFromZero)) {\n this._scrollingContainer.scrollLeft = scrollLeft;\n }\n\n if (!autoHeight && scrollTop >= 0 && (scrollTop !== this._scrollingContainer.scrollTop || columnOrRowCountJustIncreasedFromZero)) {\n this._scrollingContainer.scrollTop = scrollTop;\n }\n } // Special case where the previous size was 0:\n // In this case we don't show any windowed cells at all.\n // So we should always recalculate offset afterwards.\n\n\n var sizeJustIncreasedFromZero = (prevProps.width === 0 || prevProps.height === 0) && height > 0 && width > 0; // Update scroll offsets if the current :scrollToColumn or :scrollToRow values requires it\n // @TODO Do we also need this check or can the one in componentWillUpdate() suffice?\n\n if (this._recomputeScrollLeftFlag) {\n this._recomputeScrollLeftFlag = false;\n\n this._updateScrollLeftForScrollToColumn(this.props);\n } else {\n updateScrollIndexHelper({\n cellSizeAndPositionManager: instanceProps.columnSizeAndPositionManager,\n previousCellsCount: prevProps.columnCount,\n previousCellSize: prevProps.columnWidth,\n previousScrollToAlignment: prevProps.scrollToAlignment,\n previousScrollToIndex: prevProps.scrollToColumn,\n previousSize: prevProps.width,\n scrollOffset: scrollLeft,\n scrollToAlignment: scrollToAlignment,\n scrollToIndex: scrollToColumn,\n size: width,\n sizeJustIncreasedFromZero: sizeJustIncreasedFromZero,\n updateScrollIndexCallback: function updateScrollIndexCallback() {\n return _this2._updateScrollLeftForScrollToColumn(_this2.props);\n }\n });\n }\n\n if (this._recomputeScrollTopFlag) {\n this._recomputeScrollTopFlag = false;\n\n this._updateScrollTopForScrollToRow(this.props);\n } else {\n updateScrollIndexHelper({\n cellSizeAndPositionManager: instanceProps.rowSizeAndPositionManager,\n previousCellsCount: prevProps.rowCount,\n previousCellSize: prevProps.rowHeight,\n previousScrollToAlignment: prevProps.scrollToAlignment,\n previousScrollToIndex: prevProps.scrollToRow,\n previousSize: prevProps.height,\n scrollOffset: scrollTop,\n scrollToAlignment: scrollToAlignment,\n scrollToIndex: scrollToRow,\n size: height,\n sizeJustIncreasedFromZero: sizeJustIncreasedFromZero,\n updateScrollIndexCallback: function updateScrollIndexCallback() {\n return _this2._updateScrollTopForScrollToRow(_this2.props);\n }\n });\n } // Update onRowsRendered callback if start/stop indices have changed\n\n\n this._invokeOnGridRenderedHelper(); // Changes to :scrollLeft or :scrollTop should also notify :onScroll listeners\n\n\n if (scrollLeft !== prevState.scrollLeft || scrollTop !== prevState.scrollTop) {\n var totalRowsHeight = instanceProps.rowSizeAndPositionManager.getTotalSize();\n var totalColumnsWidth = instanceProps.columnSizeAndPositionManager.getTotalSize();\n\n this._invokeOnScrollMemoizer({\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n totalColumnsWidth: totalColumnsWidth,\n totalRowsHeight: totalRowsHeight\n });\n }\n\n this._maybeCallOnScrollbarPresenceChange();\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n if (this._disablePointerEventsTimeoutId) {\n cancelAnimationTimeout(this._disablePointerEventsTimeoutId);\n }\n }\n /**\n * This method updates scrollLeft/scrollTop in state for the following conditions:\n * 1) Empty content (0 rows or columns)\n * 2) New scroll props overriding the current state\n * 3) Cells-count or cells-size has changed, making previous scroll offsets invalid\n */\n\n }, {\n key: \"render\",\n value: function render() {\n var _this$props6 = this.props,\n autoContainerWidth = _this$props6.autoContainerWidth,\n autoHeight = _this$props6.autoHeight,\n autoWidth = _this$props6.autoWidth,\n className = _this$props6.className,\n containerProps = _this$props6.containerProps,\n containerRole = _this$props6.containerRole,\n containerStyle = _this$props6.containerStyle,\n height = _this$props6.height,\n id = _this$props6.id,\n noContentRenderer = _this$props6.noContentRenderer,\n role = _this$props6.role,\n style = _this$props6.style,\n tabIndex = _this$props6.tabIndex,\n width = _this$props6.width;\n var _this$state2 = this.state,\n instanceProps = _this$state2.instanceProps,\n needToResetStyleCache = _this$state2.needToResetStyleCache;\n\n var isScrolling = this._isScrolling();\n\n var gridStyle = {\n boxSizing: 'border-box',\n direction: 'ltr',\n height: autoHeight ? 'auto' : height,\n position: 'relative',\n width: autoWidth ? 'auto' : width,\n WebkitOverflowScrolling: 'touch',\n willChange: 'transform'\n };\n\n if (needToResetStyleCache) {\n this._styleCache = {};\n } // calculate _styleCache here\n // if state.isScrolling (not from _isScrolling) then reset\n\n\n if (!this.state.isScrolling) {\n this._resetStyleCache();\n } // calculate children to render here\n\n\n this._calculateChildrenToRender(this.props, this.state);\n\n var totalColumnsWidth = instanceProps.columnSizeAndPositionManager.getTotalSize();\n var totalRowsHeight = instanceProps.rowSizeAndPositionManager.getTotalSize(); // Force browser to hide scrollbars when we know they aren't necessary.\n // Otherwise once scrollbars appear they may not disappear again.\n // For more info see issue #116\n\n var verticalScrollBarSize = totalRowsHeight > height ? instanceProps.scrollbarSize : 0;\n var horizontalScrollBarSize = totalColumnsWidth > width ? instanceProps.scrollbarSize : 0;\n\n if (horizontalScrollBarSize !== this._horizontalScrollBarSize || verticalScrollBarSize !== this._verticalScrollBarSize) {\n this._horizontalScrollBarSize = horizontalScrollBarSize;\n this._verticalScrollBarSize = verticalScrollBarSize;\n this._scrollbarPresenceChanged = true;\n } // Also explicitly init styles to 'auto' if scrollbars are required.\n // This works around an obscure edge case where external CSS styles have not yet been loaded,\n // But an initial scroll index of offset is set as an external prop.\n // Without this style, Grid would render the correct range of cells but would NOT update its internal offset.\n // This was originally reported via clauderic/react-infinite-calendar/issues/23\n\n\n gridStyle.overflowX = totalColumnsWidth + verticalScrollBarSize <= width ? 'hidden' : 'auto';\n gridStyle.overflowY = totalRowsHeight + horizontalScrollBarSize <= height ? 'hidden' : 'auto';\n var childrenToDisplay = this._childrenToDisplay;\n var showNoContentRenderer = childrenToDisplay.length === 0 && height > 0 && width > 0;\n return React.createElement(\"div\", _extends({\n ref: this._setScrollingContainerRef\n }, containerProps, {\n \"aria-label\": this.props['aria-label'],\n \"aria-readonly\": this.props['aria-readonly'],\n className: clsx('ReactVirtualized__Grid', className),\n id: id,\n onScroll: this._onScroll,\n role: role,\n style: _objectSpread({}, gridStyle, {}, style),\n tabIndex: tabIndex\n }), childrenToDisplay.length > 0 && React.createElement(\"div\", {\n className: \"ReactVirtualized__Grid__innerScrollContainer\",\n role: containerRole,\n style: _objectSpread({\n width: autoContainerWidth ? 'auto' : totalColumnsWidth,\n height: totalRowsHeight,\n maxWidth: totalColumnsWidth,\n maxHeight: totalRowsHeight,\n overflow: 'hidden',\n pointerEvents: isScrolling ? 'none' : '',\n position: 'relative'\n }, containerStyle)\n }, childrenToDisplay), showNoContentRenderer && noContentRenderer());\n }\n /* ---------------------------- Helper methods ---------------------------- */\n\n }, {\n key: \"_calculateChildrenToRender\",\n value: function _calculateChildrenToRender() {\n var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;\n var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;\n var cellRenderer = props.cellRenderer,\n cellRangeRenderer = props.cellRangeRenderer,\n columnCount = props.columnCount,\n deferredMeasurementCache = props.deferredMeasurementCache,\n height = props.height,\n overscanColumnCount = props.overscanColumnCount,\n overscanIndicesGetter = props.overscanIndicesGetter,\n overscanRowCount = props.overscanRowCount,\n rowCount = props.rowCount,\n width = props.width,\n isScrollingOptOut = props.isScrollingOptOut;\n var scrollDirectionHorizontal = state.scrollDirectionHorizontal,\n scrollDirectionVertical = state.scrollDirectionVertical,\n instanceProps = state.instanceProps;\n var scrollTop = this._initialScrollTop > 0 ? this._initialScrollTop : state.scrollTop;\n var scrollLeft = this._initialScrollLeft > 0 ? this._initialScrollLeft : state.scrollLeft;\n\n var isScrolling = this._isScrolling(props, state);\n\n this._childrenToDisplay = []; // Render only enough columns and rows to cover the visible area of the grid.\n\n if (height > 0 && width > 0) {\n var visibleColumnIndices = instanceProps.columnSizeAndPositionManager.getVisibleCellRange({\n containerSize: width,\n offset: scrollLeft\n });\n var visibleRowIndices = instanceProps.rowSizeAndPositionManager.getVisibleCellRange({\n containerSize: height,\n offset: scrollTop\n });\n var horizontalOffsetAdjustment = instanceProps.columnSizeAndPositionManager.getOffsetAdjustment({\n containerSize: width,\n offset: scrollLeft\n });\n var verticalOffsetAdjustment = instanceProps.rowSizeAndPositionManager.getOffsetAdjustment({\n containerSize: height,\n offset: scrollTop\n }); // Store for _invokeOnGridRenderedHelper()\n\n this._renderedColumnStartIndex = visibleColumnIndices.start;\n this._renderedColumnStopIndex = visibleColumnIndices.stop;\n this._renderedRowStartIndex = visibleRowIndices.start;\n this._renderedRowStopIndex = visibleRowIndices.stop;\n var overscanColumnIndices = overscanIndicesGetter({\n direction: 'horizontal',\n cellCount: columnCount,\n overscanCellsCount: overscanColumnCount,\n scrollDirection: scrollDirectionHorizontal,\n startIndex: typeof visibleColumnIndices.start === 'number' ? visibleColumnIndices.start : 0,\n stopIndex: typeof visibleColumnIndices.stop === 'number' ? visibleColumnIndices.stop : -1\n });\n var overscanRowIndices = overscanIndicesGetter({\n direction: 'vertical',\n cellCount: rowCount,\n overscanCellsCount: overscanRowCount,\n scrollDirection: scrollDirectionVertical,\n startIndex: typeof visibleRowIndices.start === 'number' ? visibleRowIndices.start : 0,\n stopIndex: typeof visibleRowIndices.stop === 'number' ? visibleRowIndices.stop : -1\n }); // Store for _invokeOnGridRenderedHelper()\n\n var columnStartIndex = overscanColumnIndices.overscanStartIndex;\n var columnStopIndex = overscanColumnIndices.overscanStopIndex;\n var rowStartIndex = overscanRowIndices.overscanStartIndex;\n var rowStopIndex = overscanRowIndices.overscanStopIndex; // Advanced use-cases (eg CellMeasurer) require batched measurements to determine accurate sizes.\n\n if (deferredMeasurementCache) {\n // If rows have a dynamic height, scan the rows we are about to render.\n // If any have not yet been measured, then we need to render all columns initially,\n // Because the height of the row is equal to the tallest cell within that row,\n // (And so we can't know the height without measuring all column-cells first).\n if (!deferredMeasurementCache.hasFixedHeight()) {\n for (var rowIndex = rowStartIndex; rowIndex <= rowStopIndex; rowIndex++) {\n if (!deferredMeasurementCache.has(rowIndex, 0)) {\n columnStartIndex = 0;\n columnStopIndex = columnCount - 1;\n break;\n }\n }\n } // If columns have a dynamic width, scan the columns we are about to render.\n // If any have not yet been measured, then we need to render all rows initially,\n // Because the width of the column is equal to the widest cell within that column,\n // (And so we can't know the width without measuring all row-cells first).\n\n\n if (!deferredMeasurementCache.hasFixedWidth()) {\n for (var columnIndex = columnStartIndex; columnIndex <= columnStopIndex; columnIndex++) {\n if (!deferredMeasurementCache.has(0, columnIndex)) {\n rowStartIndex = 0;\n rowStopIndex = rowCount - 1;\n break;\n }\n }\n }\n }\n\n this._childrenToDisplay = cellRangeRenderer({\n cellCache: this._cellCache,\n cellRenderer: cellRenderer,\n columnSizeAndPositionManager: instanceProps.columnSizeAndPositionManager,\n columnStartIndex: columnStartIndex,\n columnStopIndex: columnStopIndex,\n deferredMeasurementCache: deferredMeasurementCache,\n horizontalOffsetAdjustment: horizontalOffsetAdjustment,\n isScrolling: isScrolling,\n isScrollingOptOut: isScrollingOptOut,\n parent: this,\n rowSizeAndPositionManager: instanceProps.rowSizeAndPositionManager,\n rowStartIndex: rowStartIndex,\n rowStopIndex: rowStopIndex,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n styleCache: this._styleCache,\n verticalOffsetAdjustment: verticalOffsetAdjustment,\n visibleColumnIndices: visibleColumnIndices,\n visibleRowIndices: visibleRowIndices\n }); // update the indices\n\n this._columnStartIndex = columnStartIndex;\n this._columnStopIndex = columnStopIndex;\n this._rowStartIndex = rowStartIndex;\n this._rowStopIndex = rowStopIndex;\n }\n }\n /**\n * Sets an :isScrolling flag for a small window of time.\n * This flag is used to disable pointer events on the scrollable portion of the Grid.\n * This prevents jerky/stuttery mouse-wheel scrolling.\n */\n\n }, {\n key: \"_debounceScrollEnded\",\n value: function _debounceScrollEnded() {\n var scrollingResetTimeInterval = this.props.scrollingResetTimeInterval;\n\n if (this._disablePointerEventsTimeoutId) {\n cancelAnimationTimeout(this._disablePointerEventsTimeoutId);\n }\n\n this._disablePointerEventsTimeoutId = requestAnimationTimeout(this._debounceScrollEndedCallback, scrollingResetTimeInterval);\n }\n }, {\n key: \"_handleInvalidatedGridSize\",\n\n /**\n * Check for batched CellMeasurer size invalidations.\n * This will occur the first time one or more previously unmeasured cells are rendered.\n */\n value: function _handleInvalidatedGridSize() {\n if (typeof this._deferredInvalidateColumnIndex === 'number' && typeof this._deferredInvalidateRowIndex === 'number') {\n var columnIndex = this._deferredInvalidateColumnIndex;\n var rowIndex = this._deferredInvalidateRowIndex;\n this._deferredInvalidateColumnIndex = null;\n this._deferredInvalidateRowIndex = null;\n this.recomputeGridSize({\n columnIndex: columnIndex,\n rowIndex: rowIndex\n });\n }\n }\n }, {\n key: \"_invokeOnScrollMemoizer\",\n value: function _invokeOnScrollMemoizer(_ref6) {\n var _this3 = this;\n\n var scrollLeft = _ref6.scrollLeft,\n scrollTop = _ref6.scrollTop,\n totalColumnsWidth = _ref6.totalColumnsWidth,\n totalRowsHeight = _ref6.totalRowsHeight;\n\n this._onScrollMemoizer({\n callback: function callback(_ref7) {\n var scrollLeft = _ref7.scrollLeft,\n scrollTop = _ref7.scrollTop;\n var _this3$props = _this3.props,\n height = _this3$props.height,\n onScroll = _this3$props.onScroll,\n width = _this3$props.width;\n onScroll({\n clientHeight: height,\n clientWidth: width,\n scrollHeight: totalRowsHeight,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n scrollWidth: totalColumnsWidth\n });\n },\n indices: {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n }\n });\n }\n }, {\n key: \"_isScrolling\",\n value: function _isScrolling() {\n var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;\n var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;\n // If isScrolling is defined in props, use it to override the value in state\n // This is a performance optimization for WindowScroller + Grid\n return Object.hasOwnProperty.call(props, 'isScrolling') ? Boolean(props.isScrolling) : Boolean(state.isScrolling);\n }\n }, {\n key: \"_maybeCallOnScrollbarPresenceChange\",\n value: function _maybeCallOnScrollbarPresenceChange() {\n if (this._scrollbarPresenceChanged) {\n var onScrollbarPresenceChange = this.props.onScrollbarPresenceChange;\n this._scrollbarPresenceChanged = false;\n onScrollbarPresenceChange({\n horizontal: this._horizontalScrollBarSize > 0,\n size: this.state.instanceProps.scrollbarSize,\n vertical: this._verticalScrollBarSize > 0\n });\n }\n }\n }, {\n key: \"scrollToPosition\",\n\n /**\n * Scroll to the specified offset(s).\n * Useful for animating position changes.\n */\n value: function scrollToPosition(_ref8) {\n var scrollLeft = _ref8.scrollLeft,\n scrollTop = _ref8.scrollTop;\n\n var stateUpdate = Grid._getScrollToPositionStateUpdate({\n prevState: this.state,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n });\n\n if (stateUpdate) {\n stateUpdate.needToResetStyleCache = false;\n this.setState(stateUpdate);\n }\n }\n }, {\n key: \"_getCalculatedScrollLeft\",\n value: function _getCalculatedScrollLeft() {\n var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;\n var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;\n return Grid._getCalculatedScrollLeft(props, state);\n }\n }, {\n key: \"_updateScrollLeftForScrollToColumn\",\n value: function _updateScrollLeftForScrollToColumn() {\n var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;\n var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;\n\n var stateUpdate = Grid._getScrollLeftForScrollToColumnStateUpdate(props, state);\n\n if (stateUpdate) {\n stateUpdate.needToResetStyleCache = false;\n this.setState(stateUpdate);\n }\n }\n }, {\n key: \"_getCalculatedScrollTop\",\n value: function _getCalculatedScrollTop() {\n var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;\n var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;\n return Grid._getCalculatedScrollTop(props, state);\n }\n }, {\n key: \"_resetStyleCache\",\n value: function _resetStyleCache() {\n var styleCache = this._styleCache;\n var cellCache = this._cellCache;\n var isScrollingOptOut = this.props.isScrollingOptOut; // Reset cell and style caches once scrolling stops.\n // This makes Grid simpler to use (since cells commonly change).\n // And it keeps the caches from growing too large.\n // Performance is most sensitive when a user is scrolling.\n // Don't clear visible cells from cellCache if isScrollingOptOut is specified.\n // This keeps the cellCache to a resonable size.\n\n this._cellCache = {};\n this._styleCache = {}; // Copy over the visible cell styles so avoid unnecessary re-render.\n\n for (var rowIndex = this._rowStartIndex; rowIndex <= this._rowStopIndex; rowIndex++) {\n for (var columnIndex = this._columnStartIndex; columnIndex <= this._columnStopIndex; columnIndex++) {\n var key = \"\".concat(rowIndex, \"-\").concat(columnIndex);\n this._styleCache[key] = styleCache[key];\n\n if (isScrollingOptOut) {\n this._cellCache[key] = cellCache[key];\n }\n }\n }\n }\n }, {\n key: \"_updateScrollTopForScrollToRow\",\n value: function _updateScrollTopForScrollToRow() {\n var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;\n var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;\n\n var stateUpdate = Grid._getScrollTopForScrollToRowStateUpdate(props, state);\n\n if (stateUpdate) {\n stateUpdate.needToResetStyleCache = false;\n this.setState(stateUpdate);\n }\n }\n }], [{\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n var newState = {};\n\n if (nextProps.columnCount === 0 && prevState.scrollLeft !== 0 || nextProps.rowCount === 0 && prevState.scrollTop !== 0) {\n newState.scrollLeft = 0;\n newState.scrollTop = 0; // only use scroll{Left,Top} from props if scrollTo{Column,Row} isn't specified\n // scrollTo{Column,Row} should override scroll{Left,Top}\n } else if (nextProps.scrollLeft !== prevState.scrollLeft && nextProps.scrollToColumn < 0 || nextProps.scrollTop !== prevState.scrollTop && nextProps.scrollToRow < 0) {\n Object.assign(newState, Grid._getScrollToPositionStateUpdate({\n prevState: prevState,\n scrollLeft: nextProps.scrollLeft,\n scrollTop: nextProps.scrollTop\n }));\n }\n\n var instanceProps = prevState.instanceProps; // Initially we should not clearStyleCache\n\n newState.needToResetStyleCache = false;\n\n if (nextProps.columnWidth !== instanceProps.prevColumnWidth || nextProps.rowHeight !== instanceProps.prevRowHeight) {\n // Reset cache. set it to {} in render\n newState.needToResetStyleCache = true;\n }\n\n instanceProps.columnSizeAndPositionManager.configure({\n cellCount: nextProps.columnCount,\n estimatedCellSize: Grid._getEstimatedColumnSize(nextProps),\n cellSizeGetter: Grid._wrapSizeGetter(nextProps.columnWidth)\n });\n instanceProps.rowSizeAndPositionManager.configure({\n cellCount: nextProps.rowCount,\n estimatedCellSize: Grid._getEstimatedRowSize(nextProps),\n cellSizeGetter: Grid._wrapSizeGetter(nextProps.rowHeight)\n });\n\n if (instanceProps.prevColumnCount === 0 || instanceProps.prevRowCount === 0) {\n instanceProps.prevColumnCount = 0;\n instanceProps.prevRowCount = 0;\n } // If scrolling is controlled outside this component, clear cache when scrolling stops\n\n\n if (nextProps.autoHeight && nextProps.isScrolling === false && instanceProps.prevIsScrolling === true) {\n Object.assign(newState, {\n isScrolling: false\n });\n }\n\n var maybeStateA;\n var maybeStateB;\n calculateSizeAndPositionDataAndUpdateScrollOffset({\n cellCount: instanceProps.prevColumnCount,\n cellSize: typeof instanceProps.prevColumnWidth === 'number' ? instanceProps.prevColumnWidth : null,\n computeMetadataCallback: function computeMetadataCallback() {\n return instanceProps.columnSizeAndPositionManager.resetCell(0);\n },\n computeMetadataCallbackProps: nextProps,\n nextCellsCount: nextProps.columnCount,\n nextCellSize: typeof nextProps.columnWidth === 'number' ? nextProps.columnWidth : null,\n nextScrollToIndex: nextProps.scrollToColumn,\n scrollToIndex: instanceProps.prevScrollToColumn,\n updateScrollOffsetForScrollToIndex: function updateScrollOffsetForScrollToIndex() {\n maybeStateA = Grid._getScrollLeftForScrollToColumnStateUpdate(nextProps, prevState);\n }\n });\n calculateSizeAndPositionDataAndUpdateScrollOffset({\n cellCount: instanceProps.prevRowCount,\n cellSize: typeof instanceProps.prevRowHeight === 'number' ? instanceProps.prevRowHeight : null,\n computeMetadataCallback: function computeMetadataCallback() {\n return instanceProps.rowSizeAndPositionManager.resetCell(0);\n },\n computeMetadataCallbackProps: nextProps,\n nextCellsCount: nextProps.rowCount,\n nextCellSize: typeof nextProps.rowHeight === 'number' ? nextProps.rowHeight : null,\n nextScrollToIndex: nextProps.scrollToRow,\n scrollToIndex: instanceProps.prevScrollToRow,\n updateScrollOffsetForScrollToIndex: function updateScrollOffsetForScrollToIndex() {\n maybeStateB = Grid._getScrollTopForScrollToRowStateUpdate(nextProps, prevState);\n }\n });\n instanceProps.prevColumnCount = nextProps.columnCount;\n instanceProps.prevColumnWidth = nextProps.columnWidth;\n instanceProps.prevIsScrolling = nextProps.isScrolling === true;\n instanceProps.prevRowCount = nextProps.rowCount;\n instanceProps.prevRowHeight = nextProps.rowHeight;\n instanceProps.prevScrollToColumn = nextProps.scrollToColumn;\n instanceProps.prevScrollToRow = nextProps.scrollToRow; // getting scrollBarSize (moved from componentWillMount)\n\n instanceProps.scrollbarSize = nextProps.getScrollbarSize();\n\n if (instanceProps.scrollbarSize === undefined) {\n instanceProps.scrollbarSizeMeasured = false;\n instanceProps.scrollbarSize = 0;\n } else {\n instanceProps.scrollbarSizeMeasured = true;\n }\n\n newState.instanceProps = instanceProps;\n return _objectSpread({}, newState, {}, maybeStateA, {}, maybeStateB);\n }\n }, {\n key: \"_getEstimatedColumnSize\",\n value: function _getEstimatedColumnSize(props) {\n return typeof props.columnWidth === 'number' ? props.columnWidth : props.estimatedColumnSize;\n }\n }, {\n key: \"_getEstimatedRowSize\",\n value: function _getEstimatedRowSize(props) {\n return typeof props.rowHeight === 'number' ? props.rowHeight : props.estimatedRowSize;\n }\n }, {\n key: \"_getScrollToPositionStateUpdate\",\n\n /**\n * Get the updated state after scrolling to\n * scrollLeft and scrollTop\n */\n value: function _getScrollToPositionStateUpdate(_ref9) {\n var prevState = _ref9.prevState,\n scrollLeft = _ref9.scrollLeft,\n scrollTop = _ref9.scrollTop;\n var newState = {\n scrollPositionChangeReason: SCROLL_POSITION_CHANGE_REASONS.REQUESTED\n };\n\n if (typeof scrollLeft === 'number' && scrollLeft >= 0) {\n newState.scrollDirectionHorizontal = scrollLeft > prevState.scrollLeft ? SCROLL_DIRECTION_FORWARD : SCROLL_DIRECTION_BACKWARD;\n newState.scrollLeft = scrollLeft;\n }\n\n if (typeof scrollTop === 'number' && scrollTop >= 0) {\n newState.scrollDirectionVertical = scrollTop > prevState.scrollTop ? SCROLL_DIRECTION_FORWARD : SCROLL_DIRECTION_BACKWARD;\n newState.scrollTop = scrollTop;\n }\n\n if (typeof scrollLeft === 'number' && scrollLeft >= 0 && scrollLeft !== prevState.scrollLeft || typeof scrollTop === 'number' && scrollTop >= 0 && scrollTop !== prevState.scrollTop) {\n return newState;\n }\n\n return {};\n }\n }, {\n key: \"_wrapSizeGetter\",\n value: function _wrapSizeGetter(value) {\n return typeof value === 'function' ? value : function () {\n return value;\n };\n }\n }, {\n key: \"_getCalculatedScrollLeft\",\n value: function _getCalculatedScrollLeft(nextProps, prevState) {\n var columnCount = nextProps.columnCount,\n height = nextProps.height,\n scrollToAlignment = nextProps.scrollToAlignment,\n scrollToColumn = nextProps.scrollToColumn,\n width = nextProps.width;\n var scrollLeft = prevState.scrollLeft,\n instanceProps = prevState.instanceProps;\n\n if (columnCount > 0) {\n var finalColumn = columnCount - 1;\n var targetIndex = scrollToColumn < 0 ? finalColumn : Math.min(finalColumn, scrollToColumn);\n var totalRowsHeight = instanceProps.rowSizeAndPositionManager.getTotalSize();\n var scrollBarSize = instanceProps.scrollbarSizeMeasured && totalRowsHeight > height ? instanceProps.scrollbarSize : 0;\n return instanceProps.columnSizeAndPositionManager.getUpdatedOffsetForIndex({\n align: scrollToAlignment,\n containerSize: width - scrollBarSize,\n currentOffset: scrollLeft,\n targetIndex: targetIndex\n });\n }\n\n return 0;\n }\n }, {\n key: \"_getScrollLeftForScrollToColumnStateUpdate\",\n value: function _getScrollLeftForScrollToColumnStateUpdate(nextProps, prevState) {\n var scrollLeft = prevState.scrollLeft;\n\n var calculatedScrollLeft = Grid._getCalculatedScrollLeft(nextProps, prevState);\n\n if (typeof calculatedScrollLeft === 'number' && calculatedScrollLeft >= 0 && scrollLeft !== calculatedScrollLeft) {\n return Grid._getScrollToPositionStateUpdate({\n prevState: prevState,\n scrollLeft: calculatedScrollLeft,\n scrollTop: -1\n });\n }\n\n return {};\n }\n }, {\n key: \"_getCalculatedScrollTop\",\n value: function _getCalculatedScrollTop(nextProps, prevState) {\n var height = nextProps.height,\n rowCount = nextProps.rowCount,\n scrollToAlignment = nextProps.scrollToAlignment,\n scrollToRow = nextProps.scrollToRow,\n width = nextProps.width;\n var scrollTop = prevState.scrollTop,\n instanceProps = prevState.instanceProps;\n\n if (rowCount > 0) {\n var finalRow = rowCount - 1;\n var targetIndex = scrollToRow < 0 ? finalRow : Math.min(finalRow, scrollToRow);\n var totalColumnsWidth = instanceProps.columnSizeAndPositionManager.getTotalSize();\n var scrollBarSize = instanceProps.scrollbarSizeMeasured && totalColumnsWidth > width ? instanceProps.scrollbarSize : 0;\n return instanceProps.rowSizeAndPositionManager.getUpdatedOffsetForIndex({\n align: scrollToAlignment,\n containerSize: height - scrollBarSize,\n currentOffset: scrollTop,\n targetIndex: targetIndex\n });\n }\n\n return 0;\n }\n }, {\n key: \"_getScrollTopForScrollToRowStateUpdate\",\n value: function _getScrollTopForScrollToRowStateUpdate(nextProps, prevState) {\n var scrollTop = prevState.scrollTop;\n\n var calculatedScrollTop = Grid._getCalculatedScrollTop(nextProps, prevState);\n\n if (typeof calculatedScrollTop === 'number' && calculatedScrollTop >= 0 && scrollTop !== calculatedScrollTop) {\n return Grid._getScrollToPositionStateUpdate({\n prevState: prevState,\n scrollLeft: -1,\n scrollTop: calculatedScrollTop\n });\n }\n\n return {};\n }\n }]);\n\n return Grid;\n}(React.PureComponent), _defineProperty(_class, \"propTypes\", process.env.NODE_ENV === 'production' ? null : {\n \"aria-label\": PropTypes.string.isRequired,\n \"aria-readonly\": PropTypes.bool,\n\n /**\n * Set the width of the inner scrollable container to 'auto'.\n * This is useful for single-column Grids to ensure that the column doesn't extend below a vertical scrollbar.\n */\n \"autoContainerWidth\": PropTypes.bool.isRequired,\n\n /**\n * Removes fixed height from the scrollingContainer so that the total height of rows can stretch the window.\n * Intended for use with WindowScroller\n */\n \"autoHeight\": PropTypes.bool.isRequired,\n\n /**\n * Removes fixed width from the scrollingContainer so that the total width of rows can stretch the window.\n * Intended for use with WindowScroller\n */\n \"autoWidth\": PropTypes.bool.isRequired,\n\n /** Responsible for rendering a cell given an row and column index. */\n \"cellRenderer\": function cellRenderer() {\n return (typeof bpfrpt_proptype_CellRenderer === \"function\" ? bpfrpt_proptype_CellRenderer.isRequired ? bpfrpt_proptype_CellRenderer.isRequired : bpfrpt_proptype_CellRenderer : PropTypes.shape(bpfrpt_proptype_CellRenderer).isRequired).apply(this, arguments);\n },\n\n /** Responsible for rendering a group of cells given their index ranges. */\n \"cellRangeRenderer\": function cellRangeRenderer() {\n return (typeof bpfrpt_proptype_CellRangeRenderer === \"function\" ? bpfrpt_proptype_CellRangeRenderer.isRequired ? bpfrpt_proptype_CellRangeRenderer.isRequired : bpfrpt_proptype_CellRangeRenderer : PropTypes.shape(bpfrpt_proptype_CellRangeRenderer).isRequired).apply(this, arguments);\n },\n\n /** Optional custom CSS class name to attach to root Grid element. */\n \"className\": PropTypes.string,\n\n /** Number of columns in grid. */\n \"columnCount\": PropTypes.number.isRequired,\n\n /** Either a fixed column width (number) or a function that returns the width of a column given its index. */\n \"columnWidth\": function columnWidth() {\n return (typeof bpfrpt_proptype_CellSize === \"function\" ? bpfrpt_proptype_CellSize.isRequired ? bpfrpt_proptype_CellSize.isRequired : bpfrpt_proptype_CellSize : PropTypes.shape(bpfrpt_proptype_CellSize).isRequired).apply(this, arguments);\n },\n\n /** Unfiltered props for the Grid container. */\n \"containerProps\": PropTypes.object,\n\n /** ARIA role for the cell-container. */\n \"containerRole\": PropTypes.string.isRequired,\n\n /** Optional inline style applied to inner cell-container */\n \"containerStyle\": PropTypes.object.isRequired,\n\n /**\n * If CellMeasurer is used to measure this Grid's children, this should be a pointer to its CellMeasurerCache.\n * A shared CellMeasurerCache reference enables Grid and CellMeasurer to share measurement data.\n */\n \"deferredMeasurementCache\": PropTypes.object,\n\n /**\n * Used to estimate the total width of a Grid before all of its columns have actually been measured.\n * The estimated total width is adjusted as columns are rendered.\n */\n \"estimatedColumnSize\": PropTypes.number.isRequired,\n\n /**\n * Used to estimate the total height of a Grid before all of its rows have actually been measured.\n * The estimated total height is adjusted as rows are rendered.\n */\n \"estimatedRowSize\": PropTypes.number.isRequired,\n\n /** Exposed for testing purposes only. */\n \"getScrollbarSize\": PropTypes.func.isRequired,\n\n /** Height of Grid; this property determines the number of visible (vs virtualized) rows. */\n \"height\": PropTypes.number.isRequired,\n\n /** Optional custom id to attach to root Grid element. */\n \"id\": PropTypes.string,\n\n /**\n * Override internal is-scrolling state tracking.\n * This property is primarily intended for use with the WindowScroller component.\n */\n \"isScrolling\": PropTypes.bool,\n\n /**\n * Opt-out of isScrolling param passed to cellRangeRenderer.\n * To avoid the extra render when scroll stops.\n */\n \"isScrollingOptOut\": PropTypes.bool.isRequired,\n\n /** Optional renderer to be used in place of rows when either :rowCount or :columnCount is 0. */\n \"noContentRenderer\": function noContentRenderer() {\n return (typeof bpfrpt_proptype_NoContentRenderer === \"function\" ? bpfrpt_proptype_NoContentRenderer.isRequired ? bpfrpt_proptype_NoContentRenderer.isRequired : bpfrpt_proptype_NoContentRenderer : PropTypes.shape(bpfrpt_proptype_NoContentRenderer).isRequired).apply(this, arguments);\n },\n\n /**\n * Callback invoked whenever the scroll offset changes within the inner scrollable region.\n * This callback can be used to sync scrolling between lists, tables, or grids.\n */\n \"onScroll\": PropTypes.func.isRequired,\n\n /**\n * Called whenever a horizontal or vertical scrollbar is added or removed.\n * This prop is not intended for end-user use;\n * It is used by MultiGrid to support fixed-row/fixed-column scroll syncing.\n */\n \"onScrollbarPresenceChange\": PropTypes.func.isRequired,\n\n /** Callback invoked with information about the section of the Grid that was just rendered. */\n \"onSectionRendered\": PropTypes.func.isRequired,\n\n /**\n * Number of columns to render before/after the visible section of the grid.\n * These columns can help for smoother scrolling on touch devices or browsers that send scroll events infrequently.\n */\n \"overscanColumnCount\": PropTypes.number.isRequired,\n\n /**\n * Calculates the number of cells to overscan before and after a specified range.\n * This function ensures that overscanning doesn't exceed the available cells.\n */\n \"overscanIndicesGetter\": function overscanIndicesGetter() {\n return (typeof bpfrpt_proptype_OverscanIndicesGetter === \"function\" ? bpfrpt_proptype_OverscanIndicesGetter.isRequired ? bpfrpt_proptype_OverscanIndicesGetter.isRequired : bpfrpt_proptype_OverscanIndicesGetter : PropTypes.shape(bpfrpt_proptype_OverscanIndicesGetter).isRequired).apply(this, arguments);\n },\n\n /**\n * Number of rows to render above/below the visible section of the grid.\n * These rows can help for smoother scrolling on touch devices or browsers that send scroll events infrequently.\n */\n \"overscanRowCount\": PropTypes.number.isRequired,\n\n /** ARIA role for the grid element. */\n \"role\": PropTypes.string.isRequired,\n\n /**\n * Either a fixed row height (number) or a function that returns the height of a row given its index.\n * Should implement the following interface: ({ index: number }): number\n */\n \"rowHeight\": function rowHeight() {\n return (typeof bpfrpt_proptype_CellSize === \"function\" ? bpfrpt_proptype_CellSize.isRequired ? bpfrpt_proptype_CellSize.isRequired : bpfrpt_proptype_CellSize : PropTypes.shape(bpfrpt_proptype_CellSize).isRequired).apply(this, arguments);\n },\n\n /** Number of rows in grid. */\n \"rowCount\": PropTypes.number.isRequired,\n\n /** Wait this amount of time after the last scroll event before resetting Grid `pointer-events`. */\n \"scrollingResetTimeInterval\": PropTypes.number.isRequired,\n\n /** Horizontal offset. */\n \"scrollLeft\": PropTypes.number,\n\n /**\n * Controls scroll-to-cell behavior of the Grid.\n * The default (\"auto\") scrolls the least amount possible to ensure that the specified cell is fully visible.\n * Use \"start\" to align cells to the top/left of the Grid and \"end\" to align bottom/right.\n */\n \"scrollToAlignment\": function scrollToAlignment() {\n return (typeof bpfrpt_proptype_Alignment === \"function\" ? bpfrpt_proptype_Alignment.isRequired ? bpfrpt_proptype_Alignment.isRequired : bpfrpt_proptype_Alignment : PropTypes.shape(bpfrpt_proptype_Alignment).isRequired).apply(this, arguments);\n },\n\n /** Column index to ensure visible (by forcefully scrolling if necessary) */\n \"scrollToColumn\": PropTypes.number.isRequired,\n\n /** Vertical offset. */\n \"scrollTop\": PropTypes.number,\n\n /** Row index to ensure visible (by forcefully scrolling if necessary) */\n \"scrollToRow\": PropTypes.number.isRequired,\n\n /** Optional inline style */\n \"style\": PropTypes.object.isRequired,\n\n /** Tab index for focus */\n \"tabIndex\": PropTypes.number,\n\n /** Width of Grid; this property determines the number of visible (vs virtualized) columns. */\n \"width\": PropTypes.number.isRequired\n}), _temp);\n\n_defineProperty(Grid, \"defaultProps\", {\n 'aria-label': 'grid',\n 'aria-readonly': true,\n autoContainerWidth: false,\n autoHeight: false,\n autoWidth: false,\n cellRangeRenderer: defaultCellRangeRenderer,\n containerRole: 'rowgroup',\n containerStyle: {},\n estimatedColumnSize: 100,\n estimatedRowSize: 30,\n getScrollbarSize: scrollbarSize,\n noContentRenderer: renderNull,\n onScroll: function onScroll() {},\n onScrollbarPresenceChange: function onScrollbarPresenceChange() {},\n onSectionRendered: function onSectionRendered() {},\n overscanColumnCount: 0,\n overscanIndicesGetter: defaultOverscanIndicesGetter,\n overscanRowCount: 10,\n role: 'grid',\n scrollingResetTimeInterval: DEFAULT_SCROLLING_RESET_TIME_INTERVAL,\n scrollToAlignment: 'auto',\n scrollToColumn: -1,\n scrollToRow: -1,\n style: {},\n tabIndex: 0,\n isScrollingOptOut: false\n});\n\npolyfill(Grid);\nexport default Grid;\nimport { bpfrpt_proptype_CellRenderer } from \"./types\";\nimport { bpfrpt_proptype_CellRangeRenderer } from \"./types\";\nimport { bpfrpt_proptype_CellPosition } from \"./types\";\nimport { bpfrpt_proptype_CellSize } from \"./types\";\nimport { bpfrpt_proptype_CellSizeGetter } from \"./types\";\nimport { bpfrpt_proptype_NoContentRenderer } from \"./types\";\nimport { bpfrpt_proptype_Scroll } from \"./types\";\nimport { bpfrpt_proptype_ScrollbarPresenceChange } from \"./types\";\nimport { bpfrpt_proptype_RenderedSection } from \"./types\";\nimport { bpfrpt_proptype_OverscanIndicesGetter } from \"./types\";\nimport { bpfrpt_proptype_Alignment } from \"./types\";\nimport { bpfrpt_proptype_CellCache } from \"./types\";\nimport { bpfrpt_proptype_StyleCache } from \"./types\";\nimport { bpfrpt_proptype_AnimationTimeoutId } from \"../utils/requestAnimationTimeout\";\nimport PropTypes from \"prop-types\";","import { caf, raf } from './animationFrame';\nvar bpfrpt_proptype_AnimationTimeoutId = process.env.NODE_ENV === 'production' ? null : {\n \"id\": PropTypes.number.isRequired\n};\nexport var cancelAnimationTimeout = function cancelAnimationTimeout(frame) {\n return caf(frame.id);\n};\n/**\n * Recursively calls requestAnimationFrame until a specified delay has been met or exceeded.\n * When the delay time has been reached the function you're timing out will be called.\n *\n * Credit: Joe Lambert (https://gist.github.com/joelambert/1002116#file-requesttimeout-js)\n */\n\nexport var requestAnimationTimeout = function requestAnimationTimeout(callback, delay) {\n var start; // wait for end of processing current event handler, because event handler may be long\n\n Promise.resolve().then(function () {\n start = Date.now();\n });\n\n var timeout = function timeout() {\n if (Date.now() - start >= delay) {\n callback.call();\n } else {\n frame.id = raf(timeout);\n }\n };\n\n var frame = {\n id: raf(timeout)\n };\n return frame;\n};\nimport PropTypes from \"prop-types\";\nexport { bpfrpt_proptype_AnimationTimeoutId };","export var SCROLL_DIRECTION_BACKWARD = -1;\nexport var SCROLL_DIRECTION_FORWARD = 1;\nexport var SCROLL_DIRECTION_HORIZONTAL = 'horizontal';\nexport var SCROLL_DIRECTION_VERTICAL = 'vertical';\n/**\n * Calculates the number of cells to overscan before and after a specified range.\n * This function ensures that overscanning doesn't exceed the available cells.\n */\n\nexport default function defaultOverscanIndicesGetter(_ref) {\n var cellCount = _ref.cellCount,\n overscanCellsCount = _ref.overscanCellsCount,\n scrollDirection = _ref.scrollDirection,\n startIndex = _ref.startIndex,\n stopIndex = _ref.stopIndex;\n\n if (scrollDirection === SCROLL_DIRECTION_FORWARD) {\n return {\n overscanStartIndex: Math.max(0, startIndex),\n overscanStopIndex: Math.min(cellCount - 1, stopIndex + overscanCellsCount)\n };\n } else {\n return {\n overscanStartIndex: Math.max(0, startIndex - overscanCellsCount),\n overscanStopIndex: Math.min(cellCount - 1, stopIndex)\n };\n }\n}\nimport { bpfrpt_proptype_OverscanIndicesGetterParams } from \"./types\";\nimport { bpfrpt_proptype_OverscanIndices } from \"./types\";","/**\n * Default implementation of cellRangeRenderer used by Grid.\n * This renderer supports cell-caching while the user is scrolling.\n */\nexport default function defaultCellRangeRenderer(_ref) {\n var cellCache = _ref.cellCache,\n cellRenderer = _ref.cellRenderer,\n columnSizeAndPositionManager = _ref.columnSizeAndPositionManager,\n columnStartIndex = _ref.columnStartIndex,\n columnStopIndex = _ref.columnStopIndex,\n deferredMeasurementCache = _ref.deferredMeasurementCache,\n horizontalOffsetAdjustment = _ref.horizontalOffsetAdjustment,\n isScrolling = _ref.isScrolling,\n isScrollingOptOut = _ref.isScrollingOptOut,\n parent = _ref.parent,\n rowSizeAndPositionManager = _ref.rowSizeAndPositionManager,\n rowStartIndex = _ref.rowStartIndex,\n rowStopIndex = _ref.rowStopIndex,\n styleCache = _ref.styleCache,\n verticalOffsetAdjustment = _ref.verticalOffsetAdjustment,\n visibleColumnIndices = _ref.visibleColumnIndices,\n visibleRowIndices = _ref.visibleRowIndices;\n var renderedCells = []; // Browsers have native size limits for elements (eg Chrome 33M pixels, IE 1.5M pixes).\n // User cannot scroll beyond these size limitations.\n // In order to work around this, ScalingCellSizeAndPositionManager compresses offsets.\n // We should never cache styles for compressed offsets though as this can lead to bugs.\n // See issue #576 for more.\n\n var areOffsetsAdjusted = columnSizeAndPositionManager.areOffsetsAdjusted() || rowSizeAndPositionManager.areOffsetsAdjusted();\n var canCacheStyle = !isScrolling && !areOffsetsAdjusted;\n\n for (var rowIndex = rowStartIndex; rowIndex <= rowStopIndex; rowIndex++) {\n var rowDatum = rowSizeAndPositionManager.getSizeAndPositionOfCell(rowIndex);\n\n for (var columnIndex = columnStartIndex; columnIndex <= columnStopIndex; columnIndex++) {\n var columnDatum = columnSizeAndPositionManager.getSizeAndPositionOfCell(columnIndex);\n var isVisible = columnIndex >= visibleColumnIndices.start && columnIndex <= visibleColumnIndices.stop && rowIndex >= visibleRowIndices.start && rowIndex <= visibleRowIndices.stop;\n var key = \"\".concat(rowIndex, \"-\").concat(columnIndex);\n var style = void 0; // Cache style objects so shallow-compare doesn't re-render unnecessarily.\n\n if (canCacheStyle && styleCache[key]) {\n style = styleCache[key];\n } else {\n // In deferred mode, cells will be initially rendered before we know their size.\n // Don't interfere with CellMeasurer's measurements by setting an invalid size.\n if (deferredMeasurementCache && !deferredMeasurementCache.has(rowIndex, columnIndex)) {\n // Position not-yet-measured cells at top/left 0,0,\n // And give them width/height of 'auto' so they can grow larger than the parent Grid if necessary.\n // Positioning them further to the right/bottom influences their measured size.\n style = {\n height: 'auto',\n left: 0,\n position: 'absolute',\n top: 0,\n width: 'auto'\n };\n } else {\n style = {\n height: rowDatum.size,\n left: columnDatum.offset + horizontalOffsetAdjustment,\n position: 'absolute',\n top: rowDatum.offset + verticalOffsetAdjustment,\n width: columnDatum.size\n };\n styleCache[key] = style;\n }\n }\n\n var cellRendererParams = {\n columnIndex: columnIndex,\n isScrolling: isScrolling,\n isVisible: isVisible,\n key: key,\n parent: parent,\n rowIndex: rowIndex,\n style: style\n };\n var renderedCell = void 0; // Avoid re-creating cells while scrolling.\n // This can lead to the same cell being created many times and can cause performance issues for \"heavy\" cells.\n // If a scroll is in progress- cache and reuse cells.\n // This cache will be thrown away once scrolling completes.\n // However if we are scaling scroll positions and sizes, we should also avoid caching.\n // This is because the offset changes slightly as scroll position changes and caching leads to stale values.\n // For more info refer to issue #395\n //\n // If isScrollingOptOut is specified, we always cache cells.\n // For more info refer to issue #1028\n\n if ((isScrollingOptOut || isScrolling) && !horizontalOffsetAdjustment && !verticalOffsetAdjustment) {\n if (!cellCache[key]) {\n cellCache[key] = cellRenderer(cellRendererParams);\n }\n\n renderedCell = cellCache[key]; // If the user is no longer scrolling, don't cache cells.\n // This makes dynamic cell content difficult for users and would also lead to a heavier memory footprint.\n } else {\n renderedCell = cellRenderer(cellRendererParams);\n }\n\n if (renderedCell == null || renderedCell === false) {\n continue;\n }\n\n if (process.env.NODE_ENV !== 'production') {\n warnAboutMissingStyle(parent, renderedCell);\n }\n\n renderedCells.push(renderedCell);\n }\n }\n\n return renderedCells;\n}\n\nfunction warnAboutMissingStyle(parent, renderedCell) {\n if (process.env.NODE_ENV !== 'production') {\n if (renderedCell) {\n // If the direct child is a CellMeasurer, then we should check its child\n // See issue #611\n if (renderedCell.type && renderedCell.type.__internalCellMeasurerFlag) {\n renderedCell = renderedCell.props.children;\n }\n\n if (renderedCell && renderedCell.props && renderedCell.props.style === undefined && parent.__warnedAboutMissingStyle !== true) {\n parent.__warnedAboutMissingStyle = true;\n console.warn('Rendered cell should include style property for positioning.');\n }\n }\n }\n}\n\nimport { bpfrpt_proptype_CellRangeRendererParams } from \"./types\";","export var SCROLL_DIRECTION_BACKWARD = -1;\nexport var SCROLL_DIRECTION_FORWARD = 1;\nexport var SCROLL_DIRECTION_HORIZONTAL = 'horizontal';\nexport var SCROLL_DIRECTION_VERTICAL = 'vertical';\n/**\n * Calculates the number of cells to overscan before and after a specified range.\n * This function ensures that overscanning doesn't exceed the available cells.\n */\n\nexport default function defaultOverscanIndicesGetter(_ref) {\n var cellCount = _ref.cellCount,\n overscanCellsCount = _ref.overscanCellsCount,\n scrollDirection = _ref.scrollDirection,\n startIndex = _ref.startIndex,\n stopIndex = _ref.stopIndex;\n // Make sure we render at least 1 cell extra before and after (except near boundaries)\n // This is necessary in order to support keyboard navigation (TAB/SHIFT+TAB) in some cases\n // For more info see issues #625\n overscanCellsCount = Math.max(1, overscanCellsCount);\n\n if (scrollDirection === SCROLL_DIRECTION_FORWARD) {\n return {\n overscanStartIndex: Math.max(0, startIndex - 1),\n overscanStopIndex: Math.min(cellCount - 1, stopIndex + overscanCellsCount)\n };\n } else {\n return {\n overscanStartIndex: Math.max(0, startIndex - overscanCellsCount),\n overscanStopIndex: Math.min(cellCount - 1, stopIndex + 1)\n };\n }\n}\nimport { bpfrpt_proptype_OverscanIndicesGetterParams } from \"./types\";\nimport { bpfrpt_proptype_OverscanIndices } from \"./types\";","var bpfrpt_proptype_ScrollIndices = process.env.NODE_ENV === 'production' ? null : {\n \"scrollToColumn\": PropTypes.number.isRequired,\n \"scrollToRow\": PropTypes.number.isRequired\n};\nimport PropTypes from \"prop-types\";\nexport { bpfrpt_proptype_ScrollIndices };","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nvar _class, _temp;\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport * as React from 'react';\nimport { polyfill } from 'react-lifecycles-compat';\n/**\n * This HOC decorates a virtualized component and responds to arrow-key events by scrolling one row or column at a time.\n */\n\nvar ArrowKeyStepper = (_temp = _class =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(ArrowKeyStepper, _React$PureComponent);\n\n function ArrowKeyStepper() {\n var _getPrototypeOf2;\n\n var _this;\n\n _classCallCheck(this, ArrowKeyStepper);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(ArrowKeyStepper)).call.apply(_getPrototypeOf2, [this].concat(args)));\n\n _defineProperty(_assertThisInitialized(_this), \"state\", {\n scrollToColumn: 0,\n scrollToRow: 0,\n instanceProps: {\n prevScrollToColumn: 0,\n prevScrollToRow: 0\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_columnStartIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_columnStopIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_rowStartIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_rowStopIndex\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_onKeyDown\", function (event) {\n var _this$props = _this.props,\n columnCount = _this$props.columnCount,\n disabled = _this$props.disabled,\n mode = _this$props.mode,\n rowCount = _this$props.rowCount;\n\n if (disabled) {\n return;\n }\n\n var _this$_getScrollState = _this._getScrollState(),\n scrollToColumnPrevious = _this$_getScrollState.scrollToColumn,\n scrollToRowPrevious = _this$_getScrollState.scrollToRow;\n\n var _this$_getScrollState2 = _this._getScrollState(),\n scrollToColumn = _this$_getScrollState2.scrollToColumn,\n scrollToRow = _this$_getScrollState2.scrollToRow; // The above cases all prevent default event event behavior.\n // This is to keep the grid from scrolling after the snap-to update.\n\n\n switch (event.key) {\n case 'ArrowDown':\n scrollToRow = mode === 'cells' ? Math.min(scrollToRow + 1, rowCount - 1) : Math.min(_this._rowStopIndex + 1, rowCount - 1);\n break;\n\n case 'ArrowLeft':\n scrollToColumn = mode === 'cells' ? Math.max(scrollToColumn - 1, 0) : Math.max(_this._columnStartIndex - 1, 0);\n break;\n\n case 'ArrowRight':\n scrollToColumn = mode === 'cells' ? Math.min(scrollToColumn + 1, columnCount - 1) : Math.min(_this._columnStopIndex + 1, columnCount - 1);\n break;\n\n case 'ArrowUp':\n scrollToRow = mode === 'cells' ? Math.max(scrollToRow - 1, 0) : Math.max(_this._rowStartIndex - 1, 0);\n break;\n }\n\n if (scrollToColumn !== scrollToColumnPrevious || scrollToRow !== scrollToRowPrevious) {\n event.preventDefault();\n\n _this._updateScrollState({\n scrollToColumn: scrollToColumn,\n scrollToRow: scrollToRow\n });\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onSectionRendered\", function (_ref) {\n var columnStartIndex = _ref.columnStartIndex,\n columnStopIndex = _ref.columnStopIndex,\n rowStartIndex = _ref.rowStartIndex,\n rowStopIndex = _ref.rowStopIndex;\n _this._columnStartIndex = columnStartIndex;\n _this._columnStopIndex = columnStopIndex;\n _this._rowStartIndex = rowStartIndex;\n _this._rowStopIndex = rowStopIndex;\n });\n\n return _this;\n }\n\n _createClass(ArrowKeyStepper, [{\n key: \"setScrollIndexes\",\n value: function setScrollIndexes(_ref2) {\n var scrollToColumn = _ref2.scrollToColumn,\n scrollToRow = _ref2.scrollToRow;\n this.setState({\n scrollToRow: scrollToRow,\n scrollToColumn: scrollToColumn\n });\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props2 = this.props,\n className = _this$props2.className,\n children = _this$props2.children;\n\n var _this$_getScrollState3 = this._getScrollState(),\n scrollToColumn = _this$_getScrollState3.scrollToColumn,\n scrollToRow = _this$_getScrollState3.scrollToRow;\n\n return React.createElement(\"div\", {\n className: className,\n onKeyDown: this._onKeyDown\n }, children({\n onSectionRendered: this._onSectionRendered,\n scrollToColumn: scrollToColumn,\n scrollToRow: scrollToRow\n }));\n }\n }, {\n key: \"_getScrollState\",\n value: function _getScrollState() {\n return this.props.isControlled ? this.props : this.state;\n }\n }, {\n key: \"_updateScrollState\",\n value: function _updateScrollState(_ref3) {\n var scrollToColumn = _ref3.scrollToColumn,\n scrollToRow = _ref3.scrollToRow;\n var _this$props3 = this.props,\n isControlled = _this$props3.isControlled,\n onScrollToChange = _this$props3.onScrollToChange;\n\n if (typeof onScrollToChange === 'function') {\n onScrollToChange({\n scrollToColumn: scrollToColumn,\n scrollToRow: scrollToRow\n });\n }\n\n if (!isControlled) {\n this.setState({\n scrollToColumn: scrollToColumn,\n scrollToRow: scrollToRow\n });\n }\n }\n }], [{\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n if (nextProps.isControlled) {\n return {};\n }\n\n if (nextProps.scrollToColumn !== prevState.instanceProps.prevScrollToColumn || nextProps.scrollToRow !== prevState.instanceProps.prevScrollToRow) {\n return _objectSpread({}, prevState, {\n scrollToColumn: nextProps.scrollToColumn,\n scrollToRow: nextProps.scrollToRow,\n instanceProps: {\n prevScrollToColumn: nextProps.scrollToColumn,\n prevScrollToRow: nextProps.scrollToRow\n }\n });\n }\n\n return {};\n }\n }]);\n\n return ArrowKeyStepper;\n}(React.PureComponent), _defineProperty(_class, \"propTypes\", process.env.NODE_ENV === 'production' ? null : {\n \"children\": PropTypes.func.isRequired,\n \"className\": PropTypes.string,\n \"columnCount\": PropTypes.number.isRequired,\n \"disabled\": PropTypes.bool.isRequired,\n \"isControlled\": PropTypes.bool.isRequired,\n \"mode\": PropTypes.oneOf([\"cells\", \"edges\"]).isRequired,\n \"onScrollToChange\": PropTypes.func,\n \"rowCount\": PropTypes.number.isRequired,\n \"scrollToColumn\": PropTypes.number.isRequired,\n \"scrollToRow\": PropTypes.number.isRequired\n}), _temp);\n\n_defineProperty(ArrowKeyStepper, \"defaultProps\", {\n disabled: false,\n isControlled: false,\n mode: 'edges',\n scrollToColumn: 0,\n scrollToRow: 0\n});\n\npolyfill(ArrowKeyStepper);\nexport default ArrowKeyStepper;\nimport { bpfrpt_proptype_RenderedSection } from \"../Grid\";\nimport { bpfrpt_proptype_ScrollIndices } from \"./types\";\nimport PropTypes from \"prop-types\";","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nvar _class, _temp;\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport * as React from 'react';\nimport createDetectElementResize from '../vendor/detectElementResize';\nvar AutoSizer = (_temp = _class =\n/*#__PURE__*/\nfunction (_React$Component) {\n _inherits(AutoSizer, _React$Component);\n\n function AutoSizer() {\n var _getPrototypeOf2;\n\n var _this;\n\n _classCallCheck(this, AutoSizer);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(AutoSizer)).call.apply(_getPrototypeOf2, [this].concat(args)));\n\n _defineProperty(_assertThisInitialized(_this), \"state\", {\n height: _this.props.defaultHeight || 0,\n width: _this.props.defaultWidth || 0\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_parentNode\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_autoSizer\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_window\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_detectElementResize\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_onResize\", function () {\n var _this$props = _this.props,\n disableHeight = _this$props.disableHeight,\n disableWidth = _this$props.disableWidth,\n onResize = _this$props.onResize;\n\n if (_this._parentNode) {\n // Guard against AutoSizer component being removed from the DOM immediately after being added.\n // This can result in invalid style values which can result in NaN values if we don't handle them.\n // See issue #150 for more context.\n var height = _this._parentNode.offsetHeight || 0;\n var width = _this._parentNode.offsetWidth || 0;\n var win = _this._window || window;\n var style = win.getComputedStyle(_this._parentNode) || {};\n var paddingLeft = parseInt(style.paddingLeft, 10) || 0;\n var paddingRight = parseInt(style.paddingRight, 10) || 0;\n var paddingTop = parseInt(style.paddingTop, 10) || 0;\n var paddingBottom = parseInt(style.paddingBottom, 10) || 0;\n var newHeight = height - paddingTop - paddingBottom;\n var newWidth = width - paddingLeft - paddingRight;\n\n if (!disableHeight && _this.state.height !== newHeight || !disableWidth && _this.state.width !== newWidth) {\n _this.setState({\n height: height - paddingTop - paddingBottom,\n width: width - paddingLeft - paddingRight\n });\n\n onResize({\n height: height,\n width: width\n });\n }\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_setRef\", function (autoSizer) {\n _this._autoSizer = autoSizer;\n });\n\n return _this;\n }\n\n _createClass(AutoSizer, [{\n key: \"componentDidMount\",\n value: function componentDidMount() {\n var nonce = this.props.nonce;\n\n if (this._autoSizer && this._autoSizer.parentNode && this._autoSizer.parentNode.ownerDocument && this._autoSizer.parentNode.ownerDocument.defaultView && this._autoSizer.parentNode instanceof this._autoSizer.parentNode.ownerDocument.defaultView.HTMLElement) {\n // Delay access of parentNode until mount.\n // This handles edge-cases where the component has already been unmounted before its ref has been set,\n // As well as libraries like react-lite which have a slightly different lifecycle.\n this._parentNode = this._autoSizer.parentNode;\n this._window = this._autoSizer.parentNode.ownerDocument.defaultView; // Defer requiring resize handler in order to support server-side rendering.\n // See issue #41\n\n this._detectElementResize = createDetectElementResize(nonce, this._window);\n\n this._detectElementResize.addResizeListener(this._parentNode, this._onResize);\n\n this._onResize();\n }\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n if (this._detectElementResize && this._parentNode) {\n this._detectElementResize.removeResizeListener(this._parentNode, this._onResize);\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props2 = this.props,\n children = _this$props2.children,\n className = _this$props2.className,\n disableHeight = _this$props2.disableHeight,\n disableWidth = _this$props2.disableWidth,\n style = _this$props2.style;\n var _this$state = this.state,\n height = _this$state.height,\n width = _this$state.width; // Outer div should not force width/height since that may prevent containers from shrinking.\n // Inner component should overflow and use calculated width/height.\n // See issue #68 for more information.\n\n var outerStyle = {\n overflow: 'visible'\n };\n var childParams = {};\n\n if (!disableHeight) {\n outerStyle.height = 0;\n childParams.height = height;\n }\n\n if (!disableWidth) {\n outerStyle.width = 0;\n childParams.width = width;\n }\n /**\n * TODO: Avoid rendering children before the initial measurements have been collected.\n * At best this would just be wasting cycles.\n * Add this check into version 10 though as it could break too many ref callbacks in version 9.\n * Note that if default width/height props were provided this would still work with SSR.\n if (\n height !== 0 &&\n width !== 0\n ) {\n child = children({ height, width })\n }\n */\n\n\n return React.createElement(\"div\", {\n className: className,\n ref: this._setRef,\n style: _objectSpread({}, outerStyle, {}, style)\n }, children(childParams));\n }\n }]);\n\n return AutoSizer;\n}(React.Component), _defineProperty(_class, \"propTypes\", process.env.NODE_ENV === 'production' ? null : {\n /** Function responsible for rendering children.*/\n \"children\": PropTypes.func.isRequired,\n\n /** Optional custom CSS class name to attach to root AutoSizer element. */\n \"className\": PropTypes.string,\n\n /** Default height to use for initial render; useful for SSR */\n \"defaultHeight\": PropTypes.number,\n\n /** Default width to use for initial render; useful for SSR */\n \"defaultWidth\": PropTypes.number,\n\n /** Disable dynamic :height property */\n \"disableHeight\": PropTypes.bool.isRequired,\n\n /** Disable dynamic :width property */\n \"disableWidth\": PropTypes.bool.isRequired,\n\n /** Nonce of the inlined stylesheet for Content Security Policy */\n \"nonce\": PropTypes.string,\n\n /** Callback to be invoked on-resize */\n \"onResize\": PropTypes.func.isRequired,\n\n /** Optional inline style */\n \"style\": PropTypes.object\n}), _temp);\n\n_defineProperty(AutoSizer, \"defaultProps\", {\n onResize: function onResize() {},\n disableHeight: false,\n disableWidth: false,\n style: {}\n});\n\nexport { AutoSizer as default };\nimport PropTypes from \"prop-types\";","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nvar _class, _temp;\n\nimport * as React from 'react';\nimport { findDOMNode } from 'react-dom';\n\n/**\n * Wraps a cell and measures its rendered content.\n * Measurements are stored in a per-cell cache.\n * Cached-content is not be re-measured.\n */\nvar CellMeasurer = (_temp = _class =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(CellMeasurer, _React$PureComponent);\n\n function CellMeasurer() {\n var _getPrototypeOf2;\n\n var _this;\n\n _classCallCheck(this, CellMeasurer);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(CellMeasurer)).call.apply(_getPrototypeOf2, [this].concat(args)));\n\n _defineProperty(_assertThisInitialized(_this), \"_child\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_measure\", function () {\n var _this$props = _this.props,\n cache = _this$props.cache,\n _this$props$columnInd = _this$props.columnIndex,\n columnIndex = _this$props$columnInd === void 0 ? 0 : _this$props$columnInd,\n parent = _this$props.parent,\n _this$props$rowIndex = _this$props.rowIndex,\n rowIndex = _this$props$rowIndex === void 0 ? _this.props.index || 0 : _this$props$rowIndex;\n\n var _this$_getCellMeasure = _this._getCellMeasurements(),\n height = _this$_getCellMeasure.height,\n width = _this$_getCellMeasure.width;\n\n if (height !== cache.getHeight(rowIndex, columnIndex) || width !== cache.getWidth(rowIndex, columnIndex)) {\n cache.set(rowIndex, columnIndex, width, height);\n\n if (parent && typeof parent.recomputeGridSize === 'function') {\n parent.recomputeGridSize({\n columnIndex: columnIndex,\n rowIndex: rowIndex\n });\n }\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_registerChild\", function (element) {\n if (element && !(element instanceof Element)) {\n console.warn('CellMeasurer registerChild expects to be passed Element or null');\n }\n\n _this._child = element;\n\n if (element) {\n _this._maybeMeasureCell();\n }\n });\n\n return _this;\n }\n\n _createClass(CellMeasurer, [{\n key: \"componentDidMount\",\n value: function componentDidMount() {\n this._maybeMeasureCell();\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate() {\n this._maybeMeasureCell();\n }\n }, {\n key: \"render\",\n value: function render() {\n var children = this.props.children;\n return typeof children === 'function' ? children({\n measure: this._measure,\n registerChild: this._registerChild\n }) : children;\n }\n }, {\n key: \"_getCellMeasurements\",\n value: function _getCellMeasurements() {\n var cache = this.props.cache;\n var node = this._child || findDOMNode(this); // TODO Check for a bad combination of fixedWidth and missing numeric width or vice versa with height\n\n if (node && node.ownerDocument && node.ownerDocument.defaultView && node instanceof node.ownerDocument.defaultView.HTMLElement) {\n var styleWidth = node.style.width;\n var styleHeight = node.style.height; // If we are re-measuring a cell that has already been measured,\n // It will have a hard-coded width/height from the previous measurement.\n // The fact that we are measuring indicates this measurement is probably stale,\n // So explicitly clear it out (eg set to \"auto\") so we can recalculate.\n // See issue #593 for more info.\n // Even if we are measuring initially- if we're inside of a MultiGrid component,\n // Explicitly clear width/height before measuring to avoid being tainted by another Grid.\n // eg top/left Grid renders before bottom/right Grid\n // Since the CellMeasurerCache is shared between them this taints derived cell size values.\n\n if (!cache.hasFixedWidth()) {\n node.style.width = 'auto';\n }\n\n if (!cache.hasFixedHeight()) {\n node.style.height = 'auto';\n }\n\n var height = Math.ceil(node.offsetHeight);\n var width = Math.ceil(node.offsetWidth); // Reset after measuring to avoid breaking styles; see #660\n\n if (styleWidth) {\n node.style.width = styleWidth;\n }\n\n if (styleHeight) {\n node.style.height = styleHeight;\n }\n\n return {\n height: height,\n width: width\n };\n } else {\n return {\n height: 0,\n width: 0\n };\n }\n }\n }, {\n key: \"_maybeMeasureCell\",\n value: function _maybeMeasureCell() {\n var _this$props2 = this.props,\n cache = _this$props2.cache,\n _this$props2$columnIn = _this$props2.columnIndex,\n columnIndex = _this$props2$columnIn === void 0 ? 0 : _this$props2$columnIn,\n parent = _this$props2.parent,\n _this$props2$rowIndex = _this$props2.rowIndex,\n rowIndex = _this$props2$rowIndex === void 0 ? this.props.index || 0 : _this$props2$rowIndex;\n\n if (!cache.has(rowIndex, columnIndex)) {\n var _this$_getCellMeasure2 = this._getCellMeasurements(),\n height = _this$_getCellMeasure2.height,\n width = _this$_getCellMeasure2.width;\n\n cache.set(rowIndex, columnIndex, width, height); // If size has changed, let Grid know to re-render.\n\n if (parent && typeof parent.invalidateCellSizeAfterRender === 'function') {\n parent.invalidateCellSizeAfterRender({\n columnIndex: columnIndex,\n rowIndex: rowIndex\n });\n }\n }\n }\n }]);\n\n return CellMeasurer;\n}(React.PureComponent), _defineProperty(_class, \"propTypes\", process.env.NODE_ENV === 'production' ? null : {\n \"cache\": function cache() {\n return (typeof bpfrpt_proptype_CellMeasureCache === \"function\" ? bpfrpt_proptype_CellMeasureCache.isRequired ? bpfrpt_proptype_CellMeasureCache.isRequired : bpfrpt_proptype_CellMeasureCache : PropTypes.shape(bpfrpt_proptype_CellMeasureCache).isRequired).apply(this, arguments);\n },\n \"children\": PropTypes.oneOfType([PropTypes.func, PropTypes.node]).isRequired,\n \"columnIndex\": PropTypes.number,\n \"index\": PropTypes.number,\n \"parent\": PropTypes.shape({\n invalidateCellSizeAfterRender: PropTypes.func,\n recomputeGridSize: PropTypes.func\n }).isRequired,\n \"rowIndex\": PropTypes.number\n}), _temp); // Used for DEV mode warning check\n\n_defineProperty(CellMeasurer, \"__internalCellMeasurerFlag\", false);\n\nexport { CellMeasurer as default };\n\nif (process.env.NODE_ENV !== 'production') {\n CellMeasurer.__internalCellMeasurerFlag = true;\n}\n\nimport { bpfrpt_proptype_CellMeasureCache } from \"./types\";\nimport PropTypes from \"prop-types\";","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport clsx from 'clsx';\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\nimport { polyfill } from 'react-lifecycles-compat';\nimport createCallbackMemoizer from '../utils/createCallbackMemoizer';\nimport getScrollbarSize from 'dom-helpers/scrollbarSize'; // @TODO Merge Collection and CollectionView\n\n/**\n * Specifies the number of milliseconds during which to disable pointer events while a scroll is in progress.\n * This improves performance and makes scrolling smoother.\n */\n\nvar IS_SCROLLING_TIMEOUT = 150;\n/**\n * Controls whether the Grid updates the DOM element's scrollLeft/scrollTop based on the current state or just observes it.\n * This prevents Grid from interrupting mouse-wheel animations (see issue #2).\n */\n\nvar SCROLL_POSITION_CHANGE_REASONS = {\n OBSERVED: 'observed',\n REQUESTED: 'requested'\n};\n/**\n * Monitors changes in properties (eg. cellCount) and state (eg. scroll offsets) to determine when rendering needs to occur.\n * This component does not render any visible content itself; it defers to the specified :cellLayoutManager.\n */\n\nvar CollectionView =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(CollectionView, _React$PureComponent);\n\n // Invokes callbacks only when their values have changed.\n function CollectionView() {\n var _getPrototypeOf2;\n\n var _this;\n\n _classCallCheck(this, CollectionView);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(CollectionView)).call.apply(_getPrototypeOf2, [this].concat(args))); // If this component is being rendered server-side, getScrollbarSize() will return undefined.\n // We handle this case in componentDidMount()\n\n _defineProperty(_assertThisInitialized(_this), \"state\", {\n isScrolling: false,\n scrollLeft: 0,\n scrollTop: 0\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_calculateSizeAndPositionDataOnNextUpdate\", false);\n\n _defineProperty(_assertThisInitialized(_this), \"_onSectionRenderedMemoizer\", createCallbackMemoizer());\n\n _defineProperty(_assertThisInitialized(_this), \"_onScrollMemoizer\", createCallbackMemoizer(false));\n\n _defineProperty(_assertThisInitialized(_this), \"_invokeOnSectionRenderedHelper\", function () {\n var _this$props = _this.props,\n cellLayoutManager = _this$props.cellLayoutManager,\n onSectionRendered = _this$props.onSectionRendered;\n\n _this._onSectionRenderedMemoizer({\n callback: onSectionRendered,\n indices: {\n indices: cellLayoutManager.getLastRenderedIndices()\n }\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_setScrollingContainerRef\", function (ref) {\n _this._scrollingContainer = ref;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_updateScrollPositionForScrollToCell\", function () {\n var _this$props2 = _this.props,\n cellLayoutManager = _this$props2.cellLayoutManager,\n height = _this$props2.height,\n scrollToAlignment = _this$props2.scrollToAlignment,\n scrollToCell = _this$props2.scrollToCell,\n width = _this$props2.width;\n var _this$state = _this.state,\n scrollLeft = _this$state.scrollLeft,\n scrollTop = _this$state.scrollTop;\n\n if (scrollToCell >= 0) {\n var scrollPosition = cellLayoutManager.getScrollPositionForCell({\n align: scrollToAlignment,\n cellIndex: scrollToCell,\n height: height,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n width: width\n });\n\n if (scrollPosition.scrollLeft !== scrollLeft || scrollPosition.scrollTop !== scrollTop) {\n _this._setScrollPosition(scrollPosition);\n }\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScroll\", function (event) {\n // In certain edge-cases React dispatches an onScroll event with an invalid target.scrollLeft / target.scrollTop.\n // This invalid event can be detected by comparing event.target to this component's scrollable DOM element.\n // See issue #404 for more information.\n if (event.target !== _this._scrollingContainer) {\n return;\n } // Prevent pointer events from interrupting a smooth scroll\n\n\n _this._enablePointerEventsAfterDelay(); // When this component is shrunk drastically, React dispatches a series of back-to-back scroll events,\n // Gradually converging on a scrollTop that is within the bounds of the new, smaller height.\n // This causes a series of rapid renders that is slow for long lists.\n // We can avoid that by doing some simple bounds checking to ensure that scrollTop never exceeds the total height.\n\n\n var _this$props3 = _this.props,\n cellLayoutManager = _this$props3.cellLayoutManager,\n height = _this$props3.height,\n isScrollingChange = _this$props3.isScrollingChange,\n width = _this$props3.width;\n var scrollbarSize = _this._scrollbarSize;\n\n var _cellLayoutManager$ge = cellLayoutManager.getTotalSize(),\n totalHeight = _cellLayoutManager$ge.height,\n totalWidth = _cellLayoutManager$ge.width;\n\n var scrollLeft = Math.max(0, Math.min(totalWidth - width + scrollbarSize, event.target.scrollLeft));\n var scrollTop = Math.max(0, Math.min(totalHeight - height + scrollbarSize, event.target.scrollTop)); // Certain devices (like Apple touchpad) rapid-fire duplicate events.\n // Don't force a re-render if this is the case.\n // The mouse may move faster then the animation frame does.\n // Use requestAnimationFrame to avoid over-updating.\n\n if (_this.state.scrollLeft !== scrollLeft || _this.state.scrollTop !== scrollTop) {\n // Browsers with cancelable scroll events (eg. Firefox) interrupt scrolling animations if scrollTop/scrollLeft is set.\n // Other browsers (eg. Safari) don't scroll as well without the help under certain conditions (DOM or style changes during scrolling).\n // All things considered, this seems to be the best current work around that I'm aware of.\n // For more information see https://github.com/bvaughn/react-virtualized/pull/124\n var scrollPositionChangeReason = event.cancelable ? SCROLL_POSITION_CHANGE_REASONS.OBSERVED : SCROLL_POSITION_CHANGE_REASONS.REQUESTED; // Synchronously set :isScrolling the first time (since _setNextState will reschedule its animation frame each time it's called)\n\n if (!_this.state.isScrolling) {\n isScrollingChange(true);\n }\n\n _this.setState({\n isScrolling: true,\n scrollLeft: scrollLeft,\n scrollPositionChangeReason: scrollPositionChangeReason,\n scrollTop: scrollTop\n });\n }\n\n _this._invokeOnScrollMemoizer({\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n totalWidth: totalWidth,\n totalHeight: totalHeight\n });\n });\n\n _this._scrollbarSize = getScrollbarSize();\n\n if (_this._scrollbarSize === undefined) {\n _this._scrollbarSizeMeasured = false;\n _this._scrollbarSize = 0;\n } else {\n _this._scrollbarSizeMeasured = true;\n }\n\n return _this;\n }\n /**\n * Forced recompute of cell sizes and positions.\n * This function should be called if cell sizes have changed but nothing else has.\n * Since cell positions are calculated by callbacks, the collection view has no way of detecting when the underlying data has changed.\n */\n\n\n _createClass(CollectionView, [{\n key: \"recomputeCellSizesAndPositions\",\n value: function recomputeCellSizesAndPositions() {\n this._calculateSizeAndPositionDataOnNextUpdate = true;\n this.forceUpdate();\n }\n /* ---------------------------- Component lifecycle methods ---------------------------- */\n\n /**\n * @private\n * This method updates scrollLeft/scrollTop in state for the following conditions:\n * 1) Empty content (0 rows or columns)\n * 2) New scroll props overriding the current state\n * 3) Cells-count or cells-size has changed, making previous scroll offsets invalid\n */\n\n }, {\n key: \"componentDidMount\",\n value: function componentDidMount() {\n var _this$props4 = this.props,\n cellLayoutManager = _this$props4.cellLayoutManager,\n scrollLeft = _this$props4.scrollLeft,\n scrollToCell = _this$props4.scrollToCell,\n scrollTop = _this$props4.scrollTop; // If this component was first rendered server-side, scrollbar size will be undefined.\n // In that event we need to remeasure.\n\n if (!this._scrollbarSizeMeasured) {\n this._scrollbarSize = getScrollbarSize();\n this._scrollbarSizeMeasured = true;\n this.setState({});\n }\n\n if (scrollToCell >= 0) {\n this._updateScrollPositionForScrollToCell();\n } else if (scrollLeft >= 0 || scrollTop >= 0) {\n this._setScrollPosition({\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n });\n } // Update onSectionRendered callback.\n\n\n this._invokeOnSectionRenderedHelper();\n\n var _cellLayoutManager$ge2 = cellLayoutManager.getTotalSize(),\n totalHeight = _cellLayoutManager$ge2.height,\n totalWidth = _cellLayoutManager$ge2.width; // Initialize onScroll callback.\n\n\n this._invokeOnScrollMemoizer({\n scrollLeft: scrollLeft || 0,\n scrollTop: scrollTop || 0,\n totalHeight: totalHeight,\n totalWidth: totalWidth\n });\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps, prevState) {\n var _this$props5 = this.props,\n height = _this$props5.height,\n scrollToAlignment = _this$props5.scrollToAlignment,\n scrollToCell = _this$props5.scrollToCell,\n width = _this$props5.width;\n var _this$state2 = this.state,\n scrollLeft = _this$state2.scrollLeft,\n scrollPositionChangeReason = _this$state2.scrollPositionChangeReason,\n scrollTop = _this$state2.scrollTop; // Make sure requested changes to :scrollLeft or :scrollTop get applied.\n // Assigning to scrollLeft/scrollTop tells the browser to interrupt any running scroll animations,\n // And to discard any pending async changes to the scroll position that may have happened in the meantime (e.g. on a separate scrolling thread).\n // So we only set these when we require an adjustment of the scroll position.\n // See issue #2 for more information.\n\n if (scrollPositionChangeReason === SCROLL_POSITION_CHANGE_REASONS.REQUESTED) {\n if (scrollLeft >= 0 && scrollLeft !== prevState.scrollLeft && scrollLeft !== this._scrollingContainer.scrollLeft) {\n this._scrollingContainer.scrollLeft = scrollLeft;\n }\n\n if (scrollTop >= 0 && scrollTop !== prevState.scrollTop && scrollTop !== this._scrollingContainer.scrollTop) {\n this._scrollingContainer.scrollTop = scrollTop;\n }\n } // Update scroll offsets if the current :scrollToCell values requires it\n\n\n if (height !== prevProps.height || scrollToAlignment !== prevProps.scrollToAlignment || scrollToCell !== prevProps.scrollToCell || width !== prevProps.width) {\n this._updateScrollPositionForScrollToCell();\n } // Update onRowsRendered callback if start/stop indices have changed\n\n\n this._invokeOnSectionRenderedHelper();\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n if (this._disablePointerEventsTimeoutId) {\n clearTimeout(this._disablePointerEventsTimeoutId);\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props6 = this.props,\n autoHeight = _this$props6.autoHeight,\n cellCount = _this$props6.cellCount,\n cellLayoutManager = _this$props6.cellLayoutManager,\n className = _this$props6.className,\n height = _this$props6.height,\n horizontalOverscanSize = _this$props6.horizontalOverscanSize,\n id = _this$props6.id,\n noContentRenderer = _this$props6.noContentRenderer,\n style = _this$props6.style,\n verticalOverscanSize = _this$props6.verticalOverscanSize,\n width = _this$props6.width;\n var _this$state3 = this.state,\n isScrolling = _this$state3.isScrolling,\n scrollLeft = _this$state3.scrollLeft,\n scrollTop = _this$state3.scrollTop; // Memoization reset\n\n if (this._lastRenderedCellCount !== cellCount || this._lastRenderedCellLayoutManager !== cellLayoutManager || this._calculateSizeAndPositionDataOnNextUpdate) {\n this._lastRenderedCellCount = cellCount;\n this._lastRenderedCellLayoutManager = cellLayoutManager;\n this._calculateSizeAndPositionDataOnNextUpdate = false;\n cellLayoutManager.calculateSizeAndPositionData();\n }\n\n var _cellLayoutManager$ge3 = cellLayoutManager.getTotalSize(),\n totalHeight = _cellLayoutManager$ge3.height,\n totalWidth = _cellLayoutManager$ge3.width; // Safely expand the rendered area by the specified overscan amount\n\n\n var left = Math.max(0, scrollLeft - horizontalOverscanSize);\n var top = Math.max(0, scrollTop - verticalOverscanSize);\n var right = Math.min(totalWidth, scrollLeft + width + horizontalOverscanSize);\n var bottom = Math.min(totalHeight, scrollTop + height + verticalOverscanSize);\n var childrenToDisplay = height > 0 && width > 0 ? cellLayoutManager.cellRenderers({\n height: bottom - top,\n isScrolling: isScrolling,\n width: right - left,\n x: left,\n y: top\n }) : [];\n var collectionStyle = {\n boxSizing: 'border-box',\n direction: 'ltr',\n height: autoHeight ? 'auto' : height,\n position: 'relative',\n WebkitOverflowScrolling: 'touch',\n width: width,\n willChange: 'transform'\n }; // Force browser to hide scrollbars when we know they aren't necessary.\n // Otherwise once scrollbars appear they may not disappear again.\n // For more info see issue #116\n\n var verticalScrollBarSize = totalHeight > height ? this._scrollbarSize : 0;\n var horizontalScrollBarSize = totalWidth > width ? this._scrollbarSize : 0; // Also explicitly init styles to 'auto' if scrollbars are required.\n // This works around an obscure edge case where external CSS styles have not yet been loaded,\n // But an initial scroll index of offset is set as an external prop.\n // Without this style, Grid would render the correct range of cells but would NOT update its internal offset.\n // This was originally reported via clauderic/react-infinite-calendar/issues/23\n\n collectionStyle.overflowX = totalWidth + verticalScrollBarSize <= width ? 'hidden' : 'auto';\n collectionStyle.overflowY = totalHeight + horizontalScrollBarSize <= height ? 'hidden' : 'auto';\n return React.createElement(\"div\", {\n ref: this._setScrollingContainerRef,\n \"aria-label\": this.props['aria-label'],\n className: clsx('ReactVirtualized__Collection', className),\n id: id,\n onScroll: this._onScroll,\n role: \"grid\",\n style: _objectSpread({}, collectionStyle, {}, style),\n tabIndex: 0\n }, cellCount > 0 && React.createElement(\"div\", {\n className: \"ReactVirtualized__Collection__innerScrollContainer\",\n style: {\n height: totalHeight,\n maxHeight: totalHeight,\n maxWidth: totalWidth,\n overflow: 'hidden',\n pointerEvents: isScrolling ? 'none' : '',\n width: totalWidth\n }\n }, childrenToDisplay), cellCount === 0 && noContentRenderer());\n }\n /* ---------------------------- Helper methods ---------------------------- */\n\n /**\n * Sets an :isScrolling flag for a small window of time.\n * This flag is used to disable pointer events on the scrollable portion of the Collection.\n * This prevents jerky/stuttery mouse-wheel scrolling.\n */\n\n }, {\n key: \"_enablePointerEventsAfterDelay\",\n value: function _enablePointerEventsAfterDelay() {\n var _this2 = this;\n\n if (this._disablePointerEventsTimeoutId) {\n clearTimeout(this._disablePointerEventsTimeoutId);\n }\n\n this._disablePointerEventsTimeoutId = setTimeout(function () {\n var isScrollingChange = _this2.props.isScrollingChange;\n isScrollingChange(false);\n _this2._disablePointerEventsTimeoutId = null;\n\n _this2.setState({\n isScrolling: false\n });\n }, IS_SCROLLING_TIMEOUT);\n }\n }, {\n key: \"_invokeOnScrollMemoizer\",\n value: function _invokeOnScrollMemoizer(_ref) {\n var _this3 = this;\n\n var scrollLeft = _ref.scrollLeft,\n scrollTop = _ref.scrollTop,\n totalHeight = _ref.totalHeight,\n totalWidth = _ref.totalWidth;\n\n this._onScrollMemoizer({\n callback: function callback(_ref2) {\n var scrollLeft = _ref2.scrollLeft,\n scrollTop = _ref2.scrollTop;\n var _this3$props = _this3.props,\n height = _this3$props.height,\n onScroll = _this3$props.onScroll,\n width = _this3$props.width;\n onScroll({\n clientHeight: height,\n clientWidth: width,\n scrollHeight: totalHeight,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n scrollWidth: totalWidth\n });\n },\n indices: {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n }\n });\n }\n }, {\n key: \"_setScrollPosition\",\n value: function _setScrollPosition(_ref3) {\n var scrollLeft = _ref3.scrollLeft,\n scrollTop = _ref3.scrollTop;\n var newState = {\n scrollPositionChangeReason: SCROLL_POSITION_CHANGE_REASONS.REQUESTED\n };\n\n if (scrollLeft >= 0) {\n newState.scrollLeft = scrollLeft;\n }\n\n if (scrollTop >= 0) {\n newState.scrollTop = scrollTop;\n }\n\n if (scrollLeft >= 0 && scrollLeft !== this.state.scrollLeft || scrollTop >= 0 && scrollTop !== this.state.scrollTop) {\n this.setState(newState);\n }\n }\n }], [{\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n if (nextProps.cellCount === 0 && (prevState.scrollLeft !== 0 || prevState.scrollTop !== 0)) {\n return {\n scrollLeft: 0,\n scrollTop: 0,\n scrollPositionChangeReason: SCROLL_POSITION_CHANGE_REASONS.REQUESTED\n };\n } else if (nextProps.scrollLeft !== prevState.scrollLeft || nextProps.scrollTop !== prevState.scrollTop) {\n return {\n scrollLeft: nextProps.scrollLeft != null ? nextProps.scrollLeft : prevState.scrollLeft,\n scrollTop: nextProps.scrollTop != null ? nextProps.scrollTop : prevState.scrollTop,\n scrollPositionChangeReason: SCROLL_POSITION_CHANGE_REASONS.REQUESTED\n };\n }\n\n return null;\n }\n }]);\n\n return CollectionView;\n}(React.PureComponent);\n\n_defineProperty(CollectionView, \"defaultProps\", {\n 'aria-label': 'grid',\n horizontalOverscanSize: 0,\n noContentRenderer: function noContentRenderer() {\n return null;\n },\n onScroll: function onScroll() {\n return null;\n },\n onSectionRendered: function onSectionRendered() {\n return null;\n },\n scrollToAlignment: 'auto',\n scrollToCell: -1,\n style: {},\n verticalOverscanSize: 0\n});\n\nCollectionView.propTypes = process.env.NODE_ENV !== \"production\" ? {\n 'aria-label': PropTypes.string,\n\n /**\n * Removes fixed height from the scrollingContainer so that the total height\n * of rows can stretch the window. Intended for use with WindowScroller\n */\n autoHeight: PropTypes.bool,\n\n /**\n * Number of cells in collection.\n */\n cellCount: PropTypes.number.isRequired,\n\n /**\n * Calculates cell sizes and positions and manages rendering the appropriate cells given a specified window.\n */\n cellLayoutManager: PropTypes.object.isRequired,\n\n /**\n * Optional custom CSS class name to attach to root Collection element.\n */\n className: PropTypes.string,\n\n /**\n * Height of Collection; this property determines the number of visible (vs virtualized) rows.\n */\n height: PropTypes.number.isRequired,\n\n /**\n * Optional custom id to attach to root Collection element.\n */\n id: PropTypes.string,\n\n /**\n * Enables the `Collection` to horiontally \"overscan\" its content similar to how `Grid` does.\n * This can reduce flicker around the edges when a user scrolls quickly.\n */\n horizontalOverscanSize: PropTypes.number.isRequired,\n isScrollingChange: PropTypes.func,\n\n /**\n * Optional renderer to be used in place of rows when either :rowCount or :cellCount is 0.\n */\n noContentRenderer: PropTypes.func.isRequired,\n\n /**\n * Callback invoked whenever the scroll offset changes within the inner scrollable region.\n * This callback can be used to sync scrolling between lists, tables, or grids.\n * ({ clientHeight, clientWidth, scrollHeight, scrollLeft, scrollTop, scrollWidth }): void\n */\n onScroll: PropTypes.func.isRequired,\n\n /**\n * Callback invoked with information about the section of the Collection that was just rendered.\n * This callback is passed a named :indices parameter which is an Array of the most recently rendered section indices.\n */\n onSectionRendered: PropTypes.func.isRequired,\n\n /**\n * Horizontal offset.\n */\n scrollLeft: PropTypes.number,\n\n /**\n * Controls scroll-to-cell behavior of the Grid.\n * The default (\"auto\") scrolls the least amount possible to ensure that the specified cell is fully visible.\n * Use \"start\" to align cells to the top/left of the Grid and \"end\" to align bottom/right.\n */\n scrollToAlignment: PropTypes.oneOf(['auto', 'end', 'start', 'center']).isRequired,\n\n /**\n * Cell index to ensure visible (by forcefully scrolling if necessary).\n */\n scrollToCell: PropTypes.number.isRequired,\n\n /**\n * Vertical offset.\n */\n scrollTop: PropTypes.number,\n\n /**\n * Optional custom inline style to attach to root Collection element.\n */\n style: PropTypes.object,\n\n /**\n * Enables the `Collection` to vertically \"overscan\" its content similar to how `Grid` does.\n * This can reduce flicker around the edges when a user scrolls quickly.\n */\n verticalOverscanSize: PropTypes.number.isRequired,\n\n /**\n * Width of Collection; this property determines the number of visible (vs virtualized) columns.\n */\n width: PropTypes.number.isRequired\n} : {};\npolyfill(CollectionView);\nexport default CollectionView;","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\n\n/**\n * A section of the Window.\n * Window Sections are used to group nearby cells.\n * This enables us to more quickly determine which cells to display in a given region of the Window.\n * Sections have a fixed size and contain 0 to many cells (tracked by their indices).\n */\nvar Section =\n/*#__PURE__*/\nfunction () {\n function Section(_ref) {\n var height = _ref.height,\n width = _ref.width,\n x = _ref.x,\n y = _ref.y;\n\n _classCallCheck(this, Section);\n\n this.height = height;\n this.width = width;\n this.x = x;\n this.y = y;\n this._indexMap = {};\n this._indices = [];\n }\n /** Add a cell to this section. */\n\n\n _createClass(Section, [{\n key: \"addCellIndex\",\n value: function addCellIndex(_ref2) {\n var index = _ref2.index;\n\n if (!this._indexMap[index]) {\n this._indexMap[index] = true;\n\n this._indices.push(index);\n }\n }\n /** Get all cell indices that have been added to this section. */\n\n }, {\n key: \"getCellIndices\",\n value: function getCellIndices() {\n return this._indices;\n }\n /** Intended for debugger/test purposes only */\n\n }, {\n key: \"toString\",\n value: function toString() {\n return \"\".concat(this.x, \",\").concat(this.y, \" \").concat(this.width, \"x\").concat(this.height);\n }\n }]);\n\n return Section;\n}();\n\nexport { Section as default };\nimport { bpfrpt_proptype_Index } from \"./types\";\nimport { bpfrpt_proptype_SizeAndPositionInfo } from \"./types\";","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\n\n/**\n * Window Sections are used to group nearby cells.\n * This enables us to more quickly determine which cells to display in a given region of the Window.\n * \n */\nimport Section from './Section';\nvar SECTION_SIZE = 100;\n\n/**\n * Contains 0 to many Sections.\n * Grows (and adds Sections) dynamically as cells are registered.\n * Automatically adds cells to the appropriate Section(s).\n */\nvar SectionManager =\n/*#__PURE__*/\nfunction () {\n function SectionManager() {\n var sectionSize = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : SECTION_SIZE;\n\n _classCallCheck(this, SectionManager);\n\n this._sectionSize = sectionSize;\n this._cellMetadata = [];\n this._sections = {};\n }\n /**\n * Gets all cell indices contained in the specified region.\n * A region may encompass 1 or more Sections.\n */\n\n\n _createClass(SectionManager, [{\n key: \"getCellIndices\",\n value: function getCellIndices(_ref) {\n var height = _ref.height,\n width = _ref.width,\n x = _ref.x,\n y = _ref.y;\n var indices = {};\n this.getSections({\n height: height,\n width: width,\n x: x,\n y: y\n }).forEach(function (section) {\n return section.getCellIndices().forEach(function (index) {\n indices[index] = index;\n });\n }); // Object keys are strings; this function returns numbers\n\n return Object.keys(indices).map(function (index) {\n return indices[index];\n });\n }\n /** Get size and position information for the cell specified. */\n\n }, {\n key: \"getCellMetadata\",\n value: function getCellMetadata(_ref2) {\n var index = _ref2.index;\n return this._cellMetadata[index];\n }\n /** Get all Sections overlapping the specified region. */\n\n }, {\n key: \"getSections\",\n value: function getSections(_ref3) {\n var height = _ref3.height,\n width = _ref3.width,\n x = _ref3.x,\n y = _ref3.y;\n var sectionXStart = Math.floor(x / this._sectionSize);\n var sectionXStop = Math.floor((x + width - 1) / this._sectionSize);\n var sectionYStart = Math.floor(y / this._sectionSize);\n var sectionYStop = Math.floor((y + height - 1) / this._sectionSize);\n var sections = [];\n\n for (var sectionX = sectionXStart; sectionX <= sectionXStop; sectionX++) {\n for (var sectionY = sectionYStart; sectionY <= sectionYStop; sectionY++) {\n var key = \"\".concat(sectionX, \".\").concat(sectionY);\n\n if (!this._sections[key]) {\n this._sections[key] = new Section({\n height: this._sectionSize,\n width: this._sectionSize,\n x: sectionX * this._sectionSize,\n y: sectionY * this._sectionSize\n });\n }\n\n sections.push(this._sections[key]);\n }\n }\n\n return sections;\n }\n /** Total number of Sections based on the currently registered cells. */\n\n }, {\n key: \"getTotalSectionCount\",\n value: function getTotalSectionCount() {\n return Object.keys(this._sections).length;\n }\n /** Intended for debugger/test purposes only */\n\n }, {\n key: \"toString\",\n value: function toString() {\n var _this = this;\n\n return Object.keys(this._sections).map(function (index) {\n return _this._sections[index].toString();\n });\n }\n /** Adds a cell to the appropriate Sections and registers it metadata for later retrievable. */\n\n }, {\n key: \"registerCell\",\n value: function registerCell(_ref4) {\n var cellMetadatum = _ref4.cellMetadatum,\n index = _ref4.index;\n this._cellMetadata[index] = cellMetadatum;\n this.getSections(cellMetadatum).forEach(function (section) {\n return section.addCellIndex({\n index: index\n });\n });\n }\n }]);\n\n return SectionManager;\n}();\n\nexport { SectionManager as default };\nimport { bpfrpt_proptype_Index } from \"./types\";\nimport { bpfrpt_proptype_SizeAndPositionInfo } from \"./types\";","/**\n * Determines a new offset that ensures a certain cell is visible, given the current offset.\n * If the cell is already visible then the current offset will be returned.\n * If the current offset is too great or small, it will be adjusted just enough to ensure the specified index is visible.\n *\n * @param align Desired alignment within container; one of \"auto\" (default), \"start\", or \"end\"\n * @param cellOffset Offset (x or y) position for cell\n * @param cellSize Size (width or height) of cell\n * @param containerSize Total size (width or height) of the container\n * @param currentOffset Container's current (x or y) offset\n * @return Offset to use to ensure the specified cell is visible\n */\nexport default function getUpdatedOffsetForIndex(_ref) {\n var _ref$align = _ref.align,\n align = _ref$align === void 0 ? 'auto' : _ref$align,\n cellOffset = _ref.cellOffset,\n cellSize = _ref.cellSize,\n containerSize = _ref.containerSize,\n currentOffset = _ref.currentOffset;\n var maxOffset = cellOffset;\n var minOffset = maxOffset - containerSize + cellSize;\n\n switch (align) {\n case 'start':\n return maxOffset;\n\n case 'end':\n return minOffset;\n\n case 'center':\n return maxOffset - (containerSize - cellSize) / 2;\n\n default:\n return Math.max(minOffset, Math.min(maxOffset, currentOffset));\n }\n}","import _extends from \"@babel/runtime/helpers/extends\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\nimport CollectionView from './CollectionView';\nimport _calculateSizeAndPositionData from './utils/calculateSizeAndPositionData';\nimport getUpdatedOffsetForIndex from '../utils/getUpdatedOffsetForIndex';\n\n/**\n * Renders scattered or non-linear data.\n * Unlike Grid, which renders checkerboard data, Collection can render arbitrarily positioned- even overlapping- data.\n */\nvar Collection =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(Collection, _React$PureComponent);\n\n function Collection(props, context) {\n var _this;\n\n _classCallCheck(this, Collection);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(Collection).call(this, props, context));\n _this._cellMetadata = [];\n _this._lastRenderedCellIndices = []; // Cell cache during scroll (for performance)\n\n _this._cellCache = [];\n _this._isScrollingChange = _this._isScrollingChange.bind(_assertThisInitialized(_this));\n _this._setCollectionViewRef = _this._setCollectionViewRef.bind(_assertThisInitialized(_this));\n return _this;\n }\n\n _createClass(Collection, [{\n key: \"forceUpdate\",\n value: function forceUpdate() {\n if (this._collectionView !== undefined) {\n this._collectionView.forceUpdate();\n }\n }\n /** See Collection#recomputeCellSizesAndPositions */\n\n }, {\n key: \"recomputeCellSizesAndPositions\",\n value: function recomputeCellSizesAndPositions() {\n this._cellCache = [];\n\n this._collectionView.recomputeCellSizesAndPositions();\n }\n /** React lifecycle methods */\n\n }, {\n key: \"render\",\n value: function render() {\n var props = _extends({}, this.props);\n\n return React.createElement(CollectionView, _extends({\n cellLayoutManager: this,\n isScrollingChange: this._isScrollingChange,\n ref: this._setCollectionViewRef\n }, props));\n }\n /** CellLayoutManager interface */\n\n }, {\n key: \"calculateSizeAndPositionData\",\n value: function calculateSizeAndPositionData() {\n var _this$props = this.props,\n cellCount = _this$props.cellCount,\n cellSizeAndPositionGetter = _this$props.cellSizeAndPositionGetter,\n sectionSize = _this$props.sectionSize;\n\n var data = _calculateSizeAndPositionData({\n cellCount: cellCount,\n cellSizeAndPositionGetter: cellSizeAndPositionGetter,\n sectionSize: sectionSize\n });\n\n this._cellMetadata = data.cellMetadata;\n this._sectionManager = data.sectionManager;\n this._height = data.height;\n this._width = data.width;\n }\n /**\n * Returns the most recently rendered set of cell indices.\n */\n\n }, {\n key: \"getLastRenderedIndices\",\n value: function getLastRenderedIndices() {\n return this._lastRenderedCellIndices;\n }\n /**\n * Calculates the minimum amount of change from the current scroll position to ensure the specified cell is (fully) visible.\n */\n\n }, {\n key: \"getScrollPositionForCell\",\n value: function getScrollPositionForCell(_ref) {\n var align = _ref.align,\n cellIndex = _ref.cellIndex,\n height = _ref.height,\n scrollLeft = _ref.scrollLeft,\n scrollTop = _ref.scrollTop,\n width = _ref.width;\n var cellCount = this.props.cellCount;\n\n if (cellIndex >= 0 && cellIndex < cellCount) {\n var cellMetadata = this._cellMetadata[cellIndex];\n scrollLeft = getUpdatedOffsetForIndex({\n align: align,\n cellOffset: cellMetadata.x,\n cellSize: cellMetadata.width,\n containerSize: width,\n currentOffset: scrollLeft,\n targetIndex: cellIndex\n });\n scrollTop = getUpdatedOffsetForIndex({\n align: align,\n cellOffset: cellMetadata.y,\n cellSize: cellMetadata.height,\n containerSize: height,\n currentOffset: scrollTop,\n targetIndex: cellIndex\n });\n }\n\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n }\n }, {\n key: \"getTotalSize\",\n value: function getTotalSize() {\n return {\n height: this._height,\n width: this._width\n };\n }\n }, {\n key: \"cellRenderers\",\n value: function cellRenderers(_ref2) {\n var _this2 = this;\n\n var height = _ref2.height,\n isScrolling = _ref2.isScrolling,\n width = _ref2.width,\n x = _ref2.x,\n y = _ref2.y;\n var _this$props2 = this.props,\n cellGroupRenderer = _this$props2.cellGroupRenderer,\n cellRenderer = _this$props2.cellRenderer; // Store for later calls to getLastRenderedIndices()\n\n this._lastRenderedCellIndices = this._sectionManager.getCellIndices({\n height: height,\n width: width,\n x: x,\n y: y\n });\n return cellGroupRenderer({\n cellCache: this._cellCache,\n cellRenderer: cellRenderer,\n cellSizeAndPositionGetter: function cellSizeAndPositionGetter(_ref3) {\n var index = _ref3.index;\n return _this2._sectionManager.getCellMetadata({\n index: index\n });\n },\n indices: this._lastRenderedCellIndices,\n isScrolling: isScrolling\n });\n }\n }, {\n key: \"_isScrollingChange\",\n value: function _isScrollingChange(isScrolling) {\n if (!isScrolling) {\n this._cellCache = [];\n }\n }\n }, {\n key: \"_setCollectionViewRef\",\n value: function _setCollectionViewRef(ref) {\n this._collectionView = ref;\n }\n }]);\n\n return Collection;\n}(React.PureComponent);\n\n_defineProperty(Collection, \"defaultProps\", {\n 'aria-label': 'grid',\n cellGroupRenderer: defaultCellGroupRenderer\n});\n\nexport { Collection as default };\nCollection.propTypes = process.env.NODE_ENV !== \"production\" ? {\n 'aria-label': PropTypes.string,\n\n /**\n * Number of cells in Collection.\n */\n cellCount: PropTypes.number.isRequired,\n\n /**\n * Responsible for rendering a group of cells given their indices.\n * Should implement the following interface: ({\n * cellSizeAndPositionGetter:Function,\n * indices: Array ,\n * cellRenderer: Function\n * }): Array \n */\n cellGroupRenderer: PropTypes.func.isRequired,\n\n /**\n * Responsible for rendering a cell given an row and column index.\n * Should implement the following interface: ({ index: number, key: string, style: object }): PropTypes.element\n */\n cellRenderer: PropTypes.func.isRequired,\n\n /**\n * Callback responsible for returning size and offset/position information for a given cell (index).\n * ({ index: number }): { height: number, width: number, x: number, y: number }\n */\n cellSizeAndPositionGetter: PropTypes.func.isRequired,\n\n /**\n * Optionally override the size of the sections a Collection's cells are split into.\n */\n sectionSize: PropTypes.number\n} : {};\n\nfunction defaultCellGroupRenderer(_ref4) {\n var cellCache = _ref4.cellCache,\n cellRenderer = _ref4.cellRenderer,\n cellSizeAndPositionGetter = _ref4.cellSizeAndPositionGetter,\n indices = _ref4.indices,\n isScrolling = _ref4.isScrolling;\n return indices.map(function (index) {\n var cellMetadata = cellSizeAndPositionGetter({\n index: index\n });\n var cellRendererProps = {\n index: index,\n isScrolling: isScrolling,\n key: index,\n style: {\n height: cellMetadata.height,\n left: cellMetadata.x,\n position: 'absolute',\n top: cellMetadata.y,\n width: cellMetadata.width\n }\n }; // Avoid re-creating cells while scrolling.\n // This can lead to the same cell being created many times and can cause performance issues for \"heavy\" cells.\n // If a scroll is in progress- cache and reuse cells.\n // This cache will be thrown away once scrolling complets.\n\n if (isScrolling) {\n if (!(index in cellCache)) {\n cellCache[index] = cellRenderer(cellRendererProps);\n }\n\n return cellCache[index];\n } else {\n return cellRenderer(cellRendererProps);\n }\n }).filter(function (renderedCell) {\n return !!renderedCell;\n });\n}\n\nimport { bpfrpt_proptype_ScrollPosition } from \"./types\";\nimport { bpfrpt_proptype_SizeInfo } from \"./types\";","import SectionManager from '../SectionManager';\nexport default function calculateSizeAndPositionData(_ref) {\n var cellCount = _ref.cellCount,\n cellSizeAndPositionGetter = _ref.cellSizeAndPositionGetter,\n sectionSize = _ref.sectionSize;\n var cellMetadata = [];\n var sectionManager = new SectionManager(sectionSize);\n var height = 0;\n var width = 0;\n\n for (var index = 0; index < cellCount; index++) {\n var cellMetadatum = cellSizeAndPositionGetter({\n index: index\n });\n\n if (cellMetadatum.height == null || isNaN(cellMetadatum.height) || cellMetadatum.width == null || isNaN(cellMetadatum.width) || cellMetadatum.x == null || isNaN(cellMetadatum.x) || cellMetadatum.y == null || isNaN(cellMetadatum.y)) {\n throw Error(\"Invalid metadata returned for cell \".concat(index, \":\\n x:\").concat(cellMetadatum.x, \", y:\").concat(cellMetadatum.y, \", width:\").concat(cellMetadatum.width, \", height:\").concat(cellMetadatum.height));\n }\n\n height = Math.max(height, cellMetadatum.y + cellMetadatum.height);\n width = Math.max(width, cellMetadatum.x + cellMetadatum.width);\n cellMetadata[index] = cellMetadatum;\n sectionManager.registerCell({\n cellMetadatum: cellMetadatum,\n index: index\n });\n }\n\n return {\n cellMetadata: cellMetadata,\n height: height,\n sectionManager: sectionManager,\n width: width\n };\n}","import Collection from './Collection';\nexport default Collection;\nexport { Collection };","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\n/**\n * High-order component that auto-calculates column-widths for `Grid` cells.\n */\n\nvar ColumnSizer =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(ColumnSizer, _React$PureComponent);\n\n function ColumnSizer(props, context) {\n var _this;\n\n _classCallCheck(this, ColumnSizer);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(ColumnSizer).call(this, props, context));\n _this._registerChild = _this._registerChild.bind(_assertThisInitialized(_this));\n return _this;\n }\n\n _createClass(ColumnSizer, [{\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps) {\n var _this$props = this.props,\n columnMaxWidth = _this$props.columnMaxWidth,\n columnMinWidth = _this$props.columnMinWidth,\n columnCount = _this$props.columnCount,\n width = _this$props.width;\n\n if (columnMaxWidth !== prevProps.columnMaxWidth || columnMinWidth !== prevProps.columnMinWidth || columnCount !== prevProps.columnCount || width !== prevProps.width) {\n if (this._registeredChild) {\n this._registeredChild.recomputeGridSize();\n }\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props2 = this.props,\n children = _this$props2.children,\n columnMaxWidth = _this$props2.columnMaxWidth,\n columnMinWidth = _this$props2.columnMinWidth,\n columnCount = _this$props2.columnCount,\n width = _this$props2.width;\n var safeColumnMinWidth = columnMinWidth || 1;\n var safeColumnMaxWidth = columnMaxWidth ? Math.min(columnMaxWidth, width) : width;\n var columnWidth = width / columnCount;\n columnWidth = Math.max(safeColumnMinWidth, columnWidth);\n columnWidth = Math.min(safeColumnMaxWidth, columnWidth);\n columnWidth = Math.floor(columnWidth);\n var adjustedWidth = Math.min(width, columnWidth * columnCount);\n return children({\n adjustedWidth: adjustedWidth,\n columnWidth: columnWidth,\n getColumnWidth: function getColumnWidth() {\n return columnWidth;\n },\n registerChild: this._registerChild\n });\n }\n }, {\n key: \"_registerChild\",\n value: function _registerChild(child) {\n if (child && typeof child.recomputeGridSize !== 'function') {\n throw Error('Unexpected child type registered; only Grid/MultiGrid children are supported.');\n }\n\n this._registeredChild = child;\n\n if (this._registeredChild) {\n this._registeredChild.recomputeGridSize();\n }\n }\n }]);\n\n return ColumnSizer;\n}(React.PureComponent);\n\nexport { ColumnSizer as default };\nColumnSizer.propTypes = process.env.NODE_ENV !== \"production\" ? {\n /**\n * Function responsible for rendering a virtualized Grid.\n * This function should implement the following signature:\n * ({ adjustedWidth, getColumnWidth, registerChild }) => PropTypes.element\n *\n * The specified :getColumnWidth function should be passed to the Grid's :columnWidth property.\n * The :registerChild should be passed to the Grid's :ref property.\n * The :adjustedWidth property is optional; it reflects the lesser of the overall width or the width of all columns.\n */\n children: PropTypes.func.isRequired,\n\n /** Optional maximum allowed column width */\n columnMaxWidth: PropTypes.number,\n\n /** Optional minimum allowed column width */\n columnMinWidth: PropTypes.number,\n\n /** Number of columns in Grid or Table child */\n columnCount: PropTypes.number.isRequired,\n\n /** Width of Grid or Table child */\n width: PropTypes.number.isRequired\n} : {};","import ColumnSizer from './ColumnSizer';\nexport default ColumnSizer;\nexport { ColumnSizer };","import _toConsumableArray from \"@babel/runtime/helpers/toConsumableArray\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nimport * as React from 'react';\nimport PropTypes from 'prop-types';\nimport createCallbackMemoizer from '../utils/createCallbackMemoizer';\n/**\n * Higher-order component that manages lazy-loading for \"infinite\" data.\n * This component decorates a virtual component and just-in-time prefetches rows as a user scrolls.\n * It is intended as a convenience component; fork it if you'd like finer-grained control over data-loading.\n */\n\nvar InfiniteLoader =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(InfiniteLoader, _React$PureComponent);\n\n function InfiniteLoader(props, context) {\n var _this;\n\n _classCallCheck(this, InfiniteLoader);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(InfiniteLoader).call(this, props, context));\n _this._loadMoreRowsMemoizer = createCallbackMemoizer();\n _this._onRowsRendered = _this._onRowsRendered.bind(_assertThisInitialized(_this));\n _this._registerChild = _this._registerChild.bind(_assertThisInitialized(_this));\n return _this;\n }\n\n _createClass(InfiniteLoader, [{\n key: \"resetLoadMoreRowsCache\",\n value: function resetLoadMoreRowsCache(autoReload) {\n this._loadMoreRowsMemoizer = createCallbackMemoizer();\n\n if (autoReload) {\n this._doStuff(this._lastRenderedStartIndex, this._lastRenderedStopIndex);\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var children = this.props.children;\n return children({\n onRowsRendered: this._onRowsRendered,\n registerChild: this._registerChild\n });\n }\n }, {\n key: \"_loadUnloadedRanges\",\n value: function _loadUnloadedRanges(unloadedRanges) {\n var _this2 = this;\n\n var loadMoreRows = this.props.loadMoreRows;\n unloadedRanges.forEach(function (unloadedRange) {\n var promise = loadMoreRows(unloadedRange);\n\n if (promise) {\n promise.then(function () {\n // Refresh the visible rows if any of them have just been loaded.\n // Otherwise they will remain in their unloaded visual state.\n if (isRangeVisible({\n lastRenderedStartIndex: _this2._lastRenderedStartIndex,\n lastRenderedStopIndex: _this2._lastRenderedStopIndex,\n startIndex: unloadedRange.startIndex,\n stopIndex: unloadedRange.stopIndex\n })) {\n if (_this2._registeredChild) {\n forceUpdateReactVirtualizedComponent(_this2._registeredChild, _this2._lastRenderedStartIndex);\n }\n }\n });\n }\n });\n }\n }, {\n key: \"_onRowsRendered\",\n value: function _onRowsRendered(_ref) {\n var startIndex = _ref.startIndex,\n stopIndex = _ref.stopIndex;\n this._lastRenderedStartIndex = startIndex;\n this._lastRenderedStopIndex = stopIndex;\n\n this._doStuff(startIndex, stopIndex);\n }\n }, {\n key: \"_doStuff\",\n value: function _doStuff(startIndex, stopIndex) {\n var _ref2,\n _this3 = this;\n\n var _this$props = this.props,\n isRowLoaded = _this$props.isRowLoaded,\n minimumBatchSize = _this$props.minimumBatchSize,\n rowCount = _this$props.rowCount,\n threshold = _this$props.threshold;\n var unloadedRanges = scanForUnloadedRanges({\n isRowLoaded: isRowLoaded,\n minimumBatchSize: minimumBatchSize,\n rowCount: rowCount,\n startIndex: Math.max(0, startIndex - threshold),\n stopIndex: Math.min(rowCount - 1, stopIndex + threshold)\n }); // For memoize comparison\n\n var squashedUnloadedRanges = (_ref2 = []).concat.apply(_ref2, _toConsumableArray(unloadedRanges.map(function (_ref3) {\n var startIndex = _ref3.startIndex,\n stopIndex = _ref3.stopIndex;\n return [startIndex, stopIndex];\n })));\n\n this._loadMoreRowsMemoizer({\n callback: function callback() {\n _this3._loadUnloadedRanges(unloadedRanges);\n },\n indices: {\n squashedUnloadedRanges: squashedUnloadedRanges\n }\n });\n }\n }, {\n key: \"_registerChild\",\n value: function _registerChild(registeredChild) {\n this._registeredChild = registeredChild;\n }\n }]);\n\n return InfiniteLoader;\n}(React.PureComponent);\n/**\n * Determines if the specified start/stop range is visible based on the most recently rendered range.\n */\n\n\n_defineProperty(InfiniteLoader, \"defaultProps\", {\n minimumBatchSize: 10,\n rowCount: 0,\n threshold: 15\n});\n\nexport { InfiniteLoader as default };\nInfiniteLoader.propTypes = process.env.NODE_ENV !== \"production\" ? {\n /**\n * Function responsible for rendering a virtualized component.\n * This function should implement the following signature:\n * ({ onRowsRendered, registerChild }) => PropTypes.element\n *\n * The specified :onRowsRendered function should be passed through to the child's :onRowsRendered property.\n * The :registerChild callback should be set as the virtualized component's :ref.\n */\n children: PropTypes.func.isRequired,\n\n /**\n * Function responsible for tracking the loaded state of each row.\n * It should implement the following signature: ({ index: number }): boolean\n */\n isRowLoaded: PropTypes.func.isRequired,\n\n /**\n * Callback to be invoked when more rows must be loaded.\n * It should implement the following signature: ({ startIndex, stopIndex }): Promise\n * The returned Promise should be resolved once row data has finished loading.\n * It will be used to determine when to refresh the list with the newly-loaded data.\n * This callback may be called multiple times in reaction to a single scroll event.\n */\n loadMoreRows: PropTypes.func.isRequired,\n\n /**\n * Minimum number of rows to be loaded at a time.\n * This property can be used to batch requests to reduce HTTP requests.\n */\n minimumBatchSize: PropTypes.number.isRequired,\n\n /**\n * Number of rows in list; can be arbitrary high number if actual number is unknown.\n */\n rowCount: PropTypes.number.isRequired,\n\n /**\n * Threshold at which to pre-fetch data.\n * A threshold X means that data will start loading when a user scrolls within X rows.\n * This value defaults to 15.\n */\n threshold: PropTypes.number.isRequired\n} : {};\nexport function isRangeVisible(_ref4) {\n var lastRenderedStartIndex = _ref4.lastRenderedStartIndex,\n lastRenderedStopIndex = _ref4.lastRenderedStopIndex,\n startIndex = _ref4.startIndex,\n stopIndex = _ref4.stopIndex;\n return !(startIndex > lastRenderedStopIndex || stopIndex < lastRenderedStartIndex);\n}\n/**\n * Returns all of the ranges within a larger range that contain unloaded rows.\n */\n\nexport function scanForUnloadedRanges(_ref5) {\n var isRowLoaded = _ref5.isRowLoaded,\n minimumBatchSize = _ref5.minimumBatchSize,\n rowCount = _ref5.rowCount,\n startIndex = _ref5.startIndex,\n stopIndex = _ref5.stopIndex;\n var unloadedRanges = [];\n var rangeStartIndex = null;\n var rangeStopIndex = null;\n\n for (var index = startIndex; index <= stopIndex; index++) {\n var loaded = isRowLoaded({\n index: index\n });\n\n if (!loaded) {\n rangeStopIndex = index;\n\n if (rangeStartIndex === null) {\n rangeStartIndex = index;\n }\n } else if (rangeStopIndex !== null) {\n unloadedRanges.push({\n startIndex: rangeStartIndex,\n stopIndex: rangeStopIndex\n });\n rangeStartIndex = rangeStopIndex = null;\n }\n } // If :rangeStopIndex is not null it means we haven't ran out of unloaded rows.\n // Scan forward to try filling our :minimumBatchSize.\n\n\n if (rangeStopIndex !== null) {\n var potentialStopIndex = Math.min(Math.max(rangeStopIndex, rangeStartIndex + minimumBatchSize - 1), rowCount - 1);\n\n for (var _index = rangeStopIndex + 1; _index <= potentialStopIndex; _index++) {\n if (!isRowLoaded({\n index: _index\n })) {\n rangeStopIndex = _index;\n } else {\n break;\n }\n }\n\n unloadedRanges.push({\n startIndex: rangeStartIndex,\n stopIndex: rangeStopIndex\n });\n } // Check to see if our first range ended prematurely.\n // In this case we should scan backwards to try filling our :minimumBatchSize.\n\n\n if (unloadedRanges.length) {\n var firstUnloadedRange = unloadedRanges[0];\n\n while (firstUnloadedRange.stopIndex - firstUnloadedRange.startIndex + 1 < minimumBatchSize && firstUnloadedRange.startIndex > 0) {\n var _index2 = firstUnloadedRange.startIndex - 1;\n\n if (!isRowLoaded({\n index: _index2\n })) {\n firstUnloadedRange.startIndex = _index2;\n } else {\n break;\n }\n }\n }\n\n return unloadedRanges;\n}\n/**\n * Since RV components use shallowCompare we need to force a render (even though props haven't changed).\n * However InfiniteLoader may wrap a Grid or it may wrap a Table or List.\n * In the first case the built-in React forceUpdate() method is sufficient to force a re-render,\n * But in the latter cases we need to use the RV-specific forceUpdateGrid() method.\n * Else the inner Grid will not be re-rendered and visuals may be stale.\n *\n * Additionally, while a Grid is scrolling the cells can be cached,\n * So it's important to invalidate that cache by recalculating sizes\n * before forcing a rerender.\n */\n\nexport function forceUpdateReactVirtualizedComponent(component) {\n var currentIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;\n var recomputeSize = typeof component.recomputeGridSize === 'function' ? component.recomputeGridSize : component.recomputeRowHeights;\n\n if (recomputeSize) {\n recomputeSize.call(component, currentIndex);\n } else {\n component.forceUpdate();\n }\n}","import InfiniteLoader from './InfiniteLoader';\nexport default InfiniteLoader;\nexport { InfiniteLoader };","import _extends from \"@babel/runtime/helpers/extends\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nvar _class, _temp;\n\nimport Grid, { accessibilityOverscanIndicesGetter } from '../Grid';\nimport * as React from 'react';\nimport clsx from 'clsx';\n/**\n * It is inefficient to create and manage a large list of DOM elements within a scrolling container\n * if only a few of those elements are visible. The primary purpose of this component is to improve\n * performance by only rendering the DOM nodes that a user is able to see based on their current\n * scroll position.\n *\n * This component renders a virtualized list of elements with either fixed or dynamic heights.\n */\n\nvar List = (_temp = _class =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(List, _React$PureComponent);\n\n function List() {\n var _getPrototypeOf2;\n\n var _this;\n\n _classCallCheck(this, List);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(List)).call.apply(_getPrototypeOf2, [this].concat(args)));\n\n _defineProperty(_assertThisInitialized(_this), \"Grid\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_cellRenderer\", function (_ref) {\n var parent = _ref.parent,\n rowIndex = _ref.rowIndex,\n style = _ref.style,\n isScrolling = _ref.isScrolling,\n isVisible = _ref.isVisible,\n key = _ref.key;\n var rowRenderer = _this.props.rowRenderer; // TRICKY The style object is sometimes cached by Grid.\n // This prevents new style objects from bypassing shallowCompare().\n // However as of React 16, style props are auto-frozen (at least in dev mode)\n // Check to make sure we can still modify the style before proceeding.\n // https://github.com/facebook/react/commit/977357765b44af8ff0cfea327866861073095c12#commitcomment-20648713\n\n var widthDescriptor = Object.getOwnPropertyDescriptor(style, 'width');\n\n if (widthDescriptor && widthDescriptor.writable) {\n // By default, List cells should be 100% width.\n // This prevents them from flowing under a scrollbar (if present).\n style.width = '100%';\n }\n\n return rowRenderer({\n index: rowIndex,\n style: style,\n isScrolling: isScrolling,\n isVisible: isVisible,\n key: key,\n parent: parent\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_setRef\", function (ref) {\n _this.Grid = ref;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScroll\", function (_ref2) {\n var clientHeight = _ref2.clientHeight,\n scrollHeight = _ref2.scrollHeight,\n scrollTop = _ref2.scrollTop;\n var onScroll = _this.props.onScroll;\n onScroll({\n clientHeight: clientHeight,\n scrollHeight: scrollHeight,\n scrollTop: scrollTop\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onSectionRendered\", function (_ref3) {\n var rowOverscanStartIndex = _ref3.rowOverscanStartIndex,\n rowOverscanStopIndex = _ref3.rowOverscanStopIndex,\n rowStartIndex = _ref3.rowStartIndex,\n rowStopIndex = _ref3.rowStopIndex;\n var onRowsRendered = _this.props.onRowsRendered;\n onRowsRendered({\n overscanStartIndex: rowOverscanStartIndex,\n overscanStopIndex: rowOverscanStopIndex,\n startIndex: rowStartIndex,\n stopIndex: rowStopIndex\n });\n });\n\n return _this;\n }\n\n _createClass(List, [{\n key: \"forceUpdateGrid\",\n value: function forceUpdateGrid() {\n if (this.Grid) {\n this.Grid.forceUpdate();\n }\n }\n /** See Grid#getOffsetForCell */\n\n }, {\n key: \"getOffsetForRow\",\n value: function getOffsetForRow(_ref4) {\n var alignment = _ref4.alignment,\n index = _ref4.index;\n\n if (this.Grid) {\n var _this$Grid$getOffsetF = this.Grid.getOffsetForCell({\n alignment: alignment,\n rowIndex: index,\n columnIndex: 0\n }),\n scrollTop = _this$Grid$getOffsetF.scrollTop;\n\n return scrollTop;\n }\n\n return 0;\n }\n /** CellMeasurer compatibility */\n\n }, {\n key: \"invalidateCellSizeAfterRender\",\n value: function invalidateCellSizeAfterRender(_ref5) {\n var columnIndex = _ref5.columnIndex,\n rowIndex = _ref5.rowIndex;\n\n if (this.Grid) {\n this.Grid.invalidateCellSizeAfterRender({\n rowIndex: rowIndex,\n columnIndex: columnIndex\n });\n }\n }\n /** See Grid#measureAllCells */\n\n }, {\n key: \"measureAllRows\",\n value: function measureAllRows() {\n if (this.Grid) {\n this.Grid.measureAllCells();\n }\n }\n /** CellMeasurer compatibility */\n\n }, {\n key: \"recomputeGridSize\",\n value: function recomputeGridSize() {\n var _ref6 = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},\n _ref6$columnIndex = _ref6.columnIndex,\n columnIndex = _ref6$columnIndex === void 0 ? 0 : _ref6$columnIndex,\n _ref6$rowIndex = _ref6.rowIndex,\n rowIndex = _ref6$rowIndex === void 0 ? 0 : _ref6$rowIndex;\n\n if (this.Grid) {\n this.Grid.recomputeGridSize({\n rowIndex: rowIndex,\n columnIndex: columnIndex\n });\n }\n }\n /** See Grid#recomputeGridSize */\n\n }, {\n key: \"recomputeRowHeights\",\n value: function recomputeRowHeights() {\n var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;\n\n if (this.Grid) {\n this.Grid.recomputeGridSize({\n rowIndex: index,\n columnIndex: 0\n });\n }\n }\n /** See Grid#scrollToPosition */\n\n }, {\n key: \"scrollToPosition\",\n value: function scrollToPosition() {\n var scrollTop = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;\n\n if (this.Grid) {\n this.Grid.scrollToPosition({\n scrollTop: scrollTop\n });\n }\n }\n /** See Grid#scrollToCell */\n\n }, {\n key: \"scrollToRow\",\n value: function scrollToRow() {\n var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;\n\n if (this.Grid) {\n this.Grid.scrollToCell({\n columnIndex: 0,\n rowIndex: index\n });\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props = this.props,\n className = _this$props.className,\n noRowsRenderer = _this$props.noRowsRenderer,\n scrollToIndex = _this$props.scrollToIndex,\n width = _this$props.width;\n var classNames = clsx('ReactVirtualized__List', className);\n return React.createElement(Grid, _extends({}, this.props, {\n autoContainerWidth: true,\n cellRenderer: this._cellRenderer,\n className: classNames,\n columnWidth: width,\n columnCount: 1,\n noContentRenderer: noRowsRenderer,\n onScroll: this._onScroll,\n onSectionRendered: this._onSectionRendered,\n ref: this._setRef,\n scrollToRow: scrollToIndex\n }));\n }\n }]);\n\n return List;\n}(React.PureComponent), _defineProperty(_class, \"propTypes\", process.env.NODE_ENV === 'production' ? null : {\n \"aria-label\": PropTypes.string,\n\n /**\n * Removes fixed height from the scrollingContainer so that the total height\n * of rows can stretch the window. Intended for use with WindowScroller\n */\n \"autoHeight\": PropTypes.bool.isRequired,\n\n /** Optional CSS class name */\n \"className\": PropTypes.string,\n\n /**\n * Used to estimate the total height of a List before all of its rows have actually been measured.\n * The estimated total height is adjusted as rows are rendered.\n */\n \"estimatedRowSize\": PropTypes.number.isRequired,\n\n /** Height constraint for list (determines how many actual rows are rendered) */\n \"height\": PropTypes.number.isRequired,\n\n /** Optional renderer to be used in place of rows when rowCount is 0 */\n \"noRowsRenderer\": function noRowsRenderer() {\n return (typeof bpfrpt_proptype_NoContentRenderer === \"function\" ? bpfrpt_proptype_NoContentRenderer.isRequired ? bpfrpt_proptype_NoContentRenderer.isRequired : bpfrpt_proptype_NoContentRenderer : PropTypes.shape(bpfrpt_proptype_NoContentRenderer).isRequired).apply(this, arguments);\n },\n\n /** Callback invoked with information about the slice of rows that were just rendered. */\n \"onRowsRendered\": PropTypes.func.isRequired,\n\n /**\n * Callback invoked whenever the scroll offset changes within the inner scrollable region.\n * This callback can be used to sync scrolling between lists, tables, or grids.\n */\n \"onScroll\": PropTypes.func.isRequired,\n\n /** See Grid#overscanIndicesGetter */\n \"overscanIndicesGetter\": function overscanIndicesGetter() {\n return (typeof bpfrpt_proptype_OverscanIndicesGetter === \"function\" ? bpfrpt_proptype_OverscanIndicesGetter.isRequired ? bpfrpt_proptype_OverscanIndicesGetter.isRequired : bpfrpt_proptype_OverscanIndicesGetter : PropTypes.shape(bpfrpt_proptype_OverscanIndicesGetter).isRequired).apply(this, arguments);\n },\n\n /**\n * Number of rows to render above/below the visible bounds of the list.\n * These rows can help for smoother scrolling on touch devices.\n */\n \"overscanRowCount\": PropTypes.number.isRequired,\n\n /** Either a fixed row height (number) or a function that returns the height of a row given its index. */\n \"rowHeight\": function rowHeight() {\n return (typeof bpfrpt_proptype_CellSize === \"function\" ? bpfrpt_proptype_CellSize.isRequired ? bpfrpt_proptype_CellSize.isRequired : bpfrpt_proptype_CellSize : PropTypes.shape(bpfrpt_proptype_CellSize).isRequired).apply(this, arguments);\n },\n\n /** Responsible for rendering a row given an index; ({ index: number }): node */\n \"rowRenderer\": function rowRenderer() {\n return (typeof bpfrpt_proptype_RowRenderer === \"function\" ? bpfrpt_proptype_RowRenderer.isRequired ? bpfrpt_proptype_RowRenderer.isRequired : bpfrpt_proptype_RowRenderer : PropTypes.shape(bpfrpt_proptype_RowRenderer).isRequired).apply(this, arguments);\n },\n\n /** Number of rows in list. */\n \"rowCount\": PropTypes.number.isRequired,\n\n /** See Grid#scrollToAlignment */\n \"scrollToAlignment\": function scrollToAlignment() {\n return (typeof bpfrpt_proptype_Alignment === \"function\" ? bpfrpt_proptype_Alignment.isRequired ? bpfrpt_proptype_Alignment.isRequired : bpfrpt_proptype_Alignment : PropTypes.shape(bpfrpt_proptype_Alignment).isRequired).apply(this, arguments);\n },\n\n /** Row index to ensure visible (by forcefully scrolling if necessary) */\n \"scrollToIndex\": PropTypes.number.isRequired,\n\n /** Vertical offset. */\n \"scrollTop\": PropTypes.number,\n\n /** Optional inline style */\n \"style\": PropTypes.object.isRequired,\n\n /** Tab index for focus */\n \"tabIndex\": PropTypes.number,\n\n /** Width of list */\n \"width\": PropTypes.number.isRequired\n}), _temp);\n\n_defineProperty(List, \"defaultProps\", {\n autoHeight: false,\n estimatedRowSize: 30,\n onScroll: function onScroll() {},\n noRowsRenderer: function noRowsRenderer() {\n return null;\n },\n onRowsRendered: function onRowsRendered() {},\n overscanIndicesGetter: accessibilityOverscanIndicesGetter,\n overscanRowCount: 10,\n scrollToAlignment: 'auto',\n scrollToIndex: -1,\n style: {}\n});\n\nexport { List as default };\nimport { bpfrpt_proptype_NoContentRenderer } from \"../Grid\";\nimport { bpfrpt_proptype_Alignment } from \"../Grid\";\nimport { bpfrpt_proptype_CellSize } from \"../Grid\";\nimport { bpfrpt_proptype_CellPosition } from \"../Grid\";\nimport { bpfrpt_proptype_OverscanIndicesGetter } from \"../Grid\";\nimport { bpfrpt_proptype_RenderedSection } from \"../Grid\";\nimport { bpfrpt_proptype_CellRendererParams } from \"../Grid\";\nimport { bpfrpt_proptype_Scroll as bpfrpt_proptype_GridScroll } from \"../Grid\";\nimport { bpfrpt_proptype_RowRenderer } from \"./types\";\nimport { bpfrpt_proptype_RenderedRows } from \"./types\";\nimport { bpfrpt_proptype_Scroll } from \"./types\";\nimport PropTypes from \"prop-types\";","/**\n * Binary Search Bounds\n * https://github.com/mikolalysenko/binary-search-bounds\n * Mikola Lysenko\n *\n * Inlined because of Content Security Policy issue caused by the use of `new Function(...)` syntax.\n * Issue reported here: https://github.com/mikolalysenko/binary-search-bounds/issues/5\n **/\nfunction _GEA(a, l, h, y) {\n var i = h + 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (x >= y) {\n i = m;\n h = m - 1;\n } else {\n l = m + 1;\n }\n }\n\n return i;\n}\n\nfunction _GEP(a, l, h, y, c) {\n var i = h + 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (c(x, y) >= 0) {\n i = m;\n h = m - 1;\n } else {\n l = m + 1;\n }\n }\n\n return i;\n}\n\nfunction dispatchBsearchGE(a, y, c, l, h) {\n if (typeof c === 'function') {\n return _GEP(a, l === void 0 ? 0 : l | 0, h === void 0 ? a.length - 1 : h | 0, y, c);\n } else {\n return _GEA(a, c === void 0 ? 0 : c | 0, l === void 0 ? a.length - 1 : l | 0, y);\n }\n}\n\nfunction _GTA(a, l, h, y) {\n var i = h + 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (x > y) {\n i = m;\n h = m - 1;\n } else {\n l = m + 1;\n }\n }\n\n return i;\n}\n\nfunction _GTP(a, l, h, y, c) {\n var i = h + 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (c(x, y) > 0) {\n i = m;\n h = m - 1;\n } else {\n l = m + 1;\n }\n }\n\n return i;\n}\n\nfunction dispatchBsearchGT(a, y, c, l, h) {\n if (typeof c === 'function') {\n return _GTP(a, l === void 0 ? 0 : l | 0, h === void 0 ? a.length - 1 : h | 0, y, c);\n } else {\n return _GTA(a, c === void 0 ? 0 : c | 0, l === void 0 ? a.length - 1 : l | 0, y);\n }\n}\n\nfunction _LTA(a, l, h, y) {\n var i = l - 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (x < y) {\n i = m;\n l = m + 1;\n } else {\n h = m - 1;\n }\n }\n\n return i;\n}\n\nfunction _LTP(a, l, h, y, c) {\n var i = l - 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (c(x, y) < 0) {\n i = m;\n l = m + 1;\n } else {\n h = m - 1;\n }\n }\n\n return i;\n}\n\nfunction dispatchBsearchLT(a, y, c, l, h) {\n if (typeof c === 'function') {\n return _LTP(a, l === void 0 ? 0 : l | 0, h === void 0 ? a.length - 1 : h | 0, y, c);\n } else {\n return _LTA(a, c === void 0 ? 0 : c | 0, l === void 0 ? a.length - 1 : l | 0, y);\n }\n}\n\nfunction _LEA(a, l, h, y) {\n var i = l - 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (x <= y) {\n i = m;\n l = m + 1;\n } else {\n h = m - 1;\n }\n }\n\n return i;\n}\n\nfunction _LEP(a, l, h, y, c) {\n var i = l - 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (c(x, y) <= 0) {\n i = m;\n l = m + 1;\n } else {\n h = m - 1;\n }\n }\n\n return i;\n}\n\nfunction dispatchBsearchLE(a, y, c, l, h) {\n if (typeof c === 'function') {\n return _LEP(a, l === void 0 ? 0 : l | 0, h === void 0 ? a.length - 1 : h | 0, y, c);\n } else {\n return _LEA(a, c === void 0 ? 0 : c | 0, l === void 0 ? a.length - 1 : l | 0, y);\n }\n}\n\nfunction _EQA(a, l, h, y) {\n l - 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n\n if (x === y) {\n return m;\n } else if (x <= y) {\n l = m + 1;\n } else {\n h = m - 1;\n }\n }\n\n return -1;\n}\n\nfunction _EQP(a, l, h, y, c) {\n l - 1;\n\n while (l <= h) {\n var m = l + h >>> 1,\n x = a[m];\n var p = c(x, y);\n\n if (p === 0) {\n return m;\n } else if (p <= 0) {\n l = m + 1;\n } else {\n h = m - 1;\n }\n }\n\n return -1;\n}\n\nfunction dispatchBsearchEQ(a, y, c, l, h) {\n if (typeof c === 'function') {\n return _EQP(a, l === void 0 ? 0 : l | 0, h === void 0 ? a.length - 1 : h | 0, y, c);\n } else {\n return _EQA(a, c === void 0 ? 0 : c | 0, l === void 0 ? a.length - 1 : l | 0, y);\n }\n}\n\nexport default {\n ge: dispatchBsearchGE,\n gt: dispatchBsearchGT,\n lt: dispatchBsearchLT,\n le: dispatchBsearchLE,\n eq: dispatchBsearchEQ\n};","/**\n * Binary Search Bounds\n * https://github.com/mikolalysenko/interval-tree-1d\n * Mikola Lysenko\n *\n * Inlined because of Content Security Policy issue caused by the use of `new Function(...)` syntax in an upstream dependency.\n * Issue reported here: https://github.com/mikolalysenko/binary-search-bounds/issues/5\n **/\nimport bounds from './binarySearchBounds';\nvar NOT_FOUND = 0;\nvar SUCCESS = 1;\nvar EMPTY = 2;\n\nfunction IntervalTreeNode(mid, left, right, leftPoints, rightPoints) {\n this.mid = mid;\n this.left = left;\n this.right = right;\n this.leftPoints = leftPoints;\n this.rightPoints = rightPoints;\n this.count = (left ? left.count : 0) + (right ? right.count : 0) + leftPoints.length;\n}\n\nvar proto = IntervalTreeNode.prototype;\n\nfunction copy(a, b) {\n a.mid = b.mid;\n a.left = b.left;\n a.right = b.right;\n a.leftPoints = b.leftPoints;\n a.rightPoints = b.rightPoints;\n a.count = b.count;\n}\n\nfunction rebuild(node, intervals) {\n var ntree = createIntervalTree(intervals);\n node.mid = ntree.mid;\n node.left = ntree.left;\n node.right = ntree.right;\n node.leftPoints = ntree.leftPoints;\n node.rightPoints = ntree.rightPoints;\n node.count = ntree.count;\n}\n\nfunction rebuildWithInterval(node, interval) {\n var intervals = node.intervals([]);\n intervals.push(interval);\n rebuild(node, intervals);\n}\n\nfunction rebuildWithoutInterval(node, interval) {\n var intervals = node.intervals([]);\n var idx = intervals.indexOf(interval);\n\n if (idx < 0) {\n return NOT_FOUND;\n }\n\n intervals.splice(idx, 1);\n rebuild(node, intervals);\n return SUCCESS;\n}\n\nproto.intervals = function (result) {\n result.push.apply(result, this.leftPoints);\n\n if (this.left) {\n this.left.intervals(result);\n }\n\n if (this.right) {\n this.right.intervals(result);\n }\n\n return result;\n};\n\nproto.insert = function (interval) {\n var weight = this.count - this.leftPoints.length;\n this.count += 1;\n\n if (interval[1] < this.mid) {\n if (this.left) {\n if (4 * (this.left.count + 1) > 3 * (weight + 1)) {\n rebuildWithInterval(this, interval);\n } else {\n this.left.insert(interval);\n }\n } else {\n this.left = createIntervalTree([interval]);\n }\n } else if (interval[0] > this.mid) {\n if (this.right) {\n if (4 * (this.right.count + 1) > 3 * (weight + 1)) {\n rebuildWithInterval(this, interval);\n } else {\n this.right.insert(interval);\n }\n } else {\n this.right = createIntervalTree([interval]);\n }\n } else {\n var l = bounds.ge(this.leftPoints, interval, compareBegin);\n var r = bounds.ge(this.rightPoints, interval, compareEnd);\n this.leftPoints.splice(l, 0, interval);\n this.rightPoints.splice(r, 0, interval);\n }\n};\n\nproto.remove = function (interval) {\n var weight = this.count - this.leftPoints;\n\n if (interval[1] < this.mid) {\n if (!this.left) {\n return NOT_FOUND;\n }\n\n var rw = this.right ? this.right.count : 0;\n\n if (4 * rw > 3 * (weight - 1)) {\n return rebuildWithoutInterval(this, interval);\n }\n\n var r = this.left.remove(interval);\n\n if (r === EMPTY) {\n this.left = null;\n this.count -= 1;\n return SUCCESS;\n } else if (r === SUCCESS) {\n this.count -= 1;\n }\n\n return r;\n } else if (interval[0] > this.mid) {\n if (!this.right) {\n return NOT_FOUND;\n }\n\n var lw = this.left ? this.left.count : 0;\n\n if (4 * lw > 3 * (weight - 1)) {\n return rebuildWithoutInterval(this, interval);\n }\n\n var r = this.right.remove(interval);\n\n if (r === EMPTY) {\n this.right = null;\n this.count -= 1;\n return SUCCESS;\n } else if (r === SUCCESS) {\n this.count -= 1;\n }\n\n return r;\n } else {\n if (this.count === 1) {\n if (this.leftPoints[0] === interval) {\n return EMPTY;\n } else {\n return NOT_FOUND;\n }\n }\n\n if (this.leftPoints.length === 1 && this.leftPoints[0] === interval) {\n if (this.left && this.right) {\n var p = this;\n var n = this.left;\n\n while (n.right) {\n p = n;\n n = n.right;\n }\n\n if (p === this) {\n n.right = this.right;\n } else {\n var l = this.left;\n var r = this.right;\n p.count -= n.count;\n p.right = n.left;\n n.left = l;\n n.right = r;\n }\n\n copy(this, n);\n this.count = (this.left ? this.left.count : 0) + (this.right ? this.right.count : 0) + this.leftPoints.length;\n } else if (this.left) {\n copy(this, this.left);\n } else {\n copy(this, this.right);\n }\n\n return SUCCESS;\n }\n\n for (var l = bounds.ge(this.leftPoints, interval, compareBegin); l < this.leftPoints.length; ++l) {\n if (this.leftPoints[l][0] !== interval[0]) {\n break;\n }\n\n if (this.leftPoints[l] === interval) {\n this.count -= 1;\n this.leftPoints.splice(l, 1);\n\n for (var r = bounds.ge(this.rightPoints, interval, compareEnd); r < this.rightPoints.length; ++r) {\n if (this.rightPoints[r][1] !== interval[1]) {\n break;\n } else if (this.rightPoints[r] === interval) {\n this.rightPoints.splice(r, 1);\n return SUCCESS;\n }\n }\n }\n }\n\n return NOT_FOUND;\n }\n};\n\nfunction reportLeftRange(arr, hi, cb) {\n for (var i = 0; i < arr.length && arr[i][0] <= hi; ++i) {\n var r = cb(arr[i]);\n\n if (r) {\n return r;\n }\n }\n}\n\nfunction reportRightRange(arr, lo, cb) {\n for (var i = arr.length - 1; i >= 0 && arr[i][1] >= lo; --i) {\n var r = cb(arr[i]);\n\n if (r) {\n return r;\n }\n }\n}\n\nfunction reportRange(arr, cb) {\n for (var i = 0; i < arr.length; ++i) {\n var r = cb(arr[i]);\n\n if (r) {\n return r;\n }\n }\n}\n\nproto.queryPoint = function (x, cb) {\n if (x < this.mid) {\n if (this.left) {\n var r = this.left.queryPoint(x, cb);\n\n if (r) {\n return r;\n }\n }\n\n return reportLeftRange(this.leftPoints, x, cb);\n } else if (x > this.mid) {\n if (this.right) {\n var r = this.right.queryPoint(x, cb);\n\n if (r) {\n return r;\n }\n }\n\n return reportRightRange(this.rightPoints, x, cb);\n } else {\n return reportRange(this.leftPoints, cb);\n }\n};\n\nproto.queryInterval = function (lo, hi, cb) {\n if (lo < this.mid && this.left) {\n var r = this.left.queryInterval(lo, hi, cb);\n\n if (r) {\n return r;\n }\n }\n\n if (hi > this.mid && this.right) {\n var r = this.right.queryInterval(lo, hi, cb);\n\n if (r) {\n return r;\n }\n }\n\n if (hi < this.mid) {\n return reportLeftRange(this.leftPoints, hi, cb);\n } else if (lo > this.mid) {\n return reportRightRange(this.rightPoints, lo, cb);\n } else {\n return reportRange(this.leftPoints, cb);\n }\n};\n\nfunction compareNumbers(a, b) {\n return a - b;\n}\n\nfunction compareBegin(a, b) {\n var d = a[0] - b[0];\n\n if (d) {\n return d;\n }\n\n return a[1] - b[1];\n}\n\nfunction compareEnd(a, b) {\n var d = a[1] - b[1];\n\n if (d) {\n return d;\n }\n\n return a[0] - b[0];\n}\n\nfunction createIntervalTree(intervals) {\n if (intervals.length === 0) {\n return null;\n }\n\n var pts = [];\n\n for (var i = 0; i < intervals.length; ++i) {\n pts.push(intervals[i][0], intervals[i][1]);\n }\n\n pts.sort(compareNumbers);\n var mid = pts[pts.length >> 1];\n var leftIntervals = [];\n var rightIntervals = [];\n var centerIntervals = [];\n\n for (var i = 0; i < intervals.length; ++i) {\n var s = intervals[i];\n\n if (s[1] < mid) {\n leftIntervals.push(s);\n } else if (mid < s[0]) {\n rightIntervals.push(s);\n } else {\n centerIntervals.push(s);\n }\n } //Split center intervals\n\n\n var leftPoints = centerIntervals;\n var rightPoints = centerIntervals.slice();\n leftPoints.sort(compareBegin);\n rightPoints.sort(compareEnd);\n return new IntervalTreeNode(mid, createIntervalTree(leftIntervals), createIntervalTree(rightIntervals), leftPoints, rightPoints);\n} //User friendly wrapper that makes it possible to support empty trees\n\n\nfunction IntervalTree(root) {\n this.root = root;\n}\n\nvar tproto = IntervalTree.prototype;\n\ntproto.insert = function (interval) {\n if (this.root) {\n this.root.insert(interval);\n } else {\n this.root = new IntervalTreeNode(interval[0], null, null, [interval], [interval]);\n }\n};\n\ntproto.remove = function (interval) {\n if (this.root) {\n var r = this.root.remove(interval);\n\n if (r === EMPTY) {\n this.root = null;\n }\n\n return r !== NOT_FOUND;\n }\n\n return false;\n};\n\ntproto.queryPoint = function (p, cb) {\n if (this.root) {\n return this.root.queryPoint(p, cb);\n }\n};\n\ntproto.queryInterval = function (lo, hi, cb) {\n if (lo <= hi && this.root) {\n return this.root.queryInterval(lo, hi, cb);\n }\n};\n\nObject.defineProperty(tproto, 'count', {\n get: function get() {\n if (this.root) {\n return this.root.count;\n }\n\n return 0;\n }\n});\nObject.defineProperty(tproto, 'intervals', {\n get: function get() {\n if (this.root) {\n return this.root.intervals([]);\n }\n\n return [];\n }\n});\nexport default function createWrapper(intervals) {\n if (!intervals || intervals.length === 0) {\n return new IntervalTree(null);\n }\n\n return new IntervalTree(createIntervalTree(intervals));\n}","import _slicedToArray from \"@babel/runtime/helpers/slicedToArray\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nimport createIntervalTree from '../vendor/intervalTree';\n\n// Position cache requirements:\n// O(log(n)) lookup of cells to render for a given viewport size\n// O(1) lookup of shortest measured column (so we know when to enter phase 1)\nvar PositionCache =\n/*#__PURE__*/\nfunction () {\n function PositionCache() {\n _classCallCheck(this, PositionCache);\n\n _defineProperty(this, \"_columnSizeMap\", {});\n\n _defineProperty(this, \"_intervalTree\", createIntervalTree());\n\n _defineProperty(this, \"_leftMap\", {});\n }\n\n _createClass(PositionCache, [{\n key: \"estimateTotalHeight\",\n value: function estimateTotalHeight(cellCount, columnCount, defaultCellHeight) {\n var unmeasuredCellCount = cellCount - this.count;\n return this.tallestColumnSize + Math.ceil(unmeasuredCellCount / columnCount) * defaultCellHeight;\n } // Render all cells visible within the viewport range defined.\n\n }, {\n key: \"range\",\n value: function range(scrollTop, clientHeight, renderCallback) {\n var _this = this;\n\n this._intervalTree.queryInterval(scrollTop, scrollTop + clientHeight, function (_ref) {\n var _ref2 = _slicedToArray(_ref, 3),\n top = _ref2[0],\n _ = _ref2[1],\n index = _ref2[2];\n\n return renderCallback(index, _this._leftMap[index], top);\n });\n }\n }, {\n key: \"setPosition\",\n value: function setPosition(index, left, top, height) {\n this._intervalTree.insert([top, top + height, index]);\n\n this._leftMap[index] = left;\n var columnSizeMap = this._columnSizeMap;\n var columnHeight = columnSizeMap[left];\n\n if (columnHeight === undefined) {\n columnSizeMap[left] = top + height;\n } else {\n columnSizeMap[left] = Math.max(columnHeight, top + height);\n }\n }\n }, {\n key: \"count\",\n get: function get() {\n return this._intervalTree.count;\n }\n }, {\n key: \"shortestColumnSize\",\n get: function get() {\n var columnSizeMap = this._columnSizeMap;\n var size = 0;\n\n for (var i in columnSizeMap) {\n var height = columnSizeMap[i];\n size = size === 0 ? height : Math.min(size, height);\n }\n\n return size;\n }\n }, {\n key: \"tallestColumnSize\",\n get: function get() {\n var columnSizeMap = this._columnSizeMap;\n var size = 0;\n\n for (var i in columnSizeMap) {\n var height = columnSizeMap[i];\n size = Math.max(size, height);\n }\n\n return size;\n }\n }]);\n\n return PositionCache;\n}();\n\nexport { PositionCache as default };","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nvar _class, _temp;\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport clsx from 'clsx';\nimport * as React from 'react';\nimport { polyfill } from 'react-lifecycles-compat';\nimport PositionCache from './PositionCache';\nimport { requestAnimationTimeout, cancelAnimationTimeout } from '../utils/requestAnimationTimeout';\nvar emptyObject = {};\n/**\n * Specifies the number of miliseconds during which to disable pointer events while a scroll is in progress.\n * This improves performance and makes scrolling smoother.\n */\n\nexport var DEFAULT_SCROLLING_RESET_TIME_INTERVAL = 150;\n/**\n * This component efficiently displays arbitrarily positioned cells using windowing techniques.\n * Cell position is determined by an injected `cellPositioner` property.\n * Windowing is vertical; this component does not support horizontal scrolling.\n *\n * Rendering occurs in two phases:\n * 1) First pass uses estimated cell sizes (provided by the cache) to determine how many cells to measure in a batch.\n * Batch size is chosen using a fast, naive layout algorithm that stacks images in order until the viewport has been filled.\n * After measurement is complete (componentDidMount or componentDidUpdate) this component evaluates positioned cells\n * in order to determine if another measurement pass is required (eg if actual cell sizes were less than estimated sizes).\n * All measurements are permanently cached (keyed by `keyMapper`) for performance purposes.\n * 2) Second pass uses the external `cellPositioner` to layout cells.\n * At this time the positioner has access to cached size measurements for all cells.\n * The positions it returns are cached by Masonry for fast access later.\n * Phase one is repeated if the user scrolls beyond the current layout's bounds.\n * If the layout is invalidated due to eg a resize, cached positions can be cleared using `recomputeCellPositions()`.\n *\n * Animation constraints:\n * Simple animations are supported (eg translate/slide into place on initial reveal).\n * More complex animations are not (eg flying from one position to another on resize).\n *\n * Layout constraints:\n * This component supports multi-column layout.\n * The height of each item may vary.\n * The width of each item must not exceed the width of the column it is \"in\".\n * The left position of all items within a column must align.\n * (Items may not span multiple columns.)\n */\n\nvar Masonry = (_temp = _class =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(Masonry, _React$PureComponent);\n\n function Masonry() {\n var _getPrototypeOf2;\n\n var _this;\n\n _classCallCheck(this, Masonry);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(Masonry)).call.apply(_getPrototypeOf2, [this].concat(args)));\n\n _defineProperty(_assertThisInitialized(_this), \"state\", {\n isScrolling: false,\n scrollTop: 0\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_debounceResetIsScrollingId\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_invalidateOnUpdateStartIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_invalidateOnUpdateStopIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_positionCache\", new PositionCache());\n\n _defineProperty(_assertThisInitialized(_this), \"_startIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_startIndexMemoized\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_stopIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_stopIndexMemoized\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_debounceResetIsScrollingCallback\", function () {\n _this.setState({\n isScrolling: false\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_setScrollingContainerRef\", function (ref) {\n _this._scrollingContainer = ref;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScroll\", function (event) {\n var height = _this.props.height;\n var eventScrollTop = event.currentTarget.scrollTop; // When this component is shrunk drastically, React dispatches a series of back-to-back scroll events,\n // Gradually converging on a scrollTop that is within the bounds of the new, smaller height.\n // This causes a series of rapid renders that is slow for long lists.\n // We can avoid that by doing some simple bounds checking to ensure that scroll offsets never exceed their bounds.\n\n var scrollTop = Math.min(Math.max(0, _this._getEstimatedTotalHeight() - height), eventScrollTop); // On iOS, we can arrive at negative offsets by swiping past the start or end.\n // Avoid re-rendering in this case as it can cause problems; see #532 for more.\n\n if (eventScrollTop !== scrollTop) {\n return;\n } // Prevent pointer events from interrupting a smooth scroll\n\n\n _this._debounceResetIsScrolling(); // Certain devices (like Apple touchpad) rapid-fire duplicate events.\n // Don't force a re-render if this is the case.\n // The mouse may move faster then the animation frame does.\n // Use requestAnimationFrame to avoid over-updating.\n\n\n if (_this.state.scrollTop !== scrollTop) {\n _this.setState({\n isScrolling: true,\n scrollTop: scrollTop\n });\n }\n });\n\n return _this;\n }\n\n _createClass(Masonry, [{\n key: \"clearCellPositions\",\n value: function clearCellPositions() {\n this._positionCache = new PositionCache();\n this.forceUpdate();\n } // HACK This method signature was intended for Grid\n\n }, {\n key: \"invalidateCellSizeAfterRender\",\n value: function invalidateCellSizeAfterRender(_ref) {\n var index = _ref.rowIndex;\n\n if (this._invalidateOnUpdateStartIndex === null) {\n this._invalidateOnUpdateStartIndex = index;\n this._invalidateOnUpdateStopIndex = index;\n } else {\n this._invalidateOnUpdateStartIndex = Math.min(this._invalidateOnUpdateStartIndex, index);\n this._invalidateOnUpdateStopIndex = Math.max(this._invalidateOnUpdateStopIndex, index);\n }\n }\n }, {\n key: \"recomputeCellPositions\",\n value: function recomputeCellPositions() {\n var stopIndex = this._positionCache.count - 1;\n this._positionCache = new PositionCache();\n\n this._populatePositionCache(0, stopIndex);\n\n this.forceUpdate();\n }\n }, {\n key: \"componentDidMount\",\n value: function componentDidMount() {\n this._checkInvalidateOnUpdate();\n\n this._invokeOnScrollCallback();\n\n this._invokeOnCellsRenderedCallback();\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps, prevState) {\n this._checkInvalidateOnUpdate();\n\n this._invokeOnScrollCallback();\n\n this._invokeOnCellsRenderedCallback();\n\n if (this.props.scrollTop !== prevProps.scrollTop) {\n this._debounceResetIsScrolling();\n }\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n if (this._debounceResetIsScrollingId) {\n cancelAnimationTimeout(this._debounceResetIsScrollingId);\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this2 = this;\n\n var _this$props = this.props,\n autoHeight = _this$props.autoHeight,\n cellCount = _this$props.cellCount,\n cellMeasurerCache = _this$props.cellMeasurerCache,\n cellRenderer = _this$props.cellRenderer,\n className = _this$props.className,\n height = _this$props.height,\n id = _this$props.id,\n keyMapper = _this$props.keyMapper,\n overscanByPixels = _this$props.overscanByPixels,\n role = _this$props.role,\n style = _this$props.style,\n tabIndex = _this$props.tabIndex,\n width = _this$props.width,\n rowDirection = _this$props.rowDirection;\n var _this$state = this.state,\n isScrolling = _this$state.isScrolling,\n scrollTop = _this$state.scrollTop;\n var children = [];\n\n var estimateTotalHeight = this._getEstimatedTotalHeight();\n\n var shortestColumnSize = this._positionCache.shortestColumnSize;\n var measuredCellCount = this._positionCache.count;\n var startIndex = 0;\n var stopIndex;\n\n this._positionCache.range(Math.max(0, scrollTop - overscanByPixels), height + overscanByPixels * 2, function (index, left, top) {\n var _style;\n\n if (typeof stopIndex === 'undefined') {\n startIndex = index;\n stopIndex = index;\n } else {\n startIndex = Math.min(startIndex, index);\n stopIndex = Math.max(stopIndex, index);\n }\n\n children.push(cellRenderer({\n index: index,\n isScrolling: isScrolling,\n key: keyMapper(index),\n parent: _this2,\n style: (_style = {\n height: cellMeasurerCache.getHeight(index)\n }, _defineProperty(_style, rowDirection === 'ltr' ? 'left' : 'right', left), _defineProperty(_style, \"position\", 'absolute'), _defineProperty(_style, \"top\", top), _defineProperty(_style, \"width\", cellMeasurerCache.getWidth(index)), _style)\n }));\n }); // We need to measure additional cells for this layout\n\n\n if (shortestColumnSize < scrollTop + height + overscanByPixels && measuredCellCount < cellCount) {\n var batchSize = Math.min(cellCount - measuredCellCount, Math.ceil((scrollTop + height + overscanByPixels - shortestColumnSize) / cellMeasurerCache.defaultHeight * width / cellMeasurerCache.defaultWidth));\n\n for (var _index = measuredCellCount; _index < measuredCellCount + batchSize; _index++) {\n stopIndex = _index;\n children.push(cellRenderer({\n index: _index,\n isScrolling: isScrolling,\n key: keyMapper(_index),\n parent: this,\n style: {\n width: cellMeasurerCache.getWidth(_index)\n }\n }));\n }\n }\n\n this._startIndex = startIndex;\n this._stopIndex = stopIndex;\n return React.createElement(\"div\", {\n ref: this._setScrollingContainerRef,\n \"aria-label\": this.props['aria-label'],\n className: clsx('ReactVirtualized__Masonry', className),\n id: id,\n onScroll: this._onScroll,\n role: role,\n style: _objectSpread({\n boxSizing: 'border-box',\n direction: 'ltr',\n height: autoHeight ? 'auto' : height,\n overflowX: 'hidden',\n overflowY: estimateTotalHeight < height ? 'hidden' : 'auto',\n position: 'relative',\n width: width,\n WebkitOverflowScrolling: 'touch',\n willChange: 'transform'\n }, style),\n tabIndex: tabIndex\n }, React.createElement(\"div\", {\n className: \"ReactVirtualized__Masonry__innerScrollContainer\",\n style: {\n width: '100%',\n height: estimateTotalHeight,\n maxWidth: '100%',\n maxHeight: estimateTotalHeight,\n overflow: 'hidden',\n pointerEvents: isScrolling ? 'none' : '',\n position: 'relative'\n }\n }, children));\n }\n }, {\n key: \"_checkInvalidateOnUpdate\",\n value: function _checkInvalidateOnUpdate() {\n if (typeof this._invalidateOnUpdateStartIndex === 'number') {\n var startIndex = this._invalidateOnUpdateStartIndex;\n var stopIndex = this._invalidateOnUpdateStopIndex;\n this._invalidateOnUpdateStartIndex = null;\n this._invalidateOnUpdateStopIndex = null; // Query external layout logic for position of newly-measured cells\n\n this._populatePositionCache(startIndex, stopIndex);\n\n this.forceUpdate();\n }\n }\n }, {\n key: \"_debounceResetIsScrolling\",\n value: function _debounceResetIsScrolling() {\n var scrollingResetTimeInterval = this.props.scrollingResetTimeInterval;\n\n if (this._debounceResetIsScrollingId) {\n cancelAnimationTimeout(this._debounceResetIsScrollingId);\n }\n\n this._debounceResetIsScrollingId = requestAnimationTimeout(this._debounceResetIsScrollingCallback, scrollingResetTimeInterval);\n }\n }, {\n key: \"_getEstimatedTotalHeight\",\n value: function _getEstimatedTotalHeight() {\n var _this$props2 = this.props,\n cellCount = _this$props2.cellCount,\n cellMeasurerCache = _this$props2.cellMeasurerCache,\n width = _this$props2.width;\n var estimatedColumnCount = Math.max(1, Math.floor(width / cellMeasurerCache.defaultWidth));\n return this._positionCache.estimateTotalHeight(cellCount, estimatedColumnCount, cellMeasurerCache.defaultHeight);\n }\n }, {\n key: \"_invokeOnScrollCallback\",\n value: function _invokeOnScrollCallback() {\n var _this$props3 = this.props,\n height = _this$props3.height,\n onScroll = _this$props3.onScroll;\n var scrollTop = this.state.scrollTop;\n\n if (this._onScrollMemoized !== scrollTop) {\n onScroll({\n clientHeight: height,\n scrollHeight: this._getEstimatedTotalHeight(),\n scrollTop: scrollTop\n });\n this._onScrollMemoized = scrollTop;\n }\n }\n }, {\n key: \"_invokeOnCellsRenderedCallback\",\n value: function _invokeOnCellsRenderedCallback() {\n if (this._startIndexMemoized !== this._startIndex || this._stopIndexMemoized !== this._stopIndex) {\n var onCellsRendered = this.props.onCellsRendered;\n onCellsRendered({\n startIndex: this._startIndex,\n stopIndex: this._stopIndex\n });\n this._startIndexMemoized = this._startIndex;\n this._stopIndexMemoized = this._stopIndex;\n }\n }\n }, {\n key: \"_populatePositionCache\",\n value: function _populatePositionCache(startIndex, stopIndex) {\n var _this$props4 = this.props,\n cellMeasurerCache = _this$props4.cellMeasurerCache,\n cellPositioner = _this$props4.cellPositioner;\n\n for (var _index2 = startIndex; _index2 <= stopIndex; _index2++) {\n var _cellPositioner = cellPositioner(_index2),\n left = _cellPositioner.left,\n top = _cellPositioner.top;\n\n this._positionCache.setPosition(_index2, left, top, cellMeasurerCache.getHeight(_index2));\n }\n }\n }], [{\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n if (nextProps.scrollTop !== undefined && prevState.scrollTop !== nextProps.scrollTop) {\n return {\n isScrolling: true,\n scrollTop: nextProps.scrollTop\n };\n }\n\n return null;\n }\n }]);\n\n return Masonry;\n}(React.PureComponent), _defineProperty(_class, \"propTypes\", process.env.NODE_ENV === 'production' ? null : {\n \"autoHeight\": PropTypes.bool.isRequired,\n \"cellCount\": PropTypes.number.isRequired,\n \"cellMeasurerCache\": function cellMeasurerCache() {\n return (typeof CellMeasurerCache === \"function\" ? PropTypes.instanceOf(CellMeasurerCache).isRequired : PropTypes.any.isRequired).apply(this, arguments);\n },\n \"cellPositioner\": function cellPositioner() {\n return (typeof Positioner === \"function\" ? PropTypes.instanceOf(Positioner).isRequired : PropTypes.any.isRequired).apply(this, arguments);\n },\n \"cellRenderer\": function cellRenderer() {\n return (typeof CellRenderer === \"function\" ? PropTypes.instanceOf(CellRenderer).isRequired : PropTypes.any.isRequired).apply(this, arguments);\n },\n \"className\": PropTypes.string,\n \"height\": PropTypes.number.isRequired,\n \"id\": PropTypes.string,\n \"keyMapper\": function keyMapper() {\n return (typeof KeyMapper === \"function\" ? PropTypes.instanceOf(KeyMapper).isRequired : PropTypes.any.isRequired).apply(this, arguments);\n },\n \"onCellsRendered\": function onCellsRendered() {\n return (typeof OnCellsRenderedCallback === \"function\" ? PropTypes.instanceOf(OnCellsRenderedCallback) : PropTypes.any).apply(this, arguments);\n },\n \"onScroll\": function onScroll() {\n return (typeof OnScrollCallback === \"function\" ? PropTypes.instanceOf(OnScrollCallback) : PropTypes.any).apply(this, arguments);\n },\n \"overscanByPixels\": PropTypes.number.isRequired,\n \"role\": PropTypes.string.isRequired,\n \"scrollingResetTimeInterval\": PropTypes.number.isRequired,\n \"style\": function style(props, propName, componentName) {\n if (!Object.prototype.hasOwnProperty.call(props, propName)) {\n throw new Error(\"Prop `\".concat(propName, \"` has type 'any' or 'mixed', but was not provided to `\").concat(componentName, \"`. Pass undefined or any other value.\"));\n }\n },\n \"tabIndex\": PropTypes.number.isRequired,\n \"width\": PropTypes.number.isRequired,\n \"rowDirection\": PropTypes.string.isRequired,\n \"scrollTop\": PropTypes.number\n}), _temp);\n\n_defineProperty(Masonry, \"defaultProps\", {\n autoHeight: false,\n keyMapper: identity,\n onCellsRendered: noop,\n onScroll: noop,\n overscanByPixels: 20,\n role: 'grid',\n scrollingResetTimeInterval: DEFAULT_SCROLLING_RESET_TIME_INTERVAL,\n style: emptyObject,\n tabIndex: 0,\n rowDirection: 'ltr'\n});\n\nfunction identity(value) {\n return value;\n}\n\nfunction noop() {}\n\nvar bpfrpt_proptype_CellMeasurerCache = process.env.NODE_ENV === 'production' ? null : {\n \"defaultHeight\": PropTypes.number.isRequired,\n \"defaultWidth\": PropTypes.number.isRequired,\n \"getHeight\": PropTypes.func.isRequired,\n \"getWidth\": PropTypes.func.isRequired\n};\npolyfill(Masonry);\nexport default Masonry;\nvar bpfrpt_proptype_Positioner = process.env.NODE_ENV === 'production' ? null : PropTypes.func;\nimport { bpfrpt_proptype_AnimationTimeoutId } from \"../utils/requestAnimationTimeout\";\nimport PropTypes from \"prop-types\";\nexport { bpfrpt_proptype_CellMeasurerCache };\nexport { bpfrpt_proptype_Positioner };","import createCellPositioner from './createCellPositioner';\nimport Masonry from './Masonry';\nexport default Masonry;\nexport { createCellPositioner, Masonry };","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nimport { CellMeasurerCache } from '../CellMeasurer';\n\n/**\n * Caches measurements for a given cell.\n */\nvar CellMeasurerCacheDecorator =\n/*#__PURE__*/\nfunction () {\n function CellMeasurerCacheDecorator() {\n var _this = this;\n\n var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n\n _classCallCheck(this, CellMeasurerCacheDecorator);\n\n _defineProperty(this, \"_cellMeasurerCache\", void 0);\n\n _defineProperty(this, \"_columnIndexOffset\", void 0);\n\n _defineProperty(this, \"_rowIndexOffset\", void 0);\n\n _defineProperty(this, \"columnWidth\", function (_ref) {\n var index = _ref.index;\n\n _this._cellMeasurerCache.columnWidth({\n index: index + _this._columnIndexOffset\n });\n });\n\n _defineProperty(this, \"rowHeight\", function (_ref2) {\n var index = _ref2.index;\n\n _this._cellMeasurerCache.rowHeight({\n index: index + _this._rowIndexOffset\n });\n });\n\n var cellMeasurerCache = params.cellMeasurerCache,\n _params$columnIndexOf = params.columnIndexOffset,\n columnIndexOffset = _params$columnIndexOf === void 0 ? 0 : _params$columnIndexOf,\n _params$rowIndexOffse = params.rowIndexOffset,\n rowIndexOffset = _params$rowIndexOffse === void 0 ? 0 : _params$rowIndexOffse;\n this._cellMeasurerCache = cellMeasurerCache;\n this._columnIndexOffset = columnIndexOffset;\n this._rowIndexOffset = rowIndexOffset;\n }\n\n _createClass(CellMeasurerCacheDecorator, [{\n key: \"clear\",\n value: function clear(rowIndex, columnIndex) {\n this._cellMeasurerCache.clear(rowIndex + this._rowIndexOffset, columnIndex + this._columnIndexOffset);\n }\n }, {\n key: \"clearAll\",\n value: function clearAll() {\n this._cellMeasurerCache.clearAll();\n }\n }, {\n key: \"hasFixedHeight\",\n value: function hasFixedHeight() {\n return this._cellMeasurerCache.hasFixedHeight();\n }\n }, {\n key: \"hasFixedWidth\",\n value: function hasFixedWidth() {\n return this._cellMeasurerCache.hasFixedWidth();\n }\n }, {\n key: \"getHeight\",\n value: function getHeight(rowIndex) {\n var columnIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;\n return this._cellMeasurerCache.getHeight(rowIndex + this._rowIndexOffset, columnIndex + this._columnIndexOffset);\n }\n }, {\n key: \"getWidth\",\n value: function getWidth(rowIndex) {\n var columnIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;\n return this._cellMeasurerCache.getWidth(rowIndex + this._rowIndexOffset, columnIndex + this._columnIndexOffset);\n }\n }, {\n key: \"has\",\n value: function has(rowIndex) {\n var columnIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;\n return this._cellMeasurerCache.has(rowIndex + this._rowIndexOffset, columnIndex + this._columnIndexOffset);\n }\n }, {\n key: \"set\",\n value: function set(rowIndex, columnIndex, width, height) {\n this._cellMeasurerCache.set(rowIndex + this._rowIndexOffset, columnIndex + this._columnIndexOffset, width, height);\n }\n }, {\n key: \"defaultHeight\",\n get: function get() {\n return this._cellMeasurerCache.defaultHeight;\n }\n }, {\n key: \"defaultWidth\",\n get: function get() {\n return this._cellMeasurerCache.defaultWidth;\n }\n }]);\n\n return CellMeasurerCacheDecorator;\n}();\n\nexport { CellMeasurerCacheDecorator as default };","import _extends from \"@babel/runtime/helpers/extends\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/objectWithoutProperties\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\nimport { polyfill } from 'react-lifecycles-compat';\nimport CellMeasurerCacheDecorator from './CellMeasurerCacheDecorator';\nimport Grid from '../Grid';\nvar SCROLLBAR_SIZE_BUFFER = 20;\n/**\n * Renders 1, 2, or 4 Grids depending on configuration.\n * A main (body) Grid will always be rendered.\n * Optionally, 1-2 Grids for sticky header rows will also be rendered.\n * If no sticky columns, only 1 sticky header Grid will be rendered.\n * If sticky columns, 2 sticky header Grids will be rendered.\n */\n\nvar MultiGrid =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(MultiGrid, _React$PureComponent);\n\n function MultiGrid(props, context) {\n var _this;\n\n _classCallCheck(this, MultiGrid);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(MultiGrid).call(this, props, context));\n\n _defineProperty(_assertThisInitialized(_this), \"state\", {\n scrollLeft: 0,\n scrollTop: 0,\n scrollbarSize: 0,\n showHorizontalScrollbar: false,\n showVerticalScrollbar: false\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_deferredInvalidateColumnIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_deferredInvalidateRowIndex\", null);\n\n _defineProperty(_assertThisInitialized(_this), \"_bottomLeftGridRef\", function (ref) {\n _this._bottomLeftGrid = ref;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_bottomRightGridRef\", function (ref) {\n _this._bottomRightGrid = ref;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_cellRendererBottomLeftGrid\", function (_ref) {\n var rowIndex = _ref.rowIndex,\n rest = _objectWithoutProperties(_ref, [\"rowIndex\"]);\n\n var _this$props = _this.props,\n cellRenderer = _this$props.cellRenderer,\n fixedRowCount = _this$props.fixedRowCount,\n rowCount = _this$props.rowCount;\n\n if (rowIndex === rowCount - fixedRowCount) {\n return React.createElement(\"div\", {\n key: rest.key,\n style: _objectSpread({}, rest.style, {\n height: SCROLLBAR_SIZE_BUFFER\n })\n });\n } else {\n return cellRenderer(_objectSpread({}, rest, {\n parent: _assertThisInitialized(_this),\n rowIndex: rowIndex + fixedRowCount\n }));\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_cellRendererBottomRightGrid\", function (_ref2) {\n var columnIndex = _ref2.columnIndex,\n rowIndex = _ref2.rowIndex,\n rest = _objectWithoutProperties(_ref2, [\"columnIndex\", \"rowIndex\"]);\n\n var _this$props2 = _this.props,\n cellRenderer = _this$props2.cellRenderer,\n fixedColumnCount = _this$props2.fixedColumnCount,\n fixedRowCount = _this$props2.fixedRowCount;\n return cellRenderer(_objectSpread({}, rest, {\n columnIndex: columnIndex + fixedColumnCount,\n parent: _assertThisInitialized(_this),\n rowIndex: rowIndex + fixedRowCount\n }));\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_cellRendererTopRightGrid\", function (_ref3) {\n var columnIndex = _ref3.columnIndex,\n rest = _objectWithoutProperties(_ref3, [\"columnIndex\"]);\n\n var _this$props3 = _this.props,\n cellRenderer = _this$props3.cellRenderer,\n columnCount = _this$props3.columnCount,\n fixedColumnCount = _this$props3.fixedColumnCount;\n\n if (columnIndex === columnCount - fixedColumnCount) {\n return React.createElement(\"div\", {\n key: rest.key,\n style: _objectSpread({}, rest.style, {\n width: SCROLLBAR_SIZE_BUFFER\n })\n });\n } else {\n return cellRenderer(_objectSpread({}, rest, {\n columnIndex: columnIndex + fixedColumnCount,\n parent: _assertThisInitialized(_this)\n }));\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_columnWidthRightGrid\", function (_ref4) {\n var index = _ref4.index;\n var _this$props4 = _this.props,\n columnCount = _this$props4.columnCount,\n fixedColumnCount = _this$props4.fixedColumnCount,\n columnWidth = _this$props4.columnWidth;\n var _this$state = _this.state,\n scrollbarSize = _this$state.scrollbarSize,\n showHorizontalScrollbar = _this$state.showHorizontalScrollbar; // An extra cell is added to the count\n // This gives the smaller Grid extra room for offset,\n // In case the main (bottom right) Grid has a scrollbar\n // If no scrollbar, the extra space is overflow:hidden anyway\n\n if (showHorizontalScrollbar && index === columnCount - fixedColumnCount) {\n return scrollbarSize;\n }\n\n return typeof columnWidth === 'function' ? columnWidth({\n index: index + fixedColumnCount\n }) : columnWidth;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScroll\", function (scrollInfo) {\n var scrollLeft = scrollInfo.scrollLeft,\n scrollTop = scrollInfo.scrollTop;\n\n _this.setState({\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n });\n\n var onScroll = _this.props.onScroll;\n\n if (onScroll) {\n onScroll(scrollInfo);\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScrollbarPresenceChange\", function (_ref5) {\n var horizontal = _ref5.horizontal,\n size = _ref5.size,\n vertical = _ref5.vertical;\n var _this$state2 = _this.state,\n showHorizontalScrollbar = _this$state2.showHorizontalScrollbar,\n showVerticalScrollbar = _this$state2.showVerticalScrollbar;\n\n if (horizontal !== showHorizontalScrollbar || vertical !== showVerticalScrollbar) {\n _this.setState({\n scrollbarSize: size,\n showHorizontalScrollbar: horizontal,\n showVerticalScrollbar: vertical\n });\n\n var onScrollbarPresenceChange = _this.props.onScrollbarPresenceChange;\n\n if (typeof onScrollbarPresenceChange === 'function') {\n onScrollbarPresenceChange({\n horizontal: horizontal,\n size: size,\n vertical: vertical\n });\n }\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScrollLeft\", function (scrollInfo) {\n var scrollLeft = scrollInfo.scrollLeft;\n\n _this._onScroll({\n scrollLeft: scrollLeft,\n scrollTop: _this.state.scrollTop\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onScrollTop\", function (scrollInfo) {\n var scrollTop = scrollInfo.scrollTop;\n\n _this._onScroll({\n scrollTop: scrollTop,\n scrollLeft: _this.state.scrollLeft\n });\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_rowHeightBottomGrid\", function (_ref6) {\n var index = _ref6.index;\n var _this$props5 = _this.props,\n fixedRowCount = _this$props5.fixedRowCount,\n rowCount = _this$props5.rowCount,\n rowHeight = _this$props5.rowHeight;\n var _this$state3 = _this.state,\n scrollbarSize = _this$state3.scrollbarSize,\n showVerticalScrollbar = _this$state3.showVerticalScrollbar; // An extra cell is added to the count\n // This gives the smaller Grid extra room for offset,\n // In case the main (bottom right) Grid has a scrollbar\n // If no scrollbar, the extra space is overflow:hidden anyway\n\n if (showVerticalScrollbar && index === rowCount - fixedRowCount) {\n return scrollbarSize;\n }\n\n return typeof rowHeight === 'function' ? rowHeight({\n index: index + fixedRowCount\n }) : rowHeight;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_topLeftGridRef\", function (ref) {\n _this._topLeftGrid = ref;\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_topRightGridRef\", function (ref) {\n _this._topRightGrid = ref;\n });\n\n var deferredMeasurementCache = props.deferredMeasurementCache,\n _fixedColumnCount = props.fixedColumnCount,\n _fixedRowCount = props.fixedRowCount;\n\n _this._maybeCalculateCachedStyles(true);\n\n if (deferredMeasurementCache) {\n _this._deferredMeasurementCacheBottomLeftGrid = _fixedRowCount > 0 ? new CellMeasurerCacheDecorator({\n cellMeasurerCache: deferredMeasurementCache,\n columnIndexOffset: 0,\n rowIndexOffset: _fixedRowCount\n }) : deferredMeasurementCache;\n _this._deferredMeasurementCacheBottomRightGrid = _fixedColumnCount > 0 || _fixedRowCount > 0 ? new CellMeasurerCacheDecorator({\n cellMeasurerCache: deferredMeasurementCache,\n columnIndexOffset: _fixedColumnCount,\n rowIndexOffset: _fixedRowCount\n }) : deferredMeasurementCache;\n _this._deferredMeasurementCacheTopRightGrid = _fixedColumnCount > 0 ? new CellMeasurerCacheDecorator({\n cellMeasurerCache: deferredMeasurementCache,\n columnIndexOffset: _fixedColumnCount,\n rowIndexOffset: 0\n }) : deferredMeasurementCache;\n }\n\n return _this;\n }\n\n _createClass(MultiGrid, [{\n key: \"forceUpdateGrids\",\n value: function forceUpdateGrids() {\n this._bottomLeftGrid && this._bottomLeftGrid.forceUpdate();\n this._bottomRightGrid && this._bottomRightGrid.forceUpdate();\n this._topLeftGrid && this._topLeftGrid.forceUpdate();\n this._topRightGrid && this._topRightGrid.forceUpdate();\n }\n /** See Grid#invalidateCellSizeAfterRender */\n\n }, {\n key: \"invalidateCellSizeAfterRender\",\n value: function invalidateCellSizeAfterRender() {\n var _ref7 = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},\n _ref7$columnIndex = _ref7.columnIndex,\n columnIndex = _ref7$columnIndex === void 0 ? 0 : _ref7$columnIndex,\n _ref7$rowIndex = _ref7.rowIndex,\n rowIndex = _ref7$rowIndex === void 0 ? 0 : _ref7$rowIndex;\n\n this._deferredInvalidateColumnIndex = typeof this._deferredInvalidateColumnIndex === 'number' ? Math.min(this._deferredInvalidateColumnIndex, columnIndex) : columnIndex;\n this._deferredInvalidateRowIndex = typeof this._deferredInvalidateRowIndex === 'number' ? Math.min(this._deferredInvalidateRowIndex, rowIndex) : rowIndex;\n }\n /** See Grid#measureAllCells */\n\n }, {\n key: \"measureAllCells\",\n value: function measureAllCells() {\n this._bottomLeftGrid && this._bottomLeftGrid.measureAllCells();\n this._bottomRightGrid && this._bottomRightGrid.measureAllCells();\n this._topLeftGrid && this._topLeftGrid.measureAllCells();\n this._topRightGrid && this._topRightGrid.measureAllCells();\n }\n /** See Grid#recomputeGridSize */\n\n }, {\n key: \"recomputeGridSize\",\n value: function recomputeGridSize() {\n var _ref8 = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},\n _ref8$columnIndex = _ref8.columnIndex,\n columnIndex = _ref8$columnIndex === void 0 ? 0 : _ref8$columnIndex,\n _ref8$rowIndex = _ref8.rowIndex,\n rowIndex = _ref8$rowIndex === void 0 ? 0 : _ref8$rowIndex;\n\n var _this$props6 = this.props,\n fixedColumnCount = _this$props6.fixedColumnCount,\n fixedRowCount = _this$props6.fixedRowCount;\n var adjustedColumnIndex = Math.max(0, columnIndex - fixedColumnCount);\n var adjustedRowIndex = Math.max(0, rowIndex - fixedRowCount);\n this._bottomLeftGrid && this._bottomLeftGrid.recomputeGridSize({\n columnIndex: columnIndex,\n rowIndex: adjustedRowIndex\n });\n this._bottomRightGrid && this._bottomRightGrid.recomputeGridSize({\n columnIndex: adjustedColumnIndex,\n rowIndex: adjustedRowIndex\n });\n this._topLeftGrid && this._topLeftGrid.recomputeGridSize({\n columnIndex: columnIndex,\n rowIndex: rowIndex\n });\n this._topRightGrid && this._topRightGrid.recomputeGridSize({\n columnIndex: adjustedColumnIndex,\n rowIndex: rowIndex\n });\n this._leftGridWidth = null;\n this._topGridHeight = null;\n\n this._maybeCalculateCachedStyles(true);\n }\n }, {\n key: \"componentDidMount\",\n value: function componentDidMount() {\n var _this$props7 = this.props,\n scrollLeft = _this$props7.scrollLeft,\n scrollTop = _this$props7.scrollTop;\n\n if (scrollLeft > 0 || scrollTop > 0) {\n var newState = {};\n\n if (scrollLeft > 0) {\n newState.scrollLeft = scrollLeft;\n }\n\n if (scrollTop > 0) {\n newState.scrollTop = scrollTop;\n }\n\n this.setState(newState);\n }\n\n this._handleInvalidatedGridSize();\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate() {\n this._handleInvalidatedGridSize();\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props8 = this.props,\n onScroll = _this$props8.onScroll,\n onSectionRendered = _this$props8.onSectionRendered,\n onScrollbarPresenceChange = _this$props8.onScrollbarPresenceChange,\n scrollLeftProp = _this$props8.scrollLeft,\n scrollToColumn = _this$props8.scrollToColumn,\n scrollTopProp = _this$props8.scrollTop,\n scrollToRow = _this$props8.scrollToRow,\n rest = _objectWithoutProperties(_this$props8, [\"onScroll\", \"onSectionRendered\", \"onScrollbarPresenceChange\", \"scrollLeft\", \"scrollToColumn\", \"scrollTop\", \"scrollToRow\"]);\n\n this._prepareForRender(); // Don't render any of our Grids if there are no cells.\n // This mirrors what Grid does,\n // And prevents us from recording inaccurage measurements when used with CellMeasurer.\n\n\n if (this.props.width === 0 || this.props.height === 0) {\n return null;\n } // scrollTop and scrollLeft props are explicitly filtered out and ignored\n\n\n var _this$state4 = this.state,\n scrollLeft = _this$state4.scrollLeft,\n scrollTop = _this$state4.scrollTop;\n return React.createElement(\"div\", {\n style: this._containerOuterStyle\n }, React.createElement(\"div\", {\n style: this._containerTopStyle\n }, this._renderTopLeftGrid(rest), this._renderTopRightGrid(_objectSpread({}, rest, {\n onScroll: onScroll,\n scrollLeft: scrollLeft\n }))), React.createElement(\"div\", {\n style: this._containerBottomStyle\n }, this._renderBottomLeftGrid(_objectSpread({}, rest, {\n onScroll: onScroll,\n scrollTop: scrollTop\n })), this._renderBottomRightGrid(_objectSpread({}, rest, {\n onScroll: onScroll,\n onSectionRendered: onSectionRendered,\n scrollLeft: scrollLeft,\n scrollToColumn: scrollToColumn,\n scrollToRow: scrollToRow,\n scrollTop: scrollTop\n }))));\n }\n }, {\n key: \"_getBottomGridHeight\",\n value: function _getBottomGridHeight(props) {\n var height = props.height;\n\n var topGridHeight = this._getTopGridHeight(props);\n\n return height - topGridHeight;\n }\n }, {\n key: \"_getLeftGridWidth\",\n value: function _getLeftGridWidth(props) {\n var fixedColumnCount = props.fixedColumnCount,\n columnWidth = props.columnWidth;\n\n if (this._leftGridWidth == null) {\n if (typeof columnWidth === 'function') {\n var leftGridWidth = 0;\n\n for (var index = 0; index < fixedColumnCount; index++) {\n leftGridWidth += columnWidth({\n index: index\n });\n }\n\n this._leftGridWidth = leftGridWidth;\n } else {\n this._leftGridWidth = columnWidth * fixedColumnCount;\n }\n }\n\n return this._leftGridWidth;\n }\n }, {\n key: \"_getRightGridWidth\",\n value: function _getRightGridWidth(props) {\n var width = props.width;\n\n var leftGridWidth = this._getLeftGridWidth(props);\n\n return width - leftGridWidth;\n }\n }, {\n key: \"_getTopGridHeight\",\n value: function _getTopGridHeight(props) {\n var fixedRowCount = props.fixedRowCount,\n rowHeight = props.rowHeight;\n\n if (this._topGridHeight == null) {\n if (typeof rowHeight === 'function') {\n var topGridHeight = 0;\n\n for (var index = 0; index < fixedRowCount; index++) {\n topGridHeight += rowHeight({\n index: index\n });\n }\n\n this._topGridHeight = topGridHeight;\n } else {\n this._topGridHeight = rowHeight * fixedRowCount;\n }\n }\n\n return this._topGridHeight;\n }\n }, {\n key: \"_handleInvalidatedGridSize\",\n value: function _handleInvalidatedGridSize() {\n if (typeof this._deferredInvalidateColumnIndex === 'number') {\n var columnIndex = this._deferredInvalidateColumnIndex;\n var rowIndex = this._deferredInvalidateRowIndex;\n this._deferredInvalidateColumnIndex = null;\n this._deferredInvalidateRowIndex = null;\n this.recomputeGridSize({\n columnIndex: columnIndex,\n rowIndex: rowIndex\n });\n this.forceUpdate();\n }\n }\n /**\n * Avoid recreating inline styles each render; this bypasses Grid's shallowCompare.\n * This method recalculates styles only when specific props change.\n */\n\n }, {\n key: \"_maybeCalculateCachedStyles\",\n value: function _maybeCalculateCachedStyles(resetAll) {\n var _this$props9 = this.props,\n columnWidth = _this$props9.columnWidth,\n enableFixedColumnScroll = _this$props9.enableFixedColumnScroll,\n enableFixedRowScroll = _this$props9.enableFixedRowScroll,\n height = _this$props9.height,\n fixedColumnCount = _this$props9.fixedColumnCount,\n fixedRowCount = _this$props9.fixedRowCount,\n rowHeight = _this$props9.rowHeight,\n style = _this$props9.style,\n styleBottomLeftGrid = _this$props9.styleBottomLeftGrid,\n styleBottomRightGrid = _this$props9.styleBottomRightGrid,\n styleTopLeftGrid = _this$props9.styleTopLeftGrid,\n styleTopRightGrid = _this$props9.styleTopRightGrid,\n width = _this$props9.width;\n var sizeChange = resetAll || height !== this._lastRenderedHeight || width !== this._lastRenderedWidth;\n var leftSizeChange = resetAll || columnWidth !== this._lastRenderedColumnWidth || fixedColumnCount !== this._lastRenderedFixedColumnCount;\n var topSizeChange = resetAll || fixedRowCount !== this._lastRenderedFixedRowCount || rowHeight !== this._lastRenderedRowHeight;\n\n if (resetAll || sizeChange || style !== this._lastRenderedStyle) {\n this._containerOuterStyle = _objectSpread({\n height: height,\n overflow: 'visible',\n // Let :focus outline show through\n width: width\n }, style);\n }\n\n if (resetAll || sizeChange || topSizeChange) {\n this._containerTopStyle = {\n height: this._getTopGridHeight(this.props),\n position: 'relative',\n width: width\n };\n this._containerBottomStyle = {\n height: height - this._getTopGridHeight(this.props),\n overflow: 'visible',\n // Let :focus outline show through\n position: 'relative',\n width: width\n };\n }\n\n if (resetAll || styleBottomLeftGrid !== this._lastRenderedStyleBottomLeftGrid) {\n this._bottomLeftGridStyle = _objectSpread({\n left: 0,\n overflowX: 'hidden',\n overflowY: enableFixedColumnScroll ? 'auto' : 'hidden',\n position: 'absolute'\n }, styleBottomLeftGrid);\n }\n\n if (resetAll || leftSizeChange || styleBottomRightGrid !== this._lastRenderedStyleBottomRightGrid) {\n this._bottomRightGridStyle = _objectSpread({\n left: this._getLeftGridWidth(this.props),\n position: 'absolute'\n }, styleBottomRightGrid);\n }\n\n if (resetAll || styleTopLeftGrid !== this._lastRenderedStyleTopLeftGrid) {\n this._topLeftGridStyle = _objectSpread({\n left: 0,\n overflowX: 'hidden',\n overflowY: 'hidden',\n position: 'absolute',\n top: 0\n }, styleTopLeftGrid);\n }\n\n if (resetAll || leftSizeChange || styleTopRightGrid !== this._lastRenderedStyleTopRightGrid) {\n this._topRightGridStyle = _objectSpread({\n left: this._getLeftGridWidth(this.props),\n overflowX: enableFixedRowScroll ? 'auto' : 'hidden',\n overflowY: 'hidden',\n position: 'absolute',\n top: 0\n }, styleTopRightGrid);\n }\n\n this._lastRenderedColumnWidth = columnWidth;\n this._lastRenderedFixedColumnCount = fixedColumnCount;\n this._lastRenderedFixedRowCount = fixedRowCount;\n this._lastRenderedHeight = height;\n this._lastRenderedRowHeight = rowHeight;\n this._lastRenderedStyle = style;\n this._lastRenderedStyleBottomLeftGrid = styleBottomLeftGrid;\n this._lastRenderedStyleBottomRightGrid = styleBottomRightGrid;\n this._lastRenderedStyleTopLeftGrid = styleTopLeftGrid;\n this._lastRenderedStyleTopRightGrid = styleTopRightGrid;\n this._lastRenderedWidth = width;\n }\n }, {\n key: \"_prepareForRender\",\n value: function _prepareForRender() {\n if (this._lastRenderedColumnWidth !== this.props.columnWidth || this._lastRenderedFixedColumnCount !== this.props.fixedColumnCount) {\n this._leftGridWidth = null;\n }\n\n if (this._lastRenderedFixedRowCount !== this.props.fixedRowCount || this._lastRenderedRowHeight !== this.props.rowHeight) {\n this._topGridHeight = null;\n }\n\n this._maybeCalculateCachedStyles();\n\n this._lastRenderedColumnWidth = this.props.columnWidth;\n this._lastRenderedFixedColumnCount = this.props.fixedColumnCount;\n this._lastRenderedFixedRowCount = this.props.fixedRowCount;\n this._lastRenderedRowHeight = this.props.rowHeight;\n }\n }, {\n key: \"_renderBottomLeftGrid\",\n value: function _renderBottomLeftGrid(props) {\n var enableFixedColumnScroll = props.enableFixedColumnScroll,\n fixedColumnCount = props.fixedColumnCount,\n fixedRowCount = props.fixedRowCount,\n rowCount = props.rowCount,\n hideBottomLeftGridScrollbar = props.hideBottomLeftGridScrollbar;\n var showVerticalScrollbar = this.state.showVerticalScrollbar;\n\n if (!fixedColumnCount) {\n return null;\n }\n\n var additionalRowCount = showVerticalScrollbar ? 1 : 0,\n height = this._getBottomGridHeight(props),\n width = this._getLeftGridWidth(props),\n scrollbarSize = this.state.showVerticalScrollbar ? this.state.scrollbarSize : 0,\n gridWidth = hideBottomLeftGridScrollbar ? width + scrollbarSize : width;\n\n var bottomLeftGrid = React.createElement(Grid, _extends({}, props, {\n cellRenderer: this._cellRendererBottomLeftGrid,\n className: this.props.classNameBottomLeftGrid,\n columnCount: fixedColumnCount,\n deferredMeasurementCache: this._deferredMeasurementCacheBottomLeftGrid,\n height: height,\n onScroll: enableFixedColumnScroll ? this._onScrollTop : undefined,\n ref: this._bottomLeftGridRef,\n rowCount: Math.max(0, rowCount - fixedRowCount) + additionalRowCount,\n rowHeight: this._rowHeightBottomGrid,\n style: this._bottomLeftGridStyle,\n tabIndex: null,\n width: gridWidth\n }));\n\n if (hideBottomLeftGridScrollbar) {\n return React.createElement(\"div\", {\n className: \"BottomLeftGrid_ScrollWrapper\",\n style: _objectSpread({}, this._bottomLeftGridStyle, {\n height: height,\n width: width,\n overflowY: 'hidden'\n })\n }, bottomLeftGrid);\n }\n\n return bottomLeftGrid;\n }\n }, {\n key: \"_renderBottomRightGrid\",\n value: function _renderBottomRightGrid(props) {\n var columnCount = props.columnCount,\n fixedColumnCount = props.fixedColumnCount,\n fixedRowCount = props.fixedRowCount,\n rowCount = props.rowCount,\n scrollToColumn = props.scrollToColumn,\n scrollToRow = props.scrollToRow;\n return React.createElement(Grid, _extends({}, props, {\n cellRenderer: this._cellRendererBottomRightGrid,\n className: this.props.classNameBottomRightGrid,\n columnCount: Math.max(0, columnCount - fixedColumnCount),\n columnWidth: this._columnWidthRightGrid,\n deferredMeasurementCache: this._deferredMeasurementCacheBottomRightGrid,\n height: this._getBottomGridHeight(props),\n onScroll: this._onScroll,\n onScrollbarPresenceChange: this._onScrollbarPresenceChange,\n ref: this._bottomRightGridRef,\n rowCount: Math.max(0, rowCount - fixedRowCount),\n rowHeight: this._rowHeightBottomGrid,\n scrollToColumn: scrollToColumn - fixedColumnCount,\n scrollToRow: scrollToRow - fixedRowCount,\n style: this._bottomRightGridStyle,\n width: this._getRightGridWidth(props)\n }));\n }\n }, {\n key: \"_renderTopLeftGrid\",\n value: function _renderTopLeftGrid(props) {\n var fixedColumnCount = props.fixedColumnCount,\n fixedRowCount = props.fixedRowCount;\n\n if (!fixedColumnCount || !fixedRowCount) {\n return null;\n }\n\n return React.createElement(Grid, _extends({}, props, {\n className: this.props.classNameTopLeftGrid,\n columnCount: fixedColumnCount,\n height: this._getTopGridHeight(props),\n ref: this._topLeftGridRef,\n rowCount: fixedRowCount,\n style: this._topLeftGridStyle,\n tabIndex: null,\n width: this._getLeftGridWidth(props)\n }));\n }\n }, {\n key: \"_renderTopRightGrid\",\n value: function _renderTopRightGrid(props) {\n var columnCount = props.columnCount,\n enableFixedRowScroll = props.enableFixedRowScroll,\n fixedColumnCount = props.fixedColumnCount,\n fixedRowCount = props.fixedRowCount,\n scrollLeft = props.scrollLeft,\n hideTopRightGridScrollbar = props.hideTopRightGridScrollbar;\n var _this$state5 = this.state,\n showHorizontalScrollbar = _this$state5.showHorizontalScrollbar,\n scrollbarSize = _this$state5.scrollbarSize;\n\n if (!fixedRowCount) {\n return null;\n }\n\n var additionalColumnCount = showHorizontalScrollbar ? 1 : 0,\n height = this._getTopGridHeight(props),\n width = this._getRightGridWidth(props),\n additionalHeight = showHorizontalScrollbar ? scrollbarSize : 0;\n\n var gridHeight = height,\n style = this._topRightGridStyle;\n\n if (hideTopRightGridScrollbar) {\n gridHeight = height + additionalHeight;\n style = _objectSpread({}, this._topRightGridStyle, {\n left: 0\n });\n }\n\n var topRightGrid = React.createElement(Grid, _extends({}, props, {\n cellRenderer: this._cellRendererTopRightGrid,\n className: this.props.classNameTopRightGrid,\n columnCount: Math.max(0, columnCount - fixedColumnCount) + additionalColumnCount,\n columnWidth: this._columnWidthRightGrid,\n deferredMeasurementCache: this._deferredMeasurementCacheTopRightGrid,\n height: gridHeight,\n onScroll: enableFixedRowScroll ? this._onScrollLeft : undefined,\n ref: this._topRightGridRef,\n rowCount: fixedRowCount,\n scrollLeft: scrollLeft,\n style: style,\n tabIndex: null,\n width: width\n }));\n\n if (hideTopRightGridScrollbar) {\n return React.createElement(\"div\", {\n className: \"TopRightGrid_ScrollWrapper\",\n style: _objectSpread({}, this._topRightGridStyle, {\n height: height,\n width: width,\n overflowX: 'hidden'\n })\n }, topRightGrid);\n }\n\n return topRightGrid;\n }\n }], [{\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n if (nextProps.scrollLeft !== prevState.scrollLeft || nextProps.scrollTop !== prevState.scrollTop) {\n return {\n scrollLeft: nextProps.scrollLeft != null && nextProps.scrollLeft >= 0 ? nextProps.scrollLeft : prevState.scrollLeft,\n scrollTop: nextProps.scrollTop != null && nextProps.scrollTop >= 0 ? nextProps.scrollTop : prevState.scrollTop\n };\n }\n\n return null;\n }\n }]);\n\n return MultiGrid;\n}(React.PureComponent);\n\n_defineProperty(MultiGrid, \"defaultProps\", {\n classNameBottomLeftGrid: '',\n classNameBottomRightGrid: '',\n classNameTopLeftGrid: '',\n classNameTopRightGrid: '',\n enableFixedColumnScroll: false,\n enableFixedRowScroll: false,\n fixedColumnCount: 0,\n fixedRowCount: 0,\n scrollToColumn: -1,\n scrollToRow: -1,\n style: {},\n styleBottomLeftGrid: {},\n styleBottomRightGrid: {},\n styleTopLeftGrid: {},\n styleTopRightGrid: {},\n hideTopRightGridScrollbar: false,\n hideBottomLeftGridScrollbar: false\n});\n\nMultiGrid.propTypes = process.env.NODE_ENV !== \"production\" ? {\n classNameBottomLeftGrid: PropTypes.string.isRequired,\n classNameBottomRightGrid: PropTypes.string.isRequired,\n classNameTopLeftGrid: PropTypes.string.isRequired,\n classNameTopRightGrid: PropTypes.string.isRequired,\n enableFixedColumnScroll: PropTypes.bool.isRequired,\n enableFixedRowScroll: PropTypes.bool.isRequired,\n fixedColumnCount: PropTypes.number.isRequired,\n fixedRowCount: PropTypes.number.isRequired,\n onScrollbarPresenceChange: PropTypes.func,\n style: PropTypes.object.isRequired,\n styleBottomLeftGrid: PropTypes.object.isRequired,\n styleBottomRightGrid: PropTypes.object.isRequired,\n styleTopLeftGrid: PropTypes.object.isRequired,\n styleTopRightGrid: PropTypes.object.isRequired,\n hideTopRightGridScrollbar: PropTypes.bool,\n hideBottomLeftGridScrollbar: PropTypes.bool\n} : {};\npolyfill(MultiGrid);\nexport default MultiGrid;","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\n/**\n * HOC that simplifies the process of synchronizing scrolling between two or more virtualized components.\n */\n\nvar ScrollSync =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(ScrollSync, _React$PureComponent);\n\n function ScrollSync(props, context) {\n var _this;\n\n _classCallCheck(this, ScrollSync);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(ScrollSync).call(this, props, context));\n _this.state = {\n clientHeight: 0,\n clientWidth: 0,\n scrollHeight: 0,\n scrollLeft: 0,\n scrollTop: 0,\n scrollWidth: 0\n };\n _this._onScroll = _this._onScroll.bind(_assertThisInitialized(_this));\n return _this;\n }\n\n _createClass(ScrollSync, [{\n key: \"render\",\n value: function render() {\n var children = this.props.children;\n var _this$state = this.state,\n clientHeight = _this$state.clientHeight,\n clientWidth = _this$state.clientWidth,\n scrollHeight = _this$state.scrollHeight,\n scrollLeft = _this$state.scrollLeft,\n scrollTop = _this$state.scrollTop,\n scrollWidth = _this$state.scrollWidth;\n return children({\n clientHeight: clientHeight,\n clientWidth: clientWidth,\n onScroll: this._onScroll,\n scrollHeight: scrollHeight,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n scrollWidth: scrollWidth\n });\n }\n }, {\n key: \"_onScroll\",\n value: function _onScroll(_ref) {\n var clientHeight = _ref.clientHeight,\n clientWidth = _ref.clientWidth,\n scrollHeight = _ref.scrollHeight,\n scrollLeft = _ref.scrollLeft,\n scrollTop = _ref.scrollTop,\n scrollWidth = _ref.scrollWidth;\n this.setState({\n clientHeight: clientHeight,\n clientWidth: clientWidth,\n scrollHeight: scrollHeight,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n scrollWidth: scrollWidth\n });\n }\n }]);\n\n return ScrollSync;\n}(React.PureComponent);\n\nexport { ScrollSync as default };\nScrollSync.propTypes = process.env.NODE_ENV !== \"production\" ? {\n /**\n * Function responsible for rendering 2 or more virtualized components.\n * This function should implement the following signature:\n * ({ onScroll, scrollLeft, scrollTop }) => PropTypes.element\n */\n children: PropTypes.func.isRequired\n} : {};","import * as React from 'react';\nexport default function defaultHeaderRowRenderer(_ref) {\n var className = _ref.className,\n columns = _ref.columns,\n style = _ref.style;\n return React.createElement(\"div\", {\n className: className,\n role: \"row\",\n style: style\n }, columns);\n}\ndefaultHeaderRowRenderer.propTypes = process.env.NODE_ENV === 'production' ? null : bpfrpt_proptype_HeaderRowRendererParams === PropTypes.any ? {} : bpfrpt_proptype_HeaderRowRendererParams;\nimport { bpfrpt_proptype_HeaderRowRendererParams } from \"./types\";\nimport PropTypes from \"prop-types\";","var SortDirection = {\n /**\n * Sort items in ascending order.\n * This means arranging from the lowest value to the highest (e.g. a-z, 0-9).\n */\n ASC: 'ASC',\n\n /**\n * Sort items in descending order.\n * This means arranging from the highest value to the lowest (e.g. z-a, 9-0).\n */\n DESC: 'DESC'\n};\nexport default SortDirection;","import clsx from 'clsx';\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\nimport SortDirection from './SortDirection';\n/**\n * Displayed beside a header to indicate that a Table is currently sorted by this column.\n */\n\nexport default function SortIndicator(_ref) {\n var sortDirection = _ref.sortDirection;\n var classNames = clsx('ReactVirtualized__Table__sortableHeaderIcon', {\n 'ReactVirtualized__Table__sortableHeaderIcon--ASC': sortDirection === SortDirection.ASC,\n 'ReactVirtualized__Table__sortableHeaderIcon--DESC': sortDirection === SortDirection.DESC\n });\n return React.createElement(\"svg\", {\n className: classNames,\n width: 18,\n height: 18,\n viewBox: \"0 0 24 24\"\n }, sortDirection === SortDirection.ASC ? React.createElement(\"path\", {\n d: \"M7 14l5-5 5 5z\"\n }) : React.createElement(\"path\", {\n d: \"M7 10l5 5 5-5z\"\n }), React.createElement(\"path\", {\n d: \"M0 0h24v24H0z\",\n fill: \"none\"\n }));\n}\nSortIndicator.propTypes = process.env.NODE_ENV !== \"production\" ? {\n sortDirection: PropTypes.oneOf([SortDirection.ASC, SortDirection.DESC])\n} : {};","import * as React from 'react';\nimport SortIndicator from './SortIndicator';\n\n/**\n * Default table header renderer.\n */\nexport default function defaultHeaderRenderer(_ref) {\n var dataKey = _ref.dataKey,\n label = _ref.label,\n sortBy = _ref.sortBy,\n sortDirection = _ref.sortDirection;\n var showSortIndicator = sortBy === dataKey;\n var children = [React.createElement(\"span\", {\n className: \"ReactVirtualized__Table__headerTruncatedText\",\n key: \"label\",\n title: typeof label === 'string' ? label : null\n }, label)];\n\n if (showSortIndicator) {\n children.push(React.createElement(SortIndicator, {\n key: \"SortIndicator\",\n sortDirection: sortDirection\n }));\n }\n\n return children;\n}\ndefaultHeaderRenderer.propTypes = process.env.NODE_ENV === 'production' ? null : bpfrpt_proptype_HeaderRendererParams === PropTypes.any ? {} : bpfrpt_proptype_HeaderRendererParams;\nimport { bpfrpt_proptype_HeaderRendererParams } from \"./types\";\nimport PropTypes from \"prop-types\";","import _extends from \"@babel/runtime/helpers/extends\";\nimport * as React from 'react';\n\n/**\n * Default row renderer for Table.\n */\nexport default function defaultRowRenderer(_ref) {\n var className = _ref.className,\n columns = _ref.columns,\n index = _ref.index,\n key = _ref.key,\n onRowClick = _ref.onRowClick,\n onRowDoubleClick = _ref.onRowDoubleClick,\n onRowMouseOut = _ref.onRowMouseOut,\n onRowMouseOver = _ref.onRowMouseOver,\n onRowRightClick = _ref.onRowRightClick,\n rowData = _ref.rowData,\n style = _ref.style;\n var a11yProps = {\n 'aria-rowindex': index + 1\n };\n\n if (onRowClick || onRowDoubleClick || onRowMouseOut || onRowMouseOver || onRowRightClick) {\n a11yProps['aria-label'] = 'row';\n a11yProps.tabIndex = 0;\n\n if (onRowClick) {\n a11yProps.onClick = function (event) {\n return onRowClick({\n event: event,\n index: index,\n rowData: rowData\n });\n };\n }\n\n if (onRowDoubleClick) {\n a11yProps.onDoubleClick = function (event) {\n return onRowDoubleClick({\n event: event,\n index: index,\n rowData: rowData\n });\n };\n }\n\n if (onRowMouseOut) {\n a11yProps.onMouseOut = function (event) {\n return onRowMouseOut({\n event: event,\n index: index,\n rowData: rowData\n });\n };\n }\n\n if (onRowMouseOver) {\n a11yProps.onMouseOver = function (event) {\n return onRowMouseOver({\n event: event,\n index: index,\n rowData: rowData\n });\n };\n }\n\n if (onRowRightClick) {\n a11yProps.onContextMenu = function (event) {\n return onRowRightClick({\n event: event,\n index: index,\n rowData: rowData\n });\n };\n }\n }\n\n return React.createElement(\"div\", _extends({}, a11yProps, {\n className: className,\n key: key,\n role: \"row\",\n style: style\n }), columns);\n}\ndefaultRowRenderer.propTypes = process.env.NODE_ENV === 'production' ? null : bpfrpt_proptype_RowRendererParams === PropTypes.any ? {} : bpfrpt_proptype_RowRendererParams;\nimport { bpfrpt_proptype_RowRendererParams } from \"./types\";\nimport PropTypes from \"prop-types\";","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\nimport defaultHeaderRenderer from './defaultHeaderRenderer';\nimport defaultCellRenderer from './defaultCellRenderer';\nimport defaultCellDataGetter from './defaultCellDataGetter';\nimport SortDirection from './SortDirection';\n/**\n * Describes the header and cell contents of a table column.\n */\n\nvar Column =\n/*#__PURE__*/\nfunction (_React$Component) {\n _inherits(Column, _React$Component);\n\n function Column() {\n _classCallCheck(this, Column);\n\n return _possibleConstructorReturn(this, _getPrototypeOf(Column).apply(this, arguments));\n }\n\n return Column;\n}(React.Component);\n\n_defineProperty(Column, \"defaultProps\", {\n cellDataGetter: defaultCellDataGetter,\n cellRenderer: defaultCellRenderer,\n defaultSortDirection: SortDirection.ASC,\n flexGrow: 0,\n flexShrink: 1,\n headerRenderer: defaultHeaderRenderer,\n style: {}\n});\n\nexport { Column as default };\nColumn.propTypes = process.env.NODE_ENV !== \"production\" ? {\n /** Optional aria-label value to set on the column header */\n 'aria-label': PropTypes.string,\n\n /**\n * Callback responsible for returning a cell's data, given its :dataKey\n * ({ columnData: any, dataKey: string, rowData: any }): any\n */\n cellDataGetter: PropTypes.func,\n\n /**\n * Callback responsible for rendering a cell's contents.\n * ({ cellData: any, columnData: any, dataKey: string, rowData: any, rowIndex: number }): node\n */\n cellRenderer: PropTypes.func,\n\n /** Optional CSS class to apply to cell */\n className: PropTypes.string,\n\n /** Optional additional data passed to this column's :cellDataGetter */\n columnData: PropTypes.object,\n\n /** Uniquely identifies the row-data attribute corresponding to this cell */\n dataKey: PropTypes.any.isRequired,\n\n /** Optional direction to be used when clicked the first time */\n defaultSortDirection: PropTypes.oneOf([SortDirection.ASC, SortDirection.DESC]),\n\n /** If sort is enabled for the table at large, disable it for this column */\n disableSort: PropTypes.bool,\n\n /** Flex grow style; defaults to 0 */\n flexGrow: PropTypes.number,\n\n /** Flex shrink style; defaults to 1 */\n flexShrink: PropTypes.number,\n\n /** Optional CSS class to apply to this column's header */\n headerClassName: PropTypes.string,\n\n /**\n * Optional callback responsible for rendering a column header contents.\n * ({ columnData: object, dataKey: string, disableSort: boolean, label: node, sortBy: string, sortDirection: string }): PropTypes.node\n */\n headerRenderer: PropTypes.func.isRequired,\n\n /** Optional inline style to apply to this column's header */\n headerStyle: PropTypes.object,\n\n /** Optional id to set on the column header */\n id: PropTypes.string,\n\n /** Header label for this column */\n label: PropTypes.node,\n\n /** Maximum width of column; this property will only be used if :flexGrow is > 0. */\n maxWidth: PropTypes.number,\n\n /** Minimum width of column. */\n minWidth: PropTypes.number,\n\n /** Optional inline style to apply to cell */\n style: PropTypes.object,\n\n /** Flex basis (width) for this column; This value can grow or shrink based on :flexGrow and :flexShrink properties. */\n width: PropTypes.number.isRequired\n} : {};","import _extends from \"@babel/runtime/helpers/extends\";\nimport _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport clsx from 'clsx';\nimport Column from './Column';\nimport PropTypes from 'prop-types';\nimport * as React from 'react';\nimport { findDOMNode } from 'react-dom';\nimport Grid, { accessibilityOverscanIndicesGetter } from '../Grid';\nimport defaultRowRenderer from './defaultRowRenderer';\nimport defaultHeaderRowRenderer from './defaultHeaderRowRenderer';\nimport SortDirection from './SortDirection';\n/**\n * Table component with fixed headers and virtualized rows for improved performance with large data sets.\n * This component expects explicit width, height, and padding parameters.\n */\n\nvar Table =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(Table, _React$PureComponent);\n\n function Table(props) {\n var _this;\n\n _classCallCheck(this, Table);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(Table).call(this, props));\n _this.state = {\n scrollbarWidth: 0\n };\n _this._createColumn = _this._createColumn.bind(_assertThisInitialized(_this));\n _this._createRow = _this._createRow.bind(_assertThisInitialized(_this));\n _this._onScroll = _this._onScroll.bind(_assertThisInitialized(_this));\n _this._onSectionRendered = _this._onSectionRendered.bind(_assertThisInitialized(_this));\n _this._setRef = _this._setRef.bind(_assertThisInitialized(_this));\n return _this;\n }\n\n _createClass(Table, [{\n key: \"forceUpdateGrid\",\n value: function forceUpdateGrid() {\n if (this.Grid) {\n this.Grid.forceUpdate();\n }\n }\n /** See Grid#getOffsetForCell */\n\n }, {\n key: \"getOffsetForRow\",\n value: function getOffsetForRow(_ref) {\n var alignment = _ref.alignment,\n index = _ref.index;\n\n if (this.Grid) {\n var _this$Grid$getOffsetF = this.Grid.getOffsetForCell({\n alignment: alignment,\n rowIndex: index\n }),\n scrollTop = _this$Grid$getOffsetF.scrollTop;\n\n return scrollTop;\n }\n\n return 0;\n }\n /** CellMeasurer compatibility */\n\n }, {\n key: \"invalidateCellSizeAfterRender\",\n value: function invalidateCellSizeAfterRender(_ref2) {\n var columnIndex = _ref2.columnIndex,\n rowIndex = _ref2.rowIndex;\n\n if (this.Grid) {\n this.Grid.invalidateCellSizeAfterRender({\n rowIndex: rowIndex,\n columnIndex: columnIndex\n });\n }\n }\n /** See Grid#measureAllCells */\n\n }, {\n key: \"measureAllRows\",\n value: function measureAllRows() {\n if (this.Grid) {\n this.Grid.measureAllCells();\n }\n }\n /** CellMeasurer compatibility */\n\n }, {\n key: \"recomputeGridSize\",\n value: function recomputeGridSize() {\n var _ref3 = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},\n _ref3$columnIndex = _ref3.columnIndex,\n columnIndex = _ref3$columnIndex === void 0 ? 0 : _ref3$columnIndex,\n _ref3$rowIndex = _ref3.rowIndex,\n rowIndex = _ref3$rowIndex === void 0 ? 0 : _ref3$rowIndex;\n\n if (this.Grid) {\n this.Grid.recomputeGridSize({\n rowIndex: rowIndex,\n columnIndex: columnIndex\n });\n }\n }\n /** See Grid#recomputeGridSize */\n\n }, {\n key: \"recomputeRowHeights\",\n value: function recomputeRowHeights() {\n var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;\n\n if (this.Grid) {\n this.Grid.recomputeGridSize({\n rowIndex: index\n });\n }\n }\n /** See Grid#scrollToPosition */\n\n }, {\n key: \"scrollToPosition\",\n value: function scrollToPosition() {\n var scrollTop = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;\n\n if (this.Grid) {\n this.Grid.scrollToPosition({\n scrollTop: scrollTop\n });\n }\n }\n /** See Grid#scrollToCell */\n\n }, {\n key: \"scrollToRow\",\n value: function scrollToRow() {\n var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;\n\n if (this.Grid) {\n this.Grid.scrollToCell({\n columnIndex: 0,\n rowIndex: index\n });\n }\n }\n }, {\n key: \"getScrollbarWidth\",\n value: function getScrollbarWidth() {\n if (this.Grid) {\n var _Grid = findDOMNode(this.Grid);\n\n var clientWidth = _Grid.clientWidth || 0;\n var offsetWidth = _Grid.offsetWidth || 0;\n return offsetWidth - clientWidth;\n }\n\n return 0;\n }\n }, {\n key: \"componentDidMount\",\n value: function componentDidMount() {\n this._setScrollbarWidth();\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate() {\n this._setScrollbarWidth();\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this2 = this;\n\n var _this$props = this.props,\n children = _this$props.children,\n className = _this$props.className,\n disableHeader = _this$props.disableHeader,\n gridClassName = _this$props.gridClassName,\n gridStyle = _this$props.gridStyle,\n headerHeight = _this$props.headerHeight,\n headerRowRenderer = _this$props.headerRowRenderer,\n height = _this$props.height,\n id = _this$props.id,\n noRowsRenderer = _this$props.noRowsRenderer,\n rowClassName = _this$props.rowClassName,\n rowStyle = _this$props.rowStyle,\n scrollToIndex = _this$props.scrollToIndex,\n style = _this$props.style,\n width = _this$props.width;\n var scrollbarWidth = this.state.scrollbarWidth;\n var availableRowsHeight = disableHeader ? height : height - headerHeight;\n var rowClass = typeof rowClassName === 'function' ? rowClassName({\n index: -1\n }) : rowClassName;\n var rowStyleObject = typeof rowStyle === 'function' ? rowStyle({\n index: -1\n }) : rowStyle; // Precompute and cache column styles before rendering rows and columns to speed things up\n\n this._cachedColumnStyles = [];\n React.Children.toArray(children).forEach(function (column, index) {\n var flexStyles = _this2._getFlexStyleForColumn(column, column.props.style);\n\n _this2._cachedColumnStyles[index] = _objectSpread({\n overflow: 'hidden'\n }, flexStyles);\n }); // Note that we specify :rowCount, :scrollbarWidth, :sortBy, and :sortDirection as properties on Grid even though these have nothing to do with Grid.\n // This is done because Grid is a pure component and won't update unless its properties or state has changed.\n // Any property that should trigger a re-render of Grid then is specified here to avoid a stale display.\n\n return React.createElement(\"div\", {\n \"aria-label\": this.props['aria-label'],\n \"aria-labelledby\": this.props['aria-labelledby'],\n \"aria-colcount\": React.Children.toArray(children).length,\n \"aria-rowcount\": this.props.rowCount,\n className: clsx('ReactVirtualized__Table', className),\n id: id,\n role: \"grid\",\n style: style\n }, !disableHeader && headerRowRenderer({\n className: clsx('ReactVirtualized__Table__headerRow', rowClass),\n columns: this._getHeaderColumns(),\n style: _objectSpread({\n height: headerHeight,\n overflow: 'hidden',\n paddingRight: scrollbarWidth,\n width: width\n }, rowStyleObject)\n }), React.createElement(Grid, _extends({}, this.props, {\n \"aria-readonly\": null,\n autoContainerWidth: true,\n className: clsx('ReactVirtualized__Table__Grid', gridClassName),\n cellRenderer: this._createRow,\n columnWidth: width,\n columnCount: 1,\n height: availableRowsHeight,\n id: undefined,\n noContentRenderer: noRowsRenderer,\n onScroll: this._onScroll,\n onSectionRendered: this._onSectionRendered,\n ref: this._setRef,\n role: \"rowgroup\",\n scrollbarWidth: scrollbarWidth,\n scrollToRow: scrollToIndex,\n style: _objectSpread({}, gridStyle, {\n overflowX: 'hidden'\n })\n })));\n }\n }, {\n key: \"_createColumn\",\n value: function _createColumn(_ref4) {\n var column = _ref4.column,\n columnIndex = _ref4.columnIndex,\n isScrolling = _ref4.isScrolling,\n parent = _ref4.parent,\n rowData = _ref4.rowData,\n rowIndex = _ref4.rowIndex;\n var onColumnClick = this.props.onColumnClick;\n var _column$props = column.props,\n cellDataGetter = _column$props.cellDataGetter,\n cellRenderer = _column$props.cellRenderer,\n className = _column$props.className,\n columnData = _column$props.columnData,\n dataKey = _column$props.dataKey,\n id = _column$props.id;\n var cellData = cellDataGetter({\n columnData: columnData,\n dataKey: dataKey,\n rowData: rowData\n });\n var renderedCell = cellRenderer({\n cellData: cellData,\n columnData: columnData,\n columnIndex: columnIndex,\n dataKey: dataKey,\n isScrolling: isScrolling,\n parent: parent,\n rowData: rowData,\n rowIndex: rowIndex\n });\n\n var onClick = function onClick(event) {\n onColumnClick && onColumnClick({\n columnData: columnData,\n dataKey: dataKey,\n event: event\n });\n };\n\n var style = this._cachedColumnStyles[columnIndex];\n var title = typeof renderedCell === 'string' ? renderedCell : null; // Avoid using object-spread syntax with multiple objects here,\n // Since it results in an extra method call to 'babel-runtime/helpers/extends'\n // See PR https://github.com/bvaughn/react-virtualized/pull/942\n\n return React.createElement(\"div\", {\n \"aria-colindex\": columnIndex + 1,\n \"aria-describedby\": id,\n className: clsx('ReactVirtualized__Table__rowColumn', className),\n key: 'Row' + rowIndex + '-' + 'Col' + columnIndex,\n onClick: onClick,\n role: \"gridcell\",\n style: style,\n title: title\n }, renderedCell);\n }\n }, {\n key: \"_createHeader\",\n value: function _createHeader(_ref5) {\n var column = _ref5.column,\n index = _ref5.index;\n var _this$props2 = this.props,\n headerClassName = _this$props2.headerClassName,\n headerStyle = _this$props2.headerStyle,\n onHeaderClick = _this$props2.onHeaderClick,\n sort = _this$props2.sort,\n sortBy = _this$props2.sortBy,\n sortDirection = _this$props2.sortDirection;\n var _column$props2 = column.props,\n columnData = _column$props2.columnData,\n dataKey = _column$props2.dataKey,\n defaultSortDirection = _column$props2.defaultSortDirection,\n disableSort = _column$props2.disableSort,\n headerRenderer = _column$props2.headerRenderer,\n id = _column$props2.id,\n label = _column$props2.label;\n var sortEnabled = !disableSort && sort;\n var classNames = clsx('ReactVirtualized__Table__headerColumn', headerClassName, column.props.headerClassName, {\n ReactVirtualized__Table__sortableHeaderColumn: sortEnabled\n });\n\n var style = this._getFlexStyleForColumn(column, _objectSpread({}, headerStyle, {}, column.props.headerStyle));\n\n var renderedHeader = headerRenderer({\n columnData: columnData,\n dataKey: dataKey,\n disableSort: disableSort,\n label: label,\n sortBy: sortBy,\n sortDirection: sortDirection\n });\n var headerOnClick, headerOnKeyDown, headerTabIndex, headerAriaSort, headerAriaLabel;\n\n if (sortEnabled || onHeaderClick) {\n // If this is a sortable header, clicking it should update the table data's sorting.\n var isFirstTimeSort = sortBy !== dataKey; // If this is the firstTime sort of this column, use the column default sort order.\n // Otherwise, invert the direction of the sort.\n\n var newSortDirection = isFirstTimeSort ? defaultSortDirection : sortDirection === SortDirection.DESC ? SortDirection.ASC : SortDirection.DESC;\n\n var onClick = function onClick(event) {\n sortEnabled && sort({\n defaultSortDirection: defaultSortDirection,\n event: event,\n sortBy: dataKey,\n sortDirection: newSortDirection\n });\n onHeaderClick && onHeaderClick({\n columnData: columnData,\n dataKey: dataKey,\n event: event\n });\n };\n\n var onKeyDown = function onKeyDown(event) {\n if (event.key === 'Enter' || event.key === ' ') {\n onClick(event);\n }\n };\n\n headerAriaLabel = column.props['aria-label'] || label || dataKey;\n headerAriaSort = 'none';\n headerTabIndex = 0;\n headerOnClick = onClick;\n headerOnKeyDown = onKeyDown;\n }\n\n if (sortBy === dataKey) {\n headerAriaSort = sortDirection === SortDirection.ASC ? 'ascending' : 'descending';\n } // Avoid using object-spread syntax with multiple objects here,\n // Since it results in an extra method call to 'babel-runtime/helpers/extends'\n // See PR https://github.com/bvaughn/react-virtualized/pull/942\n\n\n return React.createElement(\"div\", {\n \"aria-label\": headerAriaLabel,\n \"aria-sort\": headerAriaSort,\n className: classNames,\n id: id,\n key: 'Header-Col' + index,\n onClick: headerOnClick,\n onKeyDown: headerOnKeyDown,\n role: \"columnheader\",\n style: style,\n tabIndex: headerTabIndex\n }, renderedHeader);\n }\n }, {\n key: \"_createRow\",\n value: function _createRow(_ref6) {\n var _this3 = this;\n\n var index = _ref6.rowIndex,\n isScrolling = _ref6.isScrolling,\n key = _ref6.key,\n parent = _ref6.parent,\n style = _ref6.style;\n var _this$props3 = this.props,\n children = _this$props3.children,\n onRowClick = _this$props3.onRowClick,\n onRowDoubleClick = _this$props3.onRowDoubleClick,\n onRowRightClick = _this$props3.onRowRightClick,\n onRowMouseOver = _this$props3.onRowMouseOver,\n onRowMouseOut = _this$props3.onRowMouseOut,\n rowClassName = _this$props3.rowClassName,\n rowGetter = _this$props3.rowGetter,\n rowRenderer = _this$props3.rowRenderer,\n rowStyle = _this$props3.rowStyle;\n var scrollbarWidth = this.state.scrollbarWidth;\n var rowClass = typeof rowClassName === 'function' ? rowClassName({\n index: index\n }) : rowClassName;\n var rowStyleObject = typeof rowStyle === 'function' ? rowStyle({\n index: index\n }) : rowStyle;\n var rowData = rowGetter({\n index: index\n });\n var columns = React.Children.toArray(children).map(function (column, columnIndex) {\n return _this3._createColumn({\n column: column,\n columnIndex: columnIndex,\n isScrolling: isScrolling,\n parent: parent,\n rowData: rowData,\n rowIndex: index,\n scrollbarWidth: scrollbarWidth\n });\n });\n var className = clsx('ReactVirtualized__Table__row', rowClass);\n\n var flattenedStyle = _objectSpread({}, style, {\n height: this._getRowHeight(index),\n overflow: 'hidden',\n paddingRight: scrollbarWidth\n }, rowStyleObject);\n\n return rowRenderer({\n className: className,\n columns: columns,\n index: index,\n isScrolling: isScrolling,\n key: key,\n onRowClick: onRowClick,\n onRowDoubleClick: onRowDoubleClick,\n onRowRightClick: onRowRightClick,\n onRowMouseOver: onRowMouseOver,\n onRowMouseOut: onRowMouseOut,\n rowData: rowData,\n style: flattenedStyle\n });\n }\n /**\n * Determines the flex-shrink, flex-grow, and width values for a cell (header or column).\n */\n\n }, {\n key: \"_getFlexStyleForColumn\",\n value: function _getFlexStyleForColumn(column) {\n var customStyle = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var flexValue = \"\".concat(column.props.flexGrow, \" \").concat(column.props.flexShrink, \" \").concat(column.props.width, \"px\");\n\n var style = _objectSpread({}, customStyle, {\n flex: flexValue,\n msFlex: flexValue,\n WebkitFlex: flexValue\n });\n\n if (column.props.maxWidth) {\n style.maxWidth = column.props.maxWidth;\n }\n\n if (column.props.minWidth) {\n style.minWidth = column.props.minWidth;\n }\n\n return style;\n }\n }, {\n key: \"_getHeaderColumns\",\n value: function _getHeaderColumns() {\n var _this4 = this;\n\n var _this$props4 = this.props,\n children = _this$props4.children,\n disableHeader = _this$props4.disableHeader;\n var items = disableHeader ? [] : React.Children.toArray(children);\n return items.map(function (column, index) {\n return _this4._createHeader({\n column: column,\n index: index\n });\n });\n }\n }, {\n key: \"_getRowHeight\",\n value: function _getRowHeight(rowIndex) {\n var rowHeight = this.props.rowHeight;\n return typeof rowHeight === 'function' ? rowHeight({\n index: rowIndex\n }) : rowHeight;\n }\n }, {\n key: \"_onScroll\",\n value: function _onScroll(_ref7) {\n var clientHeight = _ref7.clientHeight,\n scrollHeight = _ref7.scrollHeight,\n scrollTop = _ref7.scrollTop;\n var onScroll = this.props.onScroll;\n onScroll({\n clientHeight: clientHeight,\n scrollHeight: scrollHeight,\n scrollTop: scrollTop\n });\n }\n }, {\n key: \"_onSectionRendered\",\n value: function _onSectionRendered(_ref8) {\n var rowOverscanStartIndex = _ref8.rowOverscanStartIndex,\n rowOverscanStopIndex = _ref8.rowOverscanStopIndex,\n rowStartIndex = _ref8.rowStartIndex,\n rowStopIndex = _ref8.rowStopIndex;\n var onRowsRendered = this.props.onRowsRendered;\n onRowsRendered({\n overscanStartIndex: rowOverscanStartIndex,\n overscanStopIndex: rowOverscanStopIndex,\n startIndex: rowStartIndex,\n stopIndex: rowStopIndex\n });\n }\n }, {\n key: \"_setRef\",\n value: function _setRef(ref) {\n this.Grid = ref;\n }\n }, {\n key: \"_setScrollbarWidth\",\n value: function _setScrollbarWidth() {\n var scrollbarWidth = this.getScrollbarWidth();\n this.setState({\n scrollbarWidth: scrollbarWidth\n });\n }\n }]);\n\n return Table;\n}(React.PureComponent);\n\n_defineProperty(Table, \"defaultProps\", {\n disableHeader: false,\n estimatedRowSize: 30,\n headerHeight: 0,\n headerStyle: {},\n noRowsRenderer: function noRowsRenderer() {\n return null;\n },\n onRowsRendered: function onRowsRendered() {\n return null;\n },\n onScroll: function onScroll() {\n return null;\n },\n overscanIndicesGetter: accessibilityOverscanIndicesGetter,\n overscanRowCount: 10,\n rowRenderer: defaultRowRenderer,\n headerRowRenderer: defaultHeaderRowRenderer,\n rowStyle: {},\n scrollToAlignment: 'auto',\n scrollToIndex: -1,\n style: {}\n});\n\nexport { Table as default };\nTable.propTypes = process.env.NODE_ENV !== \"production\" ? {\n /** This is just set on the grid top element. */\n 'aria-label': PropTypes.string,\n\n /** This is just set on the grid top element. */\n 'aria-labelledby': PropTypes.string,\n\n /**\n * Removes fixed height from the scrollingContainer so that the total height\n * of rows can stretch the window. Intended for use with WindowScroller\n */\n autoHeight: PropTypes.bool,\n\n /** One or more Columns describing the data displayed in this row */\n children: function children(props) {\n var children = React.Children.toArray(props.children);\n\n for (var i = 0; i < children.length; i++) {\n var childType = children[i].type;\n\n if (childType !== Column && !(childType.prototype instanceof Column)) {\n return new Error('Table only accepts children of type Column');\n }\n }\n },\n\n /** Optional CSS class name */\n className: PropTypes.string,\n\n /** Disable rendering the header at all */\n disableHeader: PropTypes.bool,\n\n /**\n * Used to estimate the total height of a Table before all of its rows have actually been measured.\n * The estimated total height is adjusted as rows are rendered.\n */\n estimatedRowSize: PropTypes.number.isRequired,\n\n /** Optional custom CSS class name to attach to inner Grid element. */\n gridClassName: PropTypes.string,\n\n /** Optional inline style to attach to inner Grid element. */\n gridStyle: PropTypes.object,\n\n /** Optional CSS class to apply to all column headers */\n headerClassName: PropTypes.string,\n\n /** Fixed height of header row */\n headerHeight: PropTypes.number.isRequired,\n\n /**\n * Responsible for rendering a table row given an array of columns:\n * Should implement the following interface: ({\n * className: string,\n * columns: any[],\n * style: any\n * }): PropTypes.node\n */\n headerRowRenderer: PropTypes.func,\n\n /** Optional custom inline style to attach to table header columns. */\n headerStyle: PropTypes.object,\n\n /** Fixed/available height for out DOM element */\n height: PropTypes.number.isRequired,\n\n /** Optional id */\n id: PropTypes.string,\n\n /** Optional renderer to be used in place of table body rows when rowCount is 0 */\n noRowsRenderer: PropTypes.func,\n\n /**\n * Optional callback when a column is clicked.\n * ({ columnData: any, dataKey: string }): void\n */\n onColumnClick: PropTypes.func,\n\n /**\n * Optional callback when a column's header is clicked.\n * ({ columnData: any, dataKey: string }): void\n */\n onHeaderClick: PropTypes.func,\n\n /**\n * Callback invoked when a user clicks on a table row.\n * ({ index: number }): void\n */\n onRowClick: PropTypes.func,\n\n /**\n * Callback invoked when a user double-clicks on a table row.\n * ({ index: number }): void\n */\n onRowDoubleClick: PropTypes.func,\n\n /**\n * Callback invoked when the mouse leaves a table row.\n * ({ index: number }): void\n */\n onRowMouseOut: PropTypes.func,\n\n /**\n * Callback invoked when a user moves the mouse over a table row.\n * ({ index: number }): void\n */\n onRowMouseOver: PropTypes.func,\n\n /**\n * Callback invoked when a user right-clicks on a table row.\n * ({ index: number }): void\n */\n onRowRightClick: PropTypes.func,\n\n /**\n * Callback invoked with information about the slice of rows that were just rendered.\n * ({ startIndex, stopIndex }): void\n */\n onRowsRendered: PropTypes.func,\n\n /**\n * Callback invoked whenever the scroll offset changes within the inner scrollable region.\n * This callback can be used to sync scrolling between lists, tables, or grids.\n * ({ clientHeight, scrollHeight, scrollTop }): void\n */\n onScroll: PropTypes.func.isRequired,\n\n /** See Grid#overscanIndicesGetter */\n overscanIndicesGetter: PropTypes.func.isRequired,\n\n /**\n * Number of rows to render above/below the visible bounds of the list.\n * These rows can help for smoother scrolling on touch devices.\n */\n overscanRowCount: PropTypes.number.isRequired,\n\n /**\n * Optional CSS class to apply to all table rows (including the header row).\n * This property can be a CSS class name (string) or a function that returns a class name.\n * If a function is provided its signature should be: ({ index: number }): string\n */\n rowClassName: PropTypes.oneOfType([PropTypes.string, PropTypes.func]),\n\n /**\n * Callback responsible for returning a data row given an index.\n * ({ index: number }): any\n */\n rowGetter: PropTypes.func.isRequired,\n\n /**\n * Either a fixed row height (number) or a function that returns the height of a row given its index.\n * ({ index: number }): number\n */\n rowHeight: PropTypes.oneOfType([PropTypes.number, PropTypes.func]).isRequired,\n\n /** Number of rows in table. */\n rowCount: PropTypes.number.isRequired,\n\n /**\n * Responsible for rendering a table row given an array of columns:\n * Should implement the following interface: ({\n * className: string,\n * columns: Array,\n * index: number,\n * isScrolling: boolean,\n * onRowClick: ?Function,\n * onRowDoubleClick: ?Function,\n * onRowMouseOver: ?Function,\n * onRowMouseOut: ?Function,\n * rowData: any,\n * style: any\n * }): PropTypes.node\n */\n rowRenderer: PropTypes.func,\n\n /** Optional custom inline style to attach to table rows. */\n rowStyle: PropTypes.oneOfType([PropTypes.object, PropTypes.func]).isRequired,\n\n /** See Grid#scrollToAlignment */\n scrollToAlignment: PropTypes.oneOf(['auto', 'end', 'start', 'center']).isRequired,\n\n /** Row index to ensure visible (by forcefully scrolling if necessary) */\n scrollToIndex: PropTypes.number.isRequired,\n\n /** Vertical offset. */\n scrollTop: PropTypes.number,\n\n /**\n * Sort function to be called if a sortable header is clicked.\n * Should implement the following interface: ({\n * defaultSortDirection: 'ASC' | 'DESC',\n * event: MouseEvent,\n * sortBy: string,\n * sortDirection: SortDirection\n * }): void\n */\n sort: PropTypes.func,\n\n /** Table data is currently sorted by this :dataKey (if it is sorted at all) */\n sortBy: PropTypes.string,\n\n /** Table data is currently sorted in this direction (if it is sorted at all) */\n sortDirection: PropTypes.oneOf([SortDirection.ASC, SortDirection.DESC]),\n\n /** Optional inline style */\n style: PropTypes.object,\n\n /** Tab index for focus */\n tabIndex: PropTypes.number,\n\n /** Width of list */\n width: PropTypes.number.isRequired\n} : {};\nimport { bpfrpt_proptype_CellPosition } from \"../Grid\";","/**\n * Default accessor for returning a cell value for a given attribute.\n * This function expects to operate on either a vanilla Object or an Immutable Map.\n * You should override the column's cellDataGetter if your data is some other type of object.\n */\nexport default function defaultCellDataGetter(_ref) {\n var dataKey = _ref.dataKey,\n rowData = _ref.rowData;\n\n if (typeof rowData.get === 'function') {\n return rowData.get(dataKey);\n } else {\n return rowData[dataKey];\n }\n}\nimport { bpfrpt_proptype_CellDataGetterParams } from \"./types\";","/**\n * Default cell renderer that displays an attribute as a simple string\n * You should override the column's cellRenderer if your data is some other type of object.\n */\nexport default function defaultCellRenderer(_ref) {\n var cellData = _ref.cellData;\n\n if (cellData == null) {\n return '';\n } else {\n return String(cellData);\n }\n}\nimport { bpfrpt_proptype_CellRendererParams } from \"./types\";","import createMultiSort from './createMultiSort';\nimport defaultCellDataGetter from './defaultCellDataGetter';\nimport defaultCellRenderer from './defaultCellRenderer';\nimport defaultHeaderRowRenderer from './defaultHeaderRowRenderer.js';\nimport defaultHeaderRenderer from './defaultHeaderRenderer';\nimport defaultRowRenderer from './defaultRowRenderer';\nimport Column from './Column';\nimport SortDirection from './SortDirection';\nimport SortIndicator from './SortIndicator';\nimport Table from './Table';\nexport default Table;\nexport { createMultiSort, defaultCellDataGetter, defaultCellRenderer, defaultHeaderRowRenderer, defaultHeaderRenderer, defaultRowRenderer, Column, SortDirection, SortIndicator, Table };","import { requestAnimationTimeout, cancelAnimationTimeout } from '../../utils/requestAnimationTimeout';\nvar mountedInstances = [];\nvar originalBodyPointerEvents = null;\nvar disablePointerEventsTimeoutId = null;\n\nfunction enablePointerEventsIfDisabled() {\n if (disablePointerEventsTimeoutId) {\n disablePointerEventsTimeoutId = null;\n\n if (document.body && originalBodyPointerEvents != null) {\n document.body.style.pointerEvents = originalBodyPointerEvents;\n }\n\n originalBodyPointerEvents = null;\n }\n}\n\nfunction enablePointerEventsAfterDelayCallback() {\n enablePointerEventsIfDisabled();\n mountedInstances.forEach(function (instance) {\n return instance.__resetIsScrolling();\n });\n}\n\nfunction enablePointerEventsAfterDelay() {\n if (disablePointerEventsTimeoutId) {\n cancelAnimationTimeout(disablePointerEventsTimeoutId);\n }\n\n var maximumTimeout = 0;\n mountedInstances.forEach(function (instance) {\n maximumTimeout = Math.max(maximumTimeout, instance.props.scrollingResetTimeInterval);\n });\n disablePointerEventsTimeoutId = requestAnimationTimeout(enablePointerEventsAfterDelayCallback, maximumTimeout);\n}\n\nfunction onScrollWindow(event) {\n if (event.currentTarget === window && originalBodyPointerEvents == null && document.body) {\n originalBodyPointerEvents = document.body.style.pointerEvents;\n document.body.style.pointerEvents = 'none';\n }\n\n enablePointerEventsAfterDelay();\n mountedInstances.forEach(function (instance) {\n if (instance.props.scrollElement === event.currentTarget) {\n instance.__handleWindowScrollEvent();\n }\n });\n}\n\nexport function registerScrollListener(component, element) {\n if (!mountedInstances.some(function (instance) {\n return instance.props.scrollElement === element;\n })) {\n element.addEventListener('scroll', onScrollWindow);\n }\n\n mountedInstances.push(component);\n}\nexport function unregisterScrollListener(component, element) {\n mountedInstances = mountedInstances.filter(function (instance) {\n return instance !== component;\n });\n\n if (!mountedInstances.length) {\n element.removeEventListener('scroll', onScrollWindow);\n\n if (disablePointerEventsTimeoutId) {\n cancelAnimationTimeout(disablePointerEventsTimeoutId);\n enablePointerEventsIfDisabled();\n }\n }\n}\nimport { bpfrpt_proptype_WindowScroller } from \"../WindowScroller.js\";","/**\n * Gets the dimensions of the element, accounting for API differences between\n * `window` and other DOM elements.\n */\n// TODO Move this into WindowScroller and import from there\nvar isWindow = function isWindow(element) {\n return element === window;\n};\n\nvar getBoundingBox = function getBoundingBox(element) {\n return element.getBoundingClientRect();\n};\n\nexport function getDimensions(scrollElement, props) {\n if (!scrollElement) {\n return {\n height: props.serverHeight,\n width: props.serverWidth\n };\n } else if (isWindow(scrollElement)) {\n var _window = window,\n innerHeight = _window.innerHeight,\n innerWidth = _window.innerWidth;\n return {\n height: typeof innerHeight === 'number' ? innerHeight : 0,\n width: typeof innerWidth === 'number' ? innerWidth : 0\n };\n } else {\n return getBoundingBox(scrollElement);\n }\n}\n/**\n * Gets the vertical and horizontal position of an element within its scroll container.\n * Elements that have been “scrolled past” return negative values.\n * Handles edge-case where a user is navigating back (history) from an already-scrolled page.\n * In this case the body’s top or left position will be a negative number and this element’s top or left will be increased (by that amount).\n */\n\nexport function getPositionOffset(element, container) {\n if (isWindow(container) && document.documentElement) {\n var containerElement = document.documentElement;\n var elementRect = getBoundingBox(element);\n var containerRect = getBoundingBox(containerElement);\n return {\n top: elementRect.top - containerRect.top,\n left: elementRect.left - containerRect.left\n };\n } else {\n var scrollOffset = getScrollOffset(container);\n\n var _elementRect = getBoundingBox(element);\n\n var _containerRect = getBoundingBox(container);\n\n return {\n top: _elementRect.top + scrollOffset.top - _containerRect.top,\n left: _elementRect.left + scrollOffset.left - _containerRect.left\n };\n }\n}\n/**\n * Gets the vertical and horizontal scroll amount of the element, accounting for IE compatibility\n * and API differences between `window` and other DOM elements.\n */\n\nexport function getScrollOffset(element) {\n if (isWindow(element) && document.documentElement) {\n return {\n top: 'scrollY' in window ? window.scrollY : document.documentElement.scrollTop,\n left: 'scrollX' in window ? window.scrollX : document.documentElement.scrollLeft\n };\n } else {\n return {\n top: element.scrollTop,\n left: element.scrollLeft\n };\n }\n}","import _classCallCheck from \"@babel/runtime/helpers/classCallCheck\";\nimport _createClass from \"@babel/runtime/helpers/createClass\";\nimport _possibleConstructorReturn from \"@babel/runtime/helpers/possibleConstructorReturn\";\nimport _getPrototypeOf from \"@babel/runtime/helpers/getPrototypeOf\";\nimport _assertThisInitialized from \"@babel/runtime/helpers/assertThisInitialized\";\nimport _inherits from \"@babel/runtime/helpers/inherits\";\nimport _defineProperty from \"@babel/runtime/helpers/defineProperty\";\n\nvar _class, _temp;\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nimport * as React from 'react';\nimport * as ReactDOM from 'react-dom';\nimport { registerScrollListener, unregisterScrollListener } from './utils/onScroll';\nimport { getDimensions, getPositionOffset, getScrollOffset } from './utils/dimensions';\nimport createDetectElementResize from '../vendor/detectElementResize';\n\n/**\n * Specifies the number of miliseconds during which to disable pointer events while a scroll is in progress.\n * This improves performance and makes scrolling smoother.\n */\nexport var IS_SCROLLING_TIMEOUT = 150;\n\nvar getWindow = function getWindow() {\n return typeof window !== 'undefined' ? window : undefined;\n};\n\nvar WindowScroller = (_temp = _class =\n/*#__PURE__*/\nfunction (_React$PureComponent) {\n _inherits(WindowScroller, _React$PureComponent);\n\n function WindowScroller() {\n var _getPrototypeOf2;\n\n var _this;\n\n _classCallCheck(this, WindowScroller);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(WindowScroller)).call.apply(_getPrototypeOf2, [this].concat(args)));\n\n _defineProperty(_assertThisInitialized(_this), \"_window\", getWindow());\n\n _defineProperty(_assertThisInitialized(_this), \"_isMounted\", false);\n\n _defineProperty(_assertThisInitialized(_this), \"_positionFromTop\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_positionFromLeft\", 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_detectElementResize\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"_child\", void 0);\n\n _defineProperty(_assertThisInitialized(_this), \"state\", _objectSpread({}, getDimensions(_this.props.scrollElement, _this.props), {\n isScrolling: false,\n scrollLeft: 0,\n scrollTop: 0\n }));\n\n _defineProperty(_assertThisInitialized(_this), \"_registerChild\", function (element) {\n if (element && !(element instanceof Element)) {\n console.warn('WindowScroller registerChild expects to be passed Element or null');\n }\n\n _this._child = element;\n\n _this.updatePosition();\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onChildScroll\", function (_ref) {\n var scrollTop = _ref.scrollTop;\n\n if (_this.state.scrollTop === scrollTop) {\n return;\n }\n\n var scrollElement = _this.props.scrollElement;\n\n if (scrollElement) {\n if (typeof scrollElement.scrollTo === 'function') {\n scrollElement.scrollTo(0, scrollTop + _this._positionFromTop);\n } else {\n scrollElement.scrollTop = scrollTop + _this._positionFromTop;\n }\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_registerResizeListener\", function (element) {\n if (element === window) {\n window.addEventListener('resize', _this._onResize, false);\n } else {\n _this._detectElementResize.addResizeListener(element, _this._onResize);\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_unregisterResizeListener\", function (element) {\n if (element === window) {\n window.removeEventListener('resize', _this._onResize, false);\n } else if (element) {\n _this._detectElementResize.removeResizeListener(element, _this._onResize);\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"_onResize\", function () {\n _this.updatePosition();\n });\n\n _defineProperty(_assertThisInitialized(_this), \"__handleWindowScrollEvent\", function () {\n if (!_this._isMounted) {\n return;\n }\n\n var onScroll = _this.props.onScroll;\n var scrollElement = _this.props.scrollElement;\n\n if (scrollElement) {\n var scrollOffset = getScrollOffset(scrollElement);\n var scrollLeft = Math.max(0, scrollOffset.left - _this._positionFromLeft);\n var scrollTop = Math.max(0, scrollOffset.top - _this._positionFromTop);\n\n _this.setState({\n isScrolling: true,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n });\n\n onScroll({\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n });\n }\n });\n\n _defineProperty(_assertThisInitialized(_this), \"__resetIsScrolling\", function () {\n _this.setState({\n isScrolling: false\n });\n });\n\n return _this;\n }\n\n _createClass(WindowScroller, [{\n key: \"updatePosition\",\n value: function updatePosition() {\n var scrollElement = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props.scrollElement;\n var onResize = this.props.onResize;\n var _this$state = this.state,\n height = _this$state.height,\n width = _this$state.width;\n var thisNode = this._child || ReactDOM.findDOMNode(this);\n\n if (thisNode instanceof Element && scrollElement) {\n var offset = getPositionOffset(thisNode, scrollElement);\n this._positionFromTop = offset.top;\n this._positionFromLeft = offset.left;\n }\n\n var dimensions = getDimensions(scrollElement, this.props);\n\n if (height !== dimensions.height || width !== dimensions.width) {\n this.setState({\n height: dimensions.height,\n width: dimensions.width\n });\n onResize({\n height: dimensions.height,\n width: dimensions.width\n });\n }\n }\n }, {\n key: \"componentDidMount\",\n value: function componentDidMount() {\n var scrollElement = this.props.scrollElement;\n this._detectElementResize = createDetectElementResize();\n this.updatePosition(scrollElement);\n\n if (scrollElement) {\n registerScrollListener(this, scrollElement);\n\n this._registerResizeListener(scrollElement);\n }\n\n this._isMounted = true;\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps, prevState) {\n var scrollElement = this.props.scrollElement;\n var prevScrollElement = prevProps.scrollElement;\n\n if (prevScrollElement !== scrollElement && prevScrollElement != null && scrollElement != null) {\n this.updatePosition(scrollElement);\n unregisterScrollListener(this, prevScrollElement);\n registerScrollListener(this, scrollElement);\n\n this._unregisterResizeListener(prevScrollElement);\n\n this._registerResizeListener(scrollElement);\n }\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n var scrollElement = this.props.scrollElement;\n\n if (scrollElement) {\n unregisterScrollListener(this, scrollElement);\n\n this._unregisterResizeListener(scrollElement);\n }\n\n this._isMounted = false;\n }\n }, {\n key: \"render\",\n value: function render() {\n var children = this.props.children;\n var _this$state2 = this.state,\n isScrolling = _this$state2.isScrolling,\n scrollTop = _this$state2.scrollTop,\n scrollLeft = _this$state2.scrollLeft,\n height = _this$state2.height,\n width = _this$state2.width;\n return children({\n onChildScroll: this._onChildScroll,\n registerChild: this._registerChild,\n height: height,\n isScrolling: isScrolling,\n scrollLeft: scrollLeft,\n scrollTop: scrollTop,\n width: width\n });\n }\n }]);\n\n return WindowScroller;\n}(React.PureComponent), _defineProperty(_class, \"propTypes\", process.env.NODE_ENV === 'production' ? null : {\n /**\n * Function responsible for rendering children.\n * This function should implement the following signature:\n * ({ height, isScrolling, scrollLeft, scrollTop, width }) => PropTypes.element\n */\n \"children\": PropTypes.func.isRequired,\n\n /** Callback to be invoked on-resize: ({ height, width }) */\n \"onResize\": PropTypes.func.isRequired,\n\n /** Callback to be invoked on-scroll: ({ scrollLeft, scrollTop }) */\n \"onScroll\": PropTypes.func.isRequired,\n\n /** Element to attach scroll event listeners. Defaults to window. */\n \"scrollElement\": PropTypes.oneOfType([PropTypes.any, function () {\n return (typeof Element === \"function\" ? PropTypes.instanceOf(Element) : PropTypes.any).apply(this, arguments);\n }]),\n\n /**\n * Wait this amount of time after the last scroll event before resetting child `pointer-events`.\n */\n \"scrollingResetTimeInterval\": PropTypes.number.isRequired,\n\n /** Height used for server-side rendering */\n \"serverHeight\": PropTypes.number.isRequired,\n\n /** Width used for server-side rendering */\n \"serverWidth\": PropTypes.number.isRequired\n}), _temp);\n\n_defineProperty(WindowScroller, \"defaultProps\", {\n onResize: function onResize() {},\n onScroll: function onScroll() {},\n scrollingResetTimeInterval: IS_SCROLLING_TIMEOUT,\n scrollElement: getWindow(),\n serverHeight: 0,\n serverWidth: 0\n});\n\nexport { WindowScroller as default };\nimport PropTypes from \"prop-types\";","var g;\n\n// This works in non-strict mode\ng = (function() {\n\treturn this;\n})();\n\ntry {\n\t// This works if eval is allowed (see CSP)\n\tg = g || new Function(\"return this\")();\n} catch (e) {\n\t// This works if the window reference is available\n\tif (typeof window === \"object\") g = window;\n}\n\n// g can still be undefined, but nothing to do about it...\n// We return undefined, instead of nothing here, so it's\n// easier to handle this case. if(!global) { ...}\n\nmodule.exports = g;\n","/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\nfunction componentWillMount() {\n // Call this.constructor.gDSFP to support sub-classes.\n var state = this.constructor.getDerivedStateFromProps(this.props, this.state);\n if (state !== null && state !== undefined) {\n this.setState(state);\n }\n}\n\nfunction componentWillReceiveProps(nextProps) {\n // Call this.constructor.gDSFP to support sub-classes.\n // Use the setState() updater to ensure state isn't stale in certain edge cases.\n function updater(prevState) {\n var state = this.constructor.getDerivedStateFromProps(nextProps, prevState);\n return state !== null && state !== undefined ? state : null;\n }\n // Binding \"this\" is important for shallow renderer support.\n this.setState(updater.bind(this));\n}\n\nfunction componentWillUpdate(nextProps, nextState) {\n try {\n var prevProps = this.props;\n var prevState = this.state;\n this.props = nextProps;\n this.state = nextState;\n this.__reactInternalSnapshotFlag = true;\n this.__reactInternalSnapshot = this.getSnapshotBeforeUpdate(\n prevProps,\n prevState\n );\n } finally {\n this.props = prevProps;\n this.state = prevState;\n }\n}\n\n// React may warn about cWM/cWRP/cWU methods being deprecated.\n// Add a flag to suppress these warnings for this special case.\ncomponentWillMount.__suppressDeprecationWarning = true;\ncomponentWillReceiveProps.__suppressDeprecationWarning = true;\ncomponentWillUpdate.__suppressDeprecationWarning = true;\n\nfunction polyfill(Component) {\n var prototype = Component.prototype;\n\n if (!prototype || !prototype.isReactComponent) {\n throw new Error('Can only polyfill class components');\n }\n\n if (\n typeof Component.getDerivedStateFromProps !== 'function' &&\n typeof prototype.getSnapshotBeforeUpdate !== 'function'\n ) {\n return Component;\n }\n\n // If new component APIs are defined, \"unsafe\" lifecycles won't be called.\n // Error if any of these lifecycles are present,\n // Because they would work differently between older and newer (16.3+) versions of React.\n var foundWillMountName = null;\n var foundWillReceivePropsName = null;\n var foundWillUpdateName = null;\n if (typeof prototype.componentWillMount === 'function') {\n foundWillMountName = 'componentWillMount';\n } else if (typeof prototype.UNSAFE_componentWillMount === 'function') {\n foundWillMountName = 'UNSAFE_componentWillMount';\n }\n if (typeof prototype.componentWillReceiveProps === 'function') {\n foundWillReceivePropsName = 'componentWillReceiveProps';\n } else if (typeof prototype.UNSAFE_componentWillReceiveProps === 'function') {\n foundWillReceivePropsName = 'UNSAFE_componentWillReceiveProps';\n }\n if (typeof prototype.componentWillUpdate === 'function') {\n foundWillUpdateName = 'componentWillUpdate';\n } else if (typeof prototype.UNSAFE_componentWillUpdate === 'function') {\n foundWillUpdateName = 'UNSAFE_componentWillUpdate';\n }\n if (\n foundWillMountName !== null ||\n foundWillReceivePropsName !== null ||\n foundWillUpdateName !== null\n ) {\n var componentName = Component.displayName || Component.name;\n var newApiName =\n typeof Component.getDerivedStateFromProps === 'function'\n ? 'getDerivedStateFromProps()'\n : 'getSnapshotBeforeUpdate()';\n\n throw Error(\n 'Unsafe legacy lifecycles will not be called for components using new component APIs.\\n\\n' +\n componentName +\n ' uses ' +\n newApiName +\n ' but also contains the following legacy lifecycles:' +\n (foundWillMountName !== null ? '\\n ' + foundWillMountName : '') +\n (foundWillReceivePropsName !== null\n ? '\\n ' + foundWillReceivePropsName\n : '') +\n (foundWillUpdateName !== null ? '\\n ' + foundWillUpdateName : '') +\n '\\n\\nThe above lifecycles should be removed. Learn more about this warning here:\\n' +\n 'https://fb.me/react-async-component-lifecycle-hooks'\n );\n }\n\n // React <= 16.2 does not support static getDerivedStateFromProps.\n // As a workaround, use cWM and cWRP to invoke the new static lifecycle.\n // Newer versions of React will ignore these lifecycles if gDSFP exists.\n if (typeof Component.getDerivedStateFromProps === 'function') {\n prototype.componentWillMount = componentWillMount;\n prototype.componentWillReceiveProps = componentWillReceiveProps;\n }\n\n // React <= 16.2 does not support getSnapshotBeforeUpdate.\n // As a workaround, use cWU to invoke the new lifecycle.\n // Newer versions of React will ignore that lifecycle if gSBU exists.\n if (typeof prototype.getSnapshotBeforeUpdate === 'function') {\n if (typeof prototype.componentDidUpdate !== 'function') {\n throw new Error(\n 'Cannot polyfill getSnapshotBeforeUpdate() for components that do not define componentDidUpdate() on the prototype'\n );\n }\n\n prototype.componentWillUpdate = componentWillUpdate;\n\n var componentDidUpdate = prototype.componentDidUpdate;\n\n prototype.componentDidUpdate = function componentDidUpdatePolyfill(\n prevProps,\n prevState,\n maybeSnapshot\n ) {\n // 16.3+ will not execute our will-update method;\n // It will pass a snapshot value to did-update though.\n // Older versions will require our polyfilled will-update value.\n // We need to handle both cases, but can't just check for the presence of \"maybeSnapshot\",\n // Because for <= 15.x versions this might be a \"prevContext\" object.\n // We also can't just check \"__reactInternalSnapshot\",\n // Because get-snapshot might return a falsy value.\n // So check for the explicit __reactInternalSnapshotFlag flag to determine behavior.\n var snapshot = this.__reactInternalSnapshotFlag\n ? this.__reactInternalSnapshot\n : maybeSnapshot;\n\n componentDidUpdate.call(this, prevProps, prevState, snapshot);\n };\n }\n\n return Component;\n}\n\nexport { polyfill };\n","export default function formControlState(_ref) {\n var props = _ref.props,\n states = _ref.states,\n muiFormControl = _ref.muiFormControl;\n return states.reduce(function (acc, state) {\n acc[state] = props[state];\n\n if (muiFormControl) {\n if (typeof props[state] === 'undefined') {\n acc[state] = muiFormControl[state];\n }\n }\n\n return acc;\n }, {});\n}","import _every from \"lodash/every\";\nimport _mapValues from \"lodash/mapValues\";\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport { getTicksOfScale, parseScale, checkDomainOfScale, getBandSizeOfAxis } from './ChartUtils';\nimport { findChildByType } from './ReactUtils';\n\n/**\n * Calculate the scale function, position, width, height of axes\n * @param {Object} props Latest props\n * @param {Object} axisMap The configuration of axes\n * @param {Object} offset The offset of main part in the svg element\n * @param {String} axisType The type of axes, x-axis or y-axis\n * @param {String} chartName The name of chart\n * @return {Object} Configuration\n */\nexport var formatAxisMap = function formatAxisMap(props, axisMap, offset, axisType, chartName) {\n var width = props.width,\n height = props.height,\n layout = props.layout,\n children = props.children;\n var ids = Object.keys(axisMap);\n var steps = {\n left: offset.left,\n leftMirror: offset.left,\n right: width - offset.right,\n rightMirror: width - offset.right,\n top: offset.top,\n topMirror: offset.top,\n bottom: height - offset.bottom,\n bottomMirror: height - offset.bottom\n };\n var hasBar = !!findChildByType(children, 'Bar');\n return ids.reduce(function (result, id) {\n var axis = axisMap[id];\n var orientation = axis.orientation,\n domain = axis.domain,\n _axis$padding = axis.padding,\n padding = _axis$padding === void 0 ? {} : _axis$padding,\n mirror = axis.mirror,\n reversed = axis.reversed;\n var offsetKey = \"\".concat(orientation).concat(mirror ? 'Mirror' : '');\n var range, x, y, needSpace;\n\n if (axisType === 'xAxis') {\n range = [offset.left + (padding.left || 0), offset.left + offset.width - (padding.right || 0)];\n } else if (axisType === 'yAxis') {\n range = layout === 'horizontal' ? [offset.top + offset.height - (padding.bottom || 0), offset.top + (padding.top || 0)] : [offset.top + (padding.top || 0), offset.top + offset.height - (padding.bottom || 0)];\n } else {\n range = axis.range;\n }\n\n if (reversed) {\n range = [range[1], range[0]];\n }\n\n var _parseScale = parseScale(axis, chartName, hasBar),\n scale = _parseScale.scale,\n realScaleType = _parseScale.realScaleType;\n\n scale.domain(domain).range(range);\n checkDomainOfScale(scale);\n var ticks = getTicksOfScale(scale, _objectSpread(_objectSpread({}, axis), {}, {\n realScaleType: realScaleType\n }));\n\n if (axisType === 'xAxis') {\n needSpace = orientation === 'top' && !mirror || orientation === 'bottom' && mirror;\n x = offset.left;\n y = steps[offsetKey] - needSpace * axis.height;\n } else if (axisType === 'yAxis') {\n needSpace = orientation === 'left' && !mirror || orientation === 'right' && mirror;\n x = steps[offsetKey] - needSpace * axis.width;\n y = offset.top;\n }\n\n var finalAxis = _objectSpread(_objectSpread(_objectSpread({}, axis), ticks), {}, {\n realScaleType: realScaleType,\n x: x,\n y: y,\n scale: scale,\n width: axisType === 'xAxis' ? offset.width : axis.width,\n height: axisType === 'yAxis' ? offset.height : axis.height\n });\n\n finalAxis.bandSize = getBandSizeOfAxis(finalAxis, ticks);\n\n if (!axis.hide && axisType === 'xAxis') {\n steps[offsetKey] += (needSpace ? -1 : 1) * finalAxis.height;\n } else if (!axis.hide) {\n steps[offsetKey] += (needSpace ? -1 : 1) * finalAxis.width;\n }\n\n return _objectSpread(_objectSpread({}, result), {}, _defineProperty({}, id, finalAxis));\n }, {});\n};\nexport var rectWithPoints = function rectWithPoints(_ref, _ref2) {\n var x1 = _ref.x,\n y1 = _ref.y;\n var x2 = _ref2.x,\n y2 = _ref2.y;\n return {\n x: Math.min(x1, x2),\n y: Math.min(y1, y2),\n width: Math.abs(x2 - x1),\n height: Math.abs(y2 - y1)\n };\n};\n/**\n * Compute the x, y, width, and height of a box from two reference points.\n * @param {Object} coords x1, x2, y1, and y2\n * @return {Object} object\n */\n\nexport var rectWithCoords = function rectWithCoords(_ref3) {\n var x1 = _ref3.x1,\n y1 = _ref3.y1,\n x2 = _ref3.x2,\n y2 = _ref3.y2;\n return rectWithPoints({\n x: x1,\n y: y1\n }, {\n x: x2,\n y: y2\n });\n};\nexport var ScaleHelper = /*#__PURE__*/function () {\n function ScaleHelper(scale) {\n _classCallCheck(this, ScaleHelper);\n\n this.scale = void 0;\n this.scale = scale;\n }\n\n _createClass(ScaleHelper, [{\n key: \"domain\",\n get: function get() {\n return this.scale.domain;\n }\n }, {\n key: \"range\",\n get: function get() {\n return this.scale.range;\n }\n }, {\n key: \"rangeMin\",\n get: function get() {\n return this.range()[0];\n }\n }, {\n key: \"rangeMax\",\n get: function get() {\n return this.range()[1];\n }\n }, {\n key: \"bandwidth\",\n get: function get() {\n return this.scale.bandwidth;\n }\n }, {\n key: \"apply\",\n value: function apply(value) {\n var _ref4 = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},\n bandAware = _ref4.bandAware,\n position = _ref4.position;\n\n if (value === undefined) {\n return undefined;\n }\n\n if (position) {\n switch (position) {\n case 'start':\n {\n return this.scale(value);\n }\n\n case 'middle':\n {\n var offset = this.bandwidth ? this.bandwidth() / 2 : 0;\n return this.scale(value) + offset;\n }\n\n case 'end':\n {\n var _offset = this.bandwidth ? this.bandwidth() : 0;\n\n return this.scale(value) + _offset;\n }\n\n default:\n {\n return this.scale(value);\n }\n }\n }\n\n if (bandAware) {\n var _offset2 = this.bandwidth ? this.bandwidth() / 2 : 0;\n\n return this.scale(value) + _offset2;\n }\n\n return this.scale(value);\n }\n }, {\n key: \"isInRange\",\n value: function isInRange(value) {\n var range = this.range();\n var first = range[0];\n var last = range[range.length - 1];\n return first <= last ? value >= first && value <= last : value >= last && value <= first;\n }\n }], [{\n key: \"create\",\n value: function create(obj) {\n return new ScaleHelper(obj);\n }\n }]);\n\n return ScaleHelper;\n}();\nScaleHelper.EPS = 1e-4;\nexport var createLabeledScales = function createLabeledScales(options) {\n var scales = Object.keys(options).reduce(function (res, key) {\n return _objectSpread(_objectSpread({}, res), {}, _defineProperty({}, key, ScaleHelper.create(options[key])));\n }, {});\n return _objectSpread(_objectSpread({}, scales), {}, {\n apply: function apply(coord) {\n var _ref5 = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},\n bandAware = _ref5.bandAware;\n\n return _mapValues(coord, function (value, label) {\n return scales[label].apply(value, {\n bandAware: bandAware\n });\n });\n },\n isInRange: function isInRange(coord) {\n return _every(coord, function (value, label) {\n return scales[label].isInRange(value);\n });\n }\n });\n};","import raf from 'raf';\nexport default function setRafTimeout(callback) {\n var timeout = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;\n var currTime = -1;\n\n var shouldUpdate = function shouldUpdate(now) {\n if (currTime < 0) {\n currTime = now;\n }\n\n if (now - currTime > timeout) {\n callback(now);\n currTime = -1;\n } else {\n raf(shouldUpdate);\n }\n };\n\n raf(shouldUpdate);\n}","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _toArray(arr) { return _arrayWithHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nimport setRafTimeout from './setRafTimeout';\nexport default function createAnimateManager() {\n var currStyle = {};\n\n var handleChange = function handleChange() {\n return null;\n };\n\n var shouldStop = false;\n\n var setStyle = function setStyle(_style) {\n if (shouldStop) {\n return;\n }\n\n if (Array.isArray(_style)) {\n if (!_style.length) {\n return;\n }\n\n var styles = _style;\n\n var _styles = _toArray(styles),\n curr = _styles[0],\n restStyles = _styles.slice(1);\n\n if (typeof curr === 'number') {\n setRafTimeout(setStyle.bind(null, restStyles), curr);\n return;\n }\n\n setStyle(curr);\n setRafTimeout(setStyle.bind(null, restStyles));\n return;\n }\n\n if (_typeof(_style) === 'object') {\n currStyle = _style;\n handleChange(currStyle);\n }\n\n if (typeof _style === 'function') {\n _style();\n }\n };\n\n return {\n stop: function stop() {\n shouldStop = true;\n },\n start: function start(style) {\n shouldStop = false;\n setStyle(style);\n },\n subscribe: function subscribe(_handleChange) {\n handleChange = _handleChange;\n return function () {\n handleChange = function handleChange() {\n return null;\n };\n };\n }\n };\n}","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n/* eslint no-console: 0 */\nvar PREFIX_LIST = ['Webkit', 'Moz', 'O', 'ms'];\nvar IN_LINE_PREFIX_LIST = ['-webkit-', '-moz-', '-o-', '-ms-'];\nvar IN_COMPATIBLE_PROPERTY = ['transform', 'transformOrigin', 'transition'];\nexport var getIntersectionKeys = function getIntersectionKeys(preObj, nextObj) {\n return [Object.keys(preObj), Object.keys(nextObj)].reduce(function (a, b) {\n return a.filter(function (c) {\n return b.includes(c);\n });\n });\n};\nexport var identity = function identity(param) {\n return param;\n};\n/*\n * @description: convert camel case to dash case\n * string => string\n */\n\nexport var getDashCase = function getDashCase(name) {\n return name.replace(/([A-Z])/g, function (v) {\n return \"-\".concat(v.toLowerCase());\n });\n};\n/*\n * @description: add compatible style prefix\n * (string, string) => object\n */\n\nexport var generatePrefixStyle = function generatePrefixStyle(name, value) {\n if (IN_COMPATIBLE_PROPERTY.indexOf(name) === -1) {\n return _defineProperty({}, name, value);\n }\n\n var isTransition = name === 'transition';\n var camelName = name.replace(/(\\w)/, function (v) {\n return v.toUpperCase();\n });\n var styleVal = value;\n return PREFIX_LIST.reduce(function (result, property, i) {\n if (isTransition) {\n styleVal = value.replace(/(transform|transform-origin)/gim, \"\".concat(IN_LINE_PREFIX_LIST[i], \"$1\"));\n }\n\n return _objectSpread(_objectSpread({}, result), {}, _defineProperty({}, property + camelName, styleVal));\n }, {});\n};\nexport var log = function log() {\n var _console;\n\n (_console = console).log.apply(_console, arguments);\n};\n/*\n * @description: log the value of a varible\n * string => any => any\n */\n\nexport var debug = function debug(name) {\n return function (item) {\n log(name, item);\n return item;\n };\n};\n/*\n * @description: log name, args, return value of a function\n * function => function\n */\n\nexport var debugf = function debugf(tag, f) {\n return function () {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n var res = f.apply(void 0, args);\n var name = tag || f.name || 'anonymous function';\n var argNames = \"(\".concat(args.map(JSON.stringify).join(', '), \")\");\n log(\"\".concat(name, \": \").concat(argNames, \" => \").concat(JSON.stringify(res)));\n return res;\n };\n};\n/*\n * @description: map object on every element in this object.\n * (function, object) => object\n */\n\nexport var mapObject = function mapObject(fn, obj) {\n return Object.keys(obj).reduce(function (res, key) {\n return _objectSpread(_objectSpread({}, res), {}, _defineProperty({}, key, fn(key, obj[key])));\n }, {});\n};\n/*\n * @description: add compatible prefix to style\n * object => object\n */\n\nexport var translateStyle = function translateStyle(style) {\n return Object.keys(style).reduce(function (res, key) {\n return _objectSpread(_objectSpread({}, res), generatePrefixStyle(key, res[key]));\n }, style);\n};\nexport var compose = function compose() {\n for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\n args[_key2] = arguments[_key2];\n }\n\n if (!args.length) {\n return identity;\n }\n\n var fns = args.reverse(); // first function can receive multiply arguments\n\n var firstFn = fns[0];\n var tailsFn = fns.slice(1);\n return function () {\n return tailsFn.reduce(function (res, fn) {\n return fn(res);\n }, firstFn.apply(void 0, arguments));\n };\n};\nexport var getTransitionVal = function getTransitionVal(props, duration, easing) {\n return props.map(function (prop) {\n return \"\".concat(getDashCase(prop), \" \").concat(duration, \"ms \").concat(easing);\n }).join(',');\n};\nvar isDev = process.env.NODE_ENV !== 'production';\nexport var warn = function warn(condition, format, a, b, c, d, e, f) {\n if (isDev && typeof console !== 'undefined' && console.warn) {\n if (format === undefined) {\n console.warn('LogUtils requires an error message argument');\n }\n\n if (!condition) {\n if (format === undefined) {\n console.warn('Minified exception occurred; use the non-minified dev environment ' + 'for the full error message and additional helpful warnings.');\n } else {\n var args = [a, b, c, d, e, f];\n var argIndex = 0;\n console.warn(format.replace(/%s/g, function () {\n return args[argIndex++];\n }));\n }\n }\n }\n};","function _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _iterableToArrayLimit(arr, i) { if (typeof Symbol === \"undefined\" || !(Symbol.iterator in Object(arr))) return; var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nfunction _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nimport { warn } from './util';\nvar ACCURACY = 1e-4;\n\nvar cubicBezierFactor = function cubicBezierFactor(c1, c2) {\n return [0, 3 * c1, 3 * c2 - 6 * c1, 3 * c1 - 3 * c2 + 1];\n};\n\nvar multyTime = function multyTime(params, t) {\n return params.map(function (param, i) {\n return param * Math.pow(t, i);\n }).reduce(function (pre, curr) {\n return pre + curr;\n });\n};\n\nvar cubicBezier = function cubicBezier(c1, c2) {\n return function (t) {\n var params = cubicBezierFactor(c1, c2);\n return multyTime(params, t);\n };\n};\n\nvar derivativeCubicBezier = function derivativeCubicBezier(c1, c2) {\n return function (t) {\n var params = cubicBezierFactor(c1, c2);\n var newParams = [].concat(_toConsumableArray(params.map(function (param, i) {\n return param * i;\n }).slice(1)), [0]);\n return multyTime(newParams, t);\n };\n}; // calculate cubic-bezier using Newton's method\n\n\nexport var configBezier = function configBezier() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n var x1 = args[0],\n y1 = args[1],\n x2 = args[2],\n y2 = args[3];\n\n if (args.length === 1) {\n switch (args[0]) {\n case 'linear':\n x1 = 0.0;\n y1 = 0.0;\n x2 = 1.0;\n y2 = 1.0;\n break;\n\n case 'ease':\n x1 = 0.25;\n y1 = 0.1;\n x2 = 0.25;\n y2 = 1.0;\n break;\n\n case 'ease-in':\n x1 = 0.42;\n y1 = 0.0;\n x2 = 1.0;\n y2 = 1.0;\n break;\n\n case 'ease-out':\n x1 = 0.42;\n y1 = 0.0;\n x2 = 0.58;\n y2 = 1.0;\n break;\n\n case 'ease-in-out':\n x1 = 0.0;\n y1 = 0.0;\n x2 = 0.58;\n y2 = 1.0;\n break;\n\n default:\n {\n var easing = args[0].split('(');\n\n if (easing[0] === 'cubic-bezier' && easing[1].split(')')[0].split(',').length === 4) {\n var _easing$1$split$0$spl = easing[1].split(')')[0].split(',').map(function (x) {\n return parseFloat(x);\n });\n\n var _easing$1$split$0$spl2 = _slicedToArray(_easing$1$split$0$spl, 4);\n\n x1 = _easing$1$split$0$spl2[0];\n y1 = _easing$1$split$0$spl2[1];\n x2 = _easing$1$split$0$spl2[2];\n y2 = _easing$1$split$0$spl2[3];\n } else {\n warn(false, '[configBezier]: arguments should be one of ' + 'oneOf \\'linear\\', \\'ease\\', \\'ease-in\\', \\'ease-out\\', ' + '\\'ease-in-out\\',\\'cubic-bezier(x1,y1,x2,y2)\\', instead received %s', args);\n }\n }\n }\n }\n\n warn([x1, x2, y1, y2].every(function (num) {\n return typeof num === 'number' && num >= 0 && num <= 1;\n }), '[configBezier]: arguments should be x1, y1, x2, y2 of [0, 1] instead received %s', args);\n var curveX = cubicBezier(x1, x2);\n var curveY = cubicBezier(y1, y2);\n var derCurveX = derivativeCubicBezier(x1, x2);\n\n var rangeValue = function rangeValue(value) {\n if (value > 1) {\n return 1;\n } else if (value < 0) {\n return 0;\n }\n\n return value;\n };\n\n var bezier = function bezier(_t) {\n var t = _t > 1 ? 1 : _t;\n var x = t;\n\n for (var i = 0; i < 8; ++i) {\n var evalT = curveX(x) - t;\n var derVal = derCurveX(x);\n\n if (Math.abs(evalT - t) < ACCURACY || derVal < ACCURACY) {\n return curveY(x);\n }\n\n x = rangeValue(x - evalT / derVal);\n }\n\n return curveY(x);\n };\n\n bezier.isStepper = false;\n return bezier;\n};\nexport var configSpring = function configSpring() {\n var config = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n var _config$stiff = config.stiff,\n stiff = _config$stiff === void 0 ? 100 : _config$stiff,\n _config$damping = config.damping,\n damping = _config$damping === void 0 ? 8 : _config$damping,\n _config$dt = config.dt,\n dt = _config$dt === void 0 ? 17 : _config$dt;\n\n var stepper = function stepper(currX, destX, currV) {\n var FSpring = -(currX - destX) * stiff;\n var FDamping = currV * damping;\n var newV = currV + (FSpring - FDamping) * dt / 1000;\n var newX = currV * dt / 1000 + currX;\n\n if (Math.abs(newX - destX) < ACCURACY && Math.abs(newV) < ACCURACY) {\n return [destX, 0];\n }\n\n return [newX, newV];\n };\n\n stepper.isStepper = true;\n stepper.dt = dt;\n return stepper;\n};\nexport var configEasing = function configEasing() {\n for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\n args[_key2] = arguments[_key2];\n }\n\n var easing = args[0];\n\n if (typeof easing === 'string') {\n switch (easing) {\n case 'ease':\n case 'ease-in-out':\n case 'ease-out':\n case 'ease-in':\n case 'linear':\n return configBezier(easing);\n\n case 'spring':\n return configSpring();\n\n default:\n if (easing.split('(')[0] === 'cubic-bezier') {\n return configBezier(easing);\n }\n\n warn(false, '[configEasing]: first argument should be one of \\'ease\\', \\'ease-in\\', ' + '\\'ease-out\\', \\'ease-in-out\\',\\'cubic-bezier(x1,y1,x2,y2)\\', \\'linear\\' and \\'spring\\', instead received %s', args);\n }\n }\n\n if (typeof easing === 'function') {\n return easing;\n }\n\n warn(false, '[configEasing]: first argument type should be function or ' + 'string, instead received %s', args);\n return null;\n};","function _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction _iterableToArrayLimit(arr, i) { if (typeof Symbol === \"undefined\" || !(Symbol.iterator in Object(arr))) return; var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nimport raf, { cancel as caf } from 'raf';\nimport { getIntersectionKeys, mapObject } from './util';\n\nvar alpha = function alpha(begin, end, k) {\n return begin + (end - begin) * k;\n};\n\nvar needContinue = function needContinue(_ref) {\n var from = _ref.from,\n to = _ref.to;\n return from !== to;\n};\n/*\n * @description: cal new from value and velocity in each stepper\n * @return: { [styleProperty]: { from, to, velocity } }\n */\n\n\nvar calStepperVals = function calStepperVals(easing, preVals, steps) {\n var nextStepVals = mapObject(function (key, val) {\n if (needContinue(val)) {\n var _easing = easing(val.from, val.to, val.velocity),\n _easing2 = _slicedToArray(_easing, 2),\n newX = _easing2[0],\n newV = _easing2[1];\n\n return _objectSpread(_objectSpread({}, val), {}, {\n from: newX,\n velocity: newV\n });\n }\n\n return val;\n }, preVals);\n\n if (steps < 1) {\n return mapObject(function (key, val) {\n if (needContinue(val)) {\n return _objectSpread(_objectSpread({}, val), {}, {\n velocity: alpha(val.velocity, nextStepVals[key].velocity, steps),\n from: alpha(val.from, nextStepVals[key].from, steps)\n });\n }\n\n return val;\n }, preVals);\n }\n\n return calStepperVals(easing, nextStepVals, steps - 1);\n}; // configure update function\n\n\nexport default (function (from, to, easing, duration, render) {\n var interKeys = getIntersectionKeys(from, to);\n var timingStyle = interKeys.reduce(function (res, key) {\n return _objectSpread(_objectSpread({}, res), {}, _defineProperty({}, key, [from[key], to[key]]));\n }, {});\n var stepperStyle = interKeys.reduce(function (res, key) {\n return _objectSpread(_objectSpread({}, res), {}, _defineProperty({}, key, {\n from: from[key],\n velocity: 0,\n to: to[key]\n }));\n }, {});\n var cafId = -1;\n var preTime;\n var beginTime;\n\n var update = function update() {\n return null;\n };\n\n var getCurrStyle = function getCurrStyle() {\n return mapObject(function (key, val) {\n return val.from;\n }, stepperStyle);\n };\n\n var shouldStopAnimation = function shouldStopAnimation() {\n return !Object.values(stepperStyle).filter(needContinue).length;\n }; // stepper timing function like spring\n\n\n var stepperUpdate = function stepperUpdate(now) {\n if (!preTime) {\n preTime = now;\n }\n\n var deltaTime = now - preTime;\n var steps = deltaTime / easing.dt;\n stepperStyle = calStepperVals(easing, stepperStyle, steps); // get union set and add compatible prefix\n\n render(_objectSpread(_objectSpread(_objectSpread({}, from), to), getCurrStyle(stepperStyle)));\n preTime = now;\n\n if (!shouldStopAnimation()) {\n cafId = raf(update);\n }\n }; // t => val timing function like cubic-bezier\n\n\n var timingUpdate = function timingUpdate(now) {\n if (!beginTime) {\n beginTime = now;\n }\n\n var t = (now - beginTime) / duration;\n var currStyle = mapObject(function (key, val) {\n return alpha.apply(void 0, _toConsumableArray(val).concat([easing(t)]));\n }, timingStyle); // get union set and add compatible prefix\n\n render(_objectSpread(_objectSpread(_objectSpread({}, from), to), currStyle));\n\n if (t < 1) {\n cafId = raf(update);\n } else {\n var finalStyle = mapObject(function (key, val) {\n return alpha.apply(void 0, _toConsumableArray(val).concat([easing(1)]));\n }, timingStyle);\n render(_objectSpread(_objectSpread(_objectSpread({}, from), to), finalStyle));\n }\n };\n\n update = easing.isStepper ? stepperUpdate : timingUpdate; // return start animation method\n\n return function () {\n raf(update); // return stop animation method\n\n return function () {\n caf(cafId);\n };\n };\n});","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\nfunction _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nimport React, { PureComponent, cloneElement, Children } from 'react';\nimport PropTypes from 'prop-types';\nimport { deepEqual } from 'fast-equals';\nimport createAnimateManager from './AnimateManager';\nimport { configEasing } from './easing';\nimport configUpdate from './configUpdate';\nimport { getTransitionVal, identity, translateStyle } from './util';\n\nvar Animate = /*#__PURE__*/function (_PureComponent) {\n _inherits(Animate, _PureComponent);\n\n var _super = _createSuper(Animate);\n\n function Animate(props, context) {\n var _this;\n\n _classCallCheck(this, Animate);\n\n _this = _super.call(this, props, context);\n var _this$props = _this.props,\n isActive = _this$props.isActive,\n attributeName = _this$props.attributeName,\n from = _this$props.from,\n to = _this$props.to,\n steps = _this$props.steps,\n children = _this$props.children;\n _this.handleStyleChange = _this.handleStyleChange.bind(_assertThisInitialized(_this));\n _this.changeStyle = _this.changeStyle.bind(_assertThisInitialized(_this));\n\n if (!isActive) {\n _this.state = {\n style: {}\n }; // if children is a function and animation is not active, set style to 'to'\n\n if (typeof children === 'function') {\n _this.state = {\n style: to\n };\n }\n\n return _possibleConstructorReturn(_this);\n }\n\n if (steps && steps.length) {\n _this.state = {\n style: steps[0].style\n };\n } else if (from) {\n if (typeof children === 'function') {\n _this.state = {\n style: from\n };\n return _possibleConstructorReturn(_this);\n }\n\n _this.state = {\n style: attributeName ? _defineProperty({}, attributeName, from) : from\n };\n } else {\n _this.state = {\n style: {}\n };\n }\n\n return _this;\n }\n\n _createClass(Animate, [{\n key: \"componentDidMount\",\n value: function componentDidMount() {\n var _this$props2 = this.props,\n isActive = _this$props2.isActive,\n canBegin = _this$props2.canBegin;\n this.mounted = true;\n\n if (!isActive || !canBegin) {\n return;\n }\n\n this.runAnimation(this.props);\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps) {\n var _this$props3 = this.props,\n isActive = _this$props3.isActive,\n canBegin = _this$props3.canBegin,\n attributeName = _this$props3.attributeName,\n shouldReAnimate = _this$props3.shouldReAnimate;\n\n if (!canBegin) {\n return;\n }\n\n if (!isActive) {\n var newState = {\n style: attributeName ? _defineProperty({}, attributeName, this.props.to) : this.props.to\n };\n\n if (this.state && this.state.style) {\n if (attributeName && this.state.style[attributeName] !== this.props.to || !attributeName && this.state.style !== this.props.to) {\n // eslint-disable-next-line react/no-did-update-set-state\n this.setState(newState);\n }\n }\n\n return;\n }\n\n if (deepEqual(prevProps.to, this.props.to) && prevProps.canBegin && prevProps.isActive) {\n return;\n }\n\n var isTriggered = !prevProps.canBegin || !prevProps.isActive;\n\n if (this.manager) {\n this.manager.stop();\n }\n\n if (this.stopJSAnimation) {\n this.stopJSAnimation();\n }\n\n var from = isTriggered || shouldReAnimate ? this.props.from : prevProps.to;\n\n if (this.state && this.state.style) {\n var _newState = {\n style: attributeName ? _defineProperty({}, attributeName, from) : from\n };\n\n if (attributeName && this.state.style[attributeName] !== from || !attributeName && this.state.style !== from) {\n // eslint-disable-next-line react/no-did-update-set-state\n this.setState(_newState);\n }\n }\n\n this.runAnimation(_objectSpread(_objectSpread({}, this.props), {}, {\n from: from,\n begin: 0\n }));\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n this.mounted = false;\n\n if (this.unSubscribe) {\n this.unSubscribe();\n }\n\n if (this.manager) {\n this.manager.stop();\n this.manager = null;\n }\n\n if (this.stopJSAnimation) {\n this.stopJSAnimation();\n }\n }\n }, {\n key: \"runJSAnimation\",\n value: function runJSAnimation(props) {\n var _this2 = this;\n\n var from = props.from,\n to = props.to,\n duration = props.duration,\n easing = props.easing,\n begin = props.begin,\n onAnimationEnd = props.onAnimationEnd,\n onAnimationStart = props.onAnimationStart;\n var startAnimation = configUpdate(from, to, configEasing(easing), duration, this.changeStyle);\n\n var finalStartAnimation = function finalStartAnimation() {\n _this2.stopJSAnimation = startAnimation();\n };\n\n this.manager.start([onAnimationStart, begin, finalStartAnimation, duration, onAnimationEnd]);\n }\n }, {\n key: \"runStepAnimation\",\n value: function runStepAnimation(props) {\n var _this3 = this;\n\n var steps = props.steps,\n begin = props.begin,\n onAnimationStart = props.onAnimationStart;\n var _steps$ = steps[0],\n initialStyle = _steps$.style,\n _steps$$duration = _steps$.duration,\n initialTime = _steps$$duration === void 0 ? 0 : _steps$$duration;\n\n var addStyle = function addStyle(sequence, nextItem, index) {\n if (index === 0) {\n return sequence;\n }\n\n var duration = nextItem.duration,\n _nextItem$easing = nextItem.easing,\n easing = _nextItem$easing === void 0 ? 'ease' : _nextItem$easing,\n style = nextItem.style,\n nextProperties = nextItem.properties,\n onAnimationEnd = nextItem.onAnimationEnd;\n var preItem = index > 0 ? steps[index - 1] : nextItem;\n var properties = nextProperties || Object.keys(style);\n\n if (typeof easing === 'function' || easing === 'spring') {\n return [].concat(_toConsumableArray(sequence), [_this3.runJSAnimation.bind(_this3, {\n from: preItem.style,\n to: style,\n duration: duration,\n easing: easing\n }), duration]);\n }\n\n var transition = getTransitionVal(properties, duration, easing);\n\n var newStyle = _objectSpread(_objectSpread(_objectSpread({}, preItem.style), style), {}, {\n transition: transition\n });\n\n return [].concat(_toConsumableArray(sequence), [newStyle, duration, onAnimationEnd]).filter(identity);\n };\n\n return this.manager.start([onAnimationStart].concat(_toConsumableArray(steps.reduce(addStyle, [initialStyle, Math.max(initialTime, begin)])), [props.onAnimationEnd]));\n }\n }, {\n key: \"runAnimation\",\n value: function runAnimation(props) {\n if (!this.manager) {\n this.manager = createAnimateManager();\n }\n\n var begin = props.begin,\n duration = props.duration,\n attributeName = props.attributeName,\n propsTo = props.to,\n easing = props.easing,\n onAnimationStart = props.onAnimationStart,\n onAnimationEnd = props.onAnimationEnd,\n steps = props.steps,\n children = props.children;\n var manager = this.manager;\n this.unSubscribe = manager.subscribe(this.handleStyleChange);\n\n if (typeof easing === 'function' || typeof children === 'function' || easing === 'spring') {\n this.runJSAnimation(props);\n return;\n }\n\n if (steps.length > 1) {\n this.runStepAnimation(props);\n return;\n }\n\n var to = attributeName ? _defineProperty({}, attributeName, propsTo) : propsTo;\n var transition = getTransitionVal(Object.keys(to), duration, easing);\n manager.start([onAnimationStart, begin, _objectSpread(_objectSpread({}, to), {}, {\n transition: transition\n }), duration, onAnimationEnd]);\n }\n }, {\n key: \"handleStyleChange\",\n value: function handleStyleChange(style) {\n this.changeStyle(style);\n }\n }, {\n key: \"changeStyle\",\n value: function changeStyle(style) {\n if (this.mounted) {\n this.setState({\n style: style\n });\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props4 = this.props,\n children = _this$props4.children,\n begin = _this$props4.begin,\n duration = _this$props4.duration,\n attributeName = _this$props4.attributeName,\n easing = _this$props4.easing,\n isActive = _this$props4.isActive,\n steps = _this$props4.steps,\n from = _this$props4.from,\n to = _this$props4.to,\n canBegin = _this$props4.canBegin,\n onAnimationEnd = _this$props4.onAnimationEnd,\n shouldReAnimate = _this$props4.shouldReAnimate,\n onAnimationReStart = _this$props4.onAnimationReStart,\n others = _objectWithoutProperties(_this$props4, [\"children\", \"begin\", \"duration\", \"attributeName\", \"easing\", \"isActive\", \"steps\", \"from\", \"to\", \"canBegin\", \"onAnimationEnd\", \"shouldReAnimate\", \"onAnimationReStart\"]);\n\n var count = Children.count(children);\n var stateStyle = translateStyle(this.state.style);\n\n if (typeof children === 'function') {\n return children(stateStyle);\n }\n\n if (!isActive || count === 0) {\n return children;\n }\n\n var cloneContainer = function cloneContainer(container) {\n var _container$props = container.props,\n _container$props$styl = _container$props.style,\n style = _container$props$styl === void 0 ? {} : _container$props$styl,\n className = _container$props.className;\n var res = /*#__PURE__*/cloneElement(container, _objectSpread(_objectSpread({}, others), {}, {\n style: _objectSpread(_objectSpread({}, style), stateStyle),\n className: className\n }));\n return res;\n };\n\n if (count === 1) {\n return cloneContainer(Children.only(children));\n }\n\n return /*#__PURE__*/React.createElement(\"div\", null, Children.map(children, function (child) {\n return cloneContainer(child);\n }));\n }\n }]);\n\n return Animate;\n}(PureComponent);\n\nAnimate.displayName = 'Animate';\nAnimate.propTypes = {\n from: PropTypes.oneOfType([PropTypes.object, PropTypes.string]),\n to: PropTypes.oneOfType([PropTypes.object, PropTypes.string]),\n attributeName: PropTypes.string,\n // animation duration\n duration: PropTypes.number,\n begin: PropTypes.number,\n easing: PropTypes.oneOfType([PropTypes.string, PropTypes.func]),\n steps: PropTypes.arrayOf(PropTypes.shape({\n duration: PropTypes.number.isRequired,\n style: PropTypes.object.isRequired,\n easing: PropTypes.oneOfType([PropTypes.oneOf(['ease', 'ease-in', 'ease-out', 'ease-in-out', 'linear']), PropTypes.func]),\n // transition css properties(dash case), optional\n properties: PropTypes.arrayOf('string'),\n onAnimationEnd: PropTypes.func\n })),\n children: PropTypes.oneOfType([PropTypes.node, PropTypes.func]),\n isActive: PropTypes.bool,\n canBegin: PropTypes.bool,\n onAnimationEnd: PropTypes.func,\n // decide if it should reanimate with initial from style when props change\n shouldReAnimate: PropTypes.bool,\n onAnimationStart: PropTypes.func,\n onAnimationReStart: PropTypes.func\n};\nAnimate.defaultProps = {\n begin: 0,\n duration: 1000,\n from: '',\n to: '',\n attributeName: '',\n easing: 'ease',\n isActive: true,\n canBegin: true,\n steps: [],\n onAnimationEnd: function onAnimationEnd() {},\n onAnimationStart: function onAnimationStart() {}\n};\nexport default Animate;","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nimport React, { Component, Children } from 'react';\nimport { Transition } from 'react-transition-group';\nimport PropTypes from 'prop-types';\nimport Animate from './Animate';\n\nif (Number.isFinite === undefined) {\n Number.isFinite = function (value) {\n return typeof value === 'number' && isFinite(value);\n };\n}\n\nvar parseDurationOfSingleTransition = function parseDurationOfSingleTransition() {\n var options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n var steps = options.steps,\n duration = options.duration;\n\n if (steps && steps.length) {\n return steps.reduce(function (result, entry) {\n return result + (Number.isFinite(entry.duration) && entry.duration > 0 ? entry.duration : 0);\n }, 0);\n }\n\n if (Number.isFinite(duration)) {\n return duration;\n }\n\n return 0;\n};\n\nvar AnimateGroupChild = /*#__PURE__*/function (_Component) {\n _inherits(AnimateGroupChild, _Component);\n\n var _super = _createSuper(AnimateGroupChild);\n\n function AnimateGroupChild() {\n var _this;\n\n _classCallCheck(this, AnimateGroupChild);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _super.call.apply(_super, [this].concat(args));\n _this.state = {\n isActive: false\n };\n\n _this.handleEnter = function (node, isAppearing) {\n var _this$props = _this.props,\n appearOptions = _this$props.appearOptions,\n enterOptions = _this$props.enterOptions;\n\n _this.handleStyleActive(isAppearing ? appearOptions : enterOptions);\n };\n\n _this.handleExit = function () {\n _this.handleStyleActive(_this.props.leaveOptions);\n };\n\n return _this;\n }\n\n _createClass(AnimateGroupChild, [{\n key: \"handleStyleActive\",\n value: function handleStyleActive(style) {\n if (style) {\n var onAnimationEnd = style.onAnimationEnd ? function () {\n style.onAnimationEnd();\n } : null;\n this.setState(_objectSpread(_objectSpread({}, style), {}, {\n onAnimationEnd: onAnimationEnd,\n isActive: true\n }));\n }\n }\n }, {\n key: \"parseTimeout\",\n value: function parseTimeout() {\n var _this$props2 = this.props,\n appearOptions = _this$props2.appearOptions,\n enterOptions = _this$props2.enterOptions,\n leaveOptions = _this$props2.leaveOptions;\n return parseDurationOfSingleTransition(appearOptions) + parseDurationOfSingleTransition(enterOptions) + parseDurationOfSingleTransition(leaveOptions);\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this2 = this;\n\n var _this$props3 = this.props,\n children = _this$props3.children,\n appearOptions = _this$props3.appearOptions,\n enterOptions = _this$props3.enterOptions,\n leaveOptions = _this$props3.leaveOptions,\n props = _objectWithoutProperties(_this$props3, [\"children\", \"appearOptions\", \"enterOptions\", \"leaveOptions\"]);\n\n return /*#__PURE__*/React.createElement(Transition, _extends({}, props, {\n onEnter: this.handleEnter,\n onExit: this.handleExit,\n timeout: this.parseTimeout()\n }), function () {\n return /*#__PURE__*/React.createElement(Animate, _this2.state, Children.only(children));\n });\n }\n }]);\n\n return AnimateGroupChild;\n}(Component);\n\nAnimateGroupChild.propTypes = {\n appearOptions: PropTypes.object,\n enterOptions: PropTypes.object,\n leaveOptions: PropTypes.object,\n children: PropTypes.element\n};\nexport default AnimateGroupChild;","import React, { Children } from 'react';\nimport { TransitionGroup } from 'react-transition-group';\nimport PropTypes from 'prop-types';\nimport AnimateGroupChild from './AnimateGroupChild';\n\nfunction AnimateGroup(props) {\n var component = props.component,\n children = props.children,\n appear = props.appear,\n enter = props.enter,\n leave = props.leave;\n return /*#__PURE__*/React.createElement(TransitionGroup, {\n component: component\n }, Children.map(children, function (child, index) {\n return /*#__PURE__*/React.createElement(AnimateGroupChild, {\n appearOptions: appear,\n enterOptions: enter,\n leaveOptions: leave,\n key: \"child-\".concat(index) // eslint-disable-line\n\n }, child);\n }));\n}\n\nAnimateGroup.propTypes = {\n appear: PropTypes.object,\n enter: PropTypes.object,\n leave: PropTypes.object,\n children: PropTypes.oneOfType([PropTypes.array, PropTypes.element]),\n component: PropTypes.any\n};\nAnimateGroup.defaultProps = {\n component: 'span'\n};\nexport default AnimateGroup;","import Animate from './Animate';\nimport { configBezier, configSpring } from './easing';\nimport { translateStyle } from './util';\nimport AnimateGroup from './AnimateGroup';\nexport { configSpring, configBezier, AnimateGroup, translateStyle };\nexport default Animate;","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nimport { Global } from './Global';\nvar stringCache = {\n widthCache: {},\n cacheCount: 0\n};\nvar MAX_CACHE_NUM = 2000;\nvar SPAN_STYLE = {\n position: 'absolute',\n top: '-20000px',\n left: 0,\n padding: 0,\n margin: 0,\n border: 'none',\n whiteSpace: 'pre'\n};\nvar STYLE_LIST = ['minWidth', 'maxWidth', 'width', 'minHeight', 'maxHeight', 'height', 'top', 'left', 'fontSize', 'lineHeight', 'padding', 'margin', 'paddingLeft', 'paddingRight', 'paddingTop', 'paddingBottom', 'marginLeft', 'marginRight', 'marginTop', 'marginBottom'];\nvar MEASUREMENT_SPAN_ID = 'recharts_measurement_span';\n\nfunction autoCompleteStyle(name, value) {\n if (STYLE_LIST.indexOf(name) >= 0 && value === +value) {\n return \"\".concat(value, \"px\");\n }\n\n return value;\n}\n\nfunction camelToMiddleLine(text) {\n var strs = text.split('');\n var formatStrs = strs.reduce(function (result, entry) {\n if (entry === entry.toUpperCase()) {\n return [].concat(_toConsumableArray(result), ['-', entry.toLowerCase()]);\n }\n\n return [].concat(_toConsumableArray(result), [entry]);\n }, []);\n return formatStrs.join('');\n}\n\nexport var getStyleString = function getStyleString(style) {\n return Object.keys(style).reduce(function (result, s) {\n return \"\".concat(result).concat(camelToMiddleLine(s), \":\").concat(autoCompleteStyle(s, style[s]), \";\");\n }, '');\n};\nexport var getStringSize = function getStringSize(text) {\n var style = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n\n if (text === undefined || text === null || Global.isSsr) {\n return {\n width: 0,\n height: 0\n };\n }\n\n var str = \"\".concat(text);\n var styleString = getStyleString(style);\n var cacheKey = \"\".concat(str, \"-\").concat(styleString);\n\n if (stringCache.widthCache[cacheKey]) {\n return stringCache.widthCache[cacheKey];\n }\n\n try {\n var measurementSpan = document.getElementById(MEASUREMENT_SPAN_ID);\n\n if (!measurementSpan) {\n measurementSpan = document.createElement('span');\n measurementSpan.setAttribute('id', MEASUREMENT_SPAN_ID);\n measurementSpan.setAttribute('aria-hidden', 'true');\n document.body.appendChild(measurementSpan);\n } // Need to use CSS Object Model (CSSOM) to be able to comply with Content Security Policy (CSP)\n // https://en.wikipedia.org/wiki/Content_Security_Policy\n\n\n var measurementSpanStyle = _objectSpread(_objectSpread({}, SPAN_STYLE), style);\n\n Object.keys(measurementSpanStyle).map(function (styleKey) {\n measurementSpan.style[styleKey] = measurementSpanStyle[styleKey];\n return styleKey;\n });\n measurementSpan.textContent = str;\n var rect = measurementSpan.getBoundingClientRect();\n var result = {\n width: rect.width,\n height: rect.height\n };\n stringCache.widthCache[cacheKey] = result;\n\n if (++stringCache.cacheCount > MAX_CACHE_NUM) {\n stringCache.cacheCount = 0;\n stringCache.widthCache = {};\n }\n\n return result;\n } catch (e) {\n return {\n width: 0,\n height: 0\n };\n }\n};\nexport var getOffset = function getOffset(el) {\n var html = el.ownerDocument.documentElement;\n var box = {\n top: 0,\n left: 0\n }; // If we don't have gBCR, just use 0,0 rather than error\n // BlackBerry 5, iOS 3 (original iPhone)\n\n if (typeof el.getBoundingClientRect !== 'undefined') {\n box = el.getBoundingClientRect();\n }\n\n return {\n top: box.top + window.pageYOffset - html.clientTop,\n left: box.left + window.pageXOffset - html.clientLeft\n };\n};\n/**\n * Calculate coordinate of cursor in chart\n * @param {Object} event Event object\n * @param {Object} offset The offset of main part in the svg element\n * @return {Object} {chartX, chartY}\n */\n\nexport var calculateChartCoordinate = function calculateChartCoordinate(event, offset) {\n return {\n chartX: Math.round(event.pageX - offset.left),\n chartY: Math.round(event.pageY - offset.top)\n };\n};","var baseMatches = require('./_baseMatches'),\n baseMatchesProperty = require('./_baseMatchesProperty'),\n identity = require('./identity'),\n isArray = require('./isArray'),\n property = require('./property');\n\n/**\n * The base implementation of `_.iteratee`.\n *\n * @private\n * @param {*} [value=_.identity] The value to convert to an iteratee.\n * @returns {Function} Returns the iteratee.\n */\nfunction baseIteratee(value) {\n // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.\n // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.\n if (typeof value == 'function') {\n return value;\n }\n if (value == null) {\n return identity;\n }\n if (typeof value == 'object') {\n return isArray(value)\n ? baseMatchesProperty(value[0], value[1])\n : baseMatches(value);\n }\n return property(value);\n}\n\nmodule.exports = baseIteratee;\n","var freeGlobal = require('./_freeGlobal');\n\n/** Detect free variable `self`. */\nvar freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n/** Used as a reference to the global object. */\nvar root = freeGlobal || freeSelf || Function('return this')();\n\nmodule.exports = root;\n","/* eslint-disable react-hooks/rules-of-hooks, react-hooks/exhaustive-deps */\nimport * as React from 'react';\nexport default function useControlled(_ref) {\n var controlled = _ref.controlled,\n defaultProp = _ref.default,\n name = _ref.name,\n _ref$state = _ref.state,\n state = _ref$state === void 0 ? 'value' : _ref$state;\n\n var _React$useRef = React.useRef(controlled !== undefined),\n isControlled = _React$useRef.current;\n\n var _React$useState = React.useState(defaultProp),\n valueState = _React$useState[0],\n setValue = _React$useState[1];\n\n var value = isControlled ? controlled : valueState;\n\n if (process.env.NODE_ENV !== 'production') {\n React.useEffect(function () {\n if (isControlled !== (controlled !== undefined)) {\n console.error([\"Material-UI: A component is changing the \".concat(isControlled ? '' : 'un', \"controlled \").concat(state, \" state of \").concat(name, \" to be \").concat(isControlled ? 'un' : '', \"controlled.\"), 'Elements should not switch from uncontrolled to controlled (or vice versa).', \"Decide between using a controlled or uncontrolled \".concat(name, \" \") + 'element for the lifetime of the component.', \"The nature of the state is determined during the first render, it's considered controlled if the value is not `undefined`.\", 'More info: https://fb.me/react-controlled-components'].join('\\n'));\n }\n }, [controlled]);\n\n var _React$useRef2 = React.useRef(defaultProp),\n defaultValue = _React$useRef2.current;\n\n React.useEffect(function () {\n if (!isControlled && defaultValue !== defaultProp) {\n console.error([\"Material-UI: A component is changing the default \".concat(state, \" state of an uncontrolled \").concat(name, \" after being initialized. \") + \"To suppress this warning opt to use a controlled \".concat(name, \".\")].join('\\n'));\n }\n }, [JSON.stringify(defaultProp)]);\n }\n\n var setValueIfUncontrolled = React.useCallback(function (newValue) {\n if (!isControlled) {\n setValue(newValue);\n }\n }, []);\n return [value, setValueIfUncontrolled];\n}","var baseIsEqual = require('./_baseIsEqual');\n\n/**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\nfunction isEqual(value, other) {\n return baseIsEqual(value, other);\n}\n\nmodule.exports = isEqual;\n","var _globalThis;\nif (typeof globalThis === 'object') {\n\t_globalThis = globalThis;\n} else {\n\ttry {\n\t\t_globalThis = require('es5-ext/global');\n\t} catch (error) {\n\t} finally {\n\t\tif (!_globalThis && typeof window !== 'undefined') { _globalThis = window; }\n\t\tif (!_globalThis) { throw new Error('Could not determine global this'); }\n\t}\n}\n\nvar NativeWebSocket = _globalThis.WebSocket || _globalThis.MozWebSocket;\nvar websocket_version = require('./version');\n\n\n/**\n * Expose a W3C WebSocket class with just one or two arguments.\n */\nfunction W3CWebSocket(uri, protocols) {\n\tvar native_instance;\n\n\tif (protocols) {\n\t\tnative_instance = new NativeWebSocket(uri, protocols);\n\t}\n\telse {\n\t\tnative_instance = new NativeWebSocket(uri);\n\t}\n\n\t/**\n\t * 'native_instance' is an instance of nativeWebSocket (the browser's WebSocket\n\t * class). Since it is an Object it will be returned as it is when creating an\n\t * instance of W3CWebSocket via 'new W3CWebSocket()'.\n\t *\n\t * ECMAScript 5: http://bclary.com/2004/11/07/#a-13.2.2\n\t */\n\treturn native_instance;\n}\nif (NativeWebSocket) {\n\t['CONNECTING', 'OPEN', 'CLOSING', 'CLOSED'].forEach(function(prop) {\n\t\tObject.defineProperty(W3CWebSocket, prop, {\n\t\t\tget: function() { return NativeWebSocket[prop]; }\n\t\t});\n\t});\n}\n\n/**\n * Module exports.\n */\nmodule.exports = {\n 'w3cwebsocket' : NativeWebSocket ? W3CWebSocket : null,\n 'version' : websocket_version\n};\n","import arrayWithoutHoles from \"./arrayWithoutHoles.js\";\nimport iterableToArray from \"./iterableToArray.js\";\nimport unsupportedIterableToArray from \"./unsupportedIterableToArray.js\";\nimport nonIterableSpread from \"./nonIterableSpread.js\";\nexport default function _toConsumableArray(arr) {\n return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread();\n}","import arrayLikeToArray from \"./arrayLikeToArray.js\";\nexport default function _arrayWithoutHoles(arr) {\n if (Array.isArray(arr)) return arrayLikeToArray(arr);\n}","export default function _nonIterableSpread() {\n throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\");\n}","import * as React from 'react';\n/**\n * @ignore - internal component.\n */\n\nvar FormControlContext = React.createContext();\n\nif (process.env.NODE_ENV !== 'production') {\n FormControlContext.displayName = 'FormControlContext';\n}\n\nexport function useFormControl() {\n return React.useContext(FormControlContext);\n}\nexport default FormControlContext;","import * as React from 'react';\n/**\n * @ignore - internal component.\n */\n\nvar ListContext = React.createContext({});\n\nif (process.env.NODE_ENV !== 'production') {\n ListContext.displayName = 'ListContext';\n}\n\nexport default ListContext;","import {formatDecimalParts} from \"./formatDecimal.js\";\n\nexport default function(x) {\n return x = formatDecimalParts(Math.abs(x)), x ? x[1] : NaN;\n}\n","var baseExtremum = require('./_baseExtremum'),\n baseGt = require('./_baseGt'),\n identity = require('./identity');\n\n/**\n * Computes the maximum value of `array`. If `array` is empty or falsey,\n * `undefined` is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Math\n * @param {Array} array The array to iterate over.\n * @returns {*} Returns the maximum value.\n * @example\n *\n * _.max([4, 2, 8, 6]);\n * // => 8\n *\n * _.max([]);\n * // => undefined\n */\nfunction max(array) {\n return (array && array.length)\n ? baseExtremum(array, identity, baseGt)\n : undefined;\n}\n\nmodule.exports = max;\n","var Symbol = require('./_Symbol'),\n getRawTag = require('./_getRawTag'),\n objectToString = require('./_objectToString');\n\n/** `Object#toString` result references. */\nvar nullTag = '[object Null]',\n undefinedTag = '[object Undefined]';\n\n/** Built-in value references. */\nvar symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n/**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\nfunction baseGetTag(value) {\n if (value == null) {\n return value === undefined ? undefinedTag : nullTag;\n }\n return (symToStringTag && symToStringTag in Object(value))\n ? getRawTag(value)\n : objectToString(value);\n}\n\nmodule.exports = baseGetTag;\n","/**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\nfunction isObjectLike(value) {\n return value != null && typeof value == 'object';\n}\n\nmodule.exports = isObjectLike;\n","var isProduction = process.env.NODE_ENV === 'production';\nfunction warning(condition, message) {\n if (!isProduction) {\n if (condition) {\n return;\n }\n\n var text = \"Warning: \" + message;\n\n if (typeof console !== 'undefined') {\n console.warn(text);\n }\n\n try {\n throw Error(text);\n } catch (x) {}\n }\n}\n\nexport default warning;\n","export default function _classCallCheck(instance, Constructor) {\n if (!(instance instanceof Constructor)) {\n throw new TypeError(\"Cannot call a class as a function\");\n }\n}","var isObject = require('./isObject'),\n now = require('./now'),\n toNumber = require('./toNumber');\n\n/** Error message constants. */\nvar FUNC_ERROR_TEXT = 'Expected a function';\n\n/* Built-in method references for those with the same name as other `lodash` methods. */\nvar nativeMax = Math.max,\n nativeMin = Math.min;\n\n/**\n * Creates a debounced function that delays invoking `func` until after `wait`\n * milliseconds have elapsed since the last time the debounced function was\n * invoked. The debounced function comes with a `cancel` method to cancel\n * delayed `func` invocations and a `flush` method to immediately invoke them.\n * Provide `options` to indicate whether `func` should be invoked on the\n * leading and/or trailing edge of the `wait` timeout. The `func` is invoked\n * with the last arguments provided to the debounced function. Subsequent\n * calls to the debounced function return the result of the last `func`\n * invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the debounced function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.debounce` and `_.throttle`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to debounce.\n * @param {number} [wait=0] The number of milliseconds to delay.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=false]\n * Specify invoking on the leading edge of the timeout.\n * @param {number} [options.maxWait]\n * The maximum time `func` is allowed to be delayed before it's invoked.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new debounced function.\n * @example\n *\n * // Avoid costly calculations while the window size is in flux.\n * jQuery(window).on('resize', _.debounce(calculateLayout, 150));\n *\n * // Invoke `sendMail` when clicked, debouncing subsequent calls.\n * jQuery(element).on('click', _.debounce(sendMail, 300, {\n * 'leading': true,\n * 'trailing': false\n * }));\n *\n * // Ensure `batchLog` is invoked once after 1 second of debounced calls.\n * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });\n * var source = new EventSource('/stream');\n * jQuery(source).on('message', debounced);\n *\n * // Cancel the trailing debounced invocation.\n * jQuery(window).on('popstate', debounced.cancel);\n */\nfunction debounce(func, wait, options) {\n var lastArgs,\n lastThis,\n maxWait,\n result,\n timerId,\n lastCallTime,\n lastInvokeTime = 0,\n leading = false,\n maxing = false,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n wait = toNumber(wait) || 0;\n if (isObject(options)) {\n leading = !!options.leading;\n maxing = 'maxWait' in options;\n maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n\n function invokeFunc(time) {\n var args = lastArgs,\n thisArg = lastThis;\n\n lastArgs = lastThis = undefined;\n lastInvokeTime = time;\n result = func.apply(thisArg, args);\n return result;\n }\n\n function leadingEdge(time) {\n // Reset any `maxWait` timer.\n lastInvokeTime = time;\n // Start the timer for the trailing edge.\n timerId = setTimeout(timerExpired, wait);\n // Invoke the leading edge.\n return leading ? invokeFunc(time) : result;\n }\n\n function remainingWait(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime,\n timeWaiting = wait - timeSinceLastCall;\n\n return maxing\n ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)\n : timeWaiting;\n }\n\n function shouldInvoke(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime;\n\n // Either this is the first call, activity has stopped and we're at the\n // trailing edge, the system time has gone backwards and we're treating\n // it as the trailing edge, or we've hit the `maxWait` limit.\n return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||\n (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));\n }\n\n function timerExpired() {\n var time = now();\n if (shouldInvoke(time)) {\n return trailingEdge(time);\n }\n // Restart the timer.\n timerId = setTimeout(timerExpired, remainingWait(time));\n }\n\n function trailingEdge(time) {\n timerId = undefined;\n\n // Only invoke if we have `lastArgs` which means `func` has been\n // debounced at least once.\n if (trailing && lastArgs) {\n return invokeFunc(time);\n }\n lastArgs = lastThis = undefined;\n return result;\n }\n\n function cancel() {\n if (timerId !== undefined) {\n clearTimeout(timerId);\n }\n lastInvokeTime = 0;\n lastArgs = lastCallTime = lastThis = timerId = undefined;\n }\n\n function flush() {\n return timerId === undefined ? result : trailingEdge(now());\n }\n\n function debounced() {\n var time = now(),\n isInvoking = shouldInvoke(time);\n\n lastArgs = arguments;\n lastThis = this;\n lastCallTime = time;\n\n if (isInvoking) {\n if (timerId === undefined) {\n return leadingEdge(lastCallTime);\n }\n if (maxing) {\n // Handle invocations in a tight loop.\n clearTimeout(timerId);\n timerId = setTimeout(timerExpired, wait);\n return invokeFunc(lastCallTime);\n }\n }\n if (timerId === undefined) {\n timerId = setTimeout(timerExpired, wait);\n }\n return result;\n }\n debounced.cancel = cancel;\n debounced.flush = flush;\n return debounced;\n}\n\nmodule.exports = debounce;\n","'use strict';\n\nvar reactIs = require('react-is');\n\n/**\n * Copyright 2015, Yahoo! Inc.\n * Copyrights licensed under the New BSD License. See the accompanying LICENSE file for terms.\n */\nvar REACT_STATICS = {\n childContextTypes: true,\n contextType: true,\n contextTypes: true,\n defaultProps: true,\n displayName: true,\n getDefaultProps: true,\n getDerivedStateFromError: true,\n getDerivedStateFromProps: true,\n mixins: true,\n propTypes: true,\n type: true\n};\nvar KNOWN_STATICS = {\n name: true,\n length: true,\n prototype: true,\n caller: true,\n callee: true,\n arguments: true,\n arity: true\n};\nvar FORWARD_REF_STATICS = {\n '$$typeof': true,\n render: true,\n defaultProps: true,\n displayName: true,\n propTypes: true\n};\nvar MEMO_STATICS = {\n '$$typeof': true,\n compare: true,\n defaultProps: true,\n displayName: true,\n propTypes: true,\n type: true\n};\nvar TYPE_STATICS = {};\nTYPE_STATICS[reactIs.ForwardRef] = FORWARD_REF_STATICS;\nTYPE_STATICS[reactIs.Memo] = MEMO_STATICS;\n\nfunction getStatics(component) {\n // React v16.11 and below\n if (reactIs.isMemo(component)) {\n return MEMO_STATICS;\n } // React v16.12 and above\n\n\n return TYPE_STATICS[component['$$typeof']] || REACT_STATICS;\n}\n\nvar defineProperty = Object.defineProperty;\nvar getOwnPropertyNames = Object.getOwnPropertyNames;\nvar getOwnPropertySymbols = Object.getOwnPropertySymbols;\nvar getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;\nvar getPrototypeOf = Object.getPrototypeOf;\nvar objectPrototype = Object.prototype;\nfunction hoistNonReactStatics(targetComponent, sourceComponent, blacklist) {\n if (typeof sourceComponent !== 'string') {\n // don't hoist over string (html) components\n if (objectPrototype) {\n var inheritedComponent = getPrototypeOf(sourceComponent);\n\n if (inheritedComponent && inheritedComponent !== objectPrototype) {\n hoistNonReactStatics(targetComponent, inheritedComponent, blacklist);\n }\n }\n\n var keys = getOwnPropertyNames(sourceComponent);\n\n if (getOwnPropertySymbols) {\n keys = keys.concat(getOwnPropertySymbols(sourceComponent));\n }\n\n var targetStatics = getStatics(targetComponent);\n var sourceStatics = getStatics(sourceComponent);\n\n for (var i = 0; i < keys.length; ++i) {\n var key = keys[i];\n\n if (!KNOWN_STATICS[key] && !(blacklist && blacklist[key]) && !(sourceStatics && sourceStatics[key]) && !(targetStatics && targetStatics[key])) {\n var descriptor = getOwnPropertyDescriptor(sourceComponent, key);\n\n try {\n // Avoid failures from read-only properties\n defineProperty(targetComponent, key, descriptor);\n } catch (e) {}\n }\n }\n }\n\n return targetComponent;\n}\n\nmodule.exports = hoistNonReactStatics;\n","export default function(x) {\n return Math.abs(x = Math.round(x)) >= 1e21\n ? x.toLocaleString(\"en\").replace(/,/g, \"\")\n : x.toString(10);\n}\n\n// Computes the decimal coefficient and exponent of the specified number x with\n// significant digits p, where x is positive and p is in [1, 21] or undefined.\n// For example, formatDecimalParts(1.23) returns [\"123\", 0].\nexport function formatDecimalParts(x, p) {\n if ((i = (x = p ? x.toExponential(p - 1) : x.toExponential()).indexOf(\"e\")) < 0) return null; // NaN, ±Infinity\n var i, coefficient = x.slice(0, i);\n\n // The string returned by toExponential either has the form \\d\\.\\d+e[-+]\\d+\n // (e.g., 1.2e+3) or the form \\de[-+]\\d+ (e.g., 1e+3).\n return [\n coefficient.length > 1 ? coefficient[0] + coefficient.slice(2) : coefficient,\n +x.slice(i + 1)\n ];\n}\n","export default function() {}\n","export function point(that, x, y) {\n that._context.bezierCurveTo(\n (2 * that._x0 + that._x1) / 3,\n (2 * that._y0 + that._y1) / 3,\n (that._x0 + 2 * that._x1) / 3,\n (that._y0 + 2 * that._y1) / 3,\n (that._x0 + 4 * that._x1 + x) / 6,\n (that._y0 + 4 * that._y1 + y) / 6\n );\n}\n\nexport function Basis(context) {\n this._context = context;\n}\n\nBasis.prototype = {\n areaStart: function() {\n this._line = 0;\n },\n areaEnd: function() {\n this._line = NaN;\n },\n lineStart: function() {\n this._x0 = this._x1 =\n this._y0 = this._y1 = NaN;\n this._point = 0;\n },\n lineEnd: function() {\n switch (this._point) {\n case 3: point(this, this._x1, this._y1); // proceed\n case 2: this._context.lineTo(this._x1, this._y1); break;\n }\n if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath();\n this._line = 1 - this._line;\n },\n point: function(x, y) {\n x = +x, y = +y;\n switch (this._point) {\n case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break;\n case 1: this._point = 2; break;\n case 2: this._point = 3; this._context.lineTo((5 * this._x0 + this._x1) / 6, (5 * this._y0 + this._y1) / 6); // proceed\n default: point(this, x, y); break;\n }\n this._x0 = this._x1, this._x1 = x;\n this._y0 = this._y1, this._y1 = y;\n }\n};\n\nexport default function(context) {\n return new Basis(context);\n}\n","import noop from \"../noop.js\";\nimport {point} from \"./basis.js\";\n\nfunction BasisClosed(context) {\n this._context = context;\n}\n\nBasisClosed.prototype = {\n areaStart: noop,\n areaEnd: noop,\n lineStart: function() {\n this._x0 = this._x1 = this._x2 = this._x3 = this._x4 =\n this._y0 = this._y1 = this._y2 = this._y3 = this._y4 = NaN;\n this._point = 0;\n },\n lineEnd: function() {\n switch (this._point) {\n case 1: {\n this._context.moveTo(this._x2, this._y2);\n this._context.closePath();\n break;\n }\n case 2: {\n this._context.moveTo((this._x2 + 2 * this._x3) / 3, (this._y2 + 2 * this._y3) / 3);\n this._context.lineTo((this._x3 + 2 * this._x2) / 3, (this._y3 + 2 * this._y2) / 3);\n this._context.closePath();\n break;\n }\n case 3: {\n this.point(this._x2, this._y2);\n this.point(this._x3, this._y3);\n this.point(this._x4, this._y4);\n break;\n }\n }\n },\n point: function(x, y) {\n x = +x, y = +y;\n switch (this._point) {\n case 0: this._point = 1; this._x2 = x, this._y2 = y; break;\n case 1: this._point = 2; this._x3 = x, this._y3 = y; break;\n case 2: this._point = 3; this._x4 = x, this._y4 = y; this._context.moveTo((this._x0 + 4 * this._x1 + x) / 6, (this._y0 + 4 * this._y1 + y) / 6); break;\n default: point(this, x, y); break;\n }\n this._x0 = this._x1, this._x1 = x;\n this._y0 = this._y1, this._y1 = y;\n }\n};\n\nexport default function(context) {\n return new BasisClosed(context);\n}\n","import {point} from \"./basis.js\";\n\nfunction BasisOpen(context) {\n this._context = context;\n}\n\nBasisOpen.prototype = {\n areaStart: function() {\n this._line = 0;\n },\n areaEnd: function() {\n this._line = NaN;\n },\n lineStart: function() {\n this._x0 = this._x1 =\n this._y0 = this._y1 = NaN;\n this._point = 0;\n },\n lineEnd: function() {\n if (this._line || (this._line !== 0 && this._point === 3)) this._context.closePath();\n this._line = 1 - this._line;\n },\n point: function(x, y) {\n x = +x, y = +y;\n switch (this._point) {\n case 0: this._point = 1; break;\n case 1: this._point = 2; break;\n case 2: this._point = 3; var x0 = (this._x0 + 4 * this._x1 + x) / 6, y0 = (this._y0 + 4 * this._y1 + y) / 6; this._line ? this._context.lineTo(x0, y0) : this._context.moveTo(x0, y0); break;\n case 3: this._point = 4; // proceed\n default: point(this, x, y); break;\n }\n this._x0 = this._x1, this._x1 = x;\n this._y0 = this._y1, this._y1 = y;\n }\n};\n\nexport default function(context) {\n return new BasisOpen(context);\n}\n","import noop from \"../noop.js\";\n\nfunction LinearClosed(context) {\n this._context = context;\n}\n\nLinearClosed.prototype = {\n areaStart: noop,\n areaEnd: noop,\n lineStart: function() {\n this._point = 0;\n },\n lineEnd: function() {\n if (this._point) this._context.closePath();\n },\n point: function(x, y) {\n x = +x, y = +y;\n if (this._point) this._context.lineTo(x, y);\n else this._point = 1, this._context.moveTo(x, y);\n }\n};\n\nexport default function(context) {\n return new LinearClosed(context);\n}\n","function Linear(context) {\n this._context = context;\n}\n\nLinear.prototype = {\n areaStart: function() {\n this._line = 0;\n },\n areaEnd: function() {\n this._line = NaN;\n },\n lineStart: function() {\n this._point = 0;\n },\n lineEnd: function() {\n if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath();\n this._line = 1 - this._line;\n },\n point: function(x, y) {\n x = +x, y = +y;\n switch (this._point) {\n case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break;\n case 1: this._point = 2; // proceed\n default: this._context.lineTo(x, y); break;\n }\n }\n};\n\nexport default function(context) {\n return new Linear(context);\n}\n","function sign(x) {\n return x < 0 ? -1 : 1;\n}\n\n// Calculate the slopes of the tangents (Hermite-type interpolation) based on\n// the following paper: Steffen, M. 1990. A Simple Method for Monotonic\n// Interpolation in One Dimension. Astronomy and Astrophysics, Vol. 239, NO.\n// NOV(II), P. 443, 1990.\nfunction slope3(that, x2, y2) {\n var h0 = that._x1 - that._x0,\n h1 = x2 - that._x1,\n s0 = (that._y1 - that._y0) / (h0 || h1 < 0 && -0),\n s1 = (y2 - that._y1) / (h1 || h0 < 0 && -0),\n p = (s0 * h1 + s1 * h0) / (h0 + h1);\n return (sign(s0) + sign(s1)) * Math.min(Math.abs(s0), Math.abs(s1), 0.5 * Math.abs(p)) || 0;\n}\n\n// Calculate a one-sided slope.\nfunction slope2(that, t) {\n var h = that._x1 - that._x0;\n return h ? (3 * (that._y1 - that._y0) / h - t) / 2 : t;\n}\n\n// According to https://en.wikipedia.org/wiki/Cubic_Hermite_spline#Representations\n// \"you can express cubic Hermite interpolation in terms of cubic Bézier curves\n// with respect to the four values p0, p0 + m0 / 3, p1 - m1 / 3, p1\".\nfunction point(that, t0, t1) {\n var x0 = that._x0,\n y0 = that._y0,\n x1 = that._x1,\n y1 = that._y1,\n dx = (x1 - x0) / 3;\n that._context.bezierCurveTo(x0 + dx, y0 + dx * t0, x1 - dx, y1 - dx * t1, x1, y1);\n}\n\nfunction MonotoneX(context) {\n this._context = context;\n}\n\nMonotoneX.prototype = {\n areaStart: function() {\n this._line = 0;\n },\n areaEnd: function() {\n this._line = NaN;\n },\n lineStart: function() {\n this._x0 = this._x1 =\n this._y0 = this._y1 =\n this._t0 = NaN;\n this._point = 0;\n },\n lineEnd: function() {\n switch (this._point) {\n case 2: this._context.lineTo(this._x1, this._y1); break;\n case 3: point(this, this._t0, slope2(this, this._t0)); break;\n }\n if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath();\n this._line = 1 - this._line;\n },\n point: function(x, y) {\n var t1 = NaN;\n\n x = +x, y = +y;\n if (x === this._x1 && y === this._y1) return; // Ignore coincident points.\n switch (this._point) {\n case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break;\n case 1: this._point = 2; break;\n case 2: this._point = 3; point(this, slope2(this, t1 = slope3(this, x, y)), t1); break;\n default: point(this, this._t0, t1 = slope3(this, x, y)); break;\n }\n\n this._x0 = this._x1, this._x1 = x;\n this._y0 = this._y1, this._y1 = y;\n this._t0 = t1;\n }\n}\n\nfunction MonotoneY(context) {\n this._context = new ReflectContext(context);\n}\n\n(MonotoneY.prototype = Object.create(MonotoneX.prototype)).point = function(x, y) {\n MonotoneX.prototype.point.call(this, y, x);\n};\n\nfunction ReflectContext(context) {\n this._context = context;\n}\n\nReflectContext.prototype = {\n moveTo: function(x, y) { this._context.moveTo(y, x); },\n closePath: function() { this._context.closePath(); },\n lineTo: function(x, y) { this._context.lineTo(y, x); },\n bezierCurveTo: function(x1, y1, x2, y2, x, y) { this._context.bezierCurveTo(y1, x1, y2, x2, y, x); }\n};\n\nexport function monotoneX(context) {\n return new MonotoneX(context);\n}\n\nexport function monotoneY(context) {\n return new MonotoneY(context);\n}\n","function Natural(context) {\n this._context = context;\n}\n\nNatural.prototype = {\n areaStart: function() {\n this._line = 0;\n },\n areaEnd: function() {\n this._line = NaN;\n },\n lineStart: function() {\n this._x = [];\n this._y = [];\n },\n lineEnd: function() {\n var x = this._x,\n y = this._y,\n n = x.length;\n\n if (n) {\n this._line ? this._context.lineTo(x[0], y[0]) : this._context.moveTo(x[0], y[0]);\n if (n === 2) {\n this._context.lineTo(x[1], y[1]);\n } else {\n var px = controlPoints(x),\n py = controlPoints(y);\n for (var i0 = 0, i1 = 1; i1 < n; ++i0, ++i1) {\n this._context.bezierCurveTo(px[0][i0], py[0][i0], px[1][i0], py[1][i0], x[i1], y[i1]);\n }\n }\n }\n\n if (this._line || (this._line !== 0 && n === 1)) this._context.closePath();\n this._line = 1 - this._line;\n this._x = this._y = null;\n },\n point: function(x, y) {\n this._x.push(+x);\n this._y.push(+y);\n }\n};\n\n// See https://www.particleincell.com/2012/bezier-splines/ for derivation.\nfunction controlPoints(x) {\n var i,\n n = x.length - 1,\n m,\n a = new Array(n),\n b = new Array(n),\n r = new Array(n);\n a[0] = 0, b[0] = 2, r[0] = x[0] + 2 * x[1];\n for (i = 1; i < n - 1; ++i) a[i] = 1, b[i] = 4, r[i] = 4 * x[i] + 2 * x[i + 1];\n a[n - 1] = 2, b[n - 1] = 7, r[n - 1] = 8 * x[n - 1] + x[n];\n for (i = 1; i < n; ++i) m = a[i] / b[i - 1], b[i] -= m, r[i] -= m * r[i - 1];\n a[n - 1] = r[n - 1] / b[n - 1];\n for (i = n - 2; i >= 0; --i) a[i] = (r[i] - a[i + 1]) / b[i];\n b[n - 1] = (x[n] + a[n - 1]) / 2;\n for (i = 0; i < n - 1; ++i) b[i] = 2 * x[i + 1] - a[i + 1];\n return [a, b];\n}\n\nexport default function(context) {\n return new Natural(context);\n}\n","function Step(context, t) {\n this._context = context;\n this._t = t;\n}\n\nStep.prototype = {\n areaStart: function() {\n this._line = 0;\n },\n areaEnd: function() {\n this._line = NaN;\n },\n lineStart: function() {\n this._x = this._y = NaN;\n this._point = 0;\n },\n lineEnd: function() {\n if (0 < this._t && this._t < 1 && this._point === 2) this._context.lineTo(this._x, this._y);\n if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath();\n if (this._line >= 0) this._t = 1 - this._t, this._line = 1 - this._line;\n },\n point: function(x, y) {\n x = +x, y = +y;\n switch (this._point) {\n case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break;\n case 1: this._point = 2; // proceed\n default: {\n if (this._t <= 0) {\n this._context.lineTo(this._x, y);\n this._context.lineTo(x, y);\n } else {\n var x1 = this._x * (1 - this._t) + x * this._t;\n this._context.lineTo(x1, this._y);\n this._context.lineTo(x1, y);\n }\n break;\n }\n }\n this._x = x, this._y = y;\n }\n};\n\nexport default function(context) {\n return new Step(context, 0.5);\n}\n\nexport function stepBefore(context) {\n return new Step(context, 0);\n}\n\nexport function stepAfter(context) {\n return new Step(context, 1);\n}\n","export function x(p) {\n return p[0];\n}\n\nexport function y(p) {\n return p[1];\n}\n","import {path} from \"d3-path\";\nimport array from \"./array.js\";\nimport constant from \"./constant.js\";\nimport curveLinear from \"./curve/linear.js\";\nimport {x as pointX, y as pointY} from \"./point.js\";\n\nexport default function(x, y) {\n var defined = constant(true),\n context = null,\n curve = curveLinear,\n output = null;\n\n x = typeof x === \"function\" ? x : (x === undefined) ? pointX : constant(x);\n y = typeof y === \"function\" ? y : (y === undefined) ? pointY : constant(y);\n\n function line(data) {\n var i,\n n = (data = array(data)).length,\n d,\n defined0 = false,\n buffer;\n\n if (context == null) output = curve(buffer = path());\n\n for (i = 0; i <= n; ++i) {\n if (!(i < n && defined(d = data[i], i, data)) === defined0) {\n if (defined0 = !defined0) output.lineStart();\n else output.lineEnd();\n }\n if (defined0) output.point(+x(d, i, data), +y(d, i, data));\n }\n\n if (buffer) return output = null, buffer + \"\" || null;\n }\n\n line.x = function(_) {\n return arguments.length ? (x = typeof _ === \"function\" ? _ : constant(+_), line) : x;\n };\n\n line.y = function(_) {\n return arguments.length ? (y = typeof _ === \"function\" ? _ : constant(+_), line) : y;\n };\n\n line.defined = function(_) {\n return arguments.length ? (defined = typeof _ === \"function\" ? _ : constant(!!_), line) : defined;\n };\n\n line.curve = function(_) {\n return arguments.length ? (curve = _, context != null && (output = curve(context)), line) : curve;\n };\n\n line.context = function(_) {\n return arguments.length ? (_ == null ? context = output = null : output = curve(context = _), line) : context;\n };\n\n return line;\n}\n","import {path} from \"d3-path\";\nimport array from \"./array.js\";\nimport constant from \"./constant.js\";\nimport curveLinear from \"./curve/linear.js\";\nimport line from \"./line.js\";\nimport {x as pointX, y as pointY} from \"./point.js\";\n\nexport default function(x0, y0, y1) {\n var x1 = null,\n defined = constant(true),\n context = null,\n curve = curveLinear,\n output = null;\n\n x0 = typeof x0 === \"function\" ? x0 : (x0 === undefined) ? pointX : constant(+x0);\n y0 = typeof y0 === \"function\" ? y0 : (y0 === undefined) ? constant(0) : constant(+y0);\n y1 = typeof y1 === \"function\" ? y1 : (y1 === undefined) ? pointY : constant(+y1);\n\n function area(data) {\n var i,\n j,\n k,\n n = (data = array(data)).length,\n d,\n defined0 = false,\n buffer,\n x0z = new Array(n),\n y0z = new Array(n);\n\n if (context == null) output = curve(buffer = path());\n\n for (i = 0; i <= n; ++i) {\n if (!(i < n && defined(d = data[i], i, data)) === defined0) {\n if (defined0 = !defined0) {\n j = i;\n output.areaStart();\n output.lineStart();\n } else {\n output.lineEnd();\n output.lineStart();\n for (k = i - 1; k >= j; --k) {\n output.point(x0z[k], y0z[k]);\n }\n output.lineEnd();\n output.areaEnd();\n }\n }\n if (defined0) {\n x0z[i] = +x0(d, i, data), y0z[i] = +y0(d, i, data);\n output.point(x1 ? +x1(d, i, data) : x0z[i], y1 ? +y1(d, i, data) : y0z[i]);\n }\n }\n\n if (buffer) return output = null, buffer + \"\" || null;\n }\n\n function arealine() {\n return line().defined(defined).curve(curve).context(context);\n }\n\n area.x = function(_) {\n return arguments.length ? (x0 = typeof _ === \"function\" ? _ : constant(+_), x1 = null, area) : x0;\n };\n\n area.x0 = function(_) {\n return arguments.length ? (x0 = typeof _ === \"function\" ? _ : constant(+_), area) : x0;\n };\n\n area.x1 = function(_) {\n return arguments.length ? (x1 = _ == null ? null : typeof _ === \"function\" ? _ : constant(+_), area) : x1;\n };\n\n area.y = function(_) {\n return arguments.length ? (y0 = typeof _ === \"function\" ? _ : constant(+_), y1 = null, area) : y0;\n };\n\n area.y0 = function(_) {\n return arguments.length ? (y0 = typeof _ === \"function\" ? _ : constant(+_), area) : y0;\n };\n\n area.y1 = function(_) {\n return arguments.length ? (y1 = _ == null ? null : typeof _ === \"function\" ? _ : constant(+_), area) : y1;\n };\n\n area.lineX0 =\n area.lineY0 = function() {\n return arealine().x(x0).y(y0);\n };\n\n area.lineY1 = function() {\n return arealine().x(x0).y(y1);\n };\n\n area.lineX1 = function() {\n return arealine().x(x1).y(y0);\n };\n\n area.defined = function(_) {\n return arguments.length ? (defined = typeof _ === \"function\" ? _ : constant(!!_), area) : defined;\n };\n\n area.curve = function(_) {\n return arguments.length ? (curve = _, context != null && (output = curve(context)), area) : curve;\n };\n\n area.context = function(_) {\n return arguments.length ? (_ == null ? context = output = null : output = curve(context = _), area) : context;\n };\n\n return area;\n}\n","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _isArray from \"lodash/isArray\";\nimport _upperFirst from \"lodash/upperFirst\";\nimport _isFunction from \"lodash/isFunction\";\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Curve\n */\nimport React, { PureComponent } from 'react';\nimport { line as shapeLine, area as shapeArea, curveBasisClosed, curveBasisOpen, curveBasis, curveLinearClosed, curveLinear, curveMonotoneX, curveMonotoneY, curveNatural, curveStep, curveStepAfter, curveStepBefore } from 'd3-shape';\nimport classNames from 'classnames';\nimport { adaptEventHandlers, filterProps } from '../util/types';\nimport { isNumber } from '../util/DataUtils';\nvar CURVE_FACTORIES = {\n curveBasisClosed: curveBasisClosed,\n curveBasisOpen: curveBasisOpen,\n curveBasis: curveBasis,\n curveLinearClosed: curveLinearClosed,\n curveLinear: curveLinear,\n curveMonotoneX: curveMonotoneX,\n curveMonotoneY: curveMonotoneY,\n curveNatural: curveNatural,\n curveStep: curveStep,\n curveStepAfter: curveStepAfter,\n curveStepBefore: curveStepBefore\n};\n\nvar defined = function defined(p) {\n return p.x === +p.x && p.y === +p.y;\n};\n\nvar getX = function getX(p) {\n return p.x;\n};\n\nvar getY = function getY(p) {\n return p.y;\n};\n\nvar getCurveFactory = function getCurveFactory(type, layout) {\n if (_isFunction(type)) {\n return type;\n }\n\n var name = \"curve\".concat(_upperFirst(type));\n\n if (name === 'curveMonotone' && layout) {\n return CURVE_FACTORIES[\"\".concat(name).concat(layout === 'vertical' ? 'Y' : 'X')];\n }\n\n return CURVE_FACTORIES[name] || curveLinear;\n};\n\nexport var Curve = /*#__PURE__*/function (_PureComponent) {\n _inherits(Curve, _PureComponent);\n\n var _super = _createSuper(Curve);\n\n function Curve() {\n _classCallCheck(this, Curve);\n\n return _super.apply(this, arguments);\n }\n\n _createClass(Curve, [{\n key: \"getPath\",\n value:\n /**\n * Calculate the path of curve\n * @return {String} path\n */\n function getPath() {\n var _this$props = this.props,\n type = _this$props.type,\n points = _this$props.points,\n baseLine = _this$props.baseLine,\n layout = _this$props.layout,\n connectNulls = _this$props.connectNulls;\n var curveFactory = getCurveFactory(type, layout);\n var formatPoints = connectNulls ? points.filter(function (entry) {\n return defined(entry);\n }) : points;\n var lineFunction;\n\n if (_isArray(baseLine)) {\n var formatBaseLine = connectNulls ? baseLine.filter(function (base) {\n return defined(base);\n }) : baseLine;\n var areaPoints = formatPoints.map(function (entry, index) {\n return _objectSpread(_objectSpread({}, entry), {}, {\n base: formatBaseLine[index]\n });\n });\n\n if (layout === 'vertical') {\n lineFunction = shapeArea().y(getY).x1(getX).x0(function (d) {\n return d.base.x;\n });\n } else {\n lineFunction = shapeArea().x(getX).y1(getY).y0(function (d) {\n return d.base.y;\n });\n }\n\n lineFunction.defined(defined).curve(curveFactory);\n return lineFunction(areaPoints);\n }\n\n if (layout === 'vertical' && isNumber(baseLine)) {\n lineFunction = shapeArea().y(getY).x1(getX).x0(baseLine);\n } else if (isNumber(baseLine)) {\n lineFunction = shapeArea().x(getX).y1(getY).y0(baseLine);\n } else {\n lineFunction = shapeLine().x(getX).y(getY);\n }\n\n lineFunction.defined(defined).curve(curveFactory);\n return lineFunction(formatPoints);\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props2 = this.props,\n className = _this$props2.className,\n points = _this$props2.points,\n path = _this$props2.path,\n pathRef = _this$props2.pathRef;\n\n if ((!points || !points.length) && !path) {\n return null;\n }\n\n var realPath = points && points.length ? this.getPath() : path;\n return /*#__PURE__*/React.createElement(\"path\", _extends({}, filterProps(this.props), adaptEventHandlers(this.props), {\n className: classNames('recharts-curve', className),\n d: realPath,\n ref: pathRef\n }));\n }\n }]);\n\n return Curve;\n}(PureComponent);\nCurve.defaultProps = {\n type: 'linear',\n points: [],\n connectNulls: false\n};","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport PropTypes from 'prop-types';\nimport clsx from 'clsx';\nimport withStyles from '../styles/withStyles';\nimport capitalize from '../utils/capitalize';\nexport var styles = function styles(theme) {\n return {\n /* Styles applied to the root element. */\n root: {\n margin: 0\n },\n\n /* Styles applied to the root element if `variant=\"body2\"`. */\n body2: theme.typography.body2,\n\n /* Styles applied to the root element if `variant=\"body1\"`. */\n body1: theme.typography.body1,\n\n /* Styles applied to the root element if `variant=\"caption\"`. */\n caption: theme.typography.caption,\n\n /* Styles applied to the root element if `variant=\"button\"`. */\n button: theme.typography.button,\n\n /* Styles applied to the root element if `variant=\"h1\"`. */\n h1: theme.typography.h1,\n\n /* Styles applied to the root element if `variant=\"h2\"`. */\n h2: theme.typography.h2,\n\n /* Styles applied to the root element if `variant=\"h3\"`. */\n h3: theme.typography.h3,\n\n /* Styles applied to the root element if `variant=\"h4\"`. */\n h4: theme.typography.h4,\n\n /* Styles applied to the root element if `variant=\"h5\"`. */\n h5: theme.typography.h5,\n\n /* Styles applied to the root element if `variant=\"h6\"`. */\n h6: theme.typography.h6,\n\n /* Styles applied to the root element if `variant=\"subtitle1\"`. */\n subtitle1: theme.typography.subtitle1,\n\n /* Styles applied to the root element if `variant=\"subtitle2\"`. */\n subtitle2: theme.typography.subtitle2,\n\n /* Styles applied to the root element if `variant=\"overline\"`. */\n overline: theme.typography.overline,\n\n /* Styles applied to the root element if `variant=\"srOnly\"`. Only accessible to screen readers. */\n srOnly: {\n position: 'absolute',\n height: 1,\n width: 1,\n overflow: 'hidden'\n },\n\n /* Styles applied to the root element if `align=\"left\"`. */\n alignLeft: {\n textAlign: 'left'\n },\n\n /* Styles applied to the root element if `align=\"center\"`. */\n alignCenter: {\n textAlign: 'center'\n },\n\n /* Styles applied to the root element if `align=\"right\"`. */\n alignRight: {\n textAlign: 'right'\n },\n\n /* Styles applied to the root element if `align=\"justify\"`. */\n alignJustify: {\n textAlign: 'justify'\n },\n\n /* Styles applied to the root element if `nowrap={true}`. */\n noWrap: {\n overflow: 'hidden',\n textOverflow: 'ellipsis',\n whiteSpace: 'nowrap'\n },\n\n /* Styles applied to the root element if `gutterBottom={true}`. */\n gutterBottom: {\n marginBottom: '0.35em'\n },\n\n /* Styles applied to the root element if `paragraph={true}`. */\n paragraph: {\n marginBottom: 16\n },\n\n /* Styles applied to the root element if `color=\"inherit\"`. */\n colorInherit: {\n color: 'inherit'\n },\n\n /* Styles applied to the root element if `color=\"primary\"`. */\n colorPrimary: {\n color: theme.palette.primary.main\n },\n\n /* Styles applied to the root element if `color=\"secondary\"`. */\n colorSecondary: {\n color: theme.palette.secondary.main\n },\n\n /* Styles applied to the root element if `color=\"textPrimary\"`. */\n colorTextPrimary: {\n color: theme.palette.text.primary\n },\n\n /* Styles applied to the root element if `color=\"textSecondary\"`. */\n colorTextSecondary: {\n color: theme.palette.text.secondary\n },\n\n /* Styles applied to the root element if `color=\"error\"`. */\n colorError: {\n color: theme.palette.error.main\n },\n\n /* Styles applied to the root element if `display=\"inline\"`. */\n displayInline: {\n display: 'inline'\n },\n\n /* Styles applied to the root element if `display=\"block\"`. */\n displayBlock: {\n display: 'block'\n }\n };\n};\nvar defaultVariantMapping = {\n h1: 'h1',\n h2: 'h2',\n h3: 'h3',\n h4: 'h4',\n h5: 'h5',\n h6: 'h6',\n subtitle1: 'h6',\n subtitle2: 'h6',\n body1: 'p',\n body2: 'p'\n};\nvar Typography = /*#__PURE__*/React.forwardRef(function Typography(props, ref) {\n var _props$align = props.align,\n align = _props$align === void 0 ? 'inherit' : _props$align,\n classes = props.classes,\n className = props.className,\n _props$color = props.color,\n color = _props$color === void 0 ? 'initial' : _props$color,\n component = props.component,\n _props$display = props.display,\n display = _props$display === void 0 ? 'initial' : _props$display,\n _props$gutterBottom = props.gutterBottom,\n gutterBottom = _props$gutterBottom === void 0 ? false : _props$gutterBottom,\n _props$noWrap = props.noWrap,\n noWrap = _props$noWrap === void 0 ? false : _props$noWrap,\n _props$paragraph = props.paragraph,\n paragraph = _props$paragraph === void 0 ? false : _props$paragraph,\n _props$variant = props.variant,\n variant = _props$variant === void 0 ? 'body1' : _props$variant,\n _props$variantMapping = props.variantMapping,\n variantMapping = _props$variantMapping === void 0 ? defaultVariantMapping : _props$variantMapping,\n other = _objectWithoutProperties(props, [\"align\", \"classes\", \"className\", \"color\", \"component\", \"display\", \"gutterBottom\", \"noWrap\", \"paragraph\", \"variant\", \"variantMapping\"]);\n\n var Component = component || (paragraph ? 'p' : variantMapping[variant] || defaultVariantMapping[variant]) || 'span';\n return /*#__PURE__*/React.createElement(Component, _extends({\n className: clsx(classes.root, className, variant !== 'inherit' && classes[variant], color !== 'initial' && classes[\"color\".concat(capitalize(color))], noWrap && classes.noWrap, gutterBottom && classes.gutterBottom, paragraph && classes.paragraph, align !== 'inherit' && classes[\"align\".concat(capitalize(align))], display !== 'initial' && classes[\"display\".concat(capitalize(display))]),\n ref: ref\n }, other));\n});\nprocess.env.NODE_ENV !== \"production\" ? Typography.propTypes = {\n /**\n * Set the text-align on the component.\n */\n align: PropTypes.oneOf(['inherit', 'left', 'center', 'right', 'justify']),\n\n /**\n * The content of the component.\n */\n children: PropTypes.node,\n\n /**\n * Override or extend the styles applied to the component.\n * See [CSS API](#css) below for more details.\n */\n classes: PropTypes.object.isRequired,\n\n /**\n * @ignore\n */\n className: PropTypes.string,\n\n /**\n * The color of the component. It supports those theme colors that make sense for this component.\n */\n color: PropTypes.oneOf(['initial', 'inherit', 'primary', 'secondary', 'textPrimary', 'textSecondary', 'error']),\n\n /**\n * The component used for the root node.\n * Either a string to use a HTML element or a component.\n * Overrides the behavior of the `variantMapping` prop.\n */\n component: PropTypes\n /* @typescript-to-proptypes-ignore */\n .elementType,\n\n /**\n * Controls the display type\n */\n display: PropTypes.oneOf(['initial', 'block', 'inline']),\n\n /**\n * If `true`, the text will have a bottom margin.\n */\n gutterBottom: PropTypes.bool,\n\n /**\n * If `true`, the text will not wrap, but instead will truncate with a text overflow ellipsis.\n *\n * Note that text overflow can only happen with block or inline-block level elements\n * (the element needs to have a width in order to overflow).\n */\n noWrap: PropTypes.bool,\n\n /**\n * If `true`, the text will have a bottom margin.\n */\n paragraph: PropTypes.bool,\n\n /**\n * Applies the theme typography styles.\n */\n variant: PropTypes.oneOf(['h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'subtitle1', 'subtitle2', 'body1', 'body2', 'caption', 'button', 'overline', 'srOnly', 'inherit']),\n\n /**\n * The component maps the variant prop to a range of different HTML element types.\n * For instance, subtitle1 to ` `.\n * If you wish to change that mapping, you can provide your own.\n * Alternatively, you can use the `component` prop.\n */\n variantMapping: PropTypes.object\n} : void 0;\nexport default withStyles(styles, {\n name: 'MuiTypography'\n})(Typography);","export default function _typeof(obj) {\n \"@babel/helpers - typeof\";\n\n if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") {\n _typeof = function _typeof(obj) {\n return typeof obj;\n };\n } else {\n _typeof = function _typeof(obj) {\n return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj;\n };\n }\n\n return _typeof(obj);\n}","import ownerDocument from './ownerDocument';\nexport default function ownerWindow(node) {\n var doc = ownerDocument(node);\n return doc.defaultView || window;\n}","// based on https://github.com/WICG/focus-visible/blob/v4.1.5/src/focus-visible.js\nimport * as React from 'react';\nimport * as ReactDOM from 'react-dom';\nvar hadKeyboardEvent = true;\nvar hadFocusVisibleRecently = false;\nvar hadFocusVisibleRecentlyTimeout = null;\nvar inputTypesWhitelist = {\n text: true,\n search: true,\n url: true,\n tel: true,\n email: true,\n password: true,\n number: true,\n date: true,\n month: true,\n week: true,\n time: true,\n datetime: true,\n 'datetime-local': true\n};\n/**\n * Computes whether the given element should automatically trigger the\n * `focus-visible` class being added, i.e. whether it should always match\n * `:focus-visible` when focused.\n * @param {Element} node\n * @return {boolean}\n */\n\nfunction focusTriggersKeyboardModality(node) {\n var type = node.type,\n tagName = node.tagName;\n\n if (tagName === 'INPUT' && inputTypesWhitelist[type] && !node.readOnly) {\n return true;\n }\n\n if (tagName === 'TEXTAREA' && !node.readOnly) {\n return true;\n }\n\n if (node.isContentEditable) {\n return true;\n }\n\n return false;\n}\n/**\n * Keep track of our keyboard modality state with `hadKeyboardEvent`.\n * If the most recent user interaction was via the keyboard;\n * and the key press did not include a meta, alt/option, or control key;\n * then the modality is keyboard. Otherwise, the modality is not keyboard.\n * @param {KeyboardEvent} event\n */\n\n\nfunction handleKeyDown(event) {\n if (event.metaKey || event.altKey || event.ctrlKey) {\n return;\n }\n\n hadKeyboardEvent = true;\n}\n/**\n * If at any point a user clicks with a pointing device, ensure that we change\n * the modality away from keyboard.\n * This avoids the situation where a user presses a key on an already focused\n * element, and then clicks on a different element, focusing it with a\n * pointing device, while we still think we're in keyboard modality.\n */\n\n\nfunction handlePointerDown() {\n hadKeyboardEvent = false;\n}\n\nfunction handleVisibilityChange() {\n if (this.visibilityState === 'hidden') {\n // If the tab becomes active again, the browser will handle calling focus\n // on the element (Safari actually calls it twice).\n // If this tab change caused a blur on an element with focus-visible,\n // re-apply the class when the user switches back to the tab.\n if (hadFocusVisibleRecently) {\n hadKeyboardEvent = true;\n }\n }\n}\n\nfunction prepare(doc) {\n doc.addEventListener('keydown', handleKeyDown, true);\n doc.addEventListener('mousedown', handlePointerDown, true);\n doc.addEventListener('pointerdown', handlePointerDown, true);\n doc.addEventListener('touchstart', handlePointerDown, true);\n doc.addEventListener('visibilitychange', handleVisibilityChange, true);\n}\n\nexport function teardown(doc) {\n doc.removeEventListener('keydown', handleKeyDown, true);\n doc.removeEventListener('mousedown', handlePointerDown, true);\n doc.removeEventListener('pointerdown', handlePointerDown, true);\n doc.removeEventListener('touchstart', handlePointerDown, true);\n doc.removeEventListener('visibilitychange', handleVisibilityChange, true);\n}\n\nfunction isFocusVisible(event) {\n var target = event.target;\n\n try {\n return target.matches(':focus-visible');\n } catch (error) {} // browsers not implementing :focus-visible will throw a SyntaxError\n // we use our own heuristic for those browsers\n // rethrow might be better if it's not the expected error but do we really\n // want to crash if focus-visible malfunctioned?\n // no need for validFocusTarget check. the user does that by attaching it to\n // focusable events only\n\n\n return hadKeyboardEvent || focusTriggersKeyboardModality(target);\n}\n/**\n * Should be called if a blur event is fired on a focus-visible element\n */\n\n\nfunction handleBlurVisible() {\n // To detect a tab/window switch, we look for a blur event followed\n // rapidly by a visibility change.\n // If we don't see a visibility change within 100ms, it's probably a\n // regular focus change.\n hadFocusVisibleRecently = true;\n window.clearTimeout(hadFocusVisibleRecentlyTimeout);\n hadFocusVisibleRecentlyTimeout = window.setTimeout(function () {\n hadFocusVisibleRecently = false;\n }, 100);\n}\n\nexport default function useIsFocusVisible() {\n var ref = React.useCallback(function (instance) {\n var node = ReactDOM.findDOMNode(instance);\n\n if (node != null) {\n prepare(node.ownerDocument);\n }\n }, []);\n\n if (process.env.NODE_ENV !== 'production') {\n // eslint-disable-next-line react-hooks/rules-of-hooks\n React.useDebugValue(isFocusVisible);\n }\n\n return {\n isFocusVisible: isFocusVisible,\n onBlurVisible: handleBlurVisible,\n ref: ref\n };\n}","//! moment.js\n//! version : 2.29.1\n//! authors : Tim Wood, Iskren Chernev, Moment.js contributors\n//! license : MIT\n//! momentjs.com\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :\n typeof define === 'function' && define.amd ? define(factory) :\n global.moment = factory()\n}(this, (function () { 'use strict';\n\n var hookCallback;\n\n function hooks() {\n return hookCallback.apply(null, arguments);\n }\n\n // This is done to register the method called with moment()\n // without creating circular dependencies.\n function setHookCallback(callback) {\n hookCallback = callback;\n }\n\n function isArray(input) {\n return (\n input instanceof Array ||\n Object.prototype.toString.call(input) === '[object Array]'\n );\n }\n\n function isObject(input) {\n // IE8 will treat undefined and null as object if it wasn't for\n // input != null\n return (\n input != null &&\n Object.prototype.toString.call(input) === '[object Object]'\n );\n }\n\n function hasOwnProp(a, b) {\n return Object.prototype.hasOwnProperty.call(a, b);\n }\n\n function isObjectEmpty(obj) {\n if (Object.getOwnPropertyNames) {\n return Object.getOwnPropertyNames(obj).length === 0;\n } else {\n var k;\n for (k in obj) {\n if (hasOwnProp(obj, k)) {\n return false;\n }\n }\n return true;\n }\n }\n\n function isUndefined(input) {\n return input === void 0;\n }\n\n function isNumber(input) {\n return (\n typeof input === 'number' ||\n Object.prototype.toString.call(input) === '[object Number]'\n );\n }\n\n function isDate(input) {\n return (\n input instanceof Date ||\n Object.prototype.toString.call(input) === '[object Date]'\n );\n }\n\n function map(arr, fn) {\n var res = [],\n i;\n for (i = 0; i < arr.length; ++i) {\n res.push(fn(arr[i], i));\n }\n return res;\n }\n\n function extend(a, b) {\n for (var i in b) {\n if (hasOwnProp(b, i)) {\n a[i] = b[i];\n }\n }\n\n if (hasOwnProp(b, 'toString')) {\n a.toString = b.toString;\n }\n\n if (hasOwnProp(b, 'valueOf')) {\n a.valueOf = b.valueOf;\n }\n\n return a;\n }\n\n function createUTC(input, format, locale, strict) {\n return createLocalOrUTC(input, format, locale, strict, true).utc();\n }\n\n function defaultParsingFlags() {\n // We need to deep clone this object.\n return {\n empty: false,\n unusedTokens: [],\n unusedInput: [],\n overflow: -2,\n charsLeftOver: 0,\n nullInput: false,\n invalidEra: null,\n invalidMonth: null,\n invalidFormat: false,\n userInvalidated: false,\n iso: false,\n parsedDateParts: [],\n era: null,\n meridiem: null,\n rfc2822: false,\n weekdayMismatch: false,\n };\n }\n\n function getParsingFlags(m) {\n if (m._pf == null) {\n m._pf = defaultParsingFlags();\n }\n return m._pf;\n }\n\n var some;\n if (Array.prototype.some) {\n some = Array.prototype.some;\n } else {\n some = function (fun) {\n var t = Object(this),\n len = t.length >>> 0,\n i;\n\n for (i = 0; i < len; i++) {\n if (i in t && fun.call(this, t[i], i, t)) {\n return true;\n }\n }\n\n return false;\n };\n }\n\n function isValid(m) {\n if (m._isValid == null) {\n var flags = getParsingFlags(m),\n parsedParts = some.call(flags.parsedDateParts, function (i) {\n return i != null;\n }),\n isNowValid =\n !isNaN(m._d.getTime()) &&\n flags.overflow < 0 &&\n !flags.empty &&\n !flags.invalidEra &&\n !flags.invalidMonth &&\n !flags.invalidWeekday &&\n !flags.weekdayMismatch &&\n !flags.nullInput &&\n !flags.invalidFormat &&\n !flags.userInvalidated &&\n (!flags.meridiem || (flags.meridiem && parsedParts));\n\n if (m._strict) {\n isNowValid =\n isNowValid &&\n flags.charsLeftOver === 0 &&\n flags.unusedTokens.length === 0 &&\n flags.bigHour === undefined;\n }\n\n if (Object.isFrozen == null || !Object.isFrozen(m)) {\n m._isValid = isNowValid;\n } else {\n return isNowValid;\n }\n }\n return m._isValid;\n }\n\n function createInvalid(flags) {\n var m = createUTC(NaN);\n if (flags != null) {\n extend(getParsingFlags(m), flags);\n } else {\n getParsingFlags(m).userInvalidated = true;\n }\n\n return m;\n }\n\n // Plugins that add properties should also add the key here (null value),\n // so we can properly clone ourselves.\n var momentProperties = (hooks.momentProperties = []),\n updateInProgress = false;\n\n function copyConfig(to, from) {\n var i, prop, val;\n\n if (!isUndefined(from._isAMomentObject)) {\n to._isAMomentObject = from._isAMomentObject;\n }\n if (!isUndefined(from._i)) {\n to._i = from._i;\n }\n if (!isUndefined(from._f)) {\n to._f = from._f;\n }\n if (!isUndefined(from._l)) {\n to._l = from._l;\n }\n if (!isUndefined(from._strict)) {\n to._strict = from._strict;\n }\n if (!isUndefined(from._tzm)) {\n to._tzm = from._tzm;\n }\n if (!isUndefined(from._isUTC)) {\n to._isUTC = from._isUTC;\n }\n if (!isUndefined(from._offset)) {\n to._offset = from._offset;\n }\n if (!isUndefined(from._pf)) {\n to._pf = getParsingFlags(from);\n }\n if (!isUndefined(from._locale)) {\n to._locale = from._locale;\n }\n\n if (momentProperties.length > 0) {\n for (i = 0; i < momentProperties.length; i++) {\n prop = momentProperties[i];\n val = from[prop];\n if (!isUndefined(val)) {\n to[prop] = val;\n }\n }\n }\n\n return to;\n }\n\n // Moment prototype object\n function Moment(config) {\n copyConfig(this, config);\n this._d = new Date(config._d != null ? config._d.getTime() : NaN);\n if (!this.isValid()) {\n this._d = new Date(NaN);\n }\n // Prevent infinite loop in case updateOffset creates new moment\n // objects.\n if (updateInProgress === false) {\n updateInProgress = true;\n hooks.updateOffset(this);\n updateInProgress = false;\n }\n }\n\n function isMoment(obj) {\n return (\n obj instanceof Moment || (obj != null && obj._isAMomentObject != null)\n );\n }\n\n function warn(msg) {\n if (\n hooks.suppressDeprecationWarnings === false &&\n typeof console !== 'undefined' &&\n console.warn\n ) {\n console.warn('Deprecation warning: ' + msg);\n }\n }\n\n function deprecate(msg, fn) {\n var firstTime = true;\n\n return extend(function () {\n if (hooks.deprecationHandler != null) {\n hooks.deprecationHandler(null, msg);\n }\n if (firstTime) {\n var args = [],\n arg,\n i,\n key;\n for (i = 0; i < arguments.length; i++) {\n arg = '';\n if (typeof arguments[i] === 'object') {\n arg += '\\n[' + i + '] ';\n for (key in arguments[0]) {\n if (hasOwnProp(arguments[0], key)) {\n arg += key + ': ' + arguments[0][key] + ', ';\n }\n }\n arg = arg.slice(0, -2); // Remove trailing comma and space\n } else {\n arg = arguments[i];\n }\n args.push(arg);\n }\n warn(\n msg +\n '\\nArguments: ' +\n Array.prototype.slice.call(args).join('') +\n '\\n' +\n new Error().stack\n );\n firstTime = false;\n }\n return fn.apply(this, arguments);\n }, fn);\n }\n\n var deprecations = {};\n\n function deprecateSimple(name, msg) {\n if (hooks.deprecationHandler != null) {\n hooks.deprecationHandler(name, msg);\n }\n if (!deprecations[name]) {\n warn(msg);\n deprecations[name] = true;\n }\n }\n\n hooks.suppressDeprecationWarnings = false;\n hooks.deprecationHandler = null;\n\n function isFunction(input) {\n return (\n (typeof Function !== 'undefined' && input instanceof Function) ||\n Object.prototype.toString.call(input) === '[object Function]'\n );\n }\n\n function set(config) {\n var prop, i;\n for (i in config) {\n if (hasOwnProp(config, i)) {\n prop = config[i];\n if (isFunction(prop)) {\n this[i] = prop;\n } else {\n this['_' + i] = prop;\n }\n }\n }\n this._config = config;\n // Lenient ordinal parsing accepts just a number in addition to\n // number + (possibly) stuff coming from _dayOfMonthOrdinalParse.\n // TODO: Remove \"ordinalParse\" fallback in next major release.\n this._dayOfMonthOrdinalParseLenient = new RegExp(\n (this._dayOfMonthOrdinalParse.source || this._ordinalParse.source) +\n '|' +\n /\\d{1,2}/.source\n );\n }\n\n function mergeConfigs(parentConfig, childConfig) {\n var res = extend({}, parentConfig),\n prop;\n for (prop in childConfig) {\n if (hasOwnProp(childConfig, prop)) {\n if (isObject(parentConfig[prop]) && isObject(childConfig[prop])) {\n res[prop] = {};\n extend(res[prop], parentConfig[prop]);\n extend(res[prop], childConfig[prop]);\n } else if (childConfig[prop] != null) {\n res[prop] = childConfig[prop];\n } else {\n delete res[prop];\n }\n }\n }\n for (prop in parentConfig) {\n if (\n hasOwnProp(parentConfig, prop) &&\n !hasOwnProp(childConfig, prop) &&\n isObject(parentConfig[prop])\n ) {\n // make sure changes to properties don't modify parent config\n res[prop] = extend({}, res[prop]);\n }\n }\n return res;\n }\n\n function Locale(config) {\n if (config != null) {\n this.set(config);\n }\n }\n\n var keys;\n\n if (Object.keys) {\n keys = Object.keys;\n } else {\n keys = function (obj) {\n var i,\n res = [];\n for (i in obj) {\n if (hasOwnProp(obj, i)) {\n res.push(i);\n }\n }\n return res;\n };\n }\n\n var defaultCalendar = {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n };\n\n function calendar(key, mom, now) {\n var output = this._calendar[key] || this._calendar['sameElse'];\n return isFunction(output) ? output.call(mom, now) : output;\n }\n\n function zeroFill(number, targetLength, forceSign) {\n var absNumber = '' + Math.abs(number),\n zerosToFill = targetLength - absNumber.length,\n sign = number >= 0;\n return (\n (sign ? (forceSign ? '+' : '') : '-') +\n Math.pow(10, Math.max(0, zerosToFill)).toString().substr(1) +\n absNumber\n );\n }\n\n var formattingTokens = /(\\[[^\\[]*\\])|(\\\\)?([Hh]mm(ss)?|Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|W[o|W]?|Qo?|N{1,5}|YYYYYY|YYYYY|YYYY|YY|y{2,4}|yo?|gg(ggg?)?|GG(GGG?)?|e|E|a|A|hh?|HH?|kk?|mm?|ss?|S{1,9}|x|X|zz?|ZZ?|.)/g,\n localFormattingTokens = /(\\[[^\\[]*\\])|(\\\\)?(LTS|LT|LL?L?L?|l{1,4})/g,\n formatFunctions = {},\n formatTokenFunctions = {};\n\n // token: 'M'\n // padded: ['MM', 2]\n // ordinal: 'Mo'\n // callback: function () { this.month() + 1 }\n function addFormatToken(token, padded, ordinal, callback) {\n var func = callback;\n if (typeof callback === 'string') {\n func = function () {\n return this[callback]();\n };\n }\n if (token) {\n formatTokenFunctions[token] = func;\n }\n if (padded) {\n formatTokenFunctions[padded[0]] = function () {\n return zeroFill(func.apply(this, arguments), padded[1], padded[2]);\n };\n }\n if (ordinal) {\n formatTokenFunctions[ordinal] = function () {\n return this.localeData().ordinal(\n func.apply(this, arguments),\n token\n );\n };\n }\n }\n\n function removeFormattingTokens(input) {\n if (input.match(/\\[[\\s\\S]/)) {\n return input.replace(/^\\[|\\]$/g, '');\n }\n return input.replace(/\\\\/g, '');\n }\n\n function makeFormatFunction(format) {\n var array = format.match(formattingTokens),\n i,\n length;\n\n for (i = 0, length = array.length; i < length; i++) {\n if (formatTokenFunctions[array[i]]) {\n array[i] = formatTokenFunctions[array[i]];\n } else {\n array[i] = removeFormattingTokens(array[i]);\n }\n }\n\n return function (mom) {\n var output = '',\n i;\n for (i = 0; i < length; i++) {\n output += isFunction(array[i])\n ? array[i].call(mom, format)\n : array[i];\n }\n return output;\n };\n }\n\n // format date using native date object\n function formatMoment(m, format) {\n if (!m.isValid()) {\n return m.localeData().invalidDate();\n }\n\n format = expandFormat(format, m.localeData());\n formatFunctions[format] =\n formatFunctions[format] || makeFormatFunction(format);\n\n return formatFunctions[format](m);\n }\n\n function expandFormat(format, locale) {\n var i = 5;\n\n function replaceLongDateFormatTokens(input) {\n return locale.longDateFormat(input) || input;\n }\n\n localFormattingTokens.lastIndex = 0;\n while (i >= 0 && localFormattingTokens.test(format)) {\n format = format.replace(\n localFormattingTokens,\n replaceLongDateFormatTokens\n );\n localFormattingTokens.lastIndex = 0;\n i -= 1;\n }\n\n return format;\n }\n\n var defaultLongDateFormat = {\n LTS: 'h:mm:ss A',\n LT: 'h:mm A',\n L: 'MM/DD/YYYY',\n LL: 'MMMM D, YYYY',\n LLL: 'MMMM D, YYYY h:mm A',\n LLLL: 'dddd, MMMM D, YYYY h:mm A',\n };\n\n function longDateFormat(key) {\n var format = this._longDateFormat[key],\n formatUpper = this._longDateFormat[key.toUpperCase()];\n\n if (format || !formatUpper) {\n return format;\n }\n\n this._longDateFormat[key] = formatUpper\n .match(formattingTokens)\n .map(function (tok) {\n if (\n tok === 'MMMM' ||\n tok === 'MM' ||\n tok === 'DD' ||\n tok === 'dddd'\n ) {\n return tok.slice(1);\n }\n return tok;\n })\n .join('');\n\n return this._longDateFormat[key];\n }\n\n var defaultInvalidDate = 'Invalid date';\n\n function invalidDate() {\n return this._invalidDate;\n }\n\n var defaultOrdinal = '%d',\n defaultDayOfMonthOrdinalParse = /\\d{1,2}/;\n\n function ordinal(number) {\n return this._ordinal.replace('%d', number);\n }\n\n var defaultRelativeTime = {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n w: 'a week',\n ww: '%d weeks',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n };\n\n function relativeTime(number, withoutSuffix, string, isFuture) {\n var output = this._relativeTime[string];\n return isFunction(output)\n ? output(number, withoutSuffix, string, isFuture)\n : output.replace(/%d/i, number);\n }\n\n function pastFuture(diff, output) {\n var format = this._relativeTime[diff > 0 ? 'future' : 'past'];\n return isFunction(format) ? format(output) : format.replace(/%s/i, output);\n }\n\n var aliases = {};\n\n function addUnitAlias(unit, shorthand) {\n var lowerCase = unit.toLowerCase();\n aliases[lowerCase] = aliases[lowerCase + 's'] = aliases[shorthand] = unit;\n }\n\n function normalizeUnits(units) {\n return typeof units === 'string'\n ? aliases[units] || aliases[units.toLowerCase()]\n : undefined;\n }\n\n function normalizeObjectUnits(inputObject) {\n var normalizedInput = {},\n normalizedProp,\n prop;\n\n for (prop in inputObject) {\n if (hasOwnProp(inputObject, prop)) {\n normalizedProp = normalizeUnits(prop);\n if (normalizedProp) {\n normalizedInput[normalizedProp] = inputObject[prop];\n }\n }\n }\n\n return normalizedInput;\n }\n\n var priorities = {};\n\n function addUnitPriority(unit, priority) {\n priorities[unit] = priority;\n }\n\n function getPrioritizedUnits(unitsObj) {\n var units = [],\n u;\n for (u in unitsObj) {\n if (hasOwnProp(unitsObj, u)) {\n units.push({ unit: u, priority: priorities[u] });\n }\n }\n units.sort(function (a, b) {\n return a.priority - b.priority;\n });\n return units;\n }\n\n function isLeapYear(year) {\n return (year % 4 === 0 && year % 100 !== 0) || year % 400 === 0;\n }\n\n function absFloor(number) {\n if (number < 0) {\n // -0 -> 0\n return Math.ceil(number) || 0;\n } else {\n return Math.floor(number);\n }\n }\n\n function toInt(argumentForCoercion) {\n var coercedNumber = +argumentForCoercion,\n value = 0;\n\n if (coercedNumber !== 0 && isFinite(coercedNumber)) {\n value = absFloor(coercedNumber);\n }\n\n return value;\n }\n\n function makeGetSet(unit, keepTime) {\n return function (value) {\n if (value != null) {\n set$1(this, unit, value);\n hooks.updateOffset(this, keepTime);\n return this;\n } else {\n return get(this, unit);\n }\n };\n }\n\n function get(mom, unit) {\n return mom.isValid()\n ? mom._d['get' + (mom._isUTC ? 'UTC' : '') + unit]()\n : NaN;\n }\n\n function set$1(mom, unit, value) {\n if (mom.isValid() && !isNaN(value)) {\n if (\n unit === 'FullYear' &&\n isLeapYear(mom.year()) &&\n mom.month() === 1 &&\n mom.date() === 29\n ) {\n value = toInt(value);\n mom._d['set' + (mom._isUTC ? 'UTC' : '') + unit](\n value,\n mom.month(),\n daysInMonth(value, mom.month())\n );\n } else {\n mom._d['set' + (mom._isUTC ? 'UTC' : '') + unit](value);\n }\n }\n }\n\n // MOMENTS\n\n function stringGet(units) {\n units = normalizeUnits(units);\n if (isFunction(this[units])) {\n return this[units]();\n }\n return this;\n }\n\n function stringSet(units, value) {\n if (typeof units === 'object') {\n units = normalizeObjectUnits(units);\n var prioritized = getPrioritizedUnits(units),\n i;\n for (i = 0; i < prioritized.length; i++) {\n this[prioritized[i].unit](units[prioritized[i].unit]);\n }\n } else {\n units = normalizeUnits(units);\n if (isFunction(this[units])) {\n return this[units](value);\n }\n }\n return this;\n }\n\n var match1 = /\\d/, // 0 - 9\n match2 = /\\d\\d/, // 00 - 99\n match3 = /\\d{3}/, // 000 - 999\n match4 = /\\d{4}/, // 0000 - 9999\n match6 = /[+-]?\\d{6}/, // -999999 - 999999\n match1to2 = /\\d\\d?/, // 0 - 99\n match3to4 = /\\d\\d\\d\\d?/, // 999 - 9999\n match5to6 = /\\d\\d\\d\\d\\d\\d?/, // 99999 - 999999\n match1to3 = /\\d{1,3}/, // 0 - 999\n match1to4 = /\\d{1,4}/, // 0 - 9999\n match1to6 = /[+-]?\\d{1,6}/, // -999999 - 999999\n matchUnsigned = /\\d+/, // 0 - inf\n matchSigned = /[+-]?\\d+/, // -inf - inf\n matchOffset = /Z|[+-]\\d\\d:?\\d\\d/gi, // +00:00 -00:00 +0000 -0000 or Z\n matchShortOffset = /Z|[+-]\\d\\d(?::?\\d\\d)?/gi, // +00 -00 +00:00 -00:00 +0000 -0000 or Z\n matchTimestamp = /[+-]?\\d+(\\.\\d{1,3})?/, // 123456789 123456789.123\n // any word (or two) characters or numbers including two/three word month in arabic.\n // includes scottish gaelic two word and hyphenated months\n matchWord = /[0-9]{0,256}['a-z\\u00A0-\\u05FF\\u0700-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFF07\\uFF10-\\uFFEF]{1,256}|[\\u0600-\\u06FF\\/]{1,256}(\\s*?[\\u0600-\\u06FF]{1,256}){1,2}/i,\n regexes;\n\n regexes = {};\n\n function addRegexToken(token, regex, strictRegex) {\n regexes[token] = isFunction(regex)\n ? regex\n : function (isStrict, localeData) {\n return isStrict && strictRegex ? strictRegex : regex;\n };\n }\n\n function getParseRegexForToken(token, config) {\n if (!hasOwnProp(regexes, token)) {\n return new RegExp(unescapeFormat(token));\n }\n\n return regexes[token](config._strict, config._locale);\n }\n\n // Code from http://stackoverflow.com/questions/3561493/is-there-a-regexp-escape-function-in-javascript\n function unescapeFormat(s) {\n return regexEscape(\n s\n .replace('\\\\', '')\n .replace(/\\\\(\\[)|\\\\(\\])|\\[([^\\]\\[]*)\\]|\\\\(.)/g, function (\n matched,\n p1,\n p2,\n p3,\n p4\n ) {\n return p1 || p2 || p3 || p4;\n })\n );\n }\n\n function regexEscape(s) {\n return s.replace(/[-\\/\\\\^$*+?.()|[\\]{}]/g, '\\\\$&');\n }\n\n var tokens = {};\n\n function addParseToken(token, callback) {\n var i,\n func = callback;\n if (typeof token === 'string') {\n token = [token];\n }\n if (isNumber(callback)) {\n func = function (input, array) {\n array[callback] = toInt(input);\n };\n }\n for (i = 0; i < token.length; i++) {\n tokens[token[i]] = func;\n }\n }\n\n function addWeekParseToken(token, callback) {\n addParseToken(token, function (input, array, config, token) {\n config._w = config._w || {};\n callback(input, config._w, config, token);\n });\n }\n\n function addTimeToArrayFromToken(token, input, config) {\n if (input != null && hasOwnProp(tokens, token)) {\n tokens[token](input, config._a, config, token);\n }\n }\n\n var YEAR = 0,\n MONTH = 1,\n DATE = 2,\n HOUR = 3,\n MINUTE = 4,\n SECOND = 5,\n MILLISECOND = 6,\n WEEK = 7,\n WEEKDAY = 8;\n\n function mod(n, x) {\n return ((n % x) + x) % x;\n }\n\n var indexOf;\n\n if (Array.prototype.indexOf) {\n indexOf = Array.prototype.indexOf;\n } else {\n indexOf = function (o) {\n // I know\n var i;\n for (i = 0; i < this.length; ++i) {\n if (this[i] === o) {\n return i;\n }\n }\n return -1;\n };\n }\n\n function daysInMonth(year, month) {\n if (isNaN(year) || isNaN(month)) {\n return NaN;\n }\n var modMonth = mod(month, 12);\n year += (month - modMonth) / 12;\n return modMonth === 1\n ? isLeapYear(year)\n ? 29\n : 28\n : 31 - ((modMonth % 7) % 2);\n }\n\n // FORMATTING\n\n addFormatToken('M', ['MM', 2], 'Mo', function () {\n return this.month() + 1;\n });\n\n addFormatToken('MMM', 0, 0, function (format) {\n return this.localeData().monthsShort(this, format);\n });\n\n addFormatToken('MMMM', 0, 0, function (format) {\n return this.localeData().months(this, format);\n });\n\n // ALIASES\n\n addUnitAlias('month', 'M');\n\n // PRIORITY\n\n addUnitPriority('month', 8);\n\n // PARSING\n\n addRegexToken('M', match1to2);\n addRegexToken('MM', match1to2, match2);\n addRegexToken('MMM', function (isStrict, locale) {\n return locale.monthsShortRegex(isStrict);\n });\n addRegexToken('MMMM', function (isStrict, locale) {\n return locale.monthsRegex(isStrict);\n });\n\n addParseToken(['M', 'MM'], function (input, array) {\n array[MONTH] = toInt(input) - 1;\n });\n\n addParseToken(['MMM', 'MMMM'], function (input, array, config, token) {\n var month = config._locale.monthsParse(input, token, config._strict);\n // if we didn't find a month name, mark the date as invalid.\n if (month != null) {\n array[MONTH] = month;\n } else {\n getParsingFlags(config).invalidMonth = input;\n }\n });\n\n // LOCALES\n\n var defaultLocaleMonths = 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n defaultLocaleMonthsShort = 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split(\n '_'\n ),\n MONTHS_IN_FORMAT = /D[oD]?(\\[[^\\[\\]]*\\]|\\s)+MMMM?/,\n defaultMonthsShortRegex = matchWord,\n defaultMonthsRegex = matchWord;\n\n function localeMonths(m, format) {\n if (!m) {\n return isArray(this._months)\n ? this._months\n : this._months['standalone'];\n }\n return isArray(this._months)\n ? this._months[m.month()]\n : this._months[\n (this._months.isFormat || MONTHS_IN_FORMAT).test(format)\n ? 'format'\n : 'standalone'\n ][m.month()];\n }\n\n function localeMonthsShort(m, format) {\n if (!m) {\n return isArray(this._monthsShort)\n ? this._monthsShort\n : this._monthsShort['standalone'];\n }\n return isArray(this._monthsShort)\n ? this._monthsShort[m.month()]\n : this._monthsShort[\n MONTHS_IN_FORMAT.test(format) ? 'format' : 'standalone'\n ][m.month()];\n }\n\n function handleStrictParse(monthName, format, strict) {\n var i,\n ii,\n mom,\n llc = monthName.toLocaleLowerCase();\n if (!this._monthsParse) {\n // this is not used\n this._monthsParse = [];\n this._longMonthsParse = [];\n this._shortMonthsParse = [];\n for (i = 0; i < 12; ++i) {\n mom = createUTC([2000, i]);\n this._shortMonthsParse[i] = this.monthsShort(\n mom,\n ''\n ).toLocaleLowerCase();\n this._longMonthsParse[i] = this.months(mom, '').toLocaleLowerCase();\n }\n }\n\n if (strict) {\n if (format === 'MMM') {\n ii = indexOf.call(this._shortMonthsParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._longMonthsParse, llc);\n return ii !== -1 ? ii : null;\n }\n } else {\n if (format === 'MMM') {\n ii = indexOf.call(this._shortMonthsParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._longMonthsParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._longMonthsParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortMonthsParse, llc);\n return ii !== -1 ? ii : null;\n }\n }\n }\n\n function localeMonthsParse(monthName, format, strict) {\n var i, mom, regex;\n\n if (this._monthsParseExact) {\n return handleStrictParse.call(this, monthName, format, strict);\n }\n\n if (!this._monthsParse) {\n this._monthsParse = [];\n this._longMonthsParse = [];\n this._shortMonthsParse = [];\n }\n\n // TODO: add sorting\n // Sorting makes sure if one month (or abbr) is a prefix of another\n // see sorting in computeMonthsParse\n for (i = 0; i < 12; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, i]);\n if (strict && !this._longMonthsParse[i]) {\n this._longMonthsParse[i] = new RegExp(\n '^' + this.months(mom, '').replace('.', '') + '$',\n 'i'\n );\n this._shortMonthsParse[i] = new RegExp(\n '^' + this.monthsShort(mom, '').replace('.', '') + '$',\n 'i'\n );\n }\n if (!strict && !this._monthsParse[i]) {\n regex =\n '^' + this.months(mom, '') + '|^' + this.monthsShort(mom, '');\n this._monthsParse[i] = new RegExp(regex.replace('.', ''), 'i');\n }\n // test the regex\n if (\n strict &&\n format === 'MMMM' &&\n this._longMonthsParse[i].test(monthName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'MMM' &&\n this._shortMonthsParse[i].test(monthName)\n ) {\n return i;\n } else if (!strict && this._monthsParse[i].test(monthName)) {\n return i;\n }\n }\n }\n\n // MOMENTS\n\n function setMonth(mom, value) {\n var dayOfMonth;\n\n if (!mom.isValid()) {\n // No op\n return mom;\n }\n\n if (typeof value === 'string') {\n if (/^\\d+$/.test(value)) {\n value = toInt(value);\n } else {\n value = mom.localeData().monthsParse(value);\n // TODO: Another silent failure?\n if (!isNumber(value)) {\n return mom;\n }\n }\n }\n\n dayOfMonth = Math.min(mom.date(), daysInMonth(mom.year(), value));\n mom._d['set' + (mom._isUTC ? 'UTC' : '') + 'Month'](value, dayOfMonth);\n return mom;\n }\n\n function getSetMonth(value) {\n if (value != null) {\n setMonth(this, value);\n hooks.updateOffset(this, true);\n return this;\n } else {\n return get(this, 'Month');\n }\n }\n\n function getDaysInMonth() {\n return daysInMonth(this.year(), this.month());\n }\n\n function monthsShortRegex(isStrict) {\n if (this._monthsParseExact) {\n if (!hasOwnProp(this, '_monthsRegex')) {\n computeMonthsParse.call(this);\n }\n if (isStrict) {\n return this._monthsShortStrictRegex;\n } else {\n return this._monthsShortRegex;\n }\n } else {\n if (!hasOwnProp(this, '_monthsShortRegex')) {\n this._monthsShortRegex = defaultMonthsShortRegex;\n }\n return this._monthsShortStrictRegex && isStrict\n ? this._monthsShortStrictRegex\n : this._monthsShortRegex;\n }\n }\n\n function monthsRegex(isStrict) {\n if (this._monthsParseExact) {\n if (!hasOwnProp(this, '_monthsRegex')) {\n computeMonthsParse.call(this);\n }\n if (isStrict) {\n return this._monthsStrictRegex;\n } else {\n return this._monthsRegex;\n }\n } else {\n if (!hasOwnProp(this, '_monthsRegex')) {\n this._monthsRegex = defaultMonthsRegex;\n }\n return this._monthsStrictRegex && isStrict\n ? this._monthsStrictRegex\n : this._monthsRegex;\n }\n }\n\n function computeMonthsParse() {\n function cmpLenRev(a, b) {\n return b.length - a.length;\n }\n\n var shortPieces = [],\n longPieces = [],\n mixedPieces = [],\n i,\n mom;\n for (i = 0; i < 12; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, i]);\n shortPieces.push(this.monthsShort(mom, ''));\n longPieces.push(this.months(mom, ''));\n mixedPieces.push(this.months(mom, ''));\n mixedPieces.push(this.monthsShort(mom, ''));\n }\n // Sorting makes sure if one month (or abbr) is a prefix of another it\n // will match the longer piece.\n shortPieces.sort(cmpLenRev);\n longPieces.sort(cmpLenRev);\n mixedPieces.sort(cmpLenRev);\n for (i = 0; i < 12; i++) {\n shortPieces[i] = regexEscape(shortPieces[i]);\n longPieces[i] = regexEscape(longPieces[i]);\n }\n for (i = 0; i < 24; i++) {\n mixedPieces[i] = regexEscape(mixedPieces[i]);\n }\n\n this._monthsRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._monthsShortRegex = this._monthsRegex;\n this._monthsStrictRegex = new RegExp(\n '^(' + longPieces.join('|') + ')',\n 'i'\n );\n this._monthsShortStrictRegex = new RegExp(\n '^(' + shortPieces.join('|') + ')',\n 'i'\n );\n }\n\n // FORMATTING\n\n addFormatToken('Y', 0, 0, function () {\n var y = this.year();\n return y <= 9999 ? zeroFill(y, 4) : '+' + y;\n });\n\n addFormatToken(0, ['YY', 2], 0, function () {\n return this.year() % 100;\n });\n\n addFormatToken(0, ['YYYY', 4], 0, 'year');\n addFormatToken(0, ['YYYYY', 5], 0, 'year');\n addFormatToken(0, ['YYYYYY', 6, true], 0, 'year');\n\n // ALIASES\n\n addUnitAlias('year', 'y');\n\n // PRIORITIES\n\n addUnitPriority('year', 1);\n\n // PARSING\n\n addRegexToken('Y', matchSigned);\n addRegexToken('YY', match1to2, match2);\n addRegexToken('YYYY', match1to4, match4);\n addRegexToken('YYYYY', match1to6, match6);\n addRegexToken('YYYYYY', match1to6, match6);\n\n addParseToken(['YYYYY', 'YYYYYY'], YEAR);\n addParseToken('YYYY', function (input, array) {\n array[YEAR] =\n input.length === 2 ? hooks.parseTwoDigitYear(input) : toInt(input);\n });\n addParseToken('YY', function (input, array) {\n array[YEAR] = hooks.parseTwoDigitYear(input);\n });\n addParseToken('Y', function (input, array) {\n array[YEAR] = parseInt(input, 10);\n });\n\n // HELPERS\n\n function daysInYear(year) {\n return isLeapYear(year) ? 366 : 365;\n }\n\n // HOOKS\n\n hooks.parseTwoDigitYear = function (input) {\n return toInt(input) + (toInt(input) > 68 ? 1900 : 2000);\n };\n\n // MOMENTS\n\n var getSetYear = makeGetSet('FullYear', true);\n\n function getIsLeapYear() {\n return isLeapYear(this.year());\n }\n\n function createDate(y, m, d, h, M, s, ms) {\n // can't just apply() to create a date:\n // https://stackoverflow.com/q/181348\n var date;\n // the date constructor remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n date = new Date(y + 400, m, d, h, M, s, ms);\n if (isFinite(date.getFullYear())) {\n date.setFullYear(y);\n }\n } else {\n date = new Date(y, m, d, h, M, s, ms);\n }\n\n return date;\n }\n\n function createUTCDate(y) {\n var date, args;\n // the Date.UTC function remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n args = Array.prototype.slice.call(arguments);\n // preserve leap years using a full 400 year cycle, then reset\n args[0] = y + 400;\n date = new Date(Date.UTC.apply(null, args));\n if (isFinite(date.getUTCFullYear())) {\n date.setUTCFullYear(y);\n }\n } else {\n date = new Date(Date.UTC.apply(null, arguments));\n }\n\n return date;\n }\n\n // start-of-first-week - start-of-year\n function firstWeekOffset(year, dow, doy) {\n var // first-week day -- which january is always in the first week (4 for iso, 1 for other)\n fwd = 7 + dow - doy,\n // first-week day local weekday -- which local weekday is fwd\n fwdlw = (7 + createUTCDate(year, 0, fwd).getUTCDay() - dow) % 7;\n\n return -fwdlw + fwd - 1;\n }\n\n // https://en.wikipedia.org/wiki/ISO_week_date#Calculating_a_date_given_the_year.2C_week_number_and_weekday\n function dayOfYearFromWeeks(year, week, weekday, dow, doy) {\n var localWeekday = (7 + weekday - dow) % 7,\n weekOffset = firstWeekOffset(year, dow, doy),\n dayOfYear = 1 + 7 * (week - 1) + localWeekday + weekOffset,\n resYear,\n resDayOfYear;\n\n if (dayOfYear <= 0) {\n resYear = year - 1;\n resDayOfYear = daysInYear(resYear) + dayOfYear;\n } else if (dayOfYear > daysInYear(year)) {\n resYear = year + 1;\n resDayOfYear = dayOfYear - daysInYear(year);\n } else {\n resYear = year;\n resDayOfYear = dayOfYear;\n }\n\n return {\n year: resYear,\n dayOfYear: resDayOfYear,\n };\n }\n\n function weekOfYear(mom, dow, doy) {\n var weekOffset = firstWeekOffset(mom.year(), dow, doy),\n week = Math.floor((mom.dayOfYear() - weekOffset - 1) / 7) + 1,\n resWeek,\n resYear;\n\n if (week < 1) {\n resYear = mom.year() - 1;\n resWeek = week + weeksInYear(resYear, dow, doy);\n } else if (week > weeksInYear(mom.year(), dow, doy)) {\n resWeek = week - weeksInYear(mom.year(), dow, doy);\n resYear = mom.year() + 1;\n } else {\n resYear = mom.year();\n resWeek = week;\n }\n\n return {\n week: resWeek,\n year: resYear,\n };\n }\n\n function weeksInYear(year, dow, doy) {\n var weekOffset = firstWeekOffset(year, dow, doy),\n weekOffsetNext = firstWeekOffset(year + 1, dow, doy);\n return (daysInYear(year) - weekOffset + weekOffsetNext) / 7;\n }\n\n // FORMATTING\n\n addFormatToken('w', ['ww', 2], 'wo', 'week');\n addFormatToken('W', ['WW', 2], 'Wo', 'isoWeek');\n\n // ALIASES\n\n addUnitAlias('week', 'w');\n addUnitAlias('isoWeek', 'W');\n\n // PRIORITIES\n\n addUnitPriority('week', 5);\n addUnitPriority('isoWeek', 5);\n\n // PARSING\n\n addRegexToken('w', match1to2);\n addRegexToken('ww', match1to2, match2);\n addRegexToken('W', match1to2);\n addRegexToken('WW', match1to2, match2);\n\n addWeekParseToken(['w', 'ww', 'W', 'WW'], function (\n input,\n week,\n config,\n token\n ) {\n week[token.substr(0, 1)] = toInt(input);\n });\n\n // HELPERS\n\n // LOCALES\n\n function localeWeek(mom) {\n return weekOfYear(mom, this._week.dow, this._week.doy).week;\n }\n\n var defaultLocaleWeek = {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n };\n\n function localeFirstDayOfWeek() {\n return this._week.dow;\n }\n\n function localeFirstDayOfYear() {\n return this._week.doy;\n }\n\n // MOMENTS\n\n function getSetWeek(input) {\n var week = this.localeData().week(this);\n return input == null ? week : this.add((input - week) * 7, 'd');\n }\n\n function getSetISOWeek(input) {\n var week = weekOfYear(this, 1, 4).week;\n return input == null ? week : this.add((input - week) * 7, 'd');\n }\n\n // FORMATTING\n\n addFormatToken('d', 0, 'do', 'day');\n\n addFormatToken('dd', 0, 0, function (format) {\n return this.localeData().weekdaysMin(this, format);\n });\n\n addFormatToken('ddd', 0, 0, function (format) {\n return this.localeData().weekdaysShort(this, format);\n });\n\n addFormatToken('dddd', 0, 0, function (format) {\n return this.localeData().weekdays(this, format);\n });\n\n addFormatToken('e', 0, 0, 'weekday');\n addFormatToken('E', 0, 0, 'isoWeekday');\n\n // ALIASES\n\n addUnitAlias('day', 'd');\n addUnitAlias('weekday', 'e');\n addUnitAlias('isoWeekday', 'E');\n\n // PRIORITY\n addUnitPriority('day', 11);\n addUnitPriority('weekday', 11);\n addUnitPriority('isoWeekday', 11);\n\n // PARSING\n\n addRegexToken('d', match1to2);\n addRegexToken('e', match1to2);\n addRegexToken('E', match1to2);\n addRegexToken('dd', function (isStrict, locale) {\n return locale.weekdaysMinRegex(isStrict);\n });\n addRegexToken('ddd', function (isStrict, locale) {\n return locale.weekdaysShortRegex(isStrict);\n });\n addRegexToken('dddd', function (isStrict, locale) {\n return locale.weekdaysRegex(isStrict);\n });\n\n addWeekParseToken(['dd', 'ddd', 'dddd'], function (input, week, config, token) {\n var weekday = config._locale.weekdaysParse(input, token, config._strict);\n // if we didn't get a weekday name, mark the date as invalid\n if (weekday != null) {\n week.d = weekday;\n } else {\n getParsingFlags(config).invalidWeekday = input;\n }\n });\n\n addWeekParseToken(['d', 'e', 'E'], function (input, week, config, token) {\n week[token] = toInt(input);\n });\n\n // HELPERS\n\n function parseWeekday(input, locale) {\n if (typeof input !== 'string') {\n return input;\n }\n\n if (!isNaN(input)) {\n return parseInt(input, 10);\n }\n\n input = locale.weekdaysParse(input);\n if (typeof input === 'number') {\n return input;\n }\n\n return null;\n }\n\n function parseIsoWeekday(input, locale) {\n if (typeof input === 'string') {\n return locale.weekdaysParse(input) % 7 || 7;\n }\n return isNaN(input) ? null : input;\n }\n\n // LOCALES\n function shiftWeekdays(ws, n) {\n return ws.slice(n, 7).concat(ws.slice(0, n));\n }\n\n var defaultLocaleWeekdays = 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n defaultLocaleWeekdaysShort = 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n defaultLocaleWeekdaysMin = 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n defaultWeekdaysRegex = matchWord,\n defaultWeekdaysShortRegex = matchWord,\n defaultWeekdaysMinRegex = matchWord;\n\n function localeWeekdays(m, format) {\n var weekdays = isArray(this._weekdays)\n ? this._weekdays\n : this._weekdays[\n m && m !== true && this._weekdays.isFormat.test(format)\n ? 'format'\n : 'standalone'\n ];\n return m === true\n ? shiftWeekdays(weekdays, this._week.dow)\n : m\n ? weekdays[m.day()]\n : weekdays;\n }\n\n function localeWeekdaysShort(m) {\n return m === true\n ? shiftWeekdays(this._weekdaysShort, this._week.dow)\n : m\n ? this._weekdaysShort[m.day()]\n : this._weekdaysShort;\n }\n\n function localeWeekdaysMin(m) {\n return m === true\n ? shiftWeekdays(this._weekdaysMin, this._week.dow)\n : m\n ? this._weekdaysMin[m.day()]\n : this._weekdaysMin;\n }\n\n function handleStrictParse$1(weekdayName, format, strict) {\n var i,\n ii,\n mom,\n llc = weekdayName.toLocaleLowerCase();\n if (!this._weekdaysParse) {\n this._weekdaysParse = [];\n this._shortWeekdaysParse = [];\n this._minWeekdaysParse = [];\n\n for (i = 0; i < 7; ++i) {\n mom = createUTC([2000, 1]).day(i);\n this._minWeekdaysParse[i] = this.weekdaysMin(\n mom,\n ''\n ).toLocaleLowerCase();\n this._shortWeekdaysParse[i] = this.weekdaysShort(\n mom,\n ''\n ).toLocaleLowerCase();\n this._weekdaysParse[i] = this.weekdays(mom, '').toLocaleLowerCase();\n }\n }\n\n if (strict) {\n if (format === 'dddd') {\n ii = indexOf.call(this._weekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else if (format === 'ddd') {\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n }\n } else {\n if (format === 'dddd') {\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else if (format === 'ddd') {\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._minWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n }\n }\n }\n\n function localeWeekdaysParse(weekdayName, format, strict) {\n var i, mom, regex;\n\n if (this._weekdaysParseExact) {\n return handleStrictParse$1.call(this, weekdayName, format, strict);\n }\n\n if (!this._weekdaysParse) {\n this._weekdaysParse = [];\n this._minWeekdaysParse = [];\n this._shortWeekdaysParse = [];\n this._fullWeekdaysParse = [];\n }\n\n for (i = 0; i < 7; i++) {\n // make the regex if we don't have it already\n\n mom = createUTC([2000, 1]).day(i);\n if (strict && !this._fullWeekdaysParse[i]) {\n this._fullWeekdaysParse[i] = new RegExp(\n '^' + this.weekdays(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n this._shortWeekdaysParse[i] = new RegExp(\n '^' + this.weekdaysShort(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n this._minWeekdaysParse[i] = new RegExp(\n '^' + this.weekdaysMin(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n }\n if (!this._weekdaysParse[i]) {\n regex =\n '^' +\n this.weekdays(mom, '') +\n '|^' +\n this.weekdaysShort(mom, '') +\n '|^' +\n this.weekdaysMin(mom, '');\n this._weekdaysParse[i] = new RegExp(regex.replace('.', ''), 'i');\n }\n // test the regex\n if (\n strict &&\n format === 'dddd' &&\n this._fullWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'ddd' &&\n this._shortWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'dd' &&\n this._minWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (!strict && this._weekdaysParse[i].test(weekdayName)) {\n return i;\n }\n }\n }\n\n // MOMENTS\n\n function getSetDayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n var day = this._isUTC ? this._d.getUTCDay() : this._d.getDay();\n if (input != null) {\n input = parseWeekday(input, this.localeData());\n return this.add(input - day, 'd');\n } else {\n return day;\n }\n }\n\n function getSetLocaleDayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n var weekday = (this.day() + 7 - this.localeData()._week.dow) % 7;\n return input == null ? weekday : this.add(input - weekday, 'd');\n }\n\n function getSetISODayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n\n // behaves the same as moment#day except\n // as a getter, returns 7 instead of 0 (1-7 range instead of 0-6)\n // as a setter, sunday should belong to the previous week.\n\n if (input != null) {\n var weekday = parseIsoWeekday(input, this.localeData());\n return this.day(this.day() % 7 ? weekday : weekday - 7);\n } else {\n return this.day() || 7;\n }\n }\n\n function weekdaysRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysStrictRegex;\n } else {\n return this._weekdaysRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n this._weekdaysRegex = defaultWeekdaysRegex;\n }\n return this._weekdaysStrictRegex && isStrict\n ? this._weekdaysStrictRegex\n : this._weekdaysRegex;\n }\n }\n\n function weekdaysShortRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysShortStrictRegex;\n } else {\n return this._weekdaysShortRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysShortRegex')) {\n this._weekdaysShortRegex = defaultWeekdaysShortRegex;\n }\n return this._weekdaysShortStrictRegex && isStrict\n ? this._weekdaysShortStrictRegex\n : this._weekdaysShortRegex;\n }\n }\n\n function weekdaysMinRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysMinStrictRegex;\n } else {\n return this._weekdaysMinRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysMinRegex')) {\n this._weekdaysMinRegex = defaultWeekdaysMinRegex;\n }\n return this._weekdaysMinStrictRegex && isStrict\n ? this._weekdaysMinStrictRegex\n : this._weekdaysMinRegex;\n }\n }\n\n function computeWeekdaysParse() {\n function cmpLenRev(a, b) {\n return b.length - a.length;\n }\n\n var minPieces = [],\n shortPieces = [],\n longPieces = [],\n mixedPieces = [],\n i,\n mom,\n minp,\n shortp,\n longp;\n for (i = 0; i < 7; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, 1]).day(i);\n minp = regexEscape(this.weekdaysMin(mom, ''));\n shortp = regexEscape(this.weekdaysShort(mom, ''));\n longp = regexEscape(this.weekdays(mom, ''));\n minPieces.push(minp);\n shortPieces.push(shortp);\n longPieces.push(longp);\n mixedPieces.push(minp);\n mixedPieces.push(shortp);\n mixedPieces.push(longp);\n }\n // Sorting makes sure if one weekday (or abbr) is a prefix of another it\n // will match the longer piece.\n minPieces.sort(cmpLenRev);\n shortPieces.sort(cmpLenRev);\n longPieces.sort(cmpLenRev);\n mixedPieces.sort(cmpLenRev);\n\n this._weekdaysRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._weekdaysShortRegex = this._weekdaysRegex;\n this._weekdaysMinRegex = this._weekdaysRegex;\n\n this._weekdaysStrictRegex = new RegExp(\n '^(' + longPieces.join('|') + ')',\n 'i'\n );\n this._weekdaysShortStrictRegex = new RegExp(\n '^(' + shortPieces.join('|') + ')',\n 'i'\n );\n this._weekdaysMinStrictRegex = new RegExp(\n '^(' + minPieces.join('|') + ')',\n 'i'\n );\n }\n\n // FORMATTING\n\n function hFormat() {\n return this.hours() % 12 || 12;\n }\n\n function kFormat() {\n return this.hours() || 24;\n }\n\n addFormatToken('H', ['HH', 2], 0, 'hour');\n addFormatToken('h', ['hh', 2], 0, hFormat);\n addFormatToken('k', ['kk', 2], 0, kFormat);\n\n addFormatToken('hmm', 0, 0, function () {\n return '' + hFormat.apply(this) + zeroFill(this.minutes(), 2);\n });\n\n addFormatToken('hmmss', 0, 0, function () {\n return (\n '' +\n hFormat.apply(this) +\n zeroFill(this.minutes(), 2) +\n zeroFill(this.seconds(), 2)\n );\n });\n\n addFormatToken('Hmm', 0, 0, function () {\n return '' + this.hours() + zeroFill(this.minutes(), 2);\n });\n\n addFormatToken('Hmmss', 0, 0, function () {\n return (\n '' +\n this.hours() +\n zeroFill(this.minutes(), 2) +\n zeroFill(this.seconds(), 2)\n );\n });\n\n function meridiem(token, lowercase) {\n addFormatToken(token, 0, 0, function () {\n return this.localeData().meridiem(\n this.hours(),\n this.minutes(),\n lowercase\n );\n });\n }\n\n meridiem('a', true);\n meridiem('A', false);\n\n // ALIASES\n\n addUnitAlias('hour', 'h');\n\n // PRIORITY\n addUnitPriority('hour', 13);\n\n // PARSING\n\n function matchMeridiem(isStrict, locale) {\n return locale._meridiemParse;\n }\n\n addRegexToken('a', matchMeridiem);\n addRegexToken('A', matchMeridiem);\n addRegexToken('H', match1to2);\n addRegexToken('h', match1to2);\n addRegexToken('k', match1to2);\n addRegexToken('HH', match1to2, match2);\n addRegexToken('hh', match1to2, match2);\n addRegexToken('kk', match1to2, match2);\n\n addRegexToken('hmm', match3to4);\n addRegexToken('hmmss', match5to6);\n addRegexToken('Hmm', match3to4);\n addRegexToken('Hmmss', match5to6);\n\n addParseToken(['H', 'HH'], HOUR);\n addParseToken(['k', 'kk'], function (input, array, config) {\n var kInput = toInt(input);\n array[HOUR] = kInput === 24 ? 0 : kInput;\n });\n addParseToken(['a', 'A'], function (input, array, config) {\n config._isPm = config._locale.isPM(input);\n config._meridiem = input;\n });\n addParseToken(['h', 'hh'], function (input, array, config) {\n array[HOUR] = toInt(input);\n getParsingFlags(config).bigHour = true;\n });\n addParseToken('hmm', function (input, array, config) {\n var pos = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos));\n array[MINUTE] = toInt(input.substr(pos));\n getParsingFlags(config).bigHour = true;\n });\n addParseToken('hmmss', function (input, array, config) {\n var pos1 = input.length - 4,\n pos2 = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos1));\n array[MINUTE] = toInt(input.substr(pos1, 2));\n array[SECOND] = toInt(input.substr(pos2));\n getParsingFlags(config).bigHour = true;\n });\n addParseToken('Hmm', function (input, array, config) {\n var pos = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos));\n array[MINUTE] = toInt(input.substr(pos));\n });\n addParseToken('Hmmss', function (input, array, config) {\n var pos1 = input.length - 4,\n pos2 = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos1));\n array[MINUTE] = toInt(input.substr(pos1, 2));\n array[SECOND] = toInt(input.substr(pos2));\n });\n\n // LOCALES\n\n function localeIsPM(input) {\n // IE8 Quirks Mode & IE7 Standards Mode do not allow accessing strings like arrays\n // Using charAt should be more compatible.\n return (input + '').toLowerCase().charAt(0) === 'p';\n }\n\n var defaultLocaleMeridiemParse = /[ap]\\.?m?\\.?/i,\n // Setting the hour should keep the time, because the user explicitly\n // specified which hour they want. So trying to maintain the same hour (in\n // a new timezone) makes sense. Adding/subtracting hours does not follow\n // this rule.\n getSetHour = makeGetSet('Hours', true);\n\n function localeMeridiem(hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'pm' : 'PM';\n } else {\n return isLower ? 'am' : 'AM';\n }\n }\n\n var baseConfig = {\n calendar: defaultCalendar,\n longDateFormat: defaultLongDateFormat,\n invalidDate: defaultInvalidDate,\n ordinal: defaultOrdinal,\n dayOfMonthOrdinalParse: defaultDayOfMonthOrdinalParse,\n relativeTime: defaultRelativeTime,\n\n months: defaultLocaleMonths,\n monthsShort: defaultLocaleMonthsShort,\n\n week: defaultLocaleWeek,\n\n weekdays: defaultLocaleWeekdays,\n weekdaysMin: defaultLocaleWeekdaysMin,\n weekdaysShort: defaultLocaleWeekdaysShort,\n\n meridiemParse: defaultLocaleMeridiemParse,\n };\n\n // internal storage for locale config files\n var locales = {},\n localeFamilies = {},\n globalLocale;\n\n function commonPrefix(arr1, arr2) {\n var i,\n minl = Math.min(arr1.length, arr2.length);\n for (i = 0; i < minl; i += 1) {\n if (arr1[i] !== arr2[i]) {\n return i;\n }\n }\n return minl;\n }\n\n function normalizeLocale(key) {\n return key ? key.toLowerCase().replace('_', '-') : key;\n }\n\n // pick the locale from the array\n // try ['en-au', 'en-gb'] as 'en-au', 'en-gb', 'en', as in move through the list trying each\n // substring from most specific to least, but move to the next array item if it's a more specific variant than the current root\n function chooseLocale(names) {\n var i = 0,\n j,\n next,\n locale,\n split;\n\n while (i < names.length) {\n split = normalizeLocale(names[i]).split('-');\n j = split.length;\n next = normalizeLocale(names[i + 1]);\n next = next ? next.split('-') : null;\n while (j > 0) {\n locale = loadLocale(split.slice(0, j).join('-'));\n if (locale) {\n return locale;\n }\n if (\n next &&\n next.length >= j &&\n commonPrefix(split, next) >= j - 1\n ) {\n //the next array item is better than a shallower substring of this one\n break;\n }\n j--;\n }\n i++;\n }\n return globalLocale;\n }\n\n function loadLocale(name) {\n var oldLocale = null,\n aliasedRequire;\n // TODO: Find a better way to register and load all the locales in Node\n if (\n locales[name] === undefined &&\n typeof module !== 'undefined' &&\n module &&\n module.exports\n ) {\n try {\n oldLocale = globalLocale._abbr;\n aliasedRequire = require;\n aliasedRequire('./locale/' + name);\n getSetGlobalLocale(oldLocale);\n } catch (e) {\n // mark as not found to avoid repeating expensive file require call causing high CPU\n // when trying to find en-US, en_US, en-us for every format call\n locales[name] = null; // null means not found\n }\n }\n return locales[name];\n }\n\n // This function will load locale and then set the global locale. If\n // no arguments are passed in, it will simply return the current global\n // locale key.\n function getSetGlobalLocale(key, values) {\n var data;\n if (key) {\n if (isUndefined(values)) {\n data = getLocale(key);\n } else {\n data = defineLocale(key, values);\n }\n\n if (data) {\n // moment.duration._locale = moment._locale = data;\n globalLocale = data;\n } else {\n if (typeof console !== 'undefined' && console.warn) {\n //warn user if arguments are passed but the locale could not be set\n console.warn(\n 'Locale ' + key + ' not found. Did you forget to load it?'\n );\n }\n }\n }\n\n return globalLocale._abbr;\n }\n\n function defineLocale(name, config) {\n if (config !== null) {\n var locale,\n parentConfig = baseConfig;\n config.abbr = name;\n if (locales[name] != null) {\n deprecateSimple(\n 'defineLocaleOverride',\n 'use moment.updateLocale(localeName, config) to change ' +\n 'an existing locale. moment.defineLocale(localeName, ' +\n 'config) should only be used for creating a new locale ' +\n 'See http://momentjs.com/guides/#/warnings/define-locale/ for more info.'\n );\n parentConfig = locales[name]._config;\n } else if (config.parentLocale != null) {\n if (locales[config.parentLocale] != null) {\n parentConfig = locales[config.parentLocale]._config;\n } else {\n locale = loadLocale(config.parentLocale);\n if (locale != null) {\n parentConfig = locale._config;\n } else {\n if (!localeFamilies[config.parentLocale]) {\n localeFamilies[config.parentLocale] = [];\n }\n localeFamilies[config.parentLocale].push({\n name: name,\n config: config,\n });\n return null;\n }\n }\n }\n locales[name] = new Locale(mergeConfigs(parentConfig, config));\n\n if (localeFamilies[name]) {\n localeFamilies[name].forEach(function (x) {\n defineLocale(x.name, x.config);\n });\n }\n\n // backwards compat for now: also set the locale\n // make sure we set the locale AFTER all child locales have been\n // created, so we won't end up with the child locale set.\n getSetGlobalLocale(name);\n\n return locales[name];\n } else {\n // useful for testing\n delete locales[name];\n return null;\n }\n }\n\n function updateLocale(name, config) {\n if (config != null) {\n var locale,\n tmpLocale,\n parentConfig = baseConfig;\n\n if (locales[name] != null && locales[name].parentLocale != null) {\n // Update existing child locale in-place to avoid memory-leaks\n locales[name].set(mergeConfigs(locales[name]._config, config));\n } else {\n // MERGE\n tmpLocale = loadLocale(name);\n if (tmpLocale != null) {\n parentConfig = tmpLocale._config;\n }\n config = mergeConfigs(parentConfig, config);\n if (tmpLocale == null) {\n // updateLocale is called for creating a new locale\n // Set abbr so it will have a name (getters return\n // undefined otherwise).\n config.abbr = name;\n }\n locale = new Locale(config);\n locale.parentLocale = locales[name];\n locales[name] = locale;\n }\n\n // backwards compat for now: also set the locale\n getSetGlobalLocale(name);\n } else {\n // pass null for config to unupdate, useful for tests\n if (locales[name] != null) {\n if (locales[name].parentLocale != null) {\n locales[name] = locales[name].parentLocale;\n if (name === getSetGlobalLocale()) {\n getSetGlobalLocale(name);\n }\n } else if (locales[name] != null) {\n delete locales[name];\n }\n }\n }\n return locales[name];\n }\n\n // returns locale data\n function getLocale(key) {\n var locale;\n\n if (key && key._locale && key._locale._abbr) {\n key = key._locale._abbr;\n }\n\n if (!key) {\n return globalLocale;\n }\n\n if (!isArray(key)) {\n //short-circuit everything else\n locale = loadLocale(key);\n if (locale) {\n return locale;\n }\n key = [key];\n }\n\n return chooseLocale(key);\n }\n\n function listLocales() {\n return keys(locales);\n }\n\n function checkOverflow(m) {\n var overflow,\n a = m._a;\n\n if (a && getParsingFlags(m).overflow === -2) {\n overflow =\n a[MONTH] < 0 || a[MONTH] > 11\n ? MONTH\n : a[DATE] < 1 || a[DATE] > daysInMonth(a[YEAR], a[MONTH])\n ? DATE\n : a[HOUR] < 0 ||\n a[HOUR] > 24 ||\n (a[HOUR] === 24 &&\n (a[MINUTE] !== 0 ||\n a[SECOND] !== 0 ||\n a[MILLISECOND] !== 0))\n ? HOUR\n : a[MINUTE] < 0 || a[MINUTE] > 59\n ? MINUTE\n : a[SECOND] < 0 || a[SECOND] > 59\n ? SECOND\n : a[MILLISECOND] < 0 || a[MILLISECOND] > 999\n ? MILLISECOND\n : -1;\n\n if (\n getParsingFlags(m)._overflowDayOfYear &&\n (overflow < YEAR || overflow > DATE)\n ) {\n overflow = DATE;\n }\n if (getParsingFlags(m)._overflowWeeks && overflow === -1) {\n overflow = WEEK;\n }\n if (getParsingFlags(m)._overflowWeekday && overflow === -1) {\n overflow = WEEKDAY;\n }\n\n getParsingFlags(m).overflow = overflow;\n }\n\n return m;\n }\n\n // iso 8601 regex\n // 0000-00-00 0000-W00 or 0000-W00-0 + T + 00 or 00:00 or 00:00:00 or 00:00:00.000 + +00:00 or +0000 or +00)\n var extendedIsoRegex = /^\\s*((?:[+-]\\d{6}|\\d{4})-(?:\\d\\d-\\d\\d|W\\d\\d-\\d|W\\d\\d|\\d\\d\\d|\\d\\d))(?:(T| )(\\d\\d(?::\\d\\d(?::\\d\\d(?:[.,]\\d+)?)?)?)([+-]\\d\\d(?::?\\d\\d)?|\\s*Z)?)?$/,\n basicIsoRegex = /^\\s*((?:[+-]\\d{6}|\\d{4})(?:\\d\\d\\d\\d|W\\d\\d\\d|W\\d\\d|\\d\\d\\d|\\d\\d|))(?:(T| )(\\d\\d(?:\\d\\d(?:\\d\\d(?:[.,]\\d+)?)?)?)([+-]\\d\\d(?::?\\d\\d)?|\\s*Z)?)?$/,\n tzRegex = /Z|[+-]\\d\\d(?::?\\d\\d)?/,\n isoDates = [\n ['YYYYYY-MM-DD', /[+-]\\d{6}-\\d\\d-\\d\\d/],\n ['YYYY-MM-DD', /\\d{4}-\\d\\d-\\d\\d/],\n ['GGGG-[W]WW-E', /\\d{4}-W\\d\\d-\\d/],\n ['GGGG-[W]WW', /\\d{4}-W\\d\\d/, false],\n ['YYYY-DDD', /\\d{4}-\\d{3}/],\n ['YYYY-MM', /\\d{4}-\\d\\d/, false],\n ['YYYYYYMMDD', /[+-]\\d{10}/],\n ['YYYYMMDD', /\\d{8}/],\n ['GGGG[W]WWE', /\\d{4}W\\d{3}/],\n ['GGGG[W]WW', /\\d{4}W\\d{2}/, false],\n ['YYYYDDD', /\\d{7}/],\n ['YYYYMM', /\\d{6}/, false],\n ['YYYY', /\\d{4}/, false],\n ],\n // iso time formats and regexes\n isoTimes = [\n ['HH:mm:ss.SSSS', /\\d\\d:\\d\\d:\\d\\d\\.\\d+/],\n ['HH:mm:ss,SSSS', /\\d\\d:\\d\\d:\\d\\d,\\d+/],\n ['HH:mm:ss', /\\d\\d:\\d\\d:\\d\\d/],\n ['HH:mm', /\\d\\d:\\d\\d/],\n ['HHmmss.SSSS', /\\d\\d\\d\\d\\d\\d\\.\\d+/],\n ['HHmmss,SSSS', /\\d\\d\\d\\d\\d\\d,\\d+/],\n ['HHmmss', /\\d\\d\\d\\d\\d\\d/],\n ['HHmm', /\\d\\d\\d\\d/],\n ['HH', /\\d\\d/],\n ],\n aspNetJsonRegex = /^\\/?Date\\((-?\\d+)/i,\n // RFC 2822 regex: For details see https://tools.ietf.org/html/rfc2822#section-3.3\n rfc2822 = /^(?:(Mon|Tue|Wed|Thu|Fri|Sat|Sun),?\\s)?(\\d{1,2})\\s(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)\\s(\\d{2,4})\\s(\\d\\d):(\\d\\d)(?::(\\d\\d))?\\s(?:(UT|GMT|[ECMP][SD]T)|([Zz])|([+-]\\d{4}))$/,\n obsOffsets = {\n UT: 0,\n GMT: 0,\n EDT: -4 * 60,\n EST: -5 * 60,\n CDT: -5 * 60,\n CST: -6 * 60,\n MDT: -6 * 60,\n MST: -7 * 60,\n PDT: -7 * 60,\n PST: -8 * 60,\n };\n\n // date from iso format\n function configFromISO(config) {\n var i,\n l,\n string = config._i,\n match = extendedIsoRegex.exec(string) || basicIsoRegex.exec(string),\n allowTime,\n dateFormat,\n timeFormat,\n tzFormat;\n\n if (match) {\n getParsingFlags(config).iso = true;\n\n for (i = 0, l = isoDates.length; i < l; i++) {\n if (isoDates[i][1].exec(match[1])) {\n dateFormat = isoDates[i][0];\n allowTime = isoDates[i][2] !== false;\n break;\n }\n }\n if (dateFormat == null) {\n config._isValid = false;\n return;\n }\n if (match[3]) {\n for (i = 0, l = isoTimes.length; i < l; i++) {\n if (isoTimes[i][1].exec(match[3])) {\n // match[2] should be 'T' or space\n timeFormat = (match[2] || ' ') + isoTimes[i][0];\n break;\n }\n }\n if (timeFormat == null) {\n config._isValid = false;\n return;\n }\n }\n if (!allowTime && timeFormat != null) {\n config._isValid = false;\n return;\n }\n if (match[4]) {\n if (tzRegex.exec(match[4])) {\n tzFormat = 'Z';\n } else {\n config._isValid = false;\n return;\n }\n }\n config._f = dateFormat + (timeFormat || '') + (tzFormat || '');\n configFromStringAndFormat(config);\n } else {\n config._isValid = false;\n }\n }\n\n function extractFromRFC2822Strings(\n yearStr,\n monthStr,\n dayStr,\n hourStr,\n minuteStr,\n secondStr\n ) {\n var result = [\n untruncateYear(yearStr),\n defaultLocaleMonthsShort.indexOf(monthStr),\n parseInt(dayStr, 10),\n parseInt(hourStr, 10),\n parseInt(minuteStr, 10),\n ];\n\n if (secondStr) {\n result.push(parseInt(secondStr, 10));\n }\n\n return result;\n }\n\n function untruncateYear(yearStr) {\n var year = parseInt(yearStr, 10);\n if (year <= 49) {\n return 2000 + year;\n } else if (year <= 999) {\n return 1900 + year;\n }\n return year;\n }\n\n function preprocessRFC2822(s) {\n // Remove comments and folding whitespace and replace multiple-spaces with a single space\n return s\n .replace(/\\([^)]*\\)|[\\n\\t]/g, ' ')\n .replace(/(\\s\\s+)/g, ' ')\n .replace(/^\\s\\s*/, '')\n .replace(/\\s\\s*$/, '');\n }\n\n function checkWeekday(weekdayStr, parsedInput, config) {\n if (weekdayStr) {\n // TODO: Replace the vanilla JS Date object with an independent day-of-week check.\n var weekdayProvided = defaultLocaleWeekdaysShort.indexOf(weekdayStr),\n weekdayActual = new Date(\n parsedInput[0],\n parsedInput[1],\n parsedInput[2]\n ).getDay();\n if (weekdayProvided !== weekdayActual) {\n getParsingFlags(config).weekdayMismatch = true;\n config._isValid = false;\n return false;\n }\n }\n return true;\n }\n\n function calculateOffset(obsOffset, militaryOffset, numOffset) {\n if (obsOffset) {\n return obsOffsets[obsOffset];\n } else if (militaryOffset) {\n // the only allowed military tz is Z\n return 0;\n } else {\n var hm = parseInt(numOffset, 10),\n m = hm % 100,\n h = (hm - m) / 100;\n return h * 60 + m;\n }\n }\n\n // date and time from ref 2822 format\n function configFromRFC2822(config) {\n var match = rfc2822.exec(preprocessRFC2822(config._i)),\n parsedArray;\n if (match) {\n parsedArray = extractFromRFC2822Strings(\n match[4],\n match[3],\n match[2],\n match[5],\n match[6],\n match[7]\n );\n if (!checkWeekday(match[1], parsedArray, config)) {\n return;\n }\n\n config._a = parsedArray;\n config._tzm = calculateOffset(match[8], match[9], match[10]);\n\n config._d = createUTCDate.apply(null, config._a);\n config._d.setUTCMinutes(config._d.getUTCMinutes() - config._tzm);\n\n getParsingFlags(config).rfc2822 = true;\n } else {\n config._isValid = false;\n }\n }\n\n // date from 1) ASP.NET, 2) ISO, 3) RFC 2822 formats, or 4) optional fallback if parsing isn't strict\n function configFromString(config) {\n var matched = aspNetJsonRegex.exec(config._i);\n if (matched !== null) {\n config._d = new Date(+matched[1]);\n return;\n }\n\n configFromISO(config);\n if (config._isValid === false) {\n delete config._isValid;\n } else {\n return;\n }\n\n configFromRFC2822(config);\n if (config._isValid === false) {\n delete config._isValid;\n } else {\n return;\n }\n\n if (config._strict) {\n config._isValid = false;\n } else {\n // Final attempt, use Input Fallback\n hooks.createFromInputFallback(config);\n }\n }\n\n hooks.createFromInputFallback = deprecate(\n 'value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), ' +\n 'which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are ' +\n 'discouraged. Please refer to http://momentjs.com/guides/#/warnings/js-date/ for more info.',\n function (config) {\n config._d = new Date(config._i + (config._useUTC ? ' UTC' : ''));\n }\n );\n\n // Pick the first defined of two or three arguments.\n function defaults(a, b, c) {\n if (a != null) {\n return a;\n }\n if (b != null) {\n return b;\n }\n return c;\n }\n\n function currentDateArray(config) {\n // hooks is actually the exported moment object\n var nowValue = new Date(hooks.now());\n if (config._useUTC) {\n return [\n nowValue.getUTCFullYear(),\n nowValue.getUTCMonth(),\n nowValue.getUTCDate(),\n ];\n }\n return [nowValue.getFullYear(), nowValue.getMonth(), nowValue.getDate()];\n }\n\n // convert an array to a date.\n // the array should mirror the parameters below\n // note: all values past the year are optional and will default to the lowest possible value.\n // [year, month, day , hour, minute, second, millisecond]\n function configFromArray(config) {\n var i,\n date,\n input = [],\n currentDate,\n expectedWeekday,\n yearToUse;\n\n if (config._d) {\n return;\n }\n\n currentDate = currentDateArray(config);\n\n //compute day of the year from weeks and weekdays\n if (config._w && config._a[DATE] == null && config._a[MONTH] == null) {\n dayOfYearFromWeekInfo(config);\n }\n\n //if the day of the year is set, figure out what it is\n if (config._dayOfYear != null) {\n yearToUse = defaults(config._a[YEAR], currentDate[YEAR]);\n\n if (\n config._dayOfYear > daysInYear(yearToUse) ||\n config._dayOfYear === 0\n ) {\n getParsingFlags(config)._overflowDayOfYear = true;\n }\n\n date = createUTCDate(yearToUse, 0, config._dayOfYear);\n config._a[MONTH] = date.getUTCMonth();\n config._a[DATE] = date.getUTCDate();\n }\n\n // Default to current date.\n // * if no year, month, day of month are given, default to today\n // * if day of month is given, default month and year\n // * if month is given, default only year\n // * if year is given, don't default anything\n for (i = 0; i < 3 && config._a[i] == null; ++i) {\n config._a[i] = input[i] = currentDate[i];\n }\n\n // Zero out whatever was not defaulted, including time\n for (; i < 7; i++) {\n config._a[i] = input[i] =\n config._a[i] == null ? (i === 2 ? 1 : 0) : config._a[i];\n }\n\n // Check for 24:00:00.000\n if (\n config._a[HOUR] === 24 &&\n config._a[MINUTE] === 0 &&\n config._a[SECOND] === 0 &&\n config._a[MILLISECOND] === 0\n ) {\n config._nextDay = true;\n config._a[HOUR] = 0;\n }\n\n config._d = (config._useUTC ? createUTCDate : createDate).apply(\n null,\n input\n );\n expectedWeekday = config._useUTC\n ? config._d.getUTCDay()\n : config._d.getDay();\n\n // Apply timezone offset from input. The actual utcOffset can be changed\n // with parseZone.\n if (config._tzm != null) {\n config._d.setUTCMinutes(config._d.getUTCMinutes() - config._tzm);\n }\n\n if (config._nextDay) {\n config._a[HOUR] = 24;\n }\n\n // check for mismatching day of week\n if (\n config._w &&\n typeof config._w.d !== 'undefined' &&\n config._w.d !== expectedWeekday\n ) {\n getParsingFlags(config).weekdayMismatch = true;\n }\n }\n\n function dayOfYearFromWeekInfo(config) {\n var w, weekYear, week, weekday, dow, doy, temp, weekdayOverflow, curWeek;\n\n w = config._w;\n if (w.GG != null || w.W != null || w.E != null) {\n dow = 1;\n doy = 4;\n\n // TODO: We need to take the current isoWeekYear, but that depends on\n // how we interpret now (local, utc, fixed offset). So create\n // a now version of current config (take local/utc/offset flags, and\n // create now).\n weekYear = defaults(\n w.GG,\n config._a[YEAR],\n weekOfYear(createLocal(), 1, 4).year\n );\n week = defaults(w.W, 1);\n weekday = defaults(w.E, 1);\n if (weekday < 1 || weekday > 7) {\n weekdayOverflow = true;\n }\n } else {\n dow = config._locale._week.dow;\n doy = config._locale._week.doy;\n\n curWeek = weekOfYear(createLocal(), dow, doy);\n\n weekYear = defaults(w.gg, config._a[YEAR], curWeek.year);\n\n // Default to current week.\n week = defaults(w.w, curWeek.week);\n\n if (w.d != null) {\n // weekday -- low day numbers are considered next week\n weekday = w.d;\n if (weekday < 0 || weekday > 6) {\n weekdayOverflow = true;\n }\n } else if (w.e != null) {\n // local weekday -- counting starts from beginning of week\n weekday = w.e + dow;\n if (w.e < 0 || w.e > 6) {\n weekdayOverflow = true;\n }\n } else {\n // default to beginning of week\n weekday = dow;\n }\n }\n if (week < 1 || week > weeksInYear(weekYear, dow, doy)) {\n getParsingFlags(config)._overflowWeeks = true;\n } else if (weekdayOverflow != null) {\n getParsingFlags(config)._overflowWeekday = true;\n } else {\n temp = dayOfYearFromWeeks(weekYear, week, weekday, dow, doy);\n config._a[YEAR] = temp.year;\n config._dayOfYear = temp.dayOfYear;\n }\n }\n\n // constant that refers to the ISO standard\n hooks.ISO_8601 = function () {};\n\n // constant that refers to the RFC 2822 form\n hooks.RFC_2822 = function () {};\n\n // date from string and format string\n function configFromStringAndFormat(config) {\n // TODO: Move this to another part of the creation flow to prevent circular deps\n if (config._f === hooks.ISO_8601) {\n configFromISO(config);\n return;\n }\n if (config._f === hooks.RFC_2822) {\n configFromRFC2822(config);\n return;\n }\n config._a = [];\n getParsingFlags(config).empty = true;\n\n // This array is used to make a Date, either with `new Date` or `Date.UTC`\n var string = '' + config._i,\n i,\n parsedInput,\n tokens,\n token,\n skipped,\n stringLength = string.length,\n totalParsedInputLength = 0,\n era;\n\n tokens =\n expandFormat(config._f, config._locale).match(formattingTokens) || [];\n\n for (i = 0; i < tokens.length; i++) {\n token = tokens[i];\n parsedInput = (string.match(getParseRegexForToken(token, config)) ||\n [])[0];\n if (parsedInput) {\n skipped = string.substr(0, string.indexOf(parsedInput));\n if (skipped.length > 0) {\n getParsingFlags(config).unusedInput.push(skipped);\n }\n string = string.slice(\n string.indexOf(parsedInput) + parsedInput.length\n );\n totalParsedInputLength += parsedInput.length;\n }\n // don't parse if it's not a known token\n if (formatTokenFunctions[token]) {\n if (parsedInput) {\n getParsingFlags(config).empty = false;\n } else {\n getParsingFlags(config).unusedTokens.push(token);\n }\n addTimeToArrayFromToken(token, parsedInput, config);\n } else if (config._strict && !parsedInput) {\n getParsingFlags(config).unusedTokens.push(token);\n }\n }\n\n // add remaining unparsed input length to the string\n getParsingFlags(config).charsLeftOver =\n stringLength - totalParsedInputLength;\n if (string.length > 0) {\n getParsingFlags(config).unusedInput.push(string);\n }\n\n // clear _12h flag if hour is <= 12\n if (\n config._a[HOUR] <= 12 &&\n getParsingFlags(config).bigHour === true &&\n config._a[HOUR] > 0\n ) {\n getParsingFlags(config).bigHour = undefined;\n }\n\n getParsingFlags(config).parsedDateParts = config._a.slice(0);\n getParsingFlags(config).meridiem = config._meridiem;\n // handle meridiem\n config._a[HOUR] = meridiemFixWrap(\n config._locale,\n config._a[HOUR],\n config._meridiem\n );\n\n // handle era\n era = getParsingFlags(config).era;\n if (era !== null) {\n config._a[YEAR] = config._locale.erasConvertYear(era, config._a[YEAR]);\n }\n\n configFromArray(config);\n checkOverflow(config);\n }\n\n function meridiemFixWrap(locale, hour, meridiem) {\n var isPm;\n\n if (meridiem == null) {\n // nothing to do\n return hour;\n }\n if (locale.meridiemHour != null) {\n return locale.meridiemHour(hour, meridiem);\n } else if (locale.isPM != null) {\n // Fallback\n isPm = locale.isPM(meridiem);\n if (isPm && hour < 12) {\n hour += 12;\n }\n if (!isPm && hour === 12) {\n hour = 0;\n }\n return hour;\n } else {\n // this is not supposed to happen\n return hour;\n }\n }\n\n // date from string and array of format strings\n function configFromStringAndArray(config) {\n var tempConfig,\n bestMoment,\n scoreToBeat,\n i,\n currentScore,\n validFormatFound,\n bestFormatIsValid = false;\n\n if (config._f.length === 0) {\n getParsingFlags(config).invalidFormat = true;\n config._d = new Date(NaN);\n return;\n }\n\n for (i = 0; i < config._f.length; i++) {\n currentScore = 0;\n validFormatFound = false;\n tempConfig = copyConfig({}, config);\n if (config._useUTC != null) {\n tempConfig._useUTC = config._useUTC;\n }\n tempConfig._f = config._f[i];\n configFromStringAndFormat(tempConfig);\n\n if (isValid(tempConfig)) {\n validFormatFound = true;\n }\n\n // if there is any input that was not parsed add a penalty for that format\n currentScore += getParsingFlags(tempConfig).charsLeftOver;\n\n //or tokens\n currentScore += getParsingFlags(tempConfig).unusedTokens.length * 10;\n\n getParsingFlags(tempConfig).score = currentScore;\n\n if (!bestFormatIsValid) {\n if (\n scoreToBeat == null ||\n currentScore < scoreToBeat ||\n validFormatFound\n ) {\n scoreToBeat = currentScore;\n bestMoment = tempConfig;\n if (validFormatFound) {\n bestFormatIsValid = true;\n }\n }\n } else {\n if (currentScore < scoreToBeat) {\n scoreToBeat = currentScore;\n bestMoment = tempConfig;\n }\n }\n }\n\n extend(config, bestMoment || tempConfig);\n }\n\n function configFromObject(config) {\n if (config._d) {\n return;\n }\n\n var i = normalizeObjectUnits(config._i),\n dayOrDate = i.day === undefined ? i.date : i.day;\n config._a = map(\n [i.year, i.month, dayOrDate, i.hour, i.minute, i.second, i.millisecond],\n function (obj) {\n return obj && parseInt(obj, 10);\n }\n );\n\n configFromArray(config);\n }\n\n function createFromConfig(config) {\n var res = new Moment(checkOverflow(prepareConfig(config)));\n if (res._nextDay) {\n // Adding is smart enough around DST\n res.add(1, 'd');\n res._nextDay = undefined;\n }\n\n return res;\n }\n\n function prepareConfig(config) {\n var input = config._i,\n format = config._f;\n\n config._locale = config._locale || getLocale(config._l);\n\n if (input === null || (format === undefined && input === '')) {\n return createInvalid({ nullInput: true });\n }\n\n if (typeof input === 'string') {\n config._i = input = config._locale.preparse(input);\n }\n\n if (isMoment(input)) {\n return new Moment(checkOverflow(input));\n } else if (isDate(input)) {\n config._d = input;\n } else if (isArray(format)) {\n configFromStringAndArray(config);\n } else if (format) {\n configFromStringAndFormat(config);\n } else {\n configFromInput(config);\n }\n\n if (!isValid(config)) {\n config._d = null;\n }\n\n return config;\n }\n\n function configFromInput(config) {\n var input = config._i;\n if (isUndefined(input)) {\n config._d = new Date(hooks.now());\n } else if (isDate(input)) {\n config._d = new Date(input.valueOf());\n } else if (typeof input === 'string') {\n configFromString(config);\n } else if (isArray(input)) {\n config._a = map(input.slice(0), function (obj) {\n return parseInt(obj, 10);\n });\n configFromArray(config);\n } else if (isObject(input)) {\n configFromObject(config);\n } else if (isNumber(input)) {\n // from milliseconds\n config._d = new Date(input);\n } else {\n hooks.createFromInputFallback(config);\n }\n }\n\n function createLocalOrUTC(input, format, locale, strict, isUTC) {\n var c = {};\n\n if (format === true || format === false) {\n strict = format;\n format = undefined;\n }\n\n if (locale === true || locale === false) {\n strict = locale;\n locale = undefined;\n }\n\n if (\n (isObject(input) && isObjectEmpty(input)) ||\n (isArray(input) && input.length === 0)\n ) {\n input = undefined;\n }\n // object construction must be done this way.\n // https://github.com/moment/moment/issues/1423\n c._isAMomentObject = true;\n c._useUTC = c._isUTC = isUTC;\n c._l = locale;\n c._i = input;\n c._f = format;\n c._strict = strict;\n\n return createFromConfig(c);\n }\n\n function createLocal(input, format, locale, strict) {\n return createLocalOrUTC(input, format, locale, strict, false);\n }\n\n var prototypeMin = deprecate(\n 'moment().min is deprecated, use moment.max instead. http://momentjs.com/guides/#/warnings/min-max/',\n function () {\n var other = createLocal.apply(null, arguments);\n if (this.isValid() && other.isValid()) {\n return other < this ? this : other;\n } else {\n return createInvalid();\n }\n }\n ),\n prototypeMax = deprecate(\n 'moment().max is deprecated, use moment.min instead. http://momentjs.com/guides/#/warnings/min-max/',\n function () {\n var other = createLocal.apply(null, arguments);\n if (this.isValid() && other.isValid()) {\n return other > this ? this : other;\n } else {\n return createInvalid();\n }\n }\n );\n\n // Pick a moment m from moments so that m[fn](other) is true for all\n // other. This relies on the function fn to be transitive.\n //\n // moments should either be an array of moment objects or an array, whose\n // first element is an array of moment objects.\n function pickBy(fn, moments) {\n var res, i;\n if (moments.length === 1 && isArray(moments[0])) {\n moments = moments[0];\n }\n if (!moments.length) {\n return createLocal();\n }\n res = moments[0];\n for (i = 1; i < moments.length; ++i) {\n if (!moments[i].isValid() || moments[i][fn](res)) {\n res = moments[i];\n }\n }\n return res;\n }\n\n // TODO: Use [].sort instead?\n function min() {\n var args = [].slice.call(arguments, 0);\n\n return pickBy('isBefore', args);\n }\n\n function max() {\n var args = [].slice.call(arguments, 0);\n\n return pickBy('isAfter', args);\n }\n\n var now = function () {\n return Date.now ? Date.now() : +new Date();\n };\n\n var ordering = [\n 'year',\n 'quarter',\n 'month',\n 'week',\n 'day',\n 'hour',\n 'minute',\n 'second',\n 'millisecond',\n ];\n\n function isDurationValid(m) {\n var key,\n unitHasDecimal = false,\n i;\n for (key in m) {\n if (\n hasOwnProp(m, key) &&\n !(\n indexOf.call(ordering, key) !== -1 &&\n (m[key] == null || !isNaN(m[key]))\n )\n ) {\n return false;\n }\n }\n\n for (i = 0; i < ordering.length; ++i) {\n if (m[ordering[i]]) {\n if (unitHasDecimal) {\n return false; // only allow non-integers for smallest unit\n }\n if (parseFloat(m[ordering[i]]) !== toInt(m[ordering[i]])) {\n unitHasDecimal = true;\n }\n }\n }\n\n return true;\n }\n\n function isValid$1() {\n return this._isValid;\n }\n\n function createInvalid$1() {\n return createDuration(NaN);\n }\n\n function Duration(duration) {\n var normalizedInput = normalizeObjectUnits(duration),\n years = normalizedInput.year || 0,\n quarters = normalizedInput.quarter || 0,\n months = normalizedInput.month || 0,\n weeks = normalizedInput.week || normalizedInput.isoWeek || 0,\n days = normalizedInput.day || 0,\n hours = normalizedInput.hour || 0,\n minutes = normalizedInput.minute || 0,\n seconds = normalizedInput.second || 0,\n milliseconds = normalizedInput.millisecond || 0;\n\n this._isValid = isDurationValid(normalizedInput);\n\n // representation for dateAddRemove\n this._milliseconds =\n +milliseconds +\n seconds * 1e3 + // 1000\n minutes * 6e4 + // 1000 * 60\n hours * 1000 * 60 * 60; //using 1000 * 60 * 60 instead of 36e5 to avoid floating point rounding errors https://github.com/moment/moment/issues/2978\n // Because of dateAddRemove treats 24 hours as different from a\n // day when working around DST, we need to store them separately\n this._days = +days + weeks * 7;\n // It is impossible to translate months into days without knowing\n // which months you are are talking about, so we have to store\n // it separately.\n this._months = +months + quarters * 3 + years * 12;\n\n this._data = {};\n\n this._locale = getLocale();\n\n this._bubble();\n }\n\n function isDuration(obj) {\n return obj instanceof Duration;\n }\n\n function absRound(number) {\n if (number < 0) {\n return Math.round(-1 * number) * -1;\n } else {\n return Math.round(number);\n }\n }\n\n // compare two arrays, return the number of differences\n function compareArrays(array1, array2, dontConvert) {\n var len = Math.min(array1.length, array2.length),\n lengthDiff = Math.abs(array1.length - array2.length),\n diffs = 0,\n i;\n for (i = 0; i < len; i++) {\n if (\n (dontConvert && array1[i] !== array2[i]) ||\n (!dontConvert && toInt(array1[i]) !== toInt(array2[i]))\n ) {\n diffs++;\n }\n }\n return diffs + lengthDiff;\n }\n\n // FORMATTING\n\n function offset(token, separator) {\n addFormatToken(token, 0, 0, function () {\n var offset = this.utcOffset(),\n sign = '+';\n if (offset < 0) {\n offset = -offset;\n sign = '-';\n }\n return (\n sign +\n zeroFill(~~(offset / 60), 2) +\n separator +\n zeroFill(~~offset % 60, 2)\n );\n });\n }\n\n offset('Z', ':');\n offset('ZZ', '');\n\n // PARSING\n\n addRegexToken('Z', matchShortOffset);\n addRegexToken('ZZ', matchShortOffset);\n addParseToken(['Z', 'ZZ'], function (input, array, config) {\n config._useUTC = true;\n config._tzm = offsetFromString(matchShortOffset, input);\n });\n\n // HELPERS\n\n // timezone chunker\n // '+10:00' > ['10', '00']\n // '-1530' > ['-15', '30']\n var chunkOffset = /([\\+\\-]|\\d\\d)/gi;\n\n function offsetFromString(matcher, string) {\n var matches = (string || '').match(matcher),\n chunk,\n parts,\n minutes;\n\n if (matches === null) {\n return null;\n }\n\n chunk = matches[matches.length - 1] || [];\n parts = (chunk + '').match(chunkOffset) || ['-', 0, 0];\n minutes = +(parts[1] * 60) + toInt(parts[2]);\n\n return minutes === 0 ? 0 : parts[0] === '+' ? minutes : -minutes;\n }\n\n // Return a moment from input, that is local/utc/zone equivalent to model.\n function cloneWithOffset(input, model) {\n var res, diff;\n if (model._isUTC) {\n res = model.clone();\n diff =\n (isMoment(input) || isDate(input)\n ? input.valueOf()\n : createLocal(input).valueOf()) - res.valueOf();\n // Use low-level api, because this fn is low-level api.\n res._d.setTime(res._d.valueOf() + diff);\n hooks.updateOffset(res, false);\n return res;\n } else {\n return createLocal(input).local();\n }\n }\n\n function getDateOffset(m) {\n // On Firefox.24 Date#getTimezoneOffset returns a floating point.\n // https://github.com/moment/moment/pull/1871\n return -Math.round(m._d.getTimezoneOffset());\n }\n\n // HOOKS\n\n // This function will be called whenever a moment is mutated.\n // It is intended to keep the offset in sync with the timezone.\n hooks.updateOffset = function () {};\n\n // MOMENTS\n\n // keepLocalTime = true means only change the timezone, without\n // affecting the local hour. So 5:31:26 +0300 --[utcOffset(2, true)]-->\n // 5:31:26 +0200 It is possible that 5:31:26 doesn't exist with offset\n // +0200, so we adjust the time as needed, to be valid.\n //\n // Keeping the time actually adds/subtracts (one hour)\n // from the actual represented time. That is why we call updateOffset\n // a second time. In case it wants us to change the offset again\n // _changeInProgress == true case, then we have to adjust, because\n // there is no such time in the given timezone.\n function getSetOffset(input, keepLocalTime, keepMinutes) {\n var offset = this._offset || 0,\n localAdjust;\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n if (input != null) {\n if (typeof input === 'string') {\n input = offsetFromString(matchShortOffset, input);\n if (input === null) {\n return this;\n }\n } else if (Math.abs(input) < 16 && !keepMinutes) {\n input = input * 60;\n }\n if (!this._isUTC && keepLocalTime) {\n localAdjust = getDateOffset(this);\n }\n this._offset = input;\n this._isUTC = true;\n if (localAdjust != null) {\n this.add(localAdjust, 'm');\n }\n if (offset !== input) {\n if (!keepLocalTime || this._changeInProgress) {\n addSubtract(\n this,\n createDuration(input - offset, 'm'),\n 1,\n false\n );\n } else if (!this._changeInProgress) {\n this._changeInProgress = true;\n hooks.updateOffset(this, true);\n this._changeInProgress = null;\n }\n }\n return this;\n } else {\n return this._isUTC ? offset : getDateOffset(this);\n }\n }\n\n function getSetZone(input, keepLocalTime) {\n if (input != null) {\n if (typeof input !== 'string') {\n input = -input;\n }\n\n this.utcOffset(input, keepLocalTime);\n\n return this;\n } else {\n return -this.utcOffset();\n }\n }\n\n function setOffsetToUTC(keepLocalTime) {\n return this.utcOffset(0, keepLocalTime);\n }\n\n function setOffsetToLocal(keepLocalTime) {\n if (this._isUTC) {\n this.utcOffset(0, keepLocalTime);\n this._isUTC = false;\n\n if (keepLocalTime) {\n this.subtract(getDateOffset(this), 'm');\n }\n }\n return this;\n }\n\n function setOffsetToParsedOffset() {\n if (this._tzm != null) {\n this.utcOffset(this._tzm, false, true);\n } else if (typeof this._i === 'string') {\n var tZone = offsetFromString(matchOffset, this._i);\n if (tZone != null) {\n this.utcOffset(tZone);\n } else {\n this.utcOffset(0, true);\n }\n }\n return this;\n }\n\n function hasAlignedHourOffset(input) {\n if (!this.isValid()) {\n return false;\n }\n input = input ? createLocal(input).utcOffset() : 0;\n\n return (this.utcOffset() - input) % 60 === 0;\n }\n\n function isDaylightSavingTime() {\n return (\n this.utcOffset() > this.clone().month(0).utcOffset() ||\n this.utcOffset() > this.clone().month(5).utcOffset()\n );\n }\n\n function isDaylightSavingTimeShifted() {\n if (!isUndefined(this._isDSTShifted)) {\n return this._isDSTShifted;\n }\n\n var c = {},\n other;\n\n copyConfig(c, this);\n c = prepareConfig(c);\n\n if (c._a) {\n other = c._isUTC ? createUTC(c._a) : createLocal(c._a);\n this._isDSTShifted =\n this.isValid() && compareArrays(c._a, other.toArray()) > 0;\n } else {\n this._isDSTShifted = false;\n }\n\n return this._isDSTShifted;\n }\n\n function isLocal() {\n return this.isValid() ? !this._isUTC : false;\n }\n\n function isUtcOffset() {\n return this.isValid() ? this._isUTC : false;\n }\n\n function isUtc() {\n return this.isValid() ? this._isUTC && this._offset === 0 : false;\n }\n\n // ASP.NET json date format regex\n var aspNetRegex = /^(-|\\+)?(?:(\\d*)[. ])?(\\d+):(\\d+)(?::(\\d+)(\\.\\d*)?)?$/,\n // from http://docs.closure-library.googlecode.com/git/closure_goog_date_date.js.source.html\n // somewhat more in line with 4.4.3.2 2004 spec, but allows decimal anywhere\n // and further modified to allow for strings containing both week and day\n isoRegex = /^(-|\\+)?P(?:([-+]?[0-9,.]*)Y)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)W)?(?:([-+]?[0-9,.]*)D)?(?:T(?:([-+]?[0-9,.]*)H)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)S)?)?$/;\n\n function createDuration(input, key) {\n var duration = input,\n // matching against regexp is expensive, do it on demand\n match = null,\n sign,\n ret,\n diffRes;\n\n if (isDuration(input)) {\n duration = {\n ms: input._milliseconds,\n d: input._days,\n M: input._months,\n };\n } else if (isNumber(input) || !isNaN(+input)) {\n duration = {};\n if (key) {\n duration[key] = +input;\n } else {\n duration.milliseconds = +input;\n }\n } else if ((match = aspNetRegex.exec(input))) {\n sign = match[1] === '-' ? -1 : 1;\n duration = {\n y: 0,\n d: toInt(match[DATE]) * sign,\n h: toInt(match[HOUR]) * sign,\n m: toInt(match[MINUTE]) * sign,\n s: toInt(match[SECOND]) * sign,\n ms: toInt(absRound(match[MILLISECOND] * 1000)) * sign, // the millisecond decimal point is included in the match\n };\n } else if ((match = isoRegex.exec(input))) {\n sign = match[1] === '-' ? -1 : 1;\n duration = {\n y: parseIso(match[2], sign),\n M: parseIso(match[3], sign),\n w: parseIso(match[4], sign),\n d: parseIso(match[5], sign),\n h: parseIso(match[6], sign),\n m: parseIso(match[7], sign),\n s: parseIso(match[8], sign),\n };\n } else if (duration == null) {\n // checks for null or undefined\n duration = {};\n } else if (\n typeof duration === 'object' &&\n ('from' in duration || 'to' in duration)\n ) {\n diffRes = momentsDifference(\n createLocal(duration.from),\n createLocal(duration.to)\n );\n\n duration = {};\n duration.ms = diffRes.milliseconds;\n duration.M = diffRes.months;\n }\n\n ret = new Duration(duration);\n\n if (isDuration(input) && hasOwnProp(input, '_locale')) {\n ret._locale = input._locale;\n }\n\n if (isDuration(input) && hasOwnProp(input, '_isValid')) {\n ret._isValid = input._isValid;\n }\n\n return ret;\n }\n\n createDuration.fn = Duration.prototype;\n createDuration.invalid = createInvalid$1;\n\n function parseIso(inp, sign) {\n // We'd normally use ~~inp for this, but unfortunately it also\n // converts floats to ints.\n // inp may be undefined, so careful calling replace on it.\n var res = inp && parseFloat(inp.replace(',', '.'));\n // apply sign while we're at it\n return (isNaN(res) ? 0 : res) * sign;\n }\n\n function positiveMomentsDifference(base, other) {\n var res = {};\n\n res.months =\n other.month() - base.month() + (other.year() - base.year()) * 12;\n if (base.clone().add(res.months, 'M').isAfter(other)) {\n --res.months;\n }\n\n res.milliseconds = +other - +base.clone().add(res.months, 'M');\n\n return res;\n }\n\n function momentsDifference(base, other) {\n var res;\n if (!(base.isValid() && other.isValid())) {\n return { milliseconds: 0, months: 0 };\n }\n\n other = cloneWithOffset(other, base);\n if (base.isBefore(other)) {\n res = positiveMomentsDifference(base, other);\n } else {\n res = positiveMomentsDifference(other, base);\n res.milliseconds = -res.milliseconds;\n res.months = -res.months;\n }\n\n return res;\n }\n\n // TODO: remove 'name' arg after deprecation is removed\n function createAdder(direction, name) {\n return function (val, period) {\n var dur, tmp;\n //invert the arguments, but complain about it\n if (period !== null && !isNaN(+period)) {\n deprecateSimple(\n name,\n 'moment().' +\n name +\n '(period, number) is deprecated. Please use moment().' +\n name +\n '(number, period). ' +\n 'See http://momentjs.com/guides/#/warnings/add-inverted-param/ for more info.'\n );\n tmp = val;\n val = period;\n period = tmp;\n }\n\n dur = createDuration(val, period);\n addSubtract(this, dur, direction);\n return this;\n };\n }\n\n function addSubtract(mom, duration, isAdding, updateOffset) {\n var milliseconds = duration._milliseconds,\n days = absRound(duration._days),\n months = absRound(duration._months);\n\n if (!mom.isValid()) {\n // No op\n return;\n }\n\n updateOffset = updateOffset == null ? true : updateOffset;\n\n if (months) {\n setMonth(mom, get(mom, 'Month') + months * isAdding);\n }\n if (days) {\n set$1(mom, 'Date', get(mom, 'Date') + days * isAdding);\n }\n if (milliseconds) {\n mom._d.setTime(mom._d.valueOf() + milliseconds * isAdding);\n }\n if (updateOffset) {\n hooks.updateOffset(mom, days || months);\n }\n }\n\n var add = createAdder(1, 'add'),\n subtract = createAdder(-1, 'subtract');\n\n function isString(input) {\n return typeof input === 'string' || input instanceof String;\n }\n\n // type MomentInput = Moment | Date | string | number | (number | string)[] | MomentInputObject | void; // null | undefined\n function isMomentInput(input) {\n return (\n isMoment(input) ||\n isDate(input) ||\n isString(input) ||\n isNumber(input) ||\n isNumberOrStringArray(input) ||\n isMomentInputObject(input) ||\n input === null ||\n input === undefined\n );\n }\n\n function isMomentInputObject(input) {\n var objectTest = isObject(input) && !isObjectEmpty(input),\n propertyTest = false,\n properties = [\n 'years',\n 'year',\n 'y',\n 'months',\n 'month',\n 'M',\n 'days',\n 'day',\n 'd',\n 'dates',\n 'date',\n 'D',\n 'hours',\n 'hour',\n 'h',\n 'minutes',\n 'minute',\n 'm',\n 'seconds',\n 'second',\n 's',\n 'milliseconds',\n 'millisecond',\n 'ms',\n ],\n i,\n property;\n\n for (i = 0; i < properties.length; i += 1) {\n property = properties[i];\n propertyTest = propertyTest || hasOwnProp(input, property);\n }\n\n return objectTest && propertyTest;\n }\n\n function isNumberOrStringArray(input) {\n var arrayTest = isArray(input),\n dataTypeTest = false;\n if (arrayTest) {\n dataTypeTest =\n input.filter(function (item) {\n return !isNumber(item) && isString(input);\n }).length === 0;\n }\n return arrayTest && dataTypeTest;\n }\n\n function isCalendarSpec(input) {\n var objectTest = isObject(input) && !isObjectEmpty(input),\n propertyTest = false,\n properties = [\n 'sameDay',\n 'nextDay',\n 'lastDay',\n 'nextWeek',\n 'lastWeek',\n 'sameElse',\n ],\n i,\n property;\n\n for (i = 0; i < properties.length; i += 1) {\n property = properties[i];\n propertyTest = propertyTest || hasOwnProp(input, property);\n }\n\n return objectTest && propertyTest;\n }\n\n function getCalendarFormat(myMoment, now) {\n var diff = myMoment.diff(now, 'days', true);\n return diff < -6\n ? 'sameElse'\n : diff < -1\n ? 'lastWeek'\n : diff < 0\n ? 'lastDay'\n : diff < 1\n ? 'sameDay'\n : diff < 2\n ? 'nextDay'\n : diff < 7\n ? 'nextWeek'\n : 'sameElse';\n }\n\n function calendar$1(time, formats) {\n // Support for single parameter, formats only overload to the calendar function\n if (arguments.length === 1) {\n if (!arguments[0]) {\n time = undefined;\n formats = undefined;\n } else if (isMomentInput(arguments[0])) {\n time = arguments[0];\n formats = undefined;\n } else if (isCalendarSpec(arguments[0])) {\n formats = arguments[0];\n time = undefined;\n }\n }\n // We want to compare the start of today, vs this.\n // Getting start-of-today depends on whether we're local/utc/offset or not.\n var now = time || createLocal(),\n sod = cloneWithOffset(now, this).startOf('day'),\n format = hooks.calendarFormat(this, sod) || 'sameElse',\n output =\n formats &&\n (isFunction(formats[format])\n ? formats[format].call(this, now)\n : formats[format]);\n\n return this.format(\n output || this.localeData().calendar(format, this, createLocal(now))\n );\n }\n\n function clone() {\n return new Moment(this);\n }\n\n function isAfter(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input);\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() > localInput.valueOf();\n } else {\n return localInput.valueOf() < this.clone().startOf(units).valueOf();\n }\n }\n\n function isBefore(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input);\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() < localInput.valueOf();\n } else {\n return this.clone().endOf(units).valueOf() < localInput.valueOf();\n }\n }\n\n function isBetween(from, to, units, inclusivity) {\n var localFrom = isMoment(from) ? from : createLocal(from),\n localTo = isMoment(to) ? to : createLocal(to);\n if (!(this.isValid() && localFrom.isValid() && localTo.isValid())) {\n return false;\n }\n inclusivity = inclusivity || '()';\n return (\n (inclusivity[0] === '('\n ? this.isAfter(localFrom, units)\n : !this.isBefore(localFrom, units)) &&\n (inclusivity[1] === ')'\n ? this.isBefore(localTo, units)\n : !this.isAfter(localTo, units))\n );\n }\n\n function isSame(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input),\n inputMs;\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() === localInput.valueOf();\n } else {\n inputMs = localInput.valueOf();\n return (\n this.clone().startOf(units).valueOf() <= inputMs &&\n inputMs <= this.clone().endOf(units).valueOf()\n );\n }\n }\n\n function isSameOrAfter(input, units) {\n return this.isSame(input, units) || this.isAfter(input, units);\n }\n\n function isSameOrBefore(input, units) {\n return this.isSame(input, units) || this.isBefore(input, units);\n }\n\n function diff(input, units, asFloat) {\n var that, zoneDelta, output;\n\n if (!this.isValid()) {\n return NaN;\n }\n\n that = cloneWithOffset(input, this);\n\n if (!that.isValid()) {\n return NaN;\n }\n\n zoneDelta = (that.utcOffset() - this.utcOffset()) * 6e4;\n\n units = normalizeUnits(units);\n\n switch (units) {\n case 'year':\n output = monthDiff(this, that) / 12;\n break;\n case 'month':\n output = monthDiff(this, that);\n break;\n case 'quarter':\n output = monthDiff(this, that) / 3;\n break;\n case 'second':\n output = (this - that) / 1e3;\n break; // 1000\n case 'minute':\n output = (this - that) / 6e4;\n break; // 1000 * 60\n case 'hour':\n output = (this - that) / 36e5;\n break; // 1000 * 60 * 60\n case 'day':\n output = (this - that - zoneDelta) / 864e5;\n break; // 1000 * 60 * 60 * 24, negate dst\n case 'week':\n output = (this - that - zoneDelta) / 6048e5;\n break; // 1000 * 60 * 60 * 24 * 7, negate dst\n default:\n output = this - that;\n }\n\n return asFloat ? output : absFloor(output);\n }\n\n function monthDiff(a, b) {\n if (a.date() < b.date()) {\n // end-of-month calculations work correct when the start month has more\n // days than the end month.\n return -monthDiff(b, a);\n }\n // difference in months\n var wholeMonthDiff = (b.year() - a.year()) * 12 + (b.month() - a.month()),\n // b is in (anchor - 1 month, anchor + 1 month)\n anchor = a.clone().add(wholeMonthDiff, 'months'),\n anchor2,\n adjust;\n\n if (b - anchor < 0) {\n anchor2 = a.clone().add(wholeMonthDiff - 1, 'months');\n // linear across the month\n adjust = (b - anchor) / (anchor - anchor2);\n } else {\n anchor2 = a.clone().add(wholeMonthDiff + 1, 'months');\n // linear across the month\n adjust = (b - anchor) / (anchor2 - anchor);\n }\n\n //check for negative zero, return zero if negative zero\n return -(wholeMonthDiff + adjust) || 0;\n }\n\n hooks.defaultFormat = 'YYYY-MM-DDTHH:mm:ssZ';\n hooks.defaultFormatUtc = 'YYYY-MM-DDTHH:mm:ss[Z]';\n\n function toString() {\n return this.clone().locale('en').format('ddd MMM DD YYYY HH:mm:ss [GMT]ZZ');\n }\n\n function toISOString(keepOffset) {\n if (!this.isValid()) {\n return null;\n }\n var utc = keepOffset !== true,\n m = utc ? this.clone().utc() : this;\n if (m.year() < 0 || m.year() > 9999) {\n return formatMoment(\n m,\n utc\n ? 'YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]'\n : 'YYYYYY-MM-DD[T]HH:mm:ss.SSSZ'\n );\n }\n if (isFunction(Date.prototype.toISOString)) {\n // native implementation is ~50x faster, use it when we can\n if (utc) {\n return this.toDate().toISOString();\n } else {\n return new Date(this.valueOf() + this.utcOffset() * 60 * 1000)\n .toISOString()\n .replace('Z', formatMoment(m, 'Z'));\n }\n }\n return formatMoment(\n m,\n utc ? 'YYYY-MM-DD[T]HH:mm:ss.SSS[Z]' : 'YYYY-MM-DD[T]HH:mm:ss.SSSZ'\n );\n }\n\n /**\n * Return a human readable representation of a moment that can\n * also be evaluated to get a new moment which is the same\n *\n * @link https://nodejs.org/dist/latest/docs/api/util.html#util_custom_inspect_function_on_objects\n */\n function inspect() {\n if (!this.isValid()) {\n return 'moment.invalid(/* ' + this._i + ' */)';\n }\n var func = 'moment',\n zone = '',\n prefix,\n year,\n datetime,\n suffix;\n if (!this.isLocal()) {\n func = this.utcOffset() === 0 ? 'moment.utc' : 'moment.parseZone';\n zone = 'Z';\n }\n prefix = '[' + func + '(\"]';\n year = 0 <= this.year() && this.year() <= 9999 ? 'YYYY' : 'YYYYYY';\n datetime = '-MM-DD[T]HH:mm:ss.SSS';\n suffix = zone + '[\")]';\n\n return this.format(prefix + year + datetime + suffix);\n }\n\n function format(inputString) {\n if (!inputString) {\n inputString = this.isUtc()\n ? hooks.defaultFormatUtc\n : hooks.defaultFormat;\n }\n var output = formatMoment(this, inputString);\n return this.localeData().postformat(output);\n }\n\n function from(time, withoutSuffix) {\n if (\n this.isValid() &&\n ((isMoment(time) && time.isValid()) || createLocal(time).isValid())\n ) {\n return createDuration({ to: this, from: time })\n .locale(this.locale())\n .humanize(!withoutSuffix);\n } else {\n return this.localeData().invalidDate();\n }\n }\n\n function fromNow(withoutSuffix) {\n return this.from(createLocal(), withoutSuffix);\n }\n\n function to(time, withoutSuffix) {\n if (\n this.isValid() &&\n ((isMoment(time) && time.isValid()) || createLocal(time).isValid())\n ) {\n return createDuration({ from: this, to: time })\n .locale(this.locale())\n .humanize(!withoutSuffix);\n } else {\n return this.localeData().invalidDate();\n }\n }\n\n function toNow(withoutSuffix) {\n return this.to(createLocal(), withoutSuffix);\n }\n\n // If passed a locale key, it will set the locale for this\n // instance. Otherwise, it will return the locale configuration\n // variables for this instance.\n function locale(key) {\n var newLocaleData;\n\n if (key === undefined) {\n return this._locale._abbr;\n } else {\n newLocaleData = getLocale(key);\n if (newLocaleData != null) {\n this._locale = newLocaleData;\n }\n return this;\n }\n }\n\n var lang = deprecate(\n 'moment().lang() is deprecated. Instead, use moment().localeData() to get the language configuration. Use moment().locale() to change languages.',\n function (key) {\n if (key === undefined) {\n return this.localeData();\n } else {\n return this.locale(key);\n }\n }\n );\n\n function localeData() {\n return this._locale;\n }\n\n var MS_PER_SECOND = 1000,\n MS_PER_MINUTE = 60 * MS_PER_SECOND,\n MS_PER_HOUR = 60 * MS_PER_MINUTE,\n MS_PER_400_YEARS = (365 * 400 + 97) * 24 * MS_PER_HOUR;\n\n // actual modulo - handles negative numbers (for dates before 1970):\n function mod$1(dividend, divisor) {\n return ((dividend % divisor) + divisor) % divisor;\n }\n\n function localStartOfDate(y, m, d) {\n // the date constructor remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n return new Date(y + 400, m, d) - MS_PER_400_YEARS;\n } else {\n return new Date(y, m, d).valueOf();\n }\n }\n\n function utcStartOfDate(y, m, d) {\n // Date.UTC remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n return Date.UTC(y + 400, m, d) - MS_PER_400_YEARS;\n } else {\n return Date.UTC(y, m, d);\n }\n }\n\n function startOf(units) {\n var time, startOfDate;\n units = normalizeUnits(units);\n if (units === undefined || units === 'millisecond' || !this.isValid()) {\n return this;\n }\n\n startOfDate = this._isUTC ? utcStartOfDate : localStartOfDate;\n\n switch (units) {\n case 'year':\n time = startOfDate(this.year(), 0, 1);\n break;\n case 'quarter':\n time = startOfDate(\n this.year(),\n this.month() - (this.month() % 3),\n 1\n );\n break;\n case 'month':\n time = startOfDate(this.year(), this.month(), 1);\n break;\n case 'week':\n time = startOfDate(\n this.year(),\n this.month(),\n this.date() - this.weekday()\n );\n break;\n case 'isoWeek':\n time = startOfDate(\n this.year(),\n this.month(),\n this.date() - (this.isoWeekday() - 1)\n );\n break;\n case 'day':\n case 'date':\n time = startOfDate(this.year(), this.month(), this.date());\n break;\n case 'hour':\n time = this._d.valueOf();\n time -= mod$1(\n time + (this._isUTC ? 0 : this.utcOffset() * MS_PER_MINUTE),\n MS_PER_HOUR\n );\n break;\n case 'minute':\n time = this._d.valueOf();\n time -= mod$1(time, MS_PER_MINUTE);\n break;\n case 'second':\n time = this._d.valueOf();\n time -= mod$1(time, MS_PER_SECOND);\n break;\n }\n\n this._d.setTime(time);\n hooks.updateOffset(this, true);\n return this;\n }\n\n function endOf(units) {\n var time, startOfDate;\n units = normalizeUnits(units);\n if (units === undefined || units === 'millisecond' || !this.isValid()) {\n return this;\n }\n\n startOfDate = this._isUTC ? utcStartOfDate : localStartOfDate;\n\n switch (units) {\n case 'year':\n time = startOfDate(this.year() + 1, 0, 1) - 1;\n break;\n case 'quarter':\n time =\n startOfDate(\n this.year(),\n this.month() - (this.month() % 3) + 3,\n 1\n ) - 1;\n break;\n case 'month':\n time = startOfDate(this.year(), this.month() + 1, 1) - 1;\n break;\n case 'week':\n time =\n startOfDate(\n this.year(),\n this.month(),\n this.date() - this.weekday() + 7\n ) - 1;\n break;\n case 'isoWeek':\n time =\n startOfDate(\n this.year(),\n this.month(),\n this.date() - (this.isoWeekday() - 1) + 7\n ) - 1;\n break;\n case 'day':\n case 'date':\n time = startOfDate(this.year(), this.month(), this.date() + 1) - 1;\n break;\n case 'hour':\n time = this._d.valueOf();\n time +=\n MS_PER_HOUR -\n mod$1(\n time + (this._isUTC ? 0 : this.utcOffset() * MS_PER_MINUTE),\n MS_PER_HOUR\n ) -\n 1;\n break;\n case 'minute':\n time = this._d.valueOf();\n time += MS_PER_MINUTE - mod$1(time, MS_PER_MINUTE) - 1;\n break;\n case 'second':\n time = this._d.valueOf();\n time += MS_PER_SECOND - mod$1(time, MS_PER_SECOND) - 1;\n break;\n }\n\n this._d.setTime(time);\n hooks.updateOffset(this, true);\n return this;\n }\n\n function valueOf() {\n return this._d.valueOf() - (this._offset || 0) * 60000;\n }\n\n function unix() {\n return Math.floor(this.valueOf() / 1000);\n }\n\n function toDate() {\n return new Date(this.valueOf());\n }\n\n function toArray() {\n var m = this;\n return [\n m.year(),\n m.month(),\n m.date(),\n m.hour(),\n m.minute(),\n m.second(),\n m.millisecond(),\n ];\n }\n\n function toObject() {\n var m = this;\n return {\n years: m.year(),\n months: m.month(),\n date: m.date(),\n hours: m.hours(),\n minutes: m.minutes(),\n seconds: m.seconds(),\n milliseconds: m.milliseconds(),\n };\n }\n\n function toJSON() {\n // new Date(NaN).toJSON() === null\n return this.isValid() ? this.toISOString() : null;\n }\n\n function isValid$2() {\n return isValid(this);\n }\n\n function parsingFlags() {\n return extend({}, getParsingFlags(this));\n }\n\n function invalidAt() {\n return getParsingFlags(this).overflow;\n }\n\n function creationData() {\n return {\n input: this._i,\n format: this._f,\n locale: this._locale,\n isUTC: this._isUTC,\n strict: this._strict,\n };\n }\n\n addFormatToken('N', 0, 0, 'eraAbbr');\n addFormatToken('NN', 0, 0, 'eraAbbr');\n addFormatToken('NNN', 0, 0, 'eraAbbr');\n addFormatToken('NNNN', 0, 0, 'eraName');\n addFormatToken('NNNNN', 0, 0, 'eraNarrow');\n\n addFormatToken('y', ['y', 1], 'yo', 'eraYear');\n addFormatToken('y', ['yy', 2], 0, 'eraYear');\n addFormatToken('y', ['yyy', 3], 0, 'eraYear');\n addFormatToken('y', ['yyyy', 4], 0, 'eraYear');\n\n addRegexToken('N', matchEraAbbr);\n addRegexToken('NN', matchEraAbbr);\n addRegexToken('NNN', matchEraAbbr);\n addRegexToken('NNNN', matchEraName);\n addRegexToken('NNNNN', matchEraNarrow);\n\n addParseToken(['N', 'NN', 'NNN', 'NNNN', 'NNNNN'], function (\n input,\n array,\n config,\n token\n ) {\n var era = config._locale.erasParse(input, token, config._strict);\n if (era) {\n getParsingFlags(config).era = era;\n } else {\n getParsingFlags(config).invalidEra = input;\n }\n });\n\n addRegexToken('y', matchUnsigned);\n addRegexToken('yy', matchUnsigned);\n addRegexToken('yyy', matchUnsigned);\n addRegexToken('yyyy', matchUnsigned);\n addRegexToken('yo', matchEraYearOrdinal);\n\n addParseToken(['y', 'yy', 'yyy', 'yyyy'], YEAR);\n addParseToken(['yo'], function (input, array, config, token) {\n var match;\n if (config._locale._eraYearOrdinalRegex) {\n match = input.match(config._locale._eraYearOrdinalRegex);\n }\n\n if (config._locale.eraYearOrdinalParse) {\n array[YEAR] = config._locale.eraYearOrdinalParse(input, match);\n } else {\n array[YEAR] = parseInt(input, 10);\n }\n });\n\n function localeEras(m, format) {\n var i,\n l,\n date,\n eras = this._eras || getLocale('en')._eras;\n for (i = 0, l = eras.length; i < l; ++i) {\n switch (typeof eras[i].since) {\n case 'string':\n // truncate time\n date = hooks(eras[i].since).startOf('day');\n eras[i].since = date.valueOf();\n break;\n }\n\n switch (typeof eras[i].until) {\n case 'undefined':\n eras[i].until = +Infinity;\n break;\n case 'string':\n // truncate time\n date = hooks(eras[i].until).startOf('day').valueOf();\n eras[i].until = date.valueOf();\n break;\n }\n }\n return eras;\n }\n\n function localeErasParse(eraName, format, strict) {\n var i,\n l,\n eras = this.eras(),\n name,\n abbr,\n narrow;\n eraName = eraName.toUpperCase();\n\n for (i = 0, l = eras.length; i < l; ++i) {\n name = eras[i].name.toUpperCase();\n abbr = eras[i].abbr.toUpperCase();\n narrow = eras[i].narrow.toUpperCase();\n\n if (strict) {\n switch (format) {\n case 'N':\n case 'NN':\n case 'NNN':\n if (abbr === eraName) {\n return eras[i];\n }\n break;\n\n case 'NNNN':\n if (name === eraName) {\n return eras[i];\n }\n break;\n\n case 'NNNNN':\n if (narrow === eraName) {\n return eras[i];\n }\n break;\n }\n } else if ([name, abbr, narrow].indexOf(eraName) >= 0) {\n return eras[i];\n }\n }\n }\n\n function localeErasConvertYear(era, year) {\n var dir = era.since <= era.until ? +1 : -1;\n if (year === undefined) {\n return hooks(era.since).year();\n } else {\n return hooks(era.since).year() + (year - era.offset) * dir;\n }\n }\n\n function getEraName() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].name;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].name;\n }\n }\n\n return '';\n }\n\n function getEraNarrow() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].narrow;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].narrow;\n }\n }\n\n return '';\n }\n\n function getEraAbbr() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].abbr;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].abbr;\n }\n }\n\n return '';\n }\n\n function getEraYear() {\n var i,\n l,\n dir,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n dir = eras[i].since <= eras[i].until ? +1 : -1;\n\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (\n (eras[i].since <= val && val <= eras[i].until) ||\n (eras[i].until <= val && val <= eras[i].since)\n ) {\n return (\n (this.year() - hooks(eras[i].since).year()) * dir +\n eras[i].offset\n );\n }\n }\n\n return this.year();\n }\n\n function erasNameRegex(isStrict) {\n if (!hasOwnProp(this, '_erasNameRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasNameRegex : this._erasRegex;\n }\n\n function erasAbbrRegex(isStrict) {\n if (!hasOwnProp(this, '_erasAbbrRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasAbbrRegex : this._erasRegex;\n }\n\n function erasNarrowRegex(isStrict) {\n if (!hasOwnProp(this, '_erasNarrowRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasNarrowRegex : this._erasRegex;\n }\n\n function matchEraAbbr(isStrict, locale) {\n return locale.erasAbbrRegex(isStrict);\n }\n\n function matchEraName(isStrict, locale) {\n return locale.erasNameRegex(isStrict);\n }\n\n function matchEraNarrow(isStrict, locale) {\n return locale.erasNarrowRegex(isStrict);\n }\n\n function matchEraYearOrdinal(isStrict, locale) {\n return locale._eraYearOrdinalRegex || matchUnsigned;\n }\n\n function computeErasParse() {\n var abbrPieces = [],\n namePieces = [],\n narrowPieces = [],\n mixedPieces = [],\n i,\n l,\n eras = this.eras();\n\n for (i = 0, l = eras.length; i < l; ++i) {\n namePieces.push(regexEscape(eras[i].name));\n abbrPieces.push(regexEscape(eras[i].abbr));\n narrowPieces.push(regexEscape(eras[i].narrow));\n\n mixedPieces.push(regexEscape(eras[i].name));\n mixedPieces.push(regexEscape(eras[i].abbr));\n mixedPieces.push(regexEscape(eras[i].narrow));\n }\n\n this._erasRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._erasNameRegex = new RegExp('^(' + namePieces.join('|') + ')', 'i');\n this._erasAbbrRegex = new RegExp('^(' + abbrPieces.join('|') + ')', 'i');\n this._erasNarrowRegex = new RegExp(\n '^(' + narrowPieces.join('|') + ')',\n 'i'\n );\n }\n\n // FORMATTING\n\n addFormatToken(0, ['gg', 2], 0, function () {\n return this.weekYear() % 100;\n });\n\n addFormatToken(0, ['GG', 2], 0, function () {\n return this.isoWeekYear() % 100;\n });\n\n function addWeekYearFormatToken(token, getter) {\n addFormatToken(0, [token, token.length], 0, getter);\n }\n\n addWeekYearFormatToken('gggg', 'weekYear');\n addWeekYearFormatToken('ggggg', 'weekYear');\n addWeekYearFormatToken('GGGG', 'isoWeekYear');\n addWeekYearFormatToken('GGGGG', 'isoWeekYear');\n\n // ALIASES\n\n addUnitAlias('weekYear', 'gg');\n addUnitAlias('isoWeekYear', 'GG');\n\n // PRIORITY\n\n addUnitPriority('weekYear', 1);\n addUnitPriority('isoWeekYear', 1);\n\n // PARSING\n\n addRegexToken('G', matchSigned);\n addRegexToken('g', matchSigned);\n addRegexToken('GG', match1to2, match2);\n addRegexToken('gg', match1to2, match2);\n addRegexToken('GGGG', match1to4, match4);\n addRegexToken('gggg', match1to4, match4);\n addRegexToken('GGGGG', match1to6, match6);\n addRegexToken('ggggg', match1to6, match6);\n\n addWeekParseToken(['gggg', 'ggggg', 'GGGG', 'GGGGG'], function (\n input,\n week,\n config,\n token\n ) {\n week[token.substr(0, 2)] = toInt(input);\n });\n\n addWeekParseToken(['gg', 'GG'], function (input, week, config, token) {\n week[token] = hooks.parseTwoDigitYear(input);\n });\n\n // MOMENTS\n\n function getSetWeekYear(input) {\n return getSetWeekYearHelper.call(\n this,\n input,\n this.week(),\n this.weekday(),\n this.localeData()._week.dow,\n this.localeData()._week.doy\n );\n }\n\n function getSetISOWeekYear(input) {\n return getSetWeekYearHelper.call(\n this,\n input,\n this.isoWeek(),\n this.isoWeekday(),\n 1,\n 4\n );\n }\n\n function getISOWeeksInYear() {\n return weeksInYear(this.year(), 1, 4);\n }\n\n function getISOWeeksInISOWeekYear() {\n return weeksInYear(this.isoWeekYear(), 1, 4);\n }\n\n function getWeeksInYear() {\n var weekInfo = this.localeData()._week;\n return weeksInYear(this.year(), weekInfo.dow, weekInfo.doy);\n }\n\n function getWeeksInWeekYear() {\n var weekInfo = this.localeData()._week;\n return weeksInYear(this.weekYear(), weekInfo.dow, weekInfo.doy);\n }\n\n function getSetWeekYearHelper(input, week, weekday, dow, doy) {\n var weeksTarget;\n if (input == null) {\n return weekOfYear(this, dow, doy).year;\n } else {\n weeksTarget = weeksInYear(input, dow, doy);\n if (week > weeksTarget) {\n week = weeksTarget;\n }\n return setWeekAll.call(this, input, week, weekday, dow, doy);\n }\n }\n\n function setWeekAll(weekYear, week, weekday, dow, doy) {\n var dayOfYearData = dayOfYearFromWeeks(weekYear, week, weekday, dow, doy),\n date = createUTCDate(dayOfYearData.year, 0, dayOfYearData.dayOfYear);\n\n this.year(date.getUTCFullYear());\n this.month(date.getUTCMonth());\n this.date(date.getUTCDate());\n return this;\n }\n\n // FORMATTING\n\n addFormatToken('Q', 0, 'Qo', 'quarter');\n\n // ALIASES\n\n addUnitAlias('quarter', 'Q');\n\n // PRIORITY\n\n addUnitPriority('quarter', 7);\n\n // PARSING\n\n addRegexToken('Q', match1);\n addParseToken('Q', function (input, array) {\n array[MONTH] = (toInt(input) - 1) * 3;\n });\n\n // MOMENTS\n\n function getSetQuarter(input) {\n return input == null\n ? Math.ceil((this.month() + 1) / 3)\n : this.month((input - 1) * 3 + (this.month() % 3));\n }\n\n // FORMATTING\n\n addFormatToken('D', ['DD', 2], 'Do', 'date');\n\n // ALIASES\n\n addUnitAlias('date', 'D');\n\n // PRIORITY\n addUnitPriority('date', 9);\n\n // PARSING\n\n addRegexToken('D', match1to2);\n addRegexToken('DD', match1to2, match2);\n addRegexToken('Do', function (isStrict, locale) {\n // TODO: Remove \"ordinalParse\" fallback in next major release.\n return isStrict\n ? locale._dayOfMonthOrdinalParse || locale._ordinalParse\n : locale._dayOfMonthOrdinalParseLenient;\n });\n\n addParseToken(['D', 'DD'], DATE);\n addParseToken('Do', function (input, array) {\n array[DATE] = toInt(input.match(match1to2)[0]);\n });\n\n // MOMENTS\n\n var getSetDayOfMonth = makeGetSet('Date', true);\n\n // FORMATTING\n\n addFormatToken('DDD', ['DDDD', 3], 'DDDo', 'dayOfYear');\n\n // ALIASES\n\n addUnitAlias('dayOfYear', 'DDD');\n\n // PRIORITY\n addUnitPriority('dayOfYear', 4);\n\n // PARSING\n\n addRegexToken('DDD', match1to3);\n addRegexToken('DDDD', match3);\n addParseToken(['DDD', 'DDDD'], function (input, array, config) {\n config._dayOfYear = toInt(input);\n });\n\n // HELPERS\n\n // MOMENTS\n\n function getSetDayOfYear(input) {\n var dayOfYear =\n Math.round(\n (this.clone().startOf('day') - this.clone().startOf('year')) / 864e5\n ) + 1;\n return input == null ? dayOfYear : this.add(input - dayOfYear, 'd');\n }\n\n // FORMATTING\n\n addFormatToken('m', ['mm', 2], 0, 'minute');\n\n // ALIASES\n\n addUnitAlias('minute', 'm');\n\n // PRIORITY\n\n addUnitPriority('minute', 14);\n\n // PARSING\n\n addRegexToken('m', match1to2);\n addRegexToken('mm', match1to2, match2);\n addParseToken(['m', 'mm'], MINUTE);\n\n // MOMENTS\n\n var getSetMinute = makeGetSet('Minutes', false);\n\n // FORMATTING\n\n addFormatToken('s', ['ss', 2], 0, 'second');\n\n // ALIASES\n\n addUnitAlias('second', 's');\n\n // PRIORITY\n\n addUnitPriority('second', 15);\n\n // PARSING\n\n addRegexToken('s', match1to2);\n addRegexToken('ss', match1to2, match2);\n addParseToken(['s', 'ss'], SECOND);\n\n // MOMENTS\n\n var getSetSecond = makeGetSet('Seconds', false);\n\n // FORMATTING\n\n addFormatToken('S', 0, 0, function () {\n return ~~(this.millisecond() / 100);\n });\n\n addFormatToken(0, ['SS', 2], 0, function () {\n return ~~(this.millisecond() / 10);\n });\n\n addFormatToken(0, ['SSS', 3], 0, 'millisecond');\n addFormatToken(0, ['SSSS', 4], 0, function () {\n return this.millisecond() * 10;\n });\n addFormatToken(0, ['SSSSS', 5], 0, function () {\n return this.millisecond() * 100;\n });\n addFormatToken(0, ['SSSSSS', 6], 0, function () {\n return this.millisecond() * 1000;\n });\n addFormatToken(0, ['SSSSSSS', 7], 0, function () {\n return this.millisecond() * 10000;\n });\n addFormatToken(0, ['SSSSSSSS', 8], 0, function () {\n return this.millisecond() * 100000;\n });\n addFormatToken(0, ['SSSSSSSSS', 9], 0, function () {\n return this.millisecond() * 1000000;\n });\n\n // ALIASES\n\n addUnitAlias('millisecond', 'ms');\n\n // PRIORITY\n\n addUnitPriority('millisecond', 16);\n\n // PARSING\n\n addRegexToken('S', match1to3, match1);\n addRegexToken('SS', match1to3, match2);\n addRegexToken('SSS', match1to3, match3);\n\n var token, getSetMillisecond;\n for (token = 'SSSS'; token.length <= 9; token += 'S') {\n addRegexToken(token, matchUnsigned);\n }\n\n function parseMs(input, array) {\n array[MILLISECOND] = toInt(('0.' + input) * 1000);\n }\n\n for (token = 'S'; token.length <= 9; token += 'S') {\n addParseToken(token, parseMs);\n }\n\n getSetMillisecond = makeGetSet('Milliseconds', false);\n\n // FORMATTING\n\n addFormatToken('z', 0, 0, 'zoneAbbr');\n addFormatToken('zz', 0, 0, 'zoneName');\n\n // MOMENTS\n\n function getZoneAbbr() {\n return this._isUTC ? 'UTC' : '';\n }\n\n function getZoneName() {\n return this._isUTC ? 'Coordinated Universal Time' : '';\n }\n\n var proto = Moment.prototype;\n\n proto.add = add;\n proto.calendar = calendar$1;\n proto.clone = clone;\n proto.diff = diff;\n proto.endOf = endOf;\n proto.format = format;\n proto.from = from;\n proto.fromNow = fromNow;\n proto.to = to;\n proto.toNow = toNow;\n proto.get = stringGet;\n proto.invalidAt = invalidAt;\n proto.isAfter = isAfter;\n proto.isBefore = isBefore;\n proto.isBetween = isBetween;\n proto.isSame = isSame;\n proto.isSameOrAfter = isSameOrAfter;\n proto.isSameOrBefore = isSameOrBefore;\n proto.isValid = isValid$2;\n proto.lang = lang;\n proto.locale = locale;\n proto.localeData = localeData;\n proto.max = prototypeMax;\n proto.min = prototypeMin;\n proto.parsingFlags = parsingFlags;\n proto.set = stringSet;\n proto.startOf = startOf;\n proto.subtract = subtract;\n proto.toArray = toArray;\n proto.toObject = toObject;\n proto.toDate = toDate;\n proto.toISOString = toISOString;\n proto.inspect = inspect;\n if (typeof Symbol !== 'undefined' && Symbol.for != null) {\n proto[Symbol.for('nodejs.util.inspect.custom')] = function () {\n return 'Moment<' + this.format() + '>';\n };\n }\n proto.toJSON = toJSON;\n proto.toString = toString;\n proto.unix = unix;\n proto.valueOf = valueOf;\n proto.creationData = creationData;\n proto.eraName = getEraName;\n proto.eraNarrow = getEraNarrow;\n proto.eraAbbr = getEraAbbr;\n proto.eraYear = getEraYear;\n proto.year = getSetYear;\n proto.isLeapYear = getIsLeapYear;\n proto.weekYear = getSetWeekYear;\n proto.isoWeekYear = getSetISOWeekYear;\n proto.quarter = proto.quarters = getSetQuarter;\n proto.month = getSetMonth;\n proto.daysInMonth = getDaysInMonth;\n proto.week = proto.weeks = getSetWeek;\n proto.isoWeek = proto.isoWeeks = getSetISOWeek;\n proto.weeksInYear = getWeeksInYear;\n proto.weeksInWeekYear = getWeeksInWeekYear;\n proto.isoWeeksInYear = getISOWeeksInYear;\n proto.isoWeeksInISOWeekYear = getISOWeeksInISOWeekYear;\n proto.date = getSetDayOfMonth;\n proto.day = proto.days = getSetDayOfWeek;\n proto.weekday = getSetLocaleDayOfWeek;\n proto.isoWeekday = getSetISODayOfWeek;\n proto.dayOfYear = getSetDayOfYear;\n proto.hour = proto.hours = getSetHour;\n proto.minute = proto.minutes = getSetMinute;\n proto.second = proto.seconds = getSetSecond;\n proto.millisecond = proto.milliseconds = getSetMillisecond;\n proto.utcOffset = getSetOffset;\n proto.utc = setOffsetToUTC;\n proto.local = setOffsetToLocal;\n proto.parseZone = setOffsetToParsedOffset;\n proto.hasAlignedHourOffset = hasAlignedHourOffset;\n proto.isDST = isDaylightSavingTime;\n proto.isLocal = isLocal;\n proto.isUtcOffset = isUtcOffset;\n proto.isUtc = isUtc;\n proto.isUTC = isUtc;\n proto.zoneAbbr = getZoneAbbr;\n proto.zoneName = getZoneName;\n proto.dates = deprecate(\n 'dates accessor is deprecated. Use date instead.',\n getSetDayOfMonth\n );\n proto.months = deprecate(\n 'months accessor is deprecated. Use month instead',\n getSetMonth\n );\n proto.years = deprecate(\n 'years accessor is deprecated. Use year instead',\n getSetYear\n );\n proto.zone = deprecate(\n 'moment().zone is deprecated, use moment().utcOffset instead. http://momentjs.com/guides/#/warnings/zone/',\n getSetZone\n );\n proto.isDSTShifted = deprecate(\n 'isDSTShifted is deprecated. See http://momentjs.com/guides/#/warnings/dst-shifted/ for more information',\n isDaylightSavingTimeShifted\n );\n\n function createUnix(input) {\n return createLocal(input * 1000);\n }\n\n function createInZone() {\n return createLocal.apply(null, arguments).parseZone();\n }\n\n function preParsePostFormat(string) {\n return string;\n }\n\n var proto$1 = Locale.prototype;\n\n proto$1.calendar = calendar;\n proto$1.longDateFormat = longDateFormat;\n proto$1.invalidDate = invalidDate;\n proto$1.ordinal = ordinal;\n proto$1.preparse = preParsePostFormat;\n proto$1.postformat = preParsePostFormat;\n proto$1.relativeTime = relativeTime;\n proto$1.pastFuture = pastFuture;\n proto$1.set = set;\n proto$1.eras = localeEras;\n proto$1.erasParse = localeErasParse;\n proto$1.erasConvertYear = localeErasConvertYear;\n proto$1.erasAbbrRegex = erasAbbrRegex;\n proto$1.erasNameRegex = erasNameRegex;\n proto$1.erasNarrowRegex = erasNarrowRegex;\n\n proto$1.months = localeMonths;\n proto$1.monthsShort = localeMonthsShort;\n proto$1.monthsParse = localeMonthsParse;\n proto$1.monthsRegex = monthsRegex;\n proto$1.monthsShortRegex = monthsShortRegex;\n proto$1.week = localeWeek;\n proto$1.firstDayOfYear = localeFirstDayOfYear;\n proto$1.firstDayOfWeek = localeFirstDayOfWeek;\n\n proto$1.weekdays = localeWeekdays;\n proto$1.weekdaysMin = localeWeekdaysMin;\n proto$1.weekdaysShort = localeWeekdaysShort;\n proto$1.weekdaysParse = localeWeekdaysParse;\n\n proto$1.weekdaysRegex = weekdaysRegex;\n proto$1.weekdaysShortRegex = weekdaysShortRegex;\n proto$1.weekdaysMinRegex = weekdaysMinRegex;\n\n proto$1.isPM = localeIsPM;\n proto$1.meridiem = localeMeridiem;\n\n function get$1(format, index, field, setter) {\n var locale = getLocale(),\n utc = createUTC().set(setter, index);\n return locale[field](utc, format);\n }\n\n function listMonthsImpl(format, index, field) {\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n\n if (index != null) {\n return get$1(format, index, field, 'month');\n }\n\n var i,\n out = [];\n for (i = 0; i < 12; i++) {\n out[i] = get$1(format, i, field, 'month');\n }\n return out;\n }\n\n // ()\n // (5)\n // (fmt, 5)\n // (fmt)\n // (true)\n // (true, 5)\n // (true, fmt, 5)\n // (true, fmt)\n function listWeekdaysImpl(localeSorted, format, index, field) {\n if (typeof localeSorted === 'boolean') {\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n } else {\n format = localeSorted;\n index = format;\n localeSorted = false;\n\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n }\n\n var locale = getLocale(),\n shift = localeSorted ? locale._week.dow : 0,\n i,\n out = [];\n\n if (index != null) {\n return get$1(format, (index + shift) % 7, field, 'day');\n }\n\n for (i = 0; i < 7; i++) {\n out[i] = get$1(format, (i + shift) % 7, field, 'day');\n }\n return out;\n }\n\n function listMonths(format, index) {\n return listMonthsImpl(format, index, 'months');\n }\n\n function listMonthsShort(format, index) {\n return listMonthsImpl(format, index, 'monthsShort');\n }\n\n function listWeekdays(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdays');\n }\n\n function listWeekdaysShort(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdaysShort');\n }\n\n function listWeekdaysMin(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdaysMin');\n }\n\n getSetGlobalLocale('en', {\n eras: [\n {\n since: '0001-01-01',\n until: +Infinity,\n offset: 1,\n name: 'Anno Domini',\n narrow: 'AD',\n abbr: 'AD',\n },\n {\n since: '0000-12-31',\n until: -Infinity,\n offset: 1,\n name: 'Before Christ',\n narrow: 'BC',\n abbr: 'BC',\n },\n ],\n dayOfMonthOrdinalParse: /\\d{1,2}(th|st|nd|rd)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n toInt((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n });\n\n // Side effect imports\n\n hooks.lang = deprecate(\n 'moment.lang is deprecated. Use moment.locale instead.',\n getSetGlobalLocale\n );\n hooks.langData = deprecate(\n 'moment.langData is deprecated. Use moment.localeData instead.',\n getLocale\n );\n\n var mathAbs = Math.abs;\n\n function abs() {\n var data = this._data;\n\n this._milliseconds = mathAbs(this._milliseconds);\n this._days = mathAbs(this._days);\n this._months = mathAbs(this._months);\n\n data.milliseconds = mathAbs(data.milliseconds);\n data.seconds = mathAbs(data.seconds);\n data.minutes = mathAbs(data.minutes);\n data.hours = mathAbs(data.hours);\n data.months = mathAbs(data.months);\n data.years = mathAbs(data.years);\n\n return this;\n }\n\n function addSubtract$1(duration, input, value, direction) {\n var other = createDuration(input, value);\n\n duration._milliseconds += direction * other._milliseconds;\n duration._days += direction * other._days;\n duration._months += direction * other._months;\n\n return duration._bubble();\n }\n\n // supports only 2.0-style add(1, 's') or add(duration)\n function add$1(input, value) {\n return addSubtract$1(this, input, value, 1);\n }\n\n // supports only 2.0-style subtract(1, 's') or subtract(duration)\n function subtract$1(input, value) {\n return addSubtract$1(this, input, value, -1);\n }\n\n function absCeil(number) {\n if (number < 0) {\n return Math.floor(number);\n } else {\n return Math.ceil(number);\n }\n }\n\n function bubble() {\n var milliseconds = this._milliseconds,\n days = this._days,\n months = this._months,\n data = this._data,\n seconds,\n minutes,\n hours,\n years,\n monthsFromDays;\n\n // if we have a mix of positive and negative values, bubble down first\n // check: https://github.com/moment/moment/issues/2166\n if (\n !(\n (milliseconds >= 0 && days >= 0 && months >= 0) ||\n (milliseconds <= 0 && days <= 0 && months <= 0)\n )\n ) {\n milliseconds += absCeil(monthsToDays(months) + days) * 864e5;\n days = 0;\n months = 0;\n }\n\n // The following code bubbles up values, see the tests for\n // examples of what that means.\n data.milliseconds = milliseconds % 1000;\n\n seconds = absFloor(milliseconds / 1000);\n data.seconds = seconds % 60;\n\n minutes = absFloor(seconds / 60);\n data.minutes = minutes % 60;\n\n hours = absFloor(minutes / 60);\n data.hours = hours % 24;\n\n days += absFloor(hours / 24);\n\n // convert days to months\n monthsFromDays = absFloor(daysToMonths(days));\n months += monthsFromDays;\n days -= absCeil(monthsToDays(monthsFromDays));\n\n // 12 months -> 1 year\n years = absFloor(months / 12);\n months %= 12;\n\n data.days = days;\n data.months = months;\n data.years = years;\n\n return this;\n }\n\n function daysToMonths(days) {\n // 400 years have 146097 days (taking into account leap year rules)\n // 400 years have 12 months === 4800\n return (days * 4800) / 146097;\n }\n\n function monthsToDays(months) {\n // the reverse of daysToMonths\n return (months * 146097) / 4800;\n }\n\n function as(units) {\n if (!this.isValid()) {\n return NaN;\n }\n var days,\n months,\n milliseconds = this._milliseconds;\n\n units = normalizeUnits(units);\n\n if (units === 'month' || units === 'quarter' || units === 'year') {\n days = this._days + milliseconds / 864e5;\n months = this._months + daysToMonths(days);\n switch (units) {\n case 'month':\n return months;\n case 'quarter':\n return months / 3;\n case 'year':\n return months / 12;\n }\n } else {\n // handle milliseconds separately because of floating point math errors (issue #1867)\n days = this._days + Math.round(monthsToDays(this._months));\n switch (units) {\n case 'week':\n return days / 7 + milliseconds / 6048e5;\n case 'day':\n return days + milliseconds / 864e5;\n case 'hour':\n return days * 24 + milliseconds / 36e5;\n case 'minute':\n return days * 1440 + milliseconds / 6e4;\n case 'second':\n return days * 86400 + milliseconds / 1000;\n // Math.floor prevents floating point math errors here\n case 'millisecond':\n return Math.floor(days * 864e5) + milliseconds;\n default:\n throw new Error('Unknown unit ' + units);\n }\n }\n }\n\n // TODO: Use this.as('ms')?\n function valueOf$1() {\n if (!this.isValid()) {\n return NaN;\n }\n return (\n this._milliseconds +\n this._days * 864e5 +\n (this._months % 12) * 2592e6 +\n toInt(this._months / 12) * 31536e6\n );\n }\n\n function makeAs(alias) {\n return function () {\n return this.as(alias);\n };\n }\n\n var asMilliseconds = makeAs('ms'),\n asSeconds = makeAs('s'),\n asMinutes = makeAs('m'),\n asHours = makeAs('h'),\n asDays = makeAs('d'),\n asWeeks = makeAs('w'),\n asMonths = makeAs('M'),\n asQuarters = makeAs('Q'),\n asYears = makeAs('y');\n\n function clone$1() {\n return createDuration(this);\n }\n\n function get$2(units) {\n units = normalizeUnits(units);\n return this.isValid() ? this[units + 's']() : NaN;\n }\n\n function makeGetter(name) {\n return function () {\n return this.isValid() ? this._data[name] : NaN;\n };\n }\n\n var milliseconds = makeGetter('milliseconds'),\n seconds = makeGetter('seconds'),\n minutes = makeGetter('minutes'),\n hours = makeGetter('hours'),\n days = makeGetter('days'),\n months = makeGetter('months'),\n years = makeGetter('years');\n\n function weeks() {\n return absFloor(this.days() / 7);\n }\n\n var round = Math.round,\n thresholds = {\n ss: 44, // a few seconds to seconds\n s: 45, // seconds to minute\n m: 45, // minutes to hour\n h: 22, // hours to day\n d: 26, // days to month/week\n w: null, // weeks to month\n M: 11, // months to year\n };\n\n // helper function for moment.fn.from, moment.fn.fromNow, and moment.duration.fn.humanize\n function substituteTimeAgo(string, number, withoutSuffix, isFuture, locale) {\n return locale.relativeTime(number || 1, !!withoutSuffix, string, isFuture);\n }\n\n function relativeTime$1(posNegDuration, withoutSuffix, thresholds, locale) {\n var duration = createDuration(posNegDuration).abs(),\n seconds = round(duration.as('s')),\n minutes = round(duration.as('m')),\n hours = round(duration.as('h')),\n days = round(duration.as('d')),\n months = round(duration.as('M')),\n weeks = round(duration.as('w')),\n years = round(duration.as('y')),\n a =\n (seconds <= thresholds.ss && ['s', seconds]) ||\n (seconds < thresholds.s && ['ss', seconds]) ||\n (minutes <= 1 && ['m']) ||\n (minutes < thresholds.m && ['mm', minutes]) ||\n (hours <= 1 && ['h']) ||\n (hours < thresholds.h && ['hh', hours]) ||\n (days <= 1 && ['d']) ||\n (days < thresholds.d && ['dd', days]);\n\n if (thresholds.w != null) {\n a =\n a ||\n (weeks <= 1 && ['w']) ||\n (weeks < thresholds.w && ['ww', weeks]);\n }\n a = a ||\n (months <= 1 && ['M']) ||\n (months < thresholds.M && ['MM', months]) ||\n (years <= 1 && ['y']) || ['yy', years];\n\n a[2] = withoutSuffix;\n a[3] = +posNegDuration > 0;\n a[4] = locale;\n return substituteTimeAgo.apply(null, a);\n }\n\n // This function allows you to set the rounding function for relative time strings\n function getSetRelativeTimeRounding(roundingFunction) {\n if (roundingFunction === undefined) {\n return round;\n }\n if (typeof roundingFunction === 'function') {\n round = roundingFunction;\n return true;\n }\n return false;\n }\n\n // This function allows you to set a threshold for relative time strings\n function getSetRelativeTimeThreshold(threshold, limit) {\n if (thresholds[threshold] === undefined) {\n return false;\n }\n if (limit === undefined) {\n return thresholds[threshold];\n }\n thresholds[threshold] = limit;\n if (threshold === 's') {\n thresholds.ss = limit - 1;\n }\n return true;\n }\n\n function humanize(argWithSuffix, argThresholds) {\n if (!this.isValid()) {\n return this.localeData().invalidDate();\n }\n\n var withSuffix = false,\n th = thresholds,\n locale,\n output;\n\n if (typeof argWithSuffix === 'object') {\n argThresholds = argWithSuffix;\n argWithSuffix = false;\n }\n if (typeof argWithSuffix === 'boolean') {\n withSuffix = argWithSuffix;\n }\n if (typeof argThresholds === 'object') {\n th = Object.assign({}, thresholds, argThresholds);\n if (argThresholds.s != null && argThresholds.ss == null) {\n th.ss = argThresholds.s - 1;\n }\n }\n\n locale = this.localeData();\n output = relativeTime$1(this, !withSuffix, th, locale);\n\n if (withSuffix) {\n output = locale.pastFuture(+this, output);\n }\n\n return locale.postformat(output);\n }\n\n var abs$1 = Math.abs;\n\n function sign(x) {\n return (x > 0) - (x < 0) || +x;\n }\n\n function toISOString$1() {\n // for ISO strings we do not use the normal bubbling rules:\n // * milliseconds bubble up until they become hours\n // * days do not bubble at all\n // * months bubble up until they become years\n // This is because there is no context-free conversion between hours and days\n // (think of clock changes)\n // and also not between days and months (28-31 days per month)\n if (!this.isValid()) {\n return this.localeData().invalidDate();\n }\n\n var seconds = abs$1(this._milliseconds) / 1000,\n days = abs$1(this._days),\n months = abs$1(this._months),\n minutes,\n hours,\n years,\n s,\n total = this.asSeconds(),\n totalSign,\n ymSign,\n daysSign,\n hmsSign;\n\n if (!total) {\n // this is the same as C#'s (Noda) and python (isodate)...\n // but not other JS (goog.date)\n return 'P0D';\n }\n\n // 3600 seconds -> 60 minutes -> 1 hour\n minutes = absFloor(seconds / 60);\n hours = absFloor(minutes / 60);\n seconds %= 60;\n minutes %= 60;\n\n // 12 months -> 1 year\n years = absFloor(months / 12);\n months %= 12;\n\n // inspired by https://github.com/dordille/moment-isoduration/blob/master/moment.isoduration.js\n s = seconds ? seconds.toFixed(3).replace(/\\.?0+$/, '') : '';\n\n totalSign = total < 0 ? '-' : '';\n ymSign = sign(this._months) !== sign(total) ? '-' : '';\n daysSign = sign(this._days) !== sign(total) ? '-' : '';\n hmsSign = sign(this._milliseconds) !== sign(total) ? '-' : '';\n\n return (\n totalSign +\n 'P' +\n (years ? ymSign + years + 'Y' : '') +\n (months ? ymSign + months + 'M' : '') +\n (days ? daysSign + days + 'D' : '') +\n (hours || minutes || seconds ? 'T' : '') +\n (hours ? hmsSign + hours + 'H' : '') +\n (minutes ? hmsSign + minutes + 'M' : '') +\n (seconds ? hmsSign + s + 'S' : '')\n );\n }\n\n var proto$2 = Duration.prototype;\n\n proto$2.isValid = isValid$1;\n proto$2.abs = abs;\n proto$2.add = add$1;\n proto$2.subtract = subtract$1;\n proto$2.as = as;\n proto$2.asMilliseconds = asMilliseconds;\n proto$2.asSeconds = asSeconds;\n proto$2.asMinutes = asMinutes;\n proto$2.asHours = asHours;\n proto$2.asDays = asDays;\n proto$2.asWeeks = asWeeks;\n proto$2.asMonths = asMonths;\n proto$2.asQuarters = asQuarters;\n proto$2.asYears = asYears;\n proto$2.valueOf = valueOf$1;\n proto$2._bubble = bubble;\n proto$2.clone = clone$1;\n proto$2.get = get$2;\n proto$2.milliseconds = milliseconds;\n proto$2.seconds = seconds;\n proto$2.minutes = minutes;\n proto$2.hours = hours;\n proto$2.days = days;\n proto$2.weeks = weeks;\n proto$2.months = months;\n proto$2.years = years;\n proto$2.humanize = humanize;\n proto$2.toISOString = toISOString$1;\n proto$2.toString = toISOString$1;\n proto$2.toJSON = toISOString$1;\n proto$2.locale = locale;\n proto$2.localeData = localeData;\n\n proto$2.toIsoString = deprecate(\n 'toIsoString() is deprecated. Please use toISOString() instead (notice the capitals)',\n toISOString$1\n );\n proto$2.lang = lang;\n\n // FORMATTING\n\n addFormatToken('X', 0, 0, 'unix');\n addFormatToken('x', 0, 0, 'valueOf');\n\n // PARSING\n\n addRegexToken('x', matchSigned);\n addRegexToken('X', matchTimestamp);\n addParseToken('X', function (input, array, config) {\n config._d = new Date(parseFloat(input) * 1000);\n });\n addParseToken('x', function (input, array, config) {\n config._d = new Date(toInt(input));\n });\n\n //! moment.js\n\n hooks.version = '2.29.1';\n\n setHookCallback(createLocal);\n\n hooks.fn = proto;\n hooks.min = min;\n hooks.max = max;\n hooks.now = now;\n hooks.utc = createUTC;\n hooks.unix = createUnix;\n hooks.months = listMonths;\n hooks.isDate = isDate;\n hooks.locale = getSetGlobalLocale;\n hooks.invalid = createInvalid;\n hooks.duration = createDuration;\n hooks.isMoment = isMoment;\n hooks.weekdays = listWeekdays;\n hooks.parseZone = createInZone;\n hooks.localeData = getLocale;\n hooks.isDuration = isDuration;\n hooks.monthsShort = listMonthsShort;\n hooks.weekdaysMin = listWeekdaysMin;\n hooks.defineLocale = defineLocale;\n hooks.updateLocale = updateLocale;\n hooks.locales = listLocales;\n hooks.weekdaysShort = listWeekdaysShort;\n hooks.normalizeUnits = normalizeUnits;\n hooks.relativeTimeRounding = getSetRelativeTimeRounding;\n hooks.relativeTimeThreshold = getSetRelativeTimeThreshold;\n hooks.calendarFormat = getCalendarFormat;\n hooks.prototype = proto;\n\n // currently HTML5 input type only supports 24-hour formats\n hooks.HTML5_FMT = {\n DATETIME_LOCAL: 'YYYY-MM-DDTHH:mm', // \n DATETIME_LOCAL_SECONDS: 'YYYY-MM-DDTHH:mm:ss', // \n DATETIME_LOCAL_MS: 'YYYY-MM-DDTHH:mm:ss.SSS', // \n DATE: 'YYYY-MM-DD', // \n TIME: 'HH:mm', // \n TIME_SECONDS: 'HH:mm:ss', // \n TIME_MS: 'HH:mm:ss.SSS', // \n WEEK: 'GGGG-[W]WW', // \n MONTH: 'YYYY-MM', // \n };\n\n return hooks;\n\n})));\n","import createMuiTheme from './createMuiTheme';\nvar defaultTheme = createMuiTheme();\nexport default defaultTheme;","import { deepmerge } from '@material-ui/utils';\n\nfunction merge(acc, item) {\n if (!item) {\n return acc;\n }\n\n return deepmerge(acc, item, {\n clone: false // No need to clone deep, it's way faster.\n\n });\n}\n\nexport default merge;","import * as React from 'react';\nexport default function isMuiElement(element, muiNames) {\n return /*#__PURE__*/React.isValidElement(element) && muiNames.indexOf(element.type.muiName) !== -1;\n}","import * as React from 'react';\n/**\n * @ignore - internal component.\n */\n\nvar Tablelvl2Context = React.createContext();\n\nif (process.env.NODE_ENV !== 'production') {\n Tablelvl2Context.displayName = 'Tablelvl2Context';\n}\n\nexport default Tablelvl2Context;","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Dot\n */\nimport React, { PureComponent } from 'react';\nimport classNames from 'classnames';\nimport { adaptEventHandlers, filterProps } from '../util/types';\nexport var Dot = /*#__PURE__*/function (_PureComponent) {\n _inherits(Dot, _PureComponent);\n\n var _super = _createSuper(Dot);\n\n function Dot() {\n _classCallCheck(this, Dot);\n\n return _super.apply(this, arguments);\n }\n\n _createClass(Dot, [{\n key: \"render\",\n value: function render() {\n var _this$props = this.props,\n cx = _this$props.cx,\n cy = _this$props.cy,\n r = _this$props.r,\n className = _this$props.className;\n var layerClass = classNames('recharts-dot', className);\n\n if (cx === +cx && cy === +cy && r === +r) {\n return /*#__PURE__*/React.createElement(\"circle\", _extends({}, filterProps(this.props), adaptEventHandlers(this.props), {\n className: layerClass,\n cx: cx,\n cy: cy,\n r: r\n }));\n }\n\n return null;\n }\n }]);\n\n return Dot;\n}(PureComponent);","var isNumber = require('./isNumber');\n\n/**\n * Checks if `value` is `NaN`.\n *\n * **Note:** This method is based on\n * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as\n * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for\n * `undefined` and other non-number values.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n * @example\n *\n * _.isNaN(NaN);\n * // => true\n *\n * _.isNaN(new Number(NaN));\n * // => true\n *\n * isNaN(undefined);\n * // => true\n *\n * _.isNaN(undefined);\n * // => false\n */\nfunction isNaN(value) {\n // An `NaN` primitive is the only value that is not equal to itself.\n // Perform the `toStringTag` check first to avoid errors with some\n // ActiveX objects in IE.\n return isNumber(value) && value != +value;\n}\n\nmodule.exports = isNaN;\n","export function shallowEqual(a, b) {\n /* eslint-disable no-restricted-syntax */\n for (var key in a) {\n if ({}.hasOwnProperty.call(a, key) && (!{}.hasOwnProperty.call(b, key) || a[key] !== b[key])) {\n return false;\n }\n }\n\n for (var _key in b) {\n if ({}.hasOwnProperty.call(b, _key) && !{}.hasOwnProperty.call(a, _key)) {\n return false;\n }\n }\n\n return true;\n}","var now = require('performance-now')\n , root = typeof window === 'undefined' ? global : window\n , vendors = ['moz', 'webkit']\n , suffix = 'AnimationFrame'\n , raf = root['request' + suffix]\n , caf = root['cancel' + suffix] || root['cancelRequest' + suffix]\n\nfor(var i = 0; !raf && i < vendors.length; i++) {\n raf = root[vendors[i] + 'Request' + suffix]\n caf = root[vendors[i] + 'Cancel' + suffix]\n || root[vendors[i] + 'CancelRequest' + suffix]\n}\n\n// Some versions of FF have rAF but not cAF\nif(!raf || !caf) {\n var last = 0\n , id = 0\n , queue = []\n , frameDuration = 1000 / 60\n\n raf = function(callback) {\n if(queue.length === 0) {\n var _now = now()\n , next = Math.max(0, frameDuration - (_now - last))\n last = next + _now\n setTimeout(function() {\n var cp = queue.slice(0)\n // Clear queue here to prevent\n // callbacks from appending listeners\n // to the current frame's queue\n queue.length = 0\n for(var i = 0; i < cp.length; i++) {\n if(!cp[i].cancelled) {\n try{\n cp[i].callback(last)\n } catch(e) {\n setTimeout(function() { throw e }, 0)\n }\n }\n }\n }, Math.round(next))\n }\n queue.push({\n handle: ++id,\n callback: callback,\n cancelled: false\n })\n return id\n }\n\n caf = function(handle) {\n for(var i = 0; i < queue.length; i++) {\n if(queue[i].handle === handle) {\n queue[i].cancelled = true\n }\n }\n }\n}\n\nmodule.exports = function(fn) {\n // Wrap in a new function to prevent\n // `cancel` potentially being assigned\n // to the native rAF function\n return raf.call(root, fn)\n}\nmodule.exports.cancel = function() {\n caf.apply(root, arguments)\n}\nmodule.exports.polyfill = function(object) {\n if (!object) {\n object = root;\n }\n object.requestAnimationFrame = raf\n object.cancelAnimationFrame = caf\n}\n","var baseIsNative = require('./_baseIsNative'),\n getValue = require('./_getValue');\n\n/**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\nfunction getNative(object, key) {\n var value = getValue(object, key);\n return baseIsNative(value) ? value : undefined;\n}\n\nmodule.exports = getNative;\n","export default function _assertThisInitialized(self) {\n if (self === void 0) {\n throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\");\n }\n\n return self;\n}","// Supports determination of isControlled().\n// Controlled input accepts its current value as a prop.\n//\n// @see https://facebook.github.io/react/docs/forms.html#controlled-components\n// @param value\n// @returns {boolean} true if string (including '') or number (including zero)\nexport function hasValue(value) {\n return value != null && !(Array.isArray(value) && value.length === 0);\n} // Determine if field is empty or filled.\n// Response determines if label is presented above field or as placeholder.\n//\n// @param obj\n// @param SSR\n// @returns {boolean} False when not present or empty string.\n// True when any number or string with length.\n\nexport function isFilled(obj) {\n var SSR = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;\n return obj && (hasValue(obj.value) && obj.value !== '' || SSR && hasValue(obj.defaultValue) && obj.defaultValue !== '');\n} // Determine if an Input is adorned on start.\n// It's corresponding to the left with LTR.\n//\n// @param obj\n// @returns {boolean} False when no adornments.\n// True when adorned at the start.\n\nexport function isAdornedStart(obj) {\n return obj.startAdornment;\n}","var createCaseFirst = require('./_createCaseFirst');\n\n/**\n * Converts the first character of `string` to upper case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.upperFirst('fred');\n * // => 'Fred'\n *\n * _.upperFirst('FRED');\n * // => 'FRED'\n */\nvar upperFirst = createCaseFirst('toUpperCase');\n\nmodule.exports = upperFirst;\n","export default function number(x) {\n return +x;\n}\n","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Rectangle\n */\nimport React, { PureComponent } from 'react';\nimport classNames from 'classnames';\nimport Animate from 'react-smooth';\nimport { filterProps } from '../util/types';\n\nvar getRectanglePath = function getRectanglePath(x, y, width, height, radius) {\n var maxRadius = Math.min(Math.abs(width) / 2, Math.abs(height) / 2);\n var ySign = height >= 0 ? 1 : -1;\n var xSign = width >= 0 ? 1 : -1;\n var clockWise = height >= 0 && width >= 0 || height < 0 && width < 0 ? 1 : 0;\n var path;\n\n if (maxRadius > 0 && radius instanceof Array) {\n var newRadius = [0, 0, 0, 0];\n\n for (var i = 0, len = 4; i < len; i++) {\n newRadius[i] = radius[i] > maxRadius ? maxRadius : radius[i];\n }\n\n path = \"M\".concat(x, \",\").concat(y + ySign * newRadius[0]);\n\n if (newRadius[0] > 0) {\n path += \"A \".concat(newRadius[0], \",\").concat(newRadius[0], \",0,0,\").concat(clockWise, \",\").concat(x + xSign * newRadius[0], \",\").concat(y);\n }\n\n path += \"L \".concat(x + width - xSign * newRadius[1], \",\").concat(y);\n\n if (newRadius[1] > 0) {\n path += \"A \".concat(newRadius[1], \",\").concat(newRadius[1], \",0,0,\").concat(clockWise, \",\\n \").concat(x + width, \",\").concat(y + ySign * newRadius[1]);\n }\n\n path += \"L \".concat(x + width, \",\").concat(y + height - ySign * newRadius[2]);\n\n if (newRadius[2] > 0) {\n path += \"A \".concat(newRadius[2], \",\").concat(newRadius[2], \",0,0,\").concat(clockWise, \",\\n \").concat(x + width - xSign * newRadius[2], \",\").concat(y + height);\n }\n\n path += \"L \".concat(x + xSign * newRadius[3], \",\").concat(y + height);\n\n if (newRadius[3] > 0) {\n path += \"A \".concat(newRadius[3], \",\").concat(newRadius[3], \",0,0,\").concat(clockWise, \",\\n \").concat(x, \",\").concat(y + height - ySign * newRadius[3]);\n }\n\n path += 'Z';\n } else if (maxRadius > 0 && radius === +radius && radius > 0) {\n var _newRadius = Math.min(maxRadius, radius);\n\n path = \"M \".concat(x, \",\").concat(y + ySign * _newRadius, \"\\n A \").concat(_newRadius, \",\").concat(_newRadius, \",0,0,\").concat(clockWise, \",\").concat(x + xSign * _newRadius, \",\").concat(y, \"\\n L \").concat(x + width - xSign * _newRadius, \",\").concat(y, \"\\n A \").concat(_newRadius, \",\").concat(_newRadius, \",0,0,\").concat(clockWise, \",\").concat(x + width, \",\").concat(y + ySign * _newRadius, \"\\n L \").concat(x + width, \",\").concat(y + height - ySign * _newRadius, \"\\n A \").concat(_newRadius, \",\").concat(_newRadius, \",0,0,\").concat(clockWise, \",\").concat(x + width - xSign * _newRadius, \",\").concat(y + height, \"\\n L \").concat(x + xSign * _newRadius, \",\").concat(y + height, \"\\n A \").concat(_newRadius, \",\").concat(_newRadius, \",0,0,\").concat(clockWise, \",\").concat(x, \",\").concat(y + height - ySign * _newRadius, \" Z\");\n } else {\n path = \"M \".concat(x, \",\").concat(y, \" h \").concat(width, \" v \").concat(height, \" h \").concat(-width, \" Z\");\n }\n\n return path;\n};\n\nexport var isInRectangle = function isInRectangle(point, rect) {\n if (!point || !rect) {\n return false;\n }\n\n var px = point.x,\n py = point.y;\n var x = rect.x,\n y = rect.y,\n width = rect.width,\n height = rect.height;\n\n if (Math.abs(width) > 0 && Math.abs(height) > 0) {\n var minX = Math.min(x, x + width);\n var maxX = Math.max(x, x + width);\n var minY = Math.min(y, y + height);\n var maxY = Math.max(y, y + height);\n return px >= minX && px <= maxX && py >= minY && py <= maxY;\n }\n\n return false;\n};\nexport var Rectangle = /*#__PURE__*/function (_PureComponent) {\n _inherits(Rectangle, _PureComponent);\n\n var _super = _createSuper(Rectangle);\n\n function Rectangle() {\n var _this;\n\n _classCallCheck(this, Rectangle);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _super.call.apply(_super, [this].concat(args));\n _this.state = {\n totalLength: -1\n };\n _this.node = void 0;\n return _this;\n }\n\n _createClass(Rectangle, [{\n key: \"componentDidMount\",\n value:\n /* eslint-disable react/no-did-mount-set-state */\n function componentDidMount() {\n if (this.node && this.node.getTotalLength) {\n try {\n var totalLength = this.node.getTotalLength();\n\n if (totalLength) {\n this.setState({\n totalLength: totalLength\n });\n }\n } catch (err) {// calculate total length error\n }\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this2 = this;\n\n var _this$props = this.props,\n x = _this$props.x,\n y = _this$props.y,\n width = _this$props.width,\n height = _this$props.height,\n radius = _this$props.radius,\n className = _this$props.className;\n var totalLength = this.state.totalLength;\n var _this$props2 = this.props,\n animationEasing = _this$props2.animationEasing,\n animationDuration = _this$props2.animationDuration,\n animationBegin = _this$props2.animationBegin,\n isAnimationActive = _this$props2.isAnimationActive,\n isUpdateAnimationActive = _this$props2.isUpdateAnimationActive;\n\n if (x !== +x || y !== +y || width !== +width || height !== +height || width === 0 || height === 0) {\n return null;\n }\n\n var layerClass = classNames('recharts-rectangle', className);\n\n if (!isUpdateAnimationActive) {\n return /*#__PURE__*/React.createElement(\"path\", _extends({}, filterProps(this.props, true), {\n className: layerClass,\n d: getRectanglePath(x, y, width, height, radius)\n }));\n }\n\n return /*#__PURE__*/React.createElement(Animate, {\n canBegin: totalLength > 0,\n from: {\n width: width,\n height: height,\n x: x,\n y: y\n },\n to: {\n width: width,\n height: height,\n x: x,\n y: y\n },\n duration: animationDuration,\n animationEasing: animationEasing,\n isActive: isUpdateAnimationActive\n }, function (_ref) {\n var currWidth = _ref.width,\n currHeight = _ref.height,\n currX = _ref.x,\n currY = _ref.y;\n return /*#__PURE__*/React.createElement(Animate, {\n canBegin: totalLength > 0,\n from: \"0px \".concat(totalLength === -1 ? 1 : totalLength, \"px\"),\n to: \"\".concat(totalLength, \"px 0px\"),\n attributeName: \"strokeDasharray\",\n begin: animationBegin,\n duration: animationDuration,\n isActive: isAnimationActive,\n easing: animationEasing\n }, /*#__PURE__*/React.createElement(\"path\", _extends({}, filterProps(_this2.props, true), {\n className: layerClass,\n d: getRectanglePath(currX, currY, currWidth, currHeight, radius),\n ref: function ref(node) {\n _this2.node = node;\n }\n })));\n });\n }\n }]);\n\n return Rectangle;\n}(PureComponent);\nRectangle.defaultProps = {\n x: 0,\n y: 0,\n width: 0,\n height: 0,\n // The radius of border\n // The radius of four corners when radius is a number\n // The radius of left-top, right-top, right-bottom, left-bottom when radius is an array\n radius: 0,\n isAnimationActive: false,\n isUpdateAnimationActive: false,\n animationBegin: 0,\n animationDuration: 1500,\n animationEasing: 'ease'\n};","var objectWithoutPropertiesLoose = require(\"./objectWithoutPropertiesLoose.js\");\n\nfunction _objectWithoutProperties(source, excluded) {\n if (source == null) return {};\n var target = objectWithoutPropertiesLoose(source, excluded);\n var key, i;\n\n if (Object.getOwnPropertySymbols) {\n var sourceSymbolKeys = Object.getOwnPropertySymbols(source);\n\n for (i = 0; i < sourceSymbolKeys.length; i++) {\n key = sourceSymbolKeys[i];\n if (excluded.indexOf(key) >= 0) continue;\n if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;\n target[key] = source[key];\n }\n }\n\n return target;\n}\n\nmodule.exports = _objectWithoutProperties;\nmodule.exports[\"default\"] = module.exports, module.exports.__esModule = true;","var baseGetTag = require('./_baseGetTag'),\n isObjectLike = require('./isObjectLike');\n\n/** `Object#toString` result references. */\nvar symbolTag = '[object Symbol]';\n\n/**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\nfunction isSymbol(value) {\n return typeof value == 'symbol' ||\n (isObjectLike(value) && baseGetTag(value) == symbolTag);\n}\n\nmodule.exports = isSymbol;\n","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.bottom = bottom;\nexports.cloneLayout = cloneLayout;\nexports.modifyLayout = modifyLayout;\nexports.withLayoutItem = withLayoutItem;\nexports.cloneLayoutItem = cloneLayoutItem;\nexports.childrenEqual = childrenEqual;\nexports.fastPositionEqual = fastPositionEqual;\nexports.collides = collides;\nexports.compact = compact;\nexports.compactItem = compactItem;\nexports.correctBounds = correctBounds;\nexports.getLayoutItem = getLayoutItem;\nexports.getFirstCollision = getFirstCollision;\nexports.getAllCollisions = getAllCollisions;\nexports.getStatics = getStatics;\nexports.moveElement = moveElement;\nexports.moveElementAwayFromCollision = moveElementAwayFromCollision;\nexports.perc = perc;\nexports.setTransform = setTransform;\nexports.setTopLeft = setTopLeft;\nexports.sortLayoutItems = sortLayoutItems;\nexports.sortLayoutItemsByRowCol = sortLayoutItemsByRowCol;\nexports.sortLayoutItemsByColRow = sortLayoutItemsByColRow;\nexports.synchronizeLayoutWithChildren = synchronizeLayoutWithChildren;\nexports.validateLayout = validateLayout;\nexports.compactType = compactType;\nexports.autoBindHandlers = autoBindHandlers;\nexports.noop = exports.fastRGLPropsEqual = void 0;\n\nvar _lodash = _interopRequireDefault(require(\"lodash.isequal\"));\n\nvar _react = _interopRequireDefault(require(\"react\"));\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) { symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); } keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nvar isProduction = process.env.NODE_ENV === \"production\";\nvar DEBUG = false;\n/**\n * Return the bottom coordinate of the layout.\n *\n * @param {Array} layout Layout array.\n * @return {Number} Bottom coordinate.\n */\n\nfunction bottom(layout\n/*: Layout*/\n)\n/*: number*/\n{\n var max = 0,\n bottomY;\n\n for (var i = 0, len = layout.length; i < len; i++) {\n bottomY = layout[i].y + layout[i].h;\n if (bottomY > max) max = bottomY;\n }\n\n return max;\n}\n\nfunction cloneLayout(layout\n/*: Layout*/\n)\n/*: Layout*/\n{\n var newLayout = Array(layout.length);\n\n for (var i = 0, len = layout.length; i < len; i++) {\n newLayout[i] = cloneLayoutItem(layout[i]);\n }\n\n return newLayout;\n} // Modify a layoutItem inside a layout. Returns a new Layout,\n// does not mutate. Carries over all other LayoutItems unmodified.\n\n\nfunction modifyLayout(layout\n/*: Layout*/\n, layoutItem\n/*: LayoutItem*/\n)\n/*: Layout*/\n{\n var newLayout = Array(layout.length);\n\n for (var i = 0, len = layout.length; i < len; i++) {\n if (layoutItem.i === layout[i].i) {\n newLayout[i] = layoutItem;\n } else {\n newLayout[i] = layout[i];\n }\n }\n\n return newLayout;\n} // Function to be called to modify a layout item.\n// Does defensive clones to ensure the layout is not modified.\n\n\nfunction withLayoutItem(layout\n/*: Layout*/\n, itemKey\n/*: string*/\n, cb\n/*: LayoutItem => LayoutItem*/\n)\n/*: [Layout, ?LayoutItem]*/\n{\n var item = getLayoutItem(layout, itemKey);\n if (!item) return [layout, null];\n item = cb(cloneLayoutItem(item)); // defensive clone then modify\n // FIXME could do this faster if we already knew the index\n\n layout = modifyLayout(layout, item);\n return [layout, item];\n} // Fast path to cloning, since this is monomorphic\n\n\nfunction cloneLayoutItem(layoutItem\n/*: LayoutItem*/\n)\n/*: LayoutItem*/\n{\n return {\n w: layoutItem.w,\n h: layoutItem.h,\n x: layoutItem.x,\n y: layoutItem.y,\n i: layoutItem.i,\n minW: layoutItem.minW,\n maxW: layoutItem.maxW,\n minH: layoutItem.minH,\n maxH: layoutItem.maxH,\n moved: Boolean(layoutItem.moved),\n static: Boolean(layoutItem.static),\n // These can be null/undefined\n isDraggable: layoutItem.isDraggable,\n isResizable: layoutItem.isResizable,\n resizeHandles: layoutItem.resizeHandles,\n isBounded: layoutItem.isBounded\n };\n}\n/**\n * Comparing React `children` is a bit difficult. This is a good way to compare them.\n * This will catch differences in keys, order, and length.\n */\n\n\nfunction childrenEqual(a\n/*: ReactChildren*/\n, b\n/*: ReactChildren*/\n)\n/*: boolean*/\n{\n return (0, _lodash.default)(_react.default.Children.map(a, function (c) {\n return c.key;\n }), _react.default.Children.map(b, function (c) {\n return c.key;\n }));\n}\n/**\n * See `fastRGLPropsEqual.js`.\n * We want this to run as fast as possible - it is called often - and to be\n * resilient to new props that we add. So rather than call lodash.isEqual,\n * which isn't suited to comparing props very well, we use this specialized\n * function in conjunction with preval to generate the fastest possible comparison\n * function, tuned for exactly our props.\n */\n\n/*:: type FastRGLPropsEqual = (Object, Object, Function) => boolean;*/\n\n\nvar fastRGLPropsEqual\n/*: FastRGLPropsEqual*/\n= require(\"./fastRGLPropsEqual\"); // Like the above, but a lot simpler.\n\n\nexports.fastRGLPropsEqual = fastRGLPropsEqual;\n\nfunction fastPositionEqual(a\n/*: Position*/\n, b\n/*: Position*/\n)\n/*: boolean*/\n{\n return a.left === b.left && a.top === b.top && a.width === b.width && a.height === b.height;\n}\n/**\n * Given two layoutitems, check if they collide.\n */\n\n\nfunction collides(l1\n/*: LayoutItem*/\n, l2\n/*: LayoutItem*/\n)\n/*: boolean*/\n{\n if (l1.i === l2.i) return false; // same element\n\n if (l1.x + l1.w <= l2.x) return false; // l1 is left of l2\n\n if (l1.x >= l2.x + l2.w) return false; // l1 is right of l2\n\n if (l1.y + l1.h <= l2.y) return false; // l1 is above l2\n\n if (l1.y >= l2.y + l2.h) return false; // l1 is below l2\n\n return true; // boxes overlap\n}\n/**\n * Given a layout, compact it. This involves going down each y coordinate and removing gaps\n * between items.\n *\n * Does not modify layout items (clones). Creates a new layout array.\n *\n * @param {Array} layout Layout.\n * @param {Boolean} verticalCompact Whether or not to compact the layout\n * vertically.\n * @return {Array} Compacted Layout.\n */\n\n\nfunction compact(layout\n/*: Layout*/\n, compactType\n/*: CompactType*/\n, cols\n/*: number*/\n)\n/*: Layout*/\n{\n // Statics go in the compareWith array right away so items flow around them.\n var compareWith = getStatics(layout); // We go through the items by row and column.\n\n var sorted = sortLayoutItems(layout, compactType); // Holding for new items.\n\n var out = Array(layout.length);\n\n for (var i = 0, len = sorted.length; i < len; i++) {\n var l = cloneLayoutItem(sorted[i]); // Don't move static elements\n\n if (!l.static) {\n l = compactItem(compareWith, l, compactType, cols, sorted); // Add to comparison array. We only collide with items before this one.\n // Statics are already in this array.\n\n compareWith.push(l);\n } // Add to output array to make sure they still come out in the right order.\n\n\n out[layout.indexOf(sorted[i])] = l; // Clear moved flag, if it exists.\n\n l.moved = false;\n }\n\n return out;\n}\n\nvar heightWidth = {\n x: \"w\",\n y: \"h\"\n};\n/**\n * Before moving item down, it will check if the movement will cause collisions and move those items down before.\n */\n\nfunction resolveCompactionCollision(layout\n/*: Layout*/\n, item\n/*: LayoutItem*/\n, moveToCoord\n/*: number*/\n, axis\n/*: \"x\" | \"y\"*/\n) {\n var sizeProp = heightWidth[axis];\n item[axis] += 1;\n var itemIndex = layout.map(function (layoutItem) {\n return layoutItem.i;\n }).indexOf(item.i); // Go through each item we collide with.\n\n for (var i = itemIndex + 1; i < layout.length; i++) {\n var otherItem = layout[i]; // Ignore static items\n\n if (otherItem.static) continue; // Optimization: we can break early if we know we're past this el\n // We can do this b/c it's a sorted layout\n\n if (otherItem.y > item.y + item.h) break;\n\n if (collides(item, otherItem)) {\n resolveCompactionCollision(layout, otherItem, moveToCoord + item[sizeProp], axis);\n }\n }\n\n item[axis] = moveToCoord;\n}\n/**\n * Compact an item in the layout.\n *\n * Modifies item.\n *\n */\n\n\nfunction compactItem(compareWith\n/*: Layout*/\n, l\n/*: LayoutItem*/\n, compactType\n/*: CompactType*/\n, cols\n/*: number*/\n, fullLayout\n/*: Layout*/\n)\n/*: LayoutItem*/\n{\n var compactV = compactType === \"vertical\";\n var compactH = compactType === \"horizontal\";\n\n if (compactV) {\n // Bottom 'y' possible is the bottom of the layout.\n // This allows you to do nice stuff like specify {y: Infinity}\n // This is here because the layout must be sorted in order to get the correct bottom `y`.\n l.y = Math.min(bottom(compareWith), l.y); // Move the element up as far as it can go without colliding.\n\n while (l.y > 0 && !getFirstCollision(compareWith, l)) {\n l.y--;\n }\n } else if (compactH) {\n // Move the element left as far as it can go without colliding.\n while (l.x > 0 && !getFirstCollision(compareWith, l)) {\n l.x--;\n }\n } // Move it down, and keep moving it down if it's colliding.\n\n\n var collides;\n\n while (collides = getFirstCollision(compareWith, l)) {\n if (compactH) {\n resolveCompactionCollision(fullLayout, l, collides.x + collides.w, \"x\");\n } else {\n resolveCompactionCollision(fullLayout, l, collides.y + collides.h, \"y\");\n } // Since we can't grow without bounds horizontally, if we've overflown, let's move it down and try again.\n\n\n if (compactH && l.x + l.w > cols) {\n l.x = cols - l.w;\n l.y++;\n }\n } // Ensure that there are no negative positions\n\n\n l.y = Math.max(l.y, 0);\n l.x = Math.max(l.x, 0);\n return l;\n}\n/**\n * Given a layout, make sure all elements fit within its bounds.\n *\n * Modifies layout items.\n *\n * @param {Array} layout Layout array.\n * @param {Number} bounds Number of columns.\n */\n\n\nfunction correctBounds(layout\n/*: Layout*/\n, bounds\n/*: { cols: number }*/\n)\n/*: Layout*/\n{\n var collidesWith = getStatics(layout);\n\n for (var i = 0, len = layout.length; i < len; i++) {\n var l = layout[i]; // Overflows right\n\n if (l.x + l.w > bounds.cols) l.x = bounds.cols - l.w; // Overflows left\n\n if (l.x < 0) {\n l.x = 0;\n l.w = bounds.cols;\n }\n\n if (!l.static) collidesWith.push(l);else {\n // If this is static and collides with other statics, we must move it down.\n // We have to do something nicer than just letting them overlap.\n while (getFirstCollision(collidesWith, l)) {\n l.y++;\n }\n }\n }\n\n return layout;\n}\n/**\n * Get a layout item by ID. Used so we can override later on if necessary.\n *\n * @param {Array} layout Layout array.\n * @param {String} id ID\n * @return {LayoutItem} Item at ID.\n */\n\n\nfunction getLayoutItem(layout\n/*: Layout*/\n, id\n/*: string*/\n)\n/*: ?LayoutItem*/\n{\n for (var i = 0, len = layout.length; i < len; i++) {\n if (layout[i].i === id) return layout[i];\n }\n}\n/**\n * Returns the first item this layout collides with.\n * It doesn't appear to matter which order we approach this from, although\n * perhaps that is the wrong thing to do.\n *\n * @param {Object} layoutItem Layout item.\n * @return {Object|undefined} A colliding layout item, or undefined.\n */\n\n\nfunction getFirstCollision(layout\n/*: Layout*/\n, layoutItem\n/*: LayoutItem*/\n)\n/*: ?LayoutItem*/\n{\n for (var i = 0, len = layout.length; i < len; i++) {\n if (collides(layout[i], layoutItem)) return layout[i];\n }\n}\n\nfunction getAllCollisions(layout\n/*: Layout*/\n, layoutItem\n/*: LayoutItem*/\n)\n/*: Array
*/\n{\n return layout.filter(function (l) {\n return collides(l, layoutItem);\n });\n}\n/**\n * Get all static elements.\n * @param {Array} layout Array of layout objects.\n * @return {Array} Array of static layout items..\n */\n\n\nfunction getStatics(layout\n/*: Layout*/\n)\n/*: Array */\n{\n return layout.filter(function (l) {\n return l.static;\n });\n}\n/**\n * Move an element. Responsible for doing cascading movements of other elements.\n *\n * Modifies layout items.\n *\n * @param {Array} layout Full layout to modify.\n * @param {LayoutItem} l element to move.\n * @param {Number} [x] X position in grid units.\n * @param {Number} [y] Y position in grid units.\n */\n\n\nfunction moveElement(layout\n/*: Layout*/\n, l\n/*: LayoutItem*/\n, x\n/*: ?number*/\n, y\n/*: ?number*/\n, isUserAction\n/*: ?boolean*/\n, preventCollision\n/*: ?boolean*/\n, compactType\n/*: CompactType*/\n, cols\n/*: number*/\n)\n/*: Layout*/\n{\n // If this is static and not explicitly enabled as draggable,\n // no move is possible, so we can short-circuit this immediately.\n if (l.static && l.isDraggable !== true) return layout; // Short-circuit if nothing to do.\n\n if (l.y === y && l.x === x) return layout;\n log(\"Moving element \".concat(l.i, \" to [\").concat(String(x), \",\").concat(String(y), \"] from [\").concat(l.x, \",\").concat(l.y, \"]\"));\n var oldX = l.x;\n var oldY = l.y; // This is quite a bit faster than extending the object\n\n if (typeof x === \"number\") l.x = x;\n if (typeof y === \"number\") l.y = y;\n l.moved = true; // If this collides with anything, move it.\n // When doing this comparison, we have to sort the items we compare with\n // to ensure, in the case of multiple collisions, that we're getting the\n // nearest collision.\n\n var sorted = sortLayoutItems(layout, compactType);\n var movingUp = compactType === \"vertical\" && typeof y === \"number\" ? oldY >= y : compactType === \"horizontal\" && typeof x === \"number\" ? oldX >= x : false; // $FlowIgnore acceptable modification of read-only array as it was recently cloned\n\n if (movingUp) sorted = sorted.reverse();\n var collisions = getAllCollisions(sorted, l); // There was a collision; abort\n\n if (preventCollision && collisions.length) {\n log(\"Collision prevented on \".concat(l.i, \", reverting.\"));\n l.x = oldX;\n l.y = oldY;\n l.moved = false;\n return layout;\n } // Move each item that collides away from this element.\n\n\n for (var i = 0, len = collisions.length; i < len; i++) {\n var collision = collisions[i];\n log(\"Resolving collision between \".concat(l.i, \" at [\").concat(l.x, \",\").concat(l.y, \"] and \").concat(collision.i, \" at [\").concat(collision.x, \",\").concat(collision.y, \"]\")); // Short circuit so we can't infinite loop\n\n if (collision.moved) continue; // Don't move static items - we have to move *this* element away\n\n if (collision.static) {\n layout = moveElementAwayFromCollision(layout, collision, l, isUserAction, compactType, cols);\n } else {\n layout = moveElementAwayFromCollision(layout, l, collision, isUserAction, compactType, cols);\n }\n }\n\n return layout;\n}\n/**\n * This is where the magic needs to happen - given a collision, move an element away from the collision.\n * We attempt to move it up if there's room, otherwise it goes below.\n *\n * @param {Array} layout Full layout to modify.\n * @param {LayoutItem} collidesWith Layout item we're colliding with.\n * @param {LayoutItem} itemToMove Layout item we're moving.\n */\n\n\nfunction moveElementAwayFromCollision(layout\n/*: Layout*/\n, collidesWith\n/*: LayoutItem*/\n, itemToMove\n/*: LayoutItem*/\n, isUserAction\n/*: ?boolean*/\n, compactType\n/*: CompactType*/\n, cols\n/*: number*/\n)\n/*: Layout*/\n{\n var compactH = compactType === \"horizontal\"; // Compact vertically if not set to horizontal\n\n var compactV = compactType !== \"horizontal\";\n var preventCollision = collidesWith.static; // we're already colliding (not for static items)\n // If there is enough space above the collision to put this element, move it there.\n // We only do this on the main collision as this can get funky in cascades and cause\n // unwanted swapping behavior.\n\n if (isUserAction) {\n // Reset isUserAction flag because we're not in the main collision anymore.\n isUserAction = false; // Make a mock item so we don't modify the item here, only modify in moveElement.\n\n var fakeItem\n /*: LayoutItem*/\n = {\n x: compactH ? Math.max(collidesWith.x - itemToMove.w, 0) : itemToMove.x,\n y: compactV ? Math.max(collidesWith.y - itemToMove.h, 0) : itemToMove.y,\n w: itemToMove.w,\n h: itemToMove.h,\n i: \"-1\"\n }; // No collision? If so, we can go up there; otherwise, we'll end up moving down as normal\n\n if (!getFirstCollision(layout, fakeItem)) {\n log(\"Doing reverse collision on \".concat(itemToMove.i, \" up to [\").concat(fakeItem.x, \",\").concat(fakeItem.y, \"].\"));\n return moveElement(layout, itemToMove, compactH ? fakeItem.x : undefined, compactV ? fakeItem.y : undefined, isUserAction, preventCollision, compactType, cols);\n }\n }\n\n return moveElement(layout, itemToMove, compactH ? itemToMove.x + 1 : undefined, compactV ? itemToMove.y + 1 : undefined, isUserAction, preventCollision, compactType, cols);\n}\n/**\n * Helper to convert a number to a percentage string.\n *\n * @param {Number} num Any number\n * @return {String} That number as a percentage.\n */\n\n\nfunction perc(num\n/*: number*/\n)\n/*: string*/\n{\n return num * 100 + \"%\";\n}\n\nfunction setTransform(_ref)\n/*: Object*/\n{\n var top = _ref.top,\n left = _ref.left,\n width = _ref.width,\n height = _ref.height;\n // Replace unitless items with px\n var translate = \"translate(\".concat(left, \"px,\").concat(top, \"px)\");\n return {\n transform: translate,\n WebkitTransform: translate,\n MozTransform: translate,\n msTransform: translate,\n OTransform: translate,\n width: \"\".concat(width, \"px\"),\n height: \"\".concat(height, \"px\"),\n position: \"absolute\"\n };\n}\n\nfunction setTopLeft(_ref2)\n/*: Object*/\n{\n var top = _ref2.top,\n left = _ref2.left,\n width = _ref2.width,\n height = _ref2.height;\n return {\n top: \"\".concat(top, \"px\"),\n left: \"\".concat(left, \"px\"),\n width: \"\".concat(width, \"px\"),\n height: \"\".concat(height, \"px\"),\n position: \"absolute\"\n };\n}\n/**\n * Get layout items sorted from top left to right and down.\n *\n * @return {Array} Array of layout objects.\n * @return {Array} Layout, sorted static items first.\n */\n\n\nfunction sortLayoutItems(layout\n/*: Layout*/\n, compactType\n/*: CompactType*/\n)\n/*: Layout*/\n{\n if (compactType === \"horizontal\") return sortLayoutItemsByColRow(layout);else return sortLayoutItemsByRowCol(layout);\n}\n/**\n * Sort layout items by row ascending and column ascending.\n *\n * Does not modify Layout.\n */\n\n\nfunction sortLayoutItemsByRowCol(layout\n/*: Layout*/\n)\n/*: Layout*/\n{\n // Slice to clone array as sort modifies\n return layout.slice(0).sort(function (a, b) {\n if (a.y > b.y || a.y === b.y && a.x > b.x) {\n return 1;\n } else if (a.y === b.y && a.x === b.x) {\n // Without this, we can get different sort results in IE vs. Chrome/FF\n return 0;\n }\n\n return -1;\n });\n}\n/**\n * Sort layout items by column ascending then row ascending.\n *\n * Does not modify Layout.\n */\n\n\nfunction sortLayoutItemsByColRow(layout\n/*: Layout*/\n)\n/*: Layout*/\n{\n return layout.slice(0).sort(function (a, b) {\n if (a.x > b.x || a.x === b.x && a.y > b.y) {\n return 1;\n }\n\n return -1;\n });\n}\n/**\n * Generate a layout using the initialLayout and children as a template.\n * Missing entries will be added, extraneous ones will be truncated.\n *\n * Does not modify initialLayout.\n *\n * @param {Array} initialLayout Layout passed in through props.\n * @param {String} breakpoint Current responsive breakpoint.\n * @param {?String} compact Compaction option.\n * @return {Array} Working layout.\n */\n\n\nfunction synchronizeLayoutWithChildren(initialLayout\n/*: Layout*/\n, children\n/*: ReactChildren*/\n, cols\n/*: number*/\n, compactType\n/*: CompactType*/\n)\n/*: Layout*/\n{\n initialLayout = initialLayout || []; // Generate one layout item per child.\n\n var layout\n /*: LayoutItem[]*/\n = [];\n\n _react.default.Children.forEach(children, function (child\n /*: ReactElement */\n , i\n /*: number*/\n ) {\n // Don't overwrite if it already exists.\n var exists = getLayoutItem(initialLayout, String(child.key));\n\n if (exists) {\n layout[i] = cloneLayoutItem(exists);\n } else {\n if (!isProduction && child.props._grid) {\n console.warn(\"`_grid` properties on children have been deprecated as of React 15.2. \" + // eslint-disable-line\n \"Please use `data-grid` or add your properties directly to the `layout`.\");\n }\n\n var g = child.props[\"data-grid\"] || child.props._grid; // Hey, this item has a data-grid property, use it.\n\n if (g) {\n if (!isProduction) {\n validateLayout([g], \"ReactGridLayout.children\");\n } // FIXME clone not really necessary here\n\n\n layout[i] = cloneLayoutItem(_objectSpread(_objectSpread({}, g), {}, {\n i: child.key\n }));\n } else {\n // Nothing provided: ensure this is added to the bottom\n // FIXME clone not really necessary here\n layout[i] = cloneLayoutItem({\n w: 1,\n h: 1,\n x: 0,\n y: bottom(layout),\n i: String(child.key)\n });\n }\n }\n }); // Correct the layout.\n\n\n var correctedLayout = correctBounds(layout, {\n cols: cols\n });\n return compact(correctedLayout, compactType, cols);\n}\n/**\n * Validate a layout. Throws errors.\n *\n * @param {Array} layout Array of layout items.\n * @param {String} [contextName] Context name for errors.\n * @throw {Error} Validation error.\n */\n\n\nfunction validateLayout(layout\n/*: Layout*/\n)\n/*: void*/\n{\n var contextName\n /*: string*/\n = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : \"Layout\";\n var subProps = [\"x\", \"y\", \"w\", \"h\"];\n if (!Array.isArray(layout)) throw new Error(contextName + \" must be an array!\");\n\n for (var i = 0, len = layout.length; i < len; i++) {\n var item = layout[i];\n\n for (var j = 0; j < subProps.length; j++) {\n if (typeof item[subProps[j]] !== \"number\") {\n throw new Error(\"ReactGridLayout: \" + contextName + \"[\" + i + \"].\" + subProps[j] + \" must be a number!\");\n }\n }\n\n if (item.i && typeof item.i !== \"string\") {\n throw new Error(\"ReactGridLayout: \" + contextName + \"[\" + i + \"].i must be a string!\");\n }\n\n if (item.static !== undefined && typeof item.static !== \"boolean\") {\n throw new Error(\"ReactGridLayout: \" + contextName + \"[\" + i + \"].static must be a boolean!\");\n }\n }\n} // Legacy support for verticalCompact: false\n\n\nfunction compactType(props\n/*: ?{ verticalCompact: boolean, compactType: CompactType }*/\n)\n/*: CompactType*/\n{\n var _ref3 = props || {},\n verticalCompact = _ref3.verticalCompact,\n compactType = _ref3.compactType;\n\n return verticalCompact === false ? null : compactType;\n} // Flow can't really figure this out, so we just use Object\n\n\nfunction autoBindHandlers(el\n/*: Object*/\n, fns\n/*: Array */\n)\n/*: void*/\n{\n fns.forEach(function (key) {\n return el[key] = el[key].bind(el);\n });\n}\n\nfunction log() {\n var _console;\n\n if (!DEBUG) return; // eslint-disable-next-line no-console\n\n (_console = console).log.apply(_console, arguments);\n}\n\nvar noop = function noop() {};\n\nexports.noop = noop;","/**\n * This method returns the first argument it receives.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {*} value Any value.\n * @returns {*} Returns `value`.\n * @example\n *\n * var object = { 'a': 1 };\n *\n * console.log(_.identity(object) === object);\n * // => true\n */\nfunction identity(value) {\n return value;\n}\n\nmodule.exports = identity;\n","import * as React from 'react';\n/**\n * Private module reserved for @material-ui/x packages.\n */\n\nexport default function useId(idOverride) {\n var _React$useState = React.useState(idOverride),\n defaultId = _React$useState[0],\n setDefaultId = _React$useState[1];\n\n var id = idOverride || defaultId;\n React.useEffect(function () {\n if (defaultId == null) {\n // Fallback to this default id when possible.\n // Use the random value for client-side rendering only.\n // We can't use it server-side.\n setDefaultId(\"mui-\".concat(Math.round(Math.random() * 1e5)));\n }\n }, [defaultId]);\n return id;\n}","import arrayLikeToArray from \"@babel/runtime/helpers/esm/arrayLikeToArray\";\nexport default function _unsupportedIterableToArray(o, minLen) {\n if (!o) return;\n if (typeof o === \"string\") return arrayLikeToArray(o, minLen);\n var n = Object.prototype.toString.call(o).slice(8, -1);\n if (n === \"Object\" && o.constructor) n = o.constructor.name;\n if (n === \"Map\" || n === \"Set\") return Array.from(o);\n if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen);\n}","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _slicedToArray from \"@babel/runtime/helpers/esm/slicedToArray\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport PropTypes from 'prop-types';\nimport clsx from 'clsx';\nimport { refType } from '@material-ui/utils';\nimport useControlled from '../utils/useControlled';\nimport useFormControl from '../FormControl/useFormControl';\nimport withStyles from '../styles/withStyles';\nimport IconButton from '../IconButton';\nexport var styles = {\n root: {\n padding: 9\n },\n checked: {},\n disabled: {},\n input: {\n cursor: 'inherit',\n position: 'absolute',\n opacity: 0,\n width: '100%',\n height: '100%',\n top: 0,\n left: 0,\n margin: 0,\n padding: 0,\n zIndex: 1\n }\n};\n/**\n * @ignore - internal component.\n */\n\nvar SwitchBase = /*#__PURE__*/React.forwardRef(function SwitchBase(props, ref) {\n var autoFocus = props.autoFocus,\n checkedProp = props.checked,\n checkedIcon = props.checkedIcon,\n classes = props.classes,\n className = props.className,\n defaultChecked = props.defaultChecked,\n disabledProp = props.disabled,\n icon = props.icon,\n id = props.id,\n inputProps = props.inputProps,\n inputRef = props.inputRef,\n name = props.name,\n onBlur = props.onBlur,\n onChange = props.onChange,\n onFocus = props.onFocus,\n readOnly = props.readOnly,\n required = props.required,\n tabIndex = props.tabIndex,\n type = props.type,\n value = props.value,\n other = _objectWithoutProperties(props, [\"autoFocus\", \"checked\", \"checkedIcon\", \"classes\", \"className\", \"defaultChecked\", \"disabled\", \"icon\", \"id\", \"inputProps\", \"inputRef\", \"name\", \"onBlur\", \"onChange\", \"onFocus\", \"readOnly\", \"required\", \"tabIndex\", \"type\", \"value\"]);\n\n var _useControlled = useControlled({\n controlled: checkedProp,\n default: Boolean(defaultChecked),\n name: 'SwitchBase',\n state: 'checked'\n }),\n _useControlled2 = _slicedToArray(_useControlled, 2),\n checked = _useControlled2[0],\n setCheckedState = _useControlled2[1];\n\n var muiFormControl = useFormControl();\n\n var handleFocus = function handleFocus(event) {\n if (onFocus) {\n onFocus(event);\n }\n\n if (muiFormControl && muiFormControl.onFocus) {\n muiFormControl.onFocus(event);\n }\n };\n\n var handleBlur = function handleBlur(event) {\n if (onBlur) {\n onBlur(event);\n }\n\n if (muiFormControl && muiFormControl.onBlur) {\n muiFormControl.onBlur(event);\n }\n };\n\n var handleInputChange = function handleInputChange(event) {\n var newChecked = event.target.checked;\n setCheckedState(newChecked);\n\n if (onChange) {\n // TODO v5: remove the second argument.\n onChange(event, newChecked);\n }\n };\n\n var disabled = disabledProp;\n\n if (muiFormControl) {\n if (typeof disabled === 'undefined') {\n disabled = muiFormControl.disabled;\n }\n }\n\n var hasLabelFor = type === 'checkbox' || type === 'radio';\n return /*#__PURE__*/React.createElement(IconButton, _extends({\n component: \"span\",\n className: clsx(classes.root, className, checked && classes.checked, disabled && classes.disabled),\n disabled: disabled,\n tabIndex: null,\n role: undefined,\n onFocus: handleFocus,\n onBlur: handleBlur,\n ref: ref\n }, other), /*#__PURE__*/React.createElement(\"input\", _extends({\n autoFocus: autoFocus,\n checked: checkedProp,\n defaultChecked: defaultChecked,\n className: classes.input,\n disabled: disabled,\n id: hasLabelFor && id,\n name: name,\n onChange: handleInputChange,\n readOnly: readOnly,\n ref: inputRef,\n required: required,\n tabIndex: tabIndex,\n type: type,\n value: value\n }, inputProps)), checked ? checkedIcon : icon);\n}); // NB: If changed, please update Checkbox, Switch and Radio\n// so that the API documentation is updated.\n\nprocess.env.NODE_ENV !== \"production\" ? SwitchBase.propTypes = {\n /**\n * If `true`, the `input` element will be focused during the first mount.\n */\n autoFocus: PropTypes.bool,\n\n /**\n * If `true`, the component is checked.\n */\n checked: PropTypes.bool,\n\n /**\n * The icon to display when the component is checked.\n */\n checkedIcon: PropTypes.node.isRequired,\n\n /**\n * Override or extend the styles applied to the component.\n * See [CSS API](#css) below for more details.\n */\n classes: PropTypes.object.isRequired,\n\n /**\n * @ignore\n */\n className: PropTypes.string,\n\n /**\n * @ignore\n */\n defaultChecked: PropTypes.bool,\n\n /**\n * If `true`, the switch will be disabled.\n */\n disabled: PropTypes.bool,\n\n /**\n * The icon to display when the component is unchecked.\n */\n icon: PropTypes.node.isRequired,\n\n /**\n * The id of the `input` element.\n */\n id: PropTypes.string,\n\n /**\n * [Attributes](https://developer.mozilla.org/en-US/docs/Web/HTML/Element/input#Attributes) applied to the `input` element.\n */\n inputProps: PropTypes.object,\n\n /**\n * Pass a ref to the `input` element.\n */\n inputRef: refType,\n\n /*\n * @ignore\n */\n name: PropTypes.string,\n\n /**\n * @ignore\n */\n onBlur: PropTypes.func,\n\n /**\n * Callback fired when the state is changed.\n *\n * @param {object} event The event source of the callback.\n * You can pull out the new checked state by accessing `event.target.checked` (boolean).\n */\n onChange: PropTypes.func,\n\n /**\n * @ignore\n */\n onFocus: PropTypes.func,\n\n /**\n * It prevents the user from changing the value of the field\n * (not from interacting with the field).\n */\n readOnly: PropTypes.bool,\n\n /**\n * If `true`, the `input` element will be required.\n */\n required: PropTypes.bool,\n\n /**\n * @ignore\n */\n tabIndex: PropTypes.oneOfType([PropTypes.number, PropTypes.string]),\n\n /**\n * The input component prop `type`.\n */\n type: PropTypes.string.isRequired,\n\n /**\n * The value of the component.\n */\n value: PropTypes.any\n} : void 0;\nexport default withStyles(styles, {\n name: 'PrivateSwitchBase'\n})(SwitchBase);","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _every from \"lodash/every\";\nimport _find from \"lodash/find\";\nimport _isFunction from \"lodash/isFunction\";\nimport _throttle from \"lodash/throttle\";\nimport _sortBy from \"lodash/sortBy\";\nimport _get from \"lodash/get\";\nimport _range from \"lodash/range\";\nimport _isNil from \"lodash/isNil\";\nimport _isBoolean from \"lodash/isBoolean\";\nimport _isArray from \"lodash/isArray\";\n\nfunction _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _iterableToArrayLimit(arr, i) { if (typeof Symbol === \"undefined\" || !(Symbol.iterator in Object(arr))) return; var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nfunction _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport React, { Component, cloneElement, isValidElement, createElement } from 'react';\nimport classNames from 'classnames';\nimport { Surface } from '../container/Surface';\nimport { Layer } from '../container/Layer';\nimport { Tooltip } from '../component/Tooltip';\nimport { Legend } from '../component/Legend';\nimport { Curve } from '../shape/Curve';\nimport { Cross } from '../shape/Cross';\nimport { Sector } from '../shape/Sector';\nimport { Dot } from '../shape/Dot';\nimport { isInRectangle, Rectangle } from '../shape/Rectangle';\nimport { findAllByType, findChildByType, getDisplayName, parseChildIndex, validateWidthHeight, isChildrenEqual, renderByOrder, getReactEventByType } from '../util/ReactUtils';\nimport { CartesianAxis } from '../cartesian/CartesianAxis';\nimport { Brush } from '../cartesian/Brush';\nimport { getOffset, calculateChartCoordinate } from '../util/DOMUtils';\nimport { getAnyElementOfObject, hasDuplicate, uniqueId, isNumber, findEntryInArray } from '../util/DataUtils';\nimport { calculateActiveTickIndex, getMainColorOfGraphicItem, getBarSizeList, getBarPosition, appendOffsetOfLegend, getLegendProps, combineEventHandlers, getTicksOfAxis, getCoordinatesOfGrid, getStackedDataOfItem, parseErrorBarsOfAxis, getBandSizeOfAxis, getStackGroupsByAxisId, isCategoricalAxis, getDomainOfItemsWithSameAxis, getDomainOfStackGroups, getDomainOfDataByKey, parseSpecifiedDomain, parseDomainOfCategoryAxis, getTooltipItem } from '../util/ChartUtils';\nimport { detectReferenceElementsDomain } from '../util/DetectReferenceElementsDomain';\nimport { inRangeOfSector, polarToCartesian } from '../util/PolarUtils';\nimport { shallowEqual } from '../util/ShallowEqual';\nimport { eventCenter, SYNC_EVENT } from '../util/Events';\nimport { filterProps, adaptEventHandlers } from '../util/types';\nvar ORIENT_MAP = {\n xAxis: ['bottom', 'top'],\n yAxis: ['left', 'right']\n};\nvar originCoordinate = {\n x: 0,\n y: 0\n}; // use legacy isFinite only if there is a problem (aka IE)\n// eslint-disable-next-line no-restricted-globals\n\nvar isFinit = Number.isFinite ? Number.isFinite : isFinite;\nvar defer = // eslint-disable-next-line no-nested-ternary\ntypeof requestAnimationFrame === 'function' ? requestAnimationFrame : typeof setImmediate === 'function' ? setImmediate : setTimeout;\nvar deferClear = // eslint-disable-next-line no-nested-ternary\ntypeof cancelAnimationFrame === 'function' ? cancelAnimationFrame : typeof clearImmediate === 'function' ? clearImmediate : clearTimeout;\n\nvar calculateTooltipPos = function calculateTooltipPos(rangeObj, layout) {\n if (layout === 'horizontal') {\n return rangeObj.x;\n }\n\n if (layout === 'vertical') {\n return rangeObj.y;\n }\n\n if (layout === 'centric') {\n return rangeObj.angle;\n }\n\n return rangeObj.radius;\n};\n\nvar getActiveCoordinate = function getActiveCoordinate(layout, tooltipTicks, activeIndex, rangeObj) {\n var entry = tooltipTicks.find(function (tick) {\n return tick && tick.index === activeIndex;\n });\n\n if (entry) {\n if (layout === 'horizontal') {\n return {\n x: entry.coordinate,\n y: rangeObj.y\n };\n }\n\n if (layout === 'vertical') {\n return {\n x: rangeObj.x,\n y: entry.coordinate\n };\n }\n\n if (layout === 'centric') {\n var _angle = entry.coordinate;\n var _radius = rangeObj.radius;\n return _objectSpread(_objectSpread(_objectSpread({}, rangeObj), polarToCartesian(rangeObj.cx, rangeObj.cy, _radius, _angle)), {}, {\n angle: _angle,\n radius: _radius\n });\n }\n\n var radius = entry.coordinate;\n var angle = rangeObj.angle;\n return _objectSpread(_objectSpread(_objectSpread({}, rangeObj), polarToCartesian(rangeObj.cx, rangeObj.cy, radius, angle)), {}, {\n angle: angle,\n radius: radius\n });\n }\n\n return originCoordinate;\n};\n\nvar getDisplayedData = function getDisplayedData(data, _ref, item) {\n var graphicalItems = _ref.graphicalItems,\n dataStartIndex = _ref.dataStartIndex,\n dataEndIndex = _ref.dataEndIndex;\n var itemsData = (graphicalItems || []).reduce(function (result, child) {\n var itemData = child.props.data;\n\n if (itemData && itemData.length) {\n return [].concat(_toConsumableArray(result), _toConsumableArray(itemData));\n }\n\n return result;\n }, []);\n\n if (itemsData && itemsData.length > 0) {\n return itemsData;\n }\n\n if (item && item.props && item.props.data && item.props.data.length > 0) {\n return item.props.data;\n }\n\n if (data && data.length && isNumber(dataStartIndex) && isNumber(dataEndIndex)) {\n return data.slice(dataStartIndex, dataEndIndex + 1);\n }\n\n return [];\n};\n/**\n * Get the content to be displayed in the tooltip\n * @param {Object} state Current state\n * @param {Array} chartData The data defined in chart\n * @param {Number} activeIndex Active index of data\n * @param {String} activeLabel Active label of data\n * @return {Array} The content of tooltip\n */\n\n\nvar getTooltipContent = function getTooltipContent(state, chartData, activeIndex, activeLabel) {\n var graphicalItems = state.graphicalItems,\n tooltipAxis = state.tooltipAxis;\n var displayedData = getDisplayedData(chartData, state);\n\n if (activeIndex < 0 || !graphicalItems || !graphicalItems.length || activeIndex >= displayedData.length) {\n return null;\n } // get data by activeIndex when the axis don't allow duplicated category\n\n\n return graphicalItems.reduce(function (result, child) {\n var hide = child.props.hide;\n\n if (hide) {\n return result;\n }\n\n var data = child.props.data;\n var payload;\n\n if (tooltipAxis.dataKey && !tooltipAxis.allowDuplicatedCategory) {\n // graphic child has data props\n var entries = data === undefined ? displayedData : data;\n payload = findEntryInArray(entries, tooltipAxis.dataKey, activeLabel);\n } else {\n payload = data && data[activeIndex] || displayedData[activeIndex];\n }\n\n if (!payload) {\n return result;\n }\n\n return [].concat(_toConsumableArray(result), [getTooltipItem(child, payload)]);\n }, []);\n};\n/**\n * Returns tooltip data based on a mouse position (as a parameter or in state)\n * @param {Object} state current state\n * @param {Array} chartData the data defined in chart\n * @param {String} layout The layout type of chart\n * @param {Object} rangeObj { x, y } coordinates\n * @return {Object} Tooltip data data\n */\n\n\nvar getTooltipData = function getTooltipData(state, chartData, layout, rangeObj) {\n var rangeData = rangeObj || {\n x: state.chartX,\n y: state.chartY\n };\n var pos = calculateTooltipPos(rangeData, layout);\n var ticks = state.orderedTooltipTicks,\n axis = state.tooltipAxis,\n tooltipTicks = state.tooltipTicks;\n var activeIndex = calculateActiveTickIndex(pos, ticks, tooltipTicks, axis);\n\n if (activeIndex >= 0 && tooltipTicks) {\n var activeLabel = tooltipTicks[activeIndex] && tooltipTicks[activeIndex].value;\n var activePayload = getTooltipContent(state, chartData, activeIndex, activeLabel);\n var activeCoordinate = getActiveCoordinate(layout, ticks, activeIndex, rangeData);\n return {\n activeTooltipIndex: activeIndex,\n activeLabel: activeLabel,\n activePayload: activePayload,\n activeCoordinate: activeCoordinate\n };\n }\n\n return null;\n};\n/**\n * Get the configuration of axis by the options of axis instance\n * @param {Object} props Latest props\n * @param {Array} axes The instance of axes\n * @param {Array} graphicalItems The instances of item\n * @param {String} axisType The type of axis, xAxis - x-axis, yAxis - y-axis\n * @param {String} axisIdKey The unique id of an axis\n * @param {Object} stackGroups The items grouped by axisId and stackId\n * @param {Number} dataStartIndex The start index of the data series when a brush is applied\n * @param {Number} dataEndIndex The end index of the data series when a brush is applied\n * @return {Object} Configuration\n */\n\n\nvar getAxisMapByAxes = function getAxisMapByAxes(props, _ref2) {\n var axes = _ref2.axes,\n graphicalItems = _ref2.graphicalItems,\n axisType = _ref2.axisType,\n axisIdKey = _ref2.axisIdKey,\n stackGroups = _ref2.stackGroups,\n dataStartIndex = _ref2.dataStartIndex,\n dataEndIndex = _ref2.dataEndIndex;\n var layout = props.layout,\n children = props.children,\n stackOffset = props.stackOffset;\n var isCategorical = isCategoricalAxis(layout, axisType); // Eliminate duplicated axes\n\n var axisMap = axes.reduce(function (result, child) {\n var _child$props = child.props,\n type = _child$props.type,\n dataKey = _child$props.dataKey,\n allowDataOverflow = _child$props.allowDataOverflow,\n allowDuplicatedCategory = _child$props.allowDuplicatedCategory,\n scale = _child$props.scale,\n ticks = _child$props.ticks;\n var axisId = child.props[axisIdKey];\n var displayedData = getDisplayedData(props.data, {\n graphicalItems: graphicalItems.filter(function (item) {\n return item.props[axisIdKey] === axisId;\n }),\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n });\n var len = displayedData.length;\n\n if (!result[axisId]) {\n var domain, duplicateDomain, categoricalDomain;\n\n if (dataKey) {\n // has dataKey in \n domain = getDomainOfDataByKey(displayedData, dataKey, type);\n\n if (type === 'category' && isCategorical) {\n // the field type is category data and this axis is catrgorical axis\n var duplicate = hasDuplicate(domain);\n\n if (allowDuplicatedCategory && duplicate) {\n duplicateDomain = domain; // When category axis has duplicated text, serial numbers are used to generate scale\n\n domain = _range(0, len);\n } else if (!allowDuplicatedCategory) {\n // remove duplicated category\n domain = parseDomainOfCategoryAxis(child.props.domain, domain, child).reduce(function (finalDomain, entry) {\n return finalDomain.indexOf(entry) >= 0 ? finalDomain : [].concat(_toConsumableArray(finalDomain), [entry]);\n }, []);\n }\n } else if (type === 'category') {\n // the field type is category data and this axis is numerical axis\n if (!allowDuplicatedCategory) {\n domain = parseDomainOfCategoryAxis(child.props.domain, domain, child).reduce(function (finalDomain, entry) {\n return finalDomain.indexOf(entry) >= 0 || entry === '' || _isNil(entry) ? finalDomain : [].concat(_toConsumableArray(finalDomain), [entry]);\n }, []);\n } else {\n // eliminate undefined or null or empty string\n domain = domain.filter(function (entry) {\n return entry !== '' && !_isNil(entry);\n });\n }\n } else if (type === 'number') {\n // the field type is numerical\n var errorBarsDomain = parseErrorBarsOfAxis(displayedData, graphicalItems.filter(function (item) {\n return item.props[axisIdKey] === axisId && !item.props.hide;\n }), dataKey, axisType);\n\n if (errorBarsDomain) {\n domain = errorBarsDomain;\n }\n }\n\n if (isCategorical && (type === 'number' || scale !== 'auto')) {\n categoricalDomain = getDomainOfDataByKey(displayedData, dataKey, 'category');\n }\n } else if (isCategorical) {\n // the axis is a categorical axis\n domain = _range(0, len);\n } else if (stackGroups && stackGroups[axisId] && stackGroups[axisId].hasStack && type === 'number') {\n // when stackOffset is 'expand', the domain may be calculated as [0, 1.000000000002]\n domain = stackOffset === 'expand' ? [0, 1] : getDomainOfStackGroups(stackGroups[axisId].stackGroups, dataStartIndex, dataEndIndex);\n } else {\n domain = getDomainOfItemsWithSameAxis(displayedData, graphicalItems.filter(function (item) {\n return item.props[axisIdKey] === axisId && !item.props.hide;\n }), type, true);\n }\n\n if (type === 'number') {\n // To detect wether there is any reference lines whose props alwaysShow is true\n domain = detectReferenceElementsDomain(children, domain, axisId, axisType, ticks);\n\n if (child.props.domain) {\n domain = parseSpecifiedDomain(child.props.domain, domain, allowDataOverflow);\n }\n } else if (type === 'category' && child.props.domain) {\n var axisDomain = child.props.domain;\n var isDomainValidate = domain.every(function (entry) {\n return axisDomain.indexOf(entry) >= 0;\n });\n\n if (isDomainValidate) {\n domain = axisDomain;\n }\n }\n\n return _objectSpread(_objectSpread({}, result), {}, _defineProperty({}, axisId, _objectSpread(_objectSpread({}, child.props), {}, {\n axisType: axisType,\n domain: domain,\n categoricalDomain: categoricalDomain,\n duplicateDomain: duplicateDomain,\n originalDomain: child.props.domain,\n isCategorical: isCategorical,\n layout: layout\n })));\n }\n\n return result;\n }, {});\n return axisMap;\n};\n/**\n * Get the configuration of axis by the options of item,\n * this kind of axis does not display in chart\n * @param {Object} props Latest props\n * @param {Array} graphicalItems The instances of item\n * @param {ReactElement} Axis Axis Component\n * @param {String} axisType The type of axis, xAxis - x-axis, yAxis - y-axis\n * @param {String} axisIdKey The unique id of an axis\n * @param {Object} stackGroups The items grouped by axisId and stackId\n * @param {Number} dataStartIndex The start index of the data series when a brush is applied\n * @param {Number} dataEndIndex The end index of the data series when a brush is applied\n * @return {Object} Configuration\n */\n\n\nvar getAxisMapByItems = function getAxisMapByItems(props, _ref3) {\n var graphicalItems = _ref3.graphicalItems,\n Axis = _ref3.Axis,\n axisType = _ref3.axisType,\n axisIdKey = _ref3.axisIdKey,\n stackGroups = _ref3.stackGroups,\n dataStartIndex = _ref3.dataStartIndex,\n dataEndIndex = _ref3.dataEndIndex;\n var layout = props.layout,\n children = props.children;\n var displayedData = getDisplayedData(props.data, {\n graphicalItems: graphicalItems,\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n });\n var len = displayedData.length;\n var isCategorical = isCategoricalAxis(layout, axisType);\n var index = -1; // The default type of x-axis is category axis,\n // The default contents of x-axis is the serial numbers of data\n // The default type of y-axis is number axis\n // The default contents of y-axis is the domain of data\n\n var axisMap = graphicalItems.reduce(function (result, child) {\n var axisId = child.props[axisIdKey];\n\n if (!result[axisId]) {\n index++;\n var domain;\n\n if (isCategorical) {\n domain = _range(0, len);\n } else if (stackGroups && stackGroups[axisId] && stackGroups[axisId].hasStack) {\n domain = getDomainOfStackGroups(stackGroups[axisId].stackGroups, dataStartIndex, dataEndIndex);\n domain = detectReferenceElementsDomain(children, domain, axisId, axisType);\n } else {\n domain = parseSpecifiedDomain(Axis.defaultProps.domain, getDomainOfItemsWithSameAxis(displayedData, graphicalItems.filter(function (item) {\n return item.props[axisIdKey] === axisId && !item.props.hide;\n }), 'number'), Axis.defaultProps.allowDataOverflow);\n domain = detectReferenceElementsDomain(children, domain, axisId, axisType);\n }\n\n return _objectSpread(_objectSpread({}, result), {}, _defineProperty({}, axisId, _objectSpread(_objectSpread({\n axisType: axisType\n }, Axis.defaultProps), {}, {\n hide: true,\n orientation: _get(ORIENT_MAP, \"\".concat(axisType, \".\").concat(index % 2), null),\n domain: domain,\n originalDomain: Axis.defaultProps.domain,\n isCategorical: isCategorical,\n layout: layout // specify scale when no Axis\n // scale: isCategorical ? 'band' : 'linear',\n\n })));\n }\n\n return result;\n }, {});\n return axisMap;\n};\n/**\n * Get the configuration of all x-axis or y-axis\n * @param {Object} props Latest props\n * @param {String} axisType The type of axis\n * @param {Array} graphicalItems The instances of item\n * @param {Object} stackGroups The items grouped by axisId and stackId\n * @param {Number} dataStartIndex The start index of the data series when a brush is applied\n * @param {Number} dataEndIndex The end index of the data series when a brush is applied\n * @return {Object} Configuration\n */\n\n\nvar getAxisMap = function getAxisMap(props, _ref4) {\n var _ref4$axisType = _ref4.axisType,\n axisType = _ref4$axisType === void 0 ? 'xAxis' : _ref4$axisType,\n AxisComp = _ref4.AxisComp,\n graphicalItems = _ref4.graphicalItems,\n stackGroups = _ref4.stackGroups,\n dataStartIndex = _ref4.dataStartIndex,\n dataEndIndex = _ref4.dataEndIndex;\n var children = props.children;\n var axisIdKey = \"\".concat(axisType, \"Id\"); // Get all the instance of Axis\n\n var axes = findAllByType(children, AxisComp);\n var axisMap = {};\n\n if (axes && axes.length) {\n axisMap = getAxisMapByAxes(props, {\n axes: axes,\n graphicalItems: graphicalItems,\n axisType: axisType,\n axisIdKey: axisIdKey,\n stackGroups: stackGroups,\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n });\n } else if (graphicalItems && graphicalItems.length) {\n axisMap = getAxisMapByItems(props, {\n Axis: AxisComp,\n graphicalItems: graphicalItems,\n axisType: axisType,\n axisIdKey: axisIdKey,\n stackGroups: stackGroups,\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n });\n }\n\n return axisMap;\n};\n\nvar tooltipTicksGenerator = function tooltipTicksGenerator(axisMap) {\n var axis = getAnyElementOfObject(axisMap);\n var tooltipTicks = getTicksOfAxis(axis, false, true);\n return {\n tooltipTicks: tooltipTicks,\n orderedTooltipTicks: _sortBy(tooltipTicks, function (o) {\n return o.coordinate;\n }),\n tooltipAxis: axis,\n tooltipAxisBandSize: getBandSizeOfAxis(axis)\n };\n};\n/**\n * Returns default, reset state for the categorical chart.\n * @param {Object} props Props object to use when creating the default state\n * @return {Object} Whole new state\n */\n\n\nvar createDefaultState = function createDefaultState(props) {\n var children = props.children,\n defaultShowTooltip = props.defaultShowTooltip;\n var brushItem = findChildByType(children, Brush.displayName);\n var startIndex = brushItem && brushItem.props && brushItem.props.startIndex || 0;\n var endIndex = brushItem && brushItem.props && brushItem.props.endIndex || props.data && props.data.length - 1 || 0;\n return {\n chartX: 0,\n chartY: 0,\n dataStartIndex: startIndex,\n dataEndIndex: endIndex,\n activeTooltipIndex: -1,\n isTooltipActive: !_isNil(defaultShowTooltip) ? defaultShowTooltip : false\n };\n};\n\nvar hasGraphicalBarItem = function hasGraphicalBarItem(graphicalItems) {\n if (!graphicalItems || !graphicalItems.length) {\n return false;\n }\n\n return graphicalItems.some(function (item) {\n var name = getDisplayName(item && item.type);\n return name && name.indexOf('Bar') >= 0;\n });\n};\n\nvar getAxisNameByLayout = function getAxisNameByLayout(layout) {\n if (layout === 'horizontal') {\n return {\n numericAxisName: 'yAxis',\n cateAxisName: 'xAxis'\n };\n }\n\n if (layout === 'vertical') {\n return {\n numericAxisName: 'xAxis',\n cateAxisName: 'yAxis'\n };\n }\n\n if (layout === 'centric') {\n return {\n numericAxisName: 'radiusAxis',\n cateAxisName: 'angleAxis'\n };\n }\n\n return {\n numericAxisName: 'angleAxis',\n cateAxisName: 'radiusAxis'\n };\n};\n/**\n * Calculate the offset of main part in the svg element\n * @param {Object} props Latest props\n * graphicalItems The instances of item\n * xAxisMap The configuration of x-axis\n * yAxisMap The configuration of y-axis\n * @param {Object} prevLegendBBox the boundary box of legend\n * @return {Object} The offset of main part in the svg element\n */\n\n\nvar calculateOffset = function calculateOffset(_ref5, prevLegendBBox) {\n var props = _ref5.props,\n graphicalItems = _ref5.graphicalItems,\n _ref5$xAxisMap = _ref5.xAxisMap,\n xAxisMap = _ref5$xAxisMap === void 0 ? {} : _ref5$xAxisMap,\n _ref5$yAxisMap = _ref5.yAxisMap,\n yAxisMap = _ref5$yAxisMap === void 0 ? {} : _ref5$yAxisMap;\n var width = props.width,\n height = props.height,\n children = props.children;\n var margin = props.margin || {};\n var brushItem = findChildByType(children, Brush.displayName);\n var legendItem = findChildByType(children, Legend.displayName);\n var offsetH = Object.keys(yAxisMap).reduce(function (result, id) {\n var entry = yAxisMap[id];\n var orientation = entry.orientation;\n\n if (!entry.mirror && !entry.hide) {\n return _objectSpread(_objectSpread({}, result), {}, _defineProperty({}, orientation, result[orientation] + entry.width));\n }\n\n return result;\n }, {\n left: margin.left || 0,\n right: margin.right || 0\n });\n var offsetV = Object.keys(xAxisMap).reduce(function (result, id) {\n var entry = xAxisMap[id];\n var orientation = entry.orientation;\n\n if (!entry.mirror && !entry.hide) {\n return _objectSpread(_objectSpread({}, result), {}, _defineProperty({}, orientation, _get(result, \"\".concat(orientation)) + entry.height));\n }\n\n return result;\n }, {\n top: margin.top || 0,\n bottom: margin.bottom || 0\n });\n\n var offset = _objectSpread(_objectSpread({}, offsetV), offsetH);\n\n var brushBottom = offset.bottom;\n\n if (brushItem) {\n offset.bottom += brushItem.props.height || Brush.defaultProps.height;\n }\n\n if (legendItem && prevLegendBBox) {\n offset = appendOffsetOfLegend(offset, graphicalItems, props, prevLegendBBox);\n }\n\n return _objectSpread(_objectSpread({\n brushBottom: brushBottom\n }, offset), {}, {\n width: width - offset.left - offset.right,\n height: height - offset.top - offset.bottom\n });\n};\n\nexport var generateCategoricalChart = function generateCategoricalChart(_ref6) {\n var _class, _temp;\n\n var chartName = _ref6.chartName,\n GraphicalChild = _ref6.GraphicalChild,\n _ref6$defaultTooltipE = _ref6.defaultTooltipEventType,\n defaultTooltipEventType = _ref6$defaultTooltipE === void 0 ? 'axis' : _ref6$defaultTooltipE,\n _ref6$validateTooltip = _ref6.validateTooltipEventTypes,\n validateTooltipEventTypes = _ref6$validateTooltip === void 0 ? ['axis'] : _ref6$validateTooltip,\n axisComponents = _ref6.axisComponents,\n legendContent = _ref6.legendContent,\n formatAxisMap = _ref6.formatAxisMap,\n defaultProps = _ref6.defaultProps;\n\n var getFormatItems = function getFormatItems(props, currentState) {\n var graphicalItems = currentState.graphicalItems,\n stackGroups = currentState.stackGroups,\n offset = currentState.offset,\n updateId = currentState.updateId,\n dataStartIndex = currentState.dataStartIndex,\n dataEndIndex = currentState.dataEndIndex;\n var barSize = props.barSize,\n layout = props.layout,\n barGap = props.barGap,\n barCategoryGap = props.barCategoryGap,\n globalMaxBarSize = props.maxBarSize;\n\n var _getAxisNameByLayout = getAxisNameByLayout(layout),\n numericAxisName = _getAxisNameByLayout.numericAxisName,\n cateAxisName = _getAxisNameByLayout.cateAxisName;\n\n var hasBar = hasGraphicalBarItem(graphicalItems);\n var sizeList = hasBar && getBarSizeList({\n barSize: barSize,\n stackGroups: stackGroups\n });\n var formatedItems = [];\n graphicalItems.forEach(function (item, index) {\n var displayedData = getDisplayedData(props.data, {\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n }, item);\n var _item$props = item.props,\n dataKey = _item$props.dataKey,\n childMaxBarSize = _item$props.maxBarSize;\n var numericAxisId = item.props[\"\".concat(numericAxisName, \"Id\")];\n var cateAxisId = item.props[\"\".concat(cateAxisName, \"Id\")];\n var axisObj = axisComponents.reduce(function (result, entry) {\n var _objectSpread6;\n\n var axisMap = currentState[\"\".concat(entry.axisType, \"Map\")];\n var id = item.props[\"\".concat(entry.axisType, \"Id\")];\n var axis = axisMap && axisMap[id];\n return _objectSpread(_objectSpread({}, result), {}, (_objectSpread6 = {}, _defineProperty(_objectSpread6, entry.axisType, axis), _defineProperty(_objectSpread6, \"\".concat(entry.axisType, \"Ticks\"), getTicksOfAxis(axis)), _objectSpread6));\n }, {});\n var cateAxis = axisObj[cateAxisName];\n var cateTicks = axisObj[\"\".concat(cateAxisName, \"Ticks\")];\n var stackedData = stackGroups && stackGroups[numericAxisId] && stackGroups[numericAxisId].hasStack && getStackedDataOfItem(item, stackGroups[numericAxisId].stackGroups);\n var itemIsBar = getDisplayName(item.type).indexOf('Bar') >= 0;\n var bandSize = getBandSizeOfAxis(cateAxis, cateTicks);\n var barPosition = [];\n\n if (itemIsBar) {\n var barBandSize = getBandSizeOfAxis(cateAxis, cateTicks, true); // 如果是bar,计算bar的位置\n\n var maxBarSize = _isNil(childMaxBarSize) ? globalMaxBarSize : childMaxBarSize;\n barPosition = getBarPosition({\n barGap: barGap,\n barCategoryGap: barCategoryGap,\n bandSize: barBandSize !== bandSize ? barBandSize : bandSize,\n sizeList: sizeList[cateAxisId],\n maxBarSize: maxBarSize\n });\n\n if (barBandSize !== bandSize) {\n barPosition = barPosition.map(function (pos) {\n return _objectSpread(_objectSpread({}, pos), {}, {\n position: _objectSpread(_objectSpread({}, pos.position), {}, {\n offset: pos.position.offset - barBandSize / 2\n })\n });\n });\n }\n }\n\n var componsedFn = item && item.type && item.type.getComposedData;\n\n if (componsedFn) {\n var _objectSpread7;\n\n formatedItems.push({\n props: _objectSpread(_objectSpread({}, componsedFn(_objectSpread(_objectSpread({}, axisObj), {}, {\n displayedData: displayedData,\n props: props,\n dataKey: dataKey,\n item: item,\n bandSize: bandSize,\n barPosition: barPosition,\n offset: offset,\n stackedData: stackedData,\n layout: layout,\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n }))), {}, (_objectSpread7 = {\n key: item.key || \"item-\".concat(index)\n }, _defineProperty(_objectSpread7, numericAxisName, axisObj[numericAxisName]), _defineProperty(_objectSpread7, cateAxisName, axisObj[cateAxisName]), _defineProperty(_objectSpread7, \"animationId\", updateId), _objectSpread7)),\n childIndex: parseChildIndex(item, props.children),\n item: item\n });\n }\n });\n return formatedItems;\n };\n /**\n * The AxisMaps are expensive to render on large data sets\n * so provide the ability to store them in state and only update them when necessary\n * they are dependent upon the start and end index of\n * the brush so it's important that this method is called _after_\n * the state is updated with any new start/end indices\n *\n * @param {Object} props The props object to be used for updating the axismaps\n * dataStartIndex: The start index of the data series when a brush is applied\n * dataEndIndex: The end index of the data series when a brush is applied\n * updateId: The update id\n * @param {Object} prevState Prev state\n * @return {Object} state New state to set\n */\n\n\n var updateStateOfAxisMapsOffsetAndStackGroups = function updateStateOfAxisMapsOffsetAndStackGroups(_ref7, prevState) {\n var props = _ref7.props,\n dataStartIndex = _ref7.dataStartIndex,\n dataEndIndex = _ref7.dataEndIndex,\n updateId = _ref7.updateId;\n\n if (!validateWidthHeight({\n props: props\n })) {\n return null;\n }\n\n var children = props.children,\n layout = props.layout,\n stackOffset = props.stackOffset,\n data = props.data,\n reverseStackOrder = props.reverseStackOrder;\n\n var _getAxisNameByLayout2 = getAxisNameByLayout(layout),\n numericAxisName = _getAxisNameByLayout2.numericAxisName,\n cateAxisName = _getAxisNameByLayout2.cateAxisName;\n\n var graphicalItems = findAllByType(children, GraphicalChild);\n var stackGroups = getStackGroupsByAxisId(data, graphicalItems, \"\".concat(numericAxisName, \"Id\"), \"\".concat(cateAxisName, \"Id\"), stackOffset, reverseStackOrder);\n var axisObj = axisComponents.reduce(function (result, entry) {\n var name = \"\".concat(entry.axisType, \"Map\");\n return _objectSpread(_objectSpread({}, result), {}, _defineProperty({}, name, getAxisMap(props, _objectSpread(_objectSpread({}, entry), {}, {\n graphicalItems: graphicalItems,\n stackGroups: entry.axisType === numericAxisName && stackGroups,\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n }))));\n }, {});\n var offset = calculateOffset(_objectSpread(_objectSpread({}, axisObj), {}, {\n props: props,\n graphicalItems: graphicalItems\n }), prevState === null || prevState === void 0 ? void 0 : prevState.legendBBox);\n Object.keys(axisObj).forEach(function (key) {\n axisObj[key] = formatAxisMap(props, axisObj[key], offset, key.replace('Map', ''), chartName);\n });\n var cateAxisMap = axisObj[\"\".concat(cateAxisName, \"Map\")];\n var ticksObj = tooltipTicksGenerator(cateAxisMap);\n var formatedGraphicalItems = getFormatItems(props, _objectSpread(_objectSpread({}, axisObj), {}, {\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex,\n updateId: updateId,\n graphicalItems: graphicalItems,\n stackGroups: stackGroups,\n offset: offset\n }));\n return _objectSpread(_objectSpread({\n formatedGraphicalItems: formatedGraphicalItems,\n graphicalItems: graphicalItems,\n offset: offset,\n stackGroups: stackGroups\n }, ticksObj), axisObj);\n };\n\n return _temp = _class = /*#__PURE__*/function (_Component) {\n _inherits(CategoricalChartWrapper, _Component);\n\n var _super = _createSuper(CategoricalChartWrapper);\n\n // todo join specific chart propTypes\n function CategoricalChartWrapper(_props) {\n var _this;\n\n _classCallCheck(this, CategoricalChartWrapper);\n\n _this = _super.call(this, _props);\n _this.uniqueChartId = void 0;\n _this.clipPathId = void 0;\n _this.legendInstance = void 0;\n _this.deferId = void 0;\n _this.container = void 0;\n\n _this.clearDeferId = function () {\n if (!_isNil(_this.deferId) && deferClear) {\n deferClear(_this.deferId);\n }\n\n _this.deferId = null;\n };\n\n _this.handleLegendBBoxUpdate = function (box) {\n if (box && _this.legendInstance) {\n var _this$state = _this.state,\n dataStartIndex = _this$state.dataStartIndex,\n dataEndIndex = _this$state.dataEndIndex,\n updateId = _this$state.updateId;\n\n _this.setState(_objectSpread({\n legendBBox: box\n }, updateStateOfAxisMapsOffsetAndStackGroups({\n props: _this.props,\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex,\n updateId: updateId\n }, _objectSpread(_objectSpread({}, _this.state), {}, {\n legendBBox: box\n }))));\n }\n };\n\n _this.handleReceiveSyncEvent = function (cId, chartId, data) {\n var syncId = _this.props.syncId;\n\n if (syncId === cId && chartId !== _this.uniqueChartId) {\n _this.clearDeferId();\n\n _this.deferId = defer && defer(_this.applySyncEvent.bind(_assertThisInitialized(_this), data));\n }\n };\n\n _this.handleBrushChange = function (_ref8) {\n var startIndex = _ref8.startIndex,\n endIndex = _ref8.endIndex;\n\n // Only trigger changes if the extents of the brush have actually changed\n if (startIndex !== _this.state.dataStartIndex || endIndex !== _this.state.dataEndIndex) {\n var updateId = _this.state.updateId;\n\n _this.setState(function () {\n return _objectSpread({\n dataStartIndex: startIndex,\n dataEndIndex: endIndex\n }, updateStateOfAxisMapsOffsetAndStackGroups({\n props: _this.props,\n dataStartIndex: startIndex,\n dataEndIndex: endIndex,\n updateId: updateId\n }, _this.state));\n });\n\n _this.triggerSyncEvent({\n dataStartIndex: startIndex,\n dataEndIndex: endIndex\n });\n }\n };\n\n _this.handleMouseEnter = function (e) {\n var onMouseEnter = _this.props.onMouseEnter;\n\n var mouse = _this.getMouseInfo(e);\n\n if (mouse) {\n var nextState = _objectSpread(_objectSpread({}, mouse), {}, {\n isTooltipActive: true\n });\n\n _this.setState(nextState);\n\n _this.triggerSyncEvent(nextState);\n\n if (_isFunction(onMouseEnter)) {\n onMouseEnter(nextState, e);\n }\n }\n };\n\n _this.triggeredAfterMouseMove = function (e) {\n var onMouseMove = _this.props.onMouseMove;\n\n var mouse = _this.getMouseInfo(e);\n\n var nextState = mouse ? _objectSpread(_objectSpread({}, mouse), {}, {\n isTooltipActive: true\n }) : {\n isTooltipActive: false\n };\n\n _this.setState(nextState);\n\n _this.triggerSyncEvent(nextState);\n\n if (_isFunction(onMouseMove)) {\n onMouseMove(nextState, e);\n }\n };\n\n _this.handleItemMouseEnter = function (el) {\n _this.setState(function () {\n return {\n isTooltipActive: true,\n activeItem: el,\n activePayload: el.tooltipPayload,\n activeCoordinate: el.tooltipPosition || {\n x: el.cx,\n y: el.cy\n }\n };\n });\n };\n\n _this.handleItemMouseLeave = function () {\n _this.setState(function () {\n return {\n isTooltipActive: false\n };\n });\n };\n\n _this.handleMouseMove = function (e) {\n if (e && _isFunction(e.persist)) {\n e.persist();\n }\n\n _this.triggeredAfterMouseMove(e);\n };\n\n _this.handleMouseLeave = function (e) {\n var onMouseLeave = _this.props.onMouseLeave;\n var nextState = {\n isTooltipActive: false\n };\n\n _this.setState(nextState);\n\n _this.triggerSyncEvent(nextState);\n\n if (_isFunction(onMouseLeave)) {\n onMouseLeave(nextState, e);\n }\n\n _this.cancelThrottledTriggerAfterMouseMove();\n };\n\n _this.handleOuterEvent = function (e) {\n var eventName = getReactEventByType(e);\n\n var event = _get(_this.props, \"\".concat(eventName));\n\n if (eventName && _isFunction(event)) {\n var mouse;\n\n if (/.*touch.*/i.test(eventName)) {\n mouse = _this.getMouseInfo(e.changedTouches[0]);\n } else {\n mouse = _this.getMouseInfo(e);\n }\n\n var handler = event;\n handler(mouse, e);\n }\n };\n\n _this.handleClick = function (e) {\n var onClick = _this.props.onClick;\n\n var mouse = _this.getMouseInfo(e);\n\n if (mouse) {\n var nextState = _objectSpread(_objectSpread({}, mouse), {}, {\n isTooltipActive: true\n });\n\n _this.setState(nextState);\n\n _this.triggerSyncEvent(nextState);\n\n if (_isFunction(onClick)) {\n onClick(nextState, e);\n }\n }\n };\n\n _this.handleMouseDown = function (e) {\n var onMouseDown = _this.props.onMouseDown;\n\n if (_isFunction(onMouseDown)) {\n var mouse = _this.getMouseInfo(e);\n\n onMouseDown(mouse, e);\n }\n };\n\n _this.handleMouseUp = function (e) {\n var onMouseUp = _this.props.onMouseUp;\n\n if (_isFunction(onMouseUp)) {\n var mouse = _this.getMouseInfo(e);\n\n onMouseUp(mouse, e);\n }\n };\n\n _this.handleTouchMove = function (e) {\n if (e.changedTouches != null && e.changedTouches.length > 0) {\n _this.handleMouseMove(e.changedTouches[0]);\n }\n };\n\n _this.handleTouchStart = function (e) {\n if (e.changedTouches != null && e.changedTouches.length > 0) {\n _this.handleMouseDown(e.changedTouches[0]);\n }\n };\n\n _this.handleTouchEnd = function (e) {\n if (e.changedTouches != null && e.changedTouches.length > 0) {\n _this.handleMouseUp(e.changedTouches[0]);\n }\n };\n\n _this.verticalCoordinatesGenerator = function (_ref9) {\n var xAxis = _ref9.xAxis,\n width = _ref9.width,\n height = _ref9.height,\n offset = _ref9.offset;\n return getCoordinatesOfGrid(CartesianAxis.getTicks(_objectSpread(_objectSpread(_objectSpread({}, CartesianAxis.defaultProps), xAxis), {}, {\n ticks: getTicksOfAxis(xAxis, true),\n viewBox: {\n x: 0,\n y: 0,\n width: width,\n height: height\n }\n })), offset.left, offset.left + offset.width);\n };\n\n _this.horizontalCoordinatesGenerator = function (_ref10) {\n var yAxis = _ref10.yAxis,\n width = _ref10.width,\n height = _ref10.height,\n offset = _ref10.offset;\n return getCoordinatesOfGrid(CartesianAxis.getTicks(_objectSpread(_objectSpread(_objectSpread({}, CartesianAxis.defaultProps), yAxis), {}, {\n ticks: getTicksOfAxis(yAxis, true),\n viewBox: {\n x: 0,\n y: 0,\n width: width,\n height: height\n }\n })), offset.top, offset.top + offset.height);\n };\n\n _this.axesTicksGenerator = function (axis) {\n return getTicksOfAxis(axis, true);\n };\n\n _this.renderCursor = function (element) {\n var _this$state2 = _this.state,\n isTooltipActive = _this$state2.isTooltipActive,\n activeCoordinate = _this$state2.activeCoordinate,\n activePayload = _this$state2.activePayload,\n offset = _this$state2.offset,\n activeTooltipIndex = _this$state2.activeTooltipIndex;\n\n var tooltipEventType = _this.getTooltipEventType();\n\n if (!element || !element.props.cursor || !isTooltipActive || !activeCoordinate || tooltipEventType !== 'axis') {\n return null;\n }\n\n var layout = _this.props.layout;\n var restProps;\n var cursorComp = Curve;\n\n if (chartName === 'ScatterChart') {\n restProps = activeCoordinate;\n cursorComp = Cross;\n } else if (chartName === 'BarChart') {\n restProps = _this.getCursorRectangle();\n cursorComp = Rectangle;\n } else if (layout === 'radial') {\n var _this$getCursorPoints = _this.getCursorPoints(),\n cx = _this$getCursorPoints.cx,\n cy = _this$getCursorPoints.cy,\n radius = _this$getCursorPoints.radius,\n startAngle = _this$getCursorPoints.startAngle,\n endAngle = _this$getCursorPoints.endAngle;\n\n restProps = {\n cx: cx,\n cy: cy,\n startAngle: startAngle,\n endAngle: endAngle,\n innerRadius: radius,\n outerRadius: radius\n };\n cursorComp = Sector;\n } else {\n restProps = {\n points: _this.getCursorPoints()\n };\n cursorComp = Curve;\n }\n\n var key = element.key || '_recharts-cursor';\n\n var cursorProps = _objectSpread(_objectSpread(_objectSpread(_objectSpread({\n stroke: '#ccc',\n pointerEvents: 'none'\n }, offset), restProps), filterProps(element.props.cursor)), {}, {\n payload: activePayload,\n payloadIndex: activeTooltipIndex,\n key: key,\n className: 'recharts-tooltip-cursor'\n });\n\n return /*#__PURE__*/isValidElement(element.props.cursor) ? /*#__PURE__*/cloneElement(element.props.cursor, cursorProps) : /*#__PURE__*/createElement(cursorComp, cursorProps);\n };\n\n _this.renderPolarAxis = function (element, displayName, index) {\n var axisType = _get(element, 'type.axisType');\n\n var axisMap = _get(_this.state, \"\".concat(axisType, \"Map\"));\n\n var axisOption = axisMap[element.props[\"\".concat(axisType, \"Id\")]];\n return /*#__PURE__*/cloneElement(element, _objectSpread(_objectSpread({}, axisOption), {}, {\n className: axisType,\n key: element.key || \"\".concat(displayName, \"-\").concat(index),\n ticks: getTicksOfAxis(axisOption, true)\n }));\n };\n\n _this.renderXAxis = function (element, displayName, index) {\n var xAxisMap = _this.state.xAxisMap;\n var axisObj = xAxisMap[element.props.xAxisId];\n return _this.renderAxis(axisObj, element, displayName, index);\n };\n\n _this.renderYAxis = function (element, displayName, index) {\n var yAxisMap = _this.state.yAxisMap;\n var axisObj = yAxisMap[element.props.yAxisId];\n return _this.renderAxis(axisObj, element, displayName, index);\n };\n\n _this.renderGrid = function (element) {\n var _this$state3 = _this.state,\n xAxisMap = _this$state3.xAxisMap,\n yAxisMap = _this$state3.yAxisMap,\n offset = _this$state3.offset;\n var _this$props = _this.props,\n width = _this$props.width,\n height = _this$props.height;\n var xAxis = getAnyElementOfObject(xAxisMap);\n\n var yAxisWithFiniteDomain = _find(yAxisMap, function (axis) {\n return _every(axis.domain, isFinit);\n });\n\n var yAxis = yAxisWithFiniteDomain || getAnyElementOfObject(yAxisMap);\n var props = element.props || {};\n return /*#__PURE__*/cloneElement(element, {\n key: element.key || 'grid',\n x: isNumber(props.x) ? props.x : offset.left,\n y: isNumber(props.y) ? props.y : offset.top,\n width: isNumber(props.width) ? props.width : offset.width,\n height: isNumber(props.height) ? props.height : offset.height,\n xAxis: xAxis,\n yAxis: yAxis,\n offset: offset,\n chartWidth: width,\n chartHeight: height,\n verticalCoordinatesGenerator: props.verticalCoordinatesGenerator || _this.verticalCoordinatesGenerator,\n horizontalCoordinatesGenerator: props.horizontalCoordinatesGenerator || _this.horizontalCoordinatesGenerator\n });\n };\n\n _this.renderPolarGrid = function (element) {\n var _element$props = element.props,\n radialLines = _element$props.radialLines,\n polarAngles = _element$props.polarAngles,\n polarRadius = _element$props.polarRadius;\n var _this$state4 = _this.state,\n radiusAxisMap = _this$state4.radiusAxisMap,\n angleAxisMap = _this$state4.angleAxisMap;\n var radiusAxis = getAnyElementOfObject(radiusAxisMap);\n var angleAxis = getAnyElementOfObject(angleAxisMap);\n var cx = angleAxis.cx,\n cy = angleAxis.cy,\n innerRadius = angleAxis.innerRadius,\n outerRadius = angleAxis.outerRadius;\n var props = element.props || {};\n return /*#__PURE__*/cloneElement(element, {\n polarAngles: _isArray(polarAngles) ? polarAngles : getTicksOfAxis(angleAxis, true).map(function (entry) {\n return entry.coordinate;\n }),\n polarRadius: _isArray(polarRadius) ? polarRadius : getTicksOfAxis(radiusAxis, true).map(function (entry) {\n return entry.coordinate;\n }),\n cx: cx,\n cy: cy,\n innerRadius: innerRadius,\n outerRadius: outerRadius,\n key: element.key || 'polar-grid',\n radialLines: radialLines\n });\n };\n\n _this.renderLegend = function () {\n var formatedGraphicalItems = _this.state.formatedGraphicalItems;\n var _this$props2 = _this.props,\n children = _this$props2.children,\n width = _this$props2.width,\n height = _this$props2.height;\n var margin = _this.props.margin || {};\n var legendWidth = width - (margin.left || 0) - (margin.right || 0);\n var props = getLegendProps({\n children: children,\n formatedGraphicalItems: formatedGraphicalItems,\n legendWidth: legendWidth,\n legendContent: legendContent\n });\n\n if (!props) {\n return null;\n }\n\n var item = props.item,\n otherProps = _objectWithoutProperties(props, [\"item\"]);\n\n return /*#__PURE__*/cloneElement(item, _objectSpread(_objectSpread({}, otherProps), {}, {\n chartWidth: width,\n chartHeight: height,\n margin: margin,\n ref: function ref(legend) {\n _this.legendInstance = legend;\n },\n onBBoxUpdate: _this.handleLegendBBoxUpdate\n }));\n };\n\n _this.renderTooltip = function () {\n var children = _this.props.children;\n var tooltipItem = findChildByType(children, Tooltip.displayName);\n\n if (!tooltipItem) {\n return null;\n }\n\n var _this$state5 = _this.state,\n isTooltipActive = _this$state5.isTooltipActive,\n activeCoordinate = _this$state5.activeCoordinate,\n activePayload = _this$state5.activePayload,\n activeLabel = _this$state5.activeLabel,\n offset = _this$state5.offset;\n return /*#__PURE__*/cloneElement(tooltipItem, {\n viewBox: _objectSpread(_objectSpread({}, offset), {}, {\n x: offset.left,\n y: offset.top\n }),\n active: isTooltipActive,\n label: activeLabel,\n payload: isTooltipActive ? activePayload : [],\n coordinate: activeCoordinate\n });\n };\n\n _this.renderBrush = function (element) {\n var _this$props3 = _this.props,\n margin = _this$props3.margin,\n data = _this$props3.data;\n var _this$state6 = _this.state,\n offset = _this$state6.offset,\n dataStartIndex = _this$state6.dataStartIndex,\n dataEndIndex = _this$state6.dataEndIndex,\n updateId = _this$state6.updateId; // TODO: update brush when children update\n\n return /*#__PURE__*/cloneElement(element, {\n key: element.key || '_recharts-brush',\n onChange: combineEventHandlers(_this.handleBrushChange, null, element.props.onChange),\n data: data,\n x: isNumber(element.props.x) ? element.props.x : offset.left,\n y: isNumber(element.props.y) ? element.props.y : offset.top + offset.height + offset.brushBottom - (margin.bottom || 0),\n width: isNumber(element.props.width) ? element.props.width : offset.width,\n startIndex: dataStartIndex,\n endIndex: dataEndIndex,\n updateId: \"brush-\".concat(updateId)\n });\n };\n\n _this.renderReferenceElement = function (element, displayName, index) {\n if (!element) {\n return null;\n }\n\n var _assertThisInitialize = _assertThisInitialized(_this),\n clipPathId = _assertThisInitialize.clipPathId;\n\n var _this$state7 = _this.state,\n xAxisMap = _this$state7.xAxisMap,\n yAxisMap = _this$state7.yAxisMap,\n offset = _this$state7.offset;\n var _element$props2 = element.props,\n xAxisId = _element$props2.xAxisId,\n yAxisId = _element$props2.yAxisId;\n return /*#__PURE__*/cloneElement(element, {\n key: element.key || \"\".concat(displayName, \"-\").concat(index),\n xAxis: xAxisMap[xAxisId],\n yAxis: yAxisMap[yAxisId],\n viewBox: {\n x: offset.left,\n y: offset.top,\n width: offset.width,\n height: offset.height\n },\n clipPathId: clipPathId\n });\n };\n\n _this.renderActivePoints = function (_ref11) {\n var item = _ref11.item,\n activePoint = _ref11.activePoint,\n basePoint = _ref11.basePoint,\n childIndex = _ref11.childIndex,\n isRange = _ref11.isRange;\n var result = [];\n var key = item.props.key;\n var _item$item$props = item.item.props,\n activeDot = _item$item$props.activeDot,\n dataKey = _item$item$props.dataKey;\n\n var dotProps = _objectSpread(_objectSpread({\n index: childIndex,\n dataKey: dataKey,\n cx: activePoint.x,\n cy: activePoint.y,\n r: 4,\n fill: getMainColorOfGraphicItem(item.item),\n strokeWidth: 2,\n stroke: '#fff',\n payload: activePoint.payload,\n value: activePoint.value,\n key: \"\".concat(key, \"-activePoint-\").concat(childIndex)\n }, filterProps(activeDot)), adaptEventHandlers(activeDot));\n\n result.push(CategoricalChartWrapper.renderActiveDot(activeDot, dotProps));\n\n if (basePoint) {\n result.push(CategoricalChartWrapper.renderActiveDot(activeDot, _objectSpread(_objectSpread({}, dotProps), {}, {\n cx: basePoint.x,\n cy: basePoint.y,\n key: \"\".concat(key, \"-basePoint-\").concat(childIndex)\n })));\n } else if (isRange) {\n result.push(null);\n }\n\n return result;\n };\n\n _this.renderGraphicChild = function (element, displayName, index) {\n var item = _this.filterFormatItem(element, displayName, index);\n\n if (!item) {\n return null;\n }\n\n var tooltipEventType = _this.getTooltipEventType();\n\n var _this$state8 = _this.state,\n isTooltipActive = _this$state8.isTooltipActive,\n tooltipAxis = _this$state8.tooltipAxis,\n activeTooltipIndex = _this$state8.activeTooltipIndex,\n activeLabel = _this$state8.activeLabel;\n var children = _this.props.children;\n var tooltipItem = findChildByType(children, Tooltip.displayName);\n var _item$props2 = item.props,\n points = _item$props2.points,\n isRange = _item$props2.isRange,\n baseLine = _item$props2.baseLine;\n var _item$item$props2 = item.item.props,\n activeDot = _item$item$props2.activeDot,\n hide = _item$item$props2.hide;\n var hasActive = !hide && isTooltipActive && tooltipItem && activeDot && activeTooltipIndex >= 0;\n var itemEvents = {};\n\n if (tooltipEventType !== 'axis' && tooltipItem && tooltipItem.props.trigger === 'click') {\n itemEvents = {\n onClick: combineEventHandlers(_this.handleItemMouseEnter, null, element.props.onCLick)\n };\n } else if (tooltipEventType !== 'axis') {\n itemEvents = {\n onMouseLeave: combineEventHandlers(_this.handleItemMouseLeave, null, element.props.onMouseLeave),\n onMouseEnter: combineEventHandlers(_this.handleItemMouseEnter, null, element.props.onMouseEnter)\n };\n }\n\n var graphicalItem = /*#__PURE__*/cloneElement(element, _objectSpread(_objectSpread({}, item.props), itemEvents));\n\n function findWithPayload(entry) {\n // TODO needs to verify dataKey is Function\n return typeof tooltipAxis.dataKey === 'function' ? tooltipAxis.dataKey(entry.payload) : null;\n }\n\n if (hasActive) {\n var activePoint, basePoint;\n\n if (tooltipAxis.dataKey && !tooltipAxis.allowDuplicatedCategory) {\n // number transform to string\n var specifiedKey = typeof tooltipAxis.dataKey === 'function' ? findWithPayload : 'payload.'.concat(tooltipAxis.dataKey.toString());\n activePoint = findEntryInArray(points, specifiedKey, activeLabel);\n basePoint = isRange && baseLine && findEntryInArray(baseLine, specifiedKey, activeLabel);\n } else {\n activePoint = points[activeTooltipIndex];\n basePoint = isRange && baseLine && baseLine[activeTooltipIndex];\n }\n\n if (!_isNil(activePoint)) {\n return [graphicalItem].concat(_toConsumableArray(_this.renderActivePoints({\n item: item,\n activePoint: activePoint,\n basePoint: basePoint,\n childIndex: activeTooltipIndex,\n isRange: isRange\n })));\n }\n }\n\n if (isRange) {\n return [graphicalItem, null, null];\n }\n\n return [graphicalItem, null];\n };\n\n _this.renderCustomized = function (element) {\n return /*#__PURE__*/cloneElement(element, _objectSpread(_objectSpread({}, _this.props), _this.state));\n };\n\n _this.uniqueChartId = _isNil(_props.id) ? uniqueId('recharts') : _props.id;\n _this.clipPathId = \"\".concat(_this.uniqueChartId, \"-clip\");\n\n if (_props.throttleDelay) {\n _this.triggeredAfterMouseMove = _throttle(_this.triggeredAfterMouseMove, _props.throttleDelay);\n }\n\n _this.state = {};\n return _this;\n }\n /* eslint-disable react/no-did-mount-set-state */\n\n\n _createClass(CategoricalChartWrapper, [{\n key: \"componentDidMount\",\n value: function componentDidMount() {\n if (!_isNil(this.props.syncId)) {\n this.addListener();\n }\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps) {\n // add syncId\n if (_isNil(prevProps.syncId) && !_isNil(this.props.syncId)) {\n this.addListener();\n } // remove syncId\n\n\n if (!_isNil(prevProps.syncId) && _isNil(this.props.syncId)) {\n this.removeListener();\n }\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n this.clearDeferId();\n\n if (!_isNil(this.props.syncId)) {\n this.removeListener();\n }\n\n this.cancelThrottledTriggerAfterMouseMove();\n }\n }, {\n key: \"cancelThrottledTriggerAfterMouseMove\",\n value: function cancelThrottledTriggerAfterMouseMove() {\n if (typeof this.triggeredAfterMouseMove.cancel === 'function') {\n this.triggeredAfterMouseMove.cancel();\n }\n }\n }, {\n key: \"getTooltipEventType\",\n value: function getTooltipEventType() {\n var tooltipItem = findChildByType(this.props.children, Tooltip.displayName);\n\n if (tooltipItem && _isBoolean(tooltipItem.props.shared)) {\n var eventType = tooltipItem.props.shared ? 'axis' : 'item';\n return validateTooltipEventTypes.indexOf(eventType) >= 0 ? eventType : defaultTooltipEventType;\n }\n\n return defaultTooltipEventType;\n }\n /**\n * Get the information of mouse in chart, return null when the mouse is not in the chart\n * @param {Object} event The event object\n * @return {Object} Mouse data\n */\n\n }, {\n key: \"getMouseInfo\",\n value: function getMouseInfo(event) {\n if (!this.container) {\n return null;\n }\n\n var containerOffset = getOffset(this.container);\n var e = calculateChartCoordinate(event, containerOffset);\n var rangeObj = this.inRange(e.chartX, e.chartY);\n\n if (!rangeObj) {\n return null;\n }\n\n var _this$state9 = this.state,\n xAxisMap = _this$state9.xAxisMap,\n yAxisMap = _this$state9.yAxisMap;\n var tooltipEventType = this.getTooltipEventType();\n\n if (tooltipEventType !== 'axis' && xAxisMap && yAxisMap) {\n var xScale = getAnyElementOfObject(xAxisMap).scale;\n var yScale = getAnyElementOfObject(yAxisMap).scale;\n var xValue = xScale && xScale.invert ? xScale.invert(e.chartX) : null;\n var yValue = yScale && yScale.invert ? yScale.invert(e.chartY) : null;\n return _objectSpread(_objectSpread({}, e), {}, {\n xValue: xValue,\n yValue: yValue\n });\n }\n\n var toolTipData = getTooltipData(this.state, this.props.data, this.props.layout, rangeObj);\n\n if (toolTipData) {\n return _objectSpread(_objectSpread({}, e), toolTipData);\n }\n\n return null;\n }\n }, {\n key: \"getCursorRectangle\",\n value: function getCursorRectangle() {\n var layout = this.props.layout;\n var _this$state10 = this.state,\n activeCoordinate = _this$state10.activeCoordinate,\n offset = _this$state10.offset,\n tooltipAxisBandSize = _this$state10.tooltipAxisBandSize;\n var halfSize = tooltipAxisBandSize / 2;\n return {\n stroke: 'none',\n fill: '#ccc',\n x: layout === 'horizontal' ? activeCoordinate.x - halfSize : offset.left + 0.5,\n y: layout === 'horizontal' ? offset.top + 0.5 : activeCoordinate.y - halfSize,\n width: layout === 'horizontal' ? tooltipAxisBandSize : offset.width - 1,\n height: layout === 'horizontal' ? offset.height - 1 : tooltipAxisBandSize\n };\n }\n }, {\n key: \"getCursorPoints\",\n value: function getCursorPoints() {\n var layout = this.props.layout;\n var _this$state11 = this.state,\n activeCoordinate = _this$state11.activeCoordinate,\n offset = _this$state11.offset;\n var x1, y1, x2, y2;\n\n if (layout === 'horizontal') {\n x1 = activeCoordinate.x;\n x2 = x1;\n y1 = offset.top;\n y2 = offset.top + offset.height;\n } else if (layout === 'vertical') {\n y1 = activeCoordinate.y;\n y2 = y1;\n x1 = offset.left;\n x2 = offset.left + offset.width;\n } else if (!_isNil(activeCoordinate.cx) || !_isNil(activeCoordinate.cy)) {\n if (layout === 'centric') {\n var cx = activeCoordinate.cx,\n cy = activeCoordinate.cy,\n innerRadius = activeCoordinate.innerRadius,\n outerRadius = activeCoordinate.outerRadius,\n angle = activeCoordinate.angle;\n var innerPoint = polarToCartesian(cx, cy, innerRadius, angle);\n var outerPoint = polarToCartesian(cx, cy, outerRadius, angle);\n x1 = innerPoint.x;\n y1 = innerPoint.y;\n x2 = outerPoint.x;\n y2 = outerPoint.y;\n } else {\n var _cx = activeCoordinate.cx,\n _cy = activeCoordinate.cy,\n radius = activeCoordinate.radius,\n startAngle = activeCoordinate.startAngle,\n endAngle = activeCoordinate.endAngle;\n var startPoint = polarToCartesian(_cx, _cy, radius, startAngle);\n var endPoint = polarToCartesian(_cx, _cy, radius, endAngle);\n return {\n points: [startPoint, endPoint],\n cx: _cx,\n cy: _cy,\n radius: radius,\n startAngle: startAngle,\n endAngle: endAngle\n };\n }\n }\n\n return [{\n x: x1,\n y: y1\n }, {\n x: x2,\n y: y2\n }];\n }\n }, {\n key: \"inRange\",\n value: function inRange(x, y) {\n var layout = this.props.layout;\n\n if (layout === 'horizontal' || layout === 'vertical') {\n var offset = this.state.offset;\n var isInRange = x >= offset.left && x <= offset.left + offset.width && y >= offset.top && y <= offset.top + offset.height;\n return isInRange ? {\n x: x,\n y: y\n } : null;\n }\n\n var _this$state12 = this.state,\n angleAxisMap = _this$state12.angleAxisMap,\n radiusAxisMap = _this$state12.radiusAxisMap;\n\n if (angleAxisMap && radiusAxisMap) {\n var angleAxis = getAnyElementOfObject(angleAxisMap);\n return inRangeOfSector({\n x: x,\n y: y\n }, angleAxis);\n }\n\n return null;\n }\n }, {\n key: \"parseEventsOfWrapper\",\n value: function parseEventsOfWrapper() {\n var children = this.props.children;\n var tooltipEventType = this.getTooltipEventType();\n var tooltipItem = findChildByType(children, Tooltip.displayName);\n var tooltipEvents = {};\n\n if (tooltipItem && tooltipEventType === 'axis') {\n if (tooltipItem.props.trigger === 'click') {\n tooltipEvents = {\n onClick: this.handleClick\n };\n } else {\n tooltipEvents = {\n onMouseEnter: this.handleMouseEnter,\n onMouseMove: this.handleMouseMove,\n onMouseLeave: this.handleMouseLeave,\n onTouchMove: this.handleTouchMove,\n onTouchStart: this.handleTouchStart,\n onTouchEnd: this.handleTouchEnd\n };\n }\n }\n\n var outerEvents = adaptEventHandlers(this.props, this.handleOuterEvent);\n return _objectSpread(_objectSpread({}, outerEvents), tooltipEvents);\n }\n /* eslint-disable no-underscore-dangle */\n\n }, {\n key: \"addListener\",\n value: function addListener() {\n eventCenter.on(SYNC_EVENT, this.handleReceiveSyncEvent);\n\n if (eventCenter.setMaxListeners && eventCenter._maxListeners) {\n eventCenter.setMaxListeners(eventCenter._maxListeners + 1);\n }\n }\n }, {\n key: \"removeListener\",\n value: function removeListener() {\n eventCenter.removeListener(SYNC_EVENT, this.handleReceiveSyncEvent);\n\n if (eventCenter.setMaxListeners && eventCenter._maxListeners) {\n eventCenter.setMaxListeners(eventCenter._maxListeners - 1);\n }\n }\n }, {\n key: \"triggerSyncEvent\",\n value: function triggerSyncEvent(data) {\n var syncId = this.props.syncId;\n\n if (!_isNil(syncId)) {\n eventCenter.emit(SYNC_EVENT, syncId, this.uniqueChartId, data);\n }\n }\n }, {\n key: \"applySyncEvent\",\n value: function applySyncEvent(data) {\n var _this$props4 = this.props,\n layout = _this$props4.layout,\n syncMethod = _this$props4.syncMethod;\n var updateId = this.state.updateId;\n var dataStartIndex = data.dataStartIndex,\n dataEndIndex = data.dataEndIndex;\n\n if (!_isNil(data.dataStartIndex) || !_isNil(data.dataEndIndex)) {\n this.setState(_objectSpread({\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex\n }, updateStateOfAxisMapsOffsetAndStackGroups({\n props: this.props,\n dataStartIndex: dataStartIndex,\n dataEndIndex: dataEndIndex,\n updateId: updateId\n }, this.state)));\n } else if (!_isNil(data.activeTooltipIndex)) {\n var chartX = data.chartX,\n chartY = data.chartY;\n var activeTooltipIndex = data.activeTooltipIndex;\n var _this$state13 = this.state,\n offset = _this$state13.offset,\n tooltipTicks = _this$state13.tooltipTicks;\n\n if (!offset) {\n return;\n }\n\n if (typeof syncMethod === 'function') {\n // Call a callback function. If there is an application specific algorithm\n activeTooltipIndex = syncMethod(tooltipTicks, data);\n } else if (syncMethod === 'value') {\n // Set activeTooltipIndex to the index with the same value as data.activeLabel\n // For loop instead of findIndex because the latter is very slow in some browsers\n activeTooltipIndex = -1; // in case we cannot find the element\n\n for (var i = 0; i < tooltipTicks.length; i++) {\n if (tooltipTicks[i].value === data.activeLabel) {\n activeTooltipIndex = i;\n break;\n }\n }\n }\n\n var viewBox = _objectSpread(_objectSpread({}, offset), {}, {\n x: offset.left,\n y: offset.top\n }); // When a categotical chart is combined with another chart, the value of chartX\n // and chartY may beyond the boundaries.\n\n\n var validateChartX = Math.min(chartX, viewBox.x + viewBox.width);\n var validateChartY = Math.min(chartY, viewBox.y + viewBox.height);\n var activeLabel = tooltipTicks[activeTooltipIndex] && tooltipTicks[activeTooltipIndex].value;\n var activePayload = getTooltipContent(this.state, this.props.data, activeTooltipIndex);\n var activeCoordinate = tooltipTicks[activeTooltipIndex] ? {\n x: layout === 'horizontal' ? tooltipTicks[activeTooltipIndex].coordinate : validateChartX,\n y: layout === 'horizontal' ? validateChartY : tooltipTicks[activeTooltipIndex].coordinate\n } : originCoordinate;\n this.setState(_objectSpread(_objectSpread({}, data), {}, {\n activeLabel: activeLabel,\n activeCoordinate: activeCoordinate,\n activePayload: activePayload,\n activeTooltipIndex: activeTooltipIndex\n }));\n } else {\n this.setState(data);\n }\n }\n }, {\n key: \"filterFormatItem\",\n value: function filterFormatItem(item, displayName, childIndex) {\n var formatedGraphicalItems = this.state.formatedGraphicalItems;\n\n for (var i = 0, len = formatedGraphicalItems.length; i < len; i++) {\n var entry = formatedGraphicalItems[i];\n\n if (entry.item === item || entry.props.key === item.key || displayName === getDisplayName(entry.item.type) && childIndex === entry.childIndex) {\n return entry;\n }\n }\n\n return null;\n }\n }, {\n key: \"renderAxis\",\n value:\n /**\n * Draw axis\n * @param {Object} axisOptions The options of axis\n * @param {Object} element The axis element\n * @param {String} displayName The display name of axis\n * @param {Number} index The index of element\n * @return {ReactElement} The instance of x-axes\n */\n function renderAxis(axisOptions, element, displayName, index) {\n var _this$props5 = this.props,\n width = _this$props5.width,\n height = _this$props5.height;\n return /*#__PURE__*/React.createElement(CartesianAxis, _extends({}, axisOptions, {\n className: \"recharts-\".concat(axisOptions.axisType, \" \").concat(axisOptions.axisType),\n key: element.key || \"\".concat(displayName, \"-\").concat(index),\n viewBox: {\n x: 0,\n y: 0,\n width: width,\n height: height\n },\n ticksGenerator: this.axesTicksGenerator\n }));\n }\n /**\n * Draw grid\n * @param {ReactElement} element the grid item\n * @return {ReactElement} The instance of grid\n */\n\n }, {\n key: \"renderClipPath\",\n value: function renderClipPath() {\n var clipPathId = this.clipPathId;\n var _this$state$offset = this.state.offset,\n left = _this$state$offset.left,\n top = _this$state$offset.top,\n height = _this$state$offset.height,\n width = _this$state$offset.width;\n return /*#__PURE__*/React.createElement(\"defs\", null, /*#__PURE__*/React.createElement(\"clipPath\", {\n id: clipPathId\n }, /*#__PURE__*/React.createElement(\"rect\", {\n x: left,\n y: top,\n height: height,\n width: width\n })));\n }\n }, {\n key: \"getXScales\",\n value: function getXScales() {\n var xAxisMap = this.state.xAxisMap;\n return xAxisMap ? Object.entries(xAxisMap).reduce(function (res, _ref12) {\n var _ref13 = _slicedToArray(_ref12, 2),\n axisId = _ref13[0],\n axisProps = _ref13[1];\n\n return _objectSpread(_objectSpread({}, res), {}, _defineProperty({}, axisId, axisProps.scale));\n }, {}) : null;\n }\n }, {\n key: \"getYScales\",\n value: function getYScales() {\n var yAxisMap = this.state.yAxisMap;\n return yAxisMap ? Object.entries(yAxisMap).reduce(function (res, _ref14) {\n var _ref15 = _slicedToArray(_ref14, 2),\n axisId = _ref15[0],\n axisProps = _ref15[1];\n\n return _objectSpread(_objectSpread({}, res), {}, _defineProperty({}, axisId, axisProps.scale));\n }, {}) : null;\n }\n }, {\n key: \"getXScaleByAxisId\",\n value: function getXScaleByAxisId(axisId) {\n var _this$state$xAxisMap, _this$state$xAxisMap$;\n\n return (_this$state$xAxisMap = this.state.xAxisMap) === null || _this$state$xAxisMap === void 0 ? void 0 : (_this$state$xAxisMap$ = _this$state$xAxisMap[axisId]) === null || _this$state$xAxisMap$ === void 0 ? void 0 : _this$state$xAxisMap$.scale;\n }\n }, {\n key: \"getYScaleByAxisId\",\n value: function getYScaleByAxisId(axisId) {\n var _this$state$yAxisMap, _this$state$yAxisMap$;\n\n return (_this$state$yAxisMap = this.state.yAxisMap) === null || _this$state$yAxisMap === void 0 ? void 0 : (_this$state$yAxisMap$ = _this$state$yAxisMap[axisId]) === null || _this$state$yAxisMap$ === void 0 ? void 0 : _this$state$yAxisMap$.scale;\n }\n }, {\n key: \"getItemByXY\",\n value: function getItemByXY(chartXY) {\n var formatedGraphicalItems = this.state.formatedGraphicalItems;\n\n if (formatedGraphicalItems && formatedGraphicalItems.length) {\n for (var i = 0, len = formatedGraphicalItems.length; i < len; i++) {\n var graphicalItem = formatedGraphicalItems[i];\n var props = graphicalItem.props,\n item = graphicalItem.item;\n var itemDisplayName = getDisplayName(item.type);\n\n if (itemDisplayName === 'Bar') {\n var activeBarItem = (props.data || []).find(function (entry) {\n return isInRectangle(chartXY, entry);\n });\n\n if (activeBarItem) {\n return {\n graphicalItem: graphicalItem,\n payload: activeBarItem\n };\n }\n } else if (itemDisplayName === 'RadialBar') {\n var _activeBarItem = (props.data || []).find(function (entry) {\n return inRangeOfSector(chartXY, entry);\n });\n\n if (_activeBarItem) {\n return {\n graphicalItem: graphicalItem,\n payload: _activeBarItem\n };\n }\n }\n }\n }\n\n return null;\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this2 = this;\n\n if (!validateWidthHeight(this)) {\n return null;\n }\n\n var _this$props6 = this.props,\n children = _this$props6.children,\n className = _this$props6.className,\n width = _this$props6.width,\n height = _this$props6.height,\n style = _this$props6.style,\n compact = _this$props6.compact,\n others = _objectWithoutProperties(_this$props6, [\"children\", \"className\", \"width\", \"height\", \"style\", \"compact\"]);\n\n var attrs = filterProps(others);\n var map = {\n CartesianGrid: {\n handler: this.renderGrid,\n once: true\n },\n ReferenceArea: {\n handler: this.renderReferenceElement\n },\n ReferenceLine: {\n handler: this.renderReferenceElement\n },\n ReferenceDot: {\n handler: this.renderReferenceElement\n },\n XAxis: {\n handler: this.renderXAxis\n },\n YAxis: {\n handler: this.renderYAxis\n },\n Brush: {\n handler: this.renderBrush,\n once: true\n },\n Bar: {\n handler: this.renderGraphicChild\n },\n Line: {\n handler: this.renderGraphicChild\n },\n Area: {\n handler: this.renderGraphicChild\n },\n Radar: {\n handler: this.renderGraphicChild\n },\n RadialBar: {\n handler: this.renderGraphicChild\n },\n Scatter: {\n handler: this.renderGraphicChild\n },\n Pie: {\n handler: this.renderGraphicChild\n },\n Funnel: {\n handler: this.renderGraphicChild\n },\n Tooltip: {\n handler: this.renderCursor,\n once: true\n },\n PolarGrid: {\n handler: this.renderPolarGrid,\n once: true\n },\n PolarAngleAxis: {\n handler: this.renderPolarAxis\n },\n PolarRadiusAxis: {\n handler: this.renderPolarAxis\n },\n Customized: {\n handler: this.renderCustomized\n }\n }; // The \"compact\" mode is mainly used as the panorama within Brush\n\n if (compact) {\n return /*#__PURE__*/React.createElement(Surface, _extends({}, attrs, {\n width: width,\n height: height\n }), this.renderClipPath(), renderByOrder(children, map));\n }\n\n var events = this.parseEventsOfWrapper();\n return /*#__PURE__*/React.createElement(\"div\", _extends({\n className: classNames('recharts-wrapper', className),\n style: _objectSpread({\n position: 'relative',\n cursor: 'default',\n width: width,\n height: height\n }, style)\n }, events, {\n ref: function ref(node) {\n _this2.container = node;\n }\n }), /*#__PURE__*/React.createElement(Surface, _extends({}, attrs, {\n width: width,\n height: height\n }), this.renderClipPath(), renderByOrder(children, map)), this.renderLegend(), this.renderTooltip());\n }\n }]);\n\n return CategoricalChartWrapper;\n }(Component), _class.displayName = chartName, _class.defaultProps = _objectSpread({\n layout: 'horizontal',\n stackOffset: 'none',\n barCategoryGap: '10%',\n barGap: 4,\n margin: {\n top: 5,\n right: 5,\n bottom: 5,\n left: 5\n },\n reverseStackOrder: false,\n syncMethod: 'index'\n }, defaultProps), _class.getDerivedStateFromProps = function (nextProps, prevState) {\n var data = nextProps.data,\n children = nextProps.children,\n width = nextProps.width,\n height = nextProps.height,\n layout = nextProps.layout,\n stackOffset = nextProps.stackOffset,\n margin = nextProps.margin;\n\n if (_isNil(prevState.updateId)) {\n var defaultState = createDefaultState(nextProps);\n return _objectSpread(_objectSpread(_objectSpread({}, defaultState), {}, {\n updateId: 0\n }, updateStateOfAxisMapsOffsetAndStackGroups(_objectSpread(_objectSpread({\n props: nextProps\n }, defaultState), {}, {\n updateId: 0\n }), prevState)), {}, {\n prevData: data,\n prevWidth: width,\n prevHeight: height,\n prevLayout: layout,\n prevStackOffset: stackOffset,\n prevMargin: margin,\n prevChildren: children\n });\n }\n\n if (data !== prevState.prevData || width !== prevState.prevWidth || height !== prevState.prevHeight || layout !== prevState.prevLayout || stackOffset !== prevState.prevStackOffset || !shallowEqual(margin, prevState.prevMargin)) {\n var _defaultState = createDefaultState(nextProps); // Fixes https://github.com/recharts/recharts/issues/2143\n\n\n var keepFromPrevState = {\n // (chartX, chartY) are (0,0) in default state, but we want to keep the last mouse position to avoid\n // any flickering\n chartX: prevState.chartX,\n chartY: prevState.chartY,\n // The tooltip should stay active when it was active in the previous render. If this is not\n // the case, the tooltip disappears and immediately re-appears, causing a flickering effect\n isTooltipActive: prevState.isTooltipActive\n };\n\n var updatesToState = _objectSpread(_objectSpread({}, getTooltipData(prevState, data, layout)), {}, {\n updateId: prevState.updateId + 1\n });\n\n var newState = _objectSpread(_objectSpread(_objectSpread({}, _defaultState), keepFromPrevState), updatesToState);\n\n return _objectSpread(_objectSpread(_objectSpread({}, newState), updateStateOfAxisMapsOffsetAndStackGroups(_objectSpread({\n props: nextProps\n }, newState), prevState)), {}, {\n prevData: data,\n prevWidth: width,\n prevHeight: height,\n prevLayout: layout,\n prevStackOffset: stackOffset,\n prevMargin: margin,\n prevChildren: children\n });\n }\n\n if (!isChildrenEqual(children, prevState.prevChildren)) {\n // update configuration in chilren\n var hasGlobalData = !_isNil(data);\n var newUpdateId = hasGlobalData ? prevState.updateId : prevState.updateId + 1;\n return _objectSpread(_objectSpread({\n updateId: newUpdateId\n }, updateStateOfAxisMapsOffsetAndStackGroups(_objectSpread(_objectSpread({\n props: nextProps\n }, prevState), {}, {\n updateId: newUpdateId\n }), prevState)), {}, {\n prevChildren: children\n });\n }\n\n return null;\n }, _class.renderActiveDot = function (option, props) {\n var dot;\n\n if ( /*#__PURE__*/isValidElement(option)) {\n dot = /*#__PURE__*/cloneElement(option, props);\n } else if (_isFunction(option)) {\n dot = option(props);\n } else {\n dot = /*#__PURE__*/React.createElement(Dot, props);\n }\n\n return /*#__PURE__*/React.createElement(Layer, {\n className: \"recharts-active-dot\",\n key: props.key\n }, dot);\n }, _temp;\n};","var baseFlatten = require('./_baseFlatten'),\n baseOrderBy = require('./_baseOrderBy'),\n baseRest = require('./_baseRest'),\n isIterateeCall = require('./_isIterateeCall');\n\n/**\n * Creates an array of elements, sorted in ascending order by the results of\n * running each element in a collection thru each iteratee. This method\n * performs a stable sort, that is, it preserves the original sort order of\n * equal elements. The iteratees are invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {...(Function|Function[])} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 30 },\n * { 'user': 'barney', 'age': 34 }\n * ];\n *\n * _.sortBy(users, [function(o) { return o.user; }]);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 30]]\n *\n * _.sortBy(users, ['user', 'age']);\n * // => objects for [['barney', 34], ['barney', 36], ['fred', 30], ['fred', 48]]\n */\nvar sortBy = baseRest(function(collection, iteratees) {\n if (collection == null) {\n return [];\n }\n var length = iteratees.length;\n if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {\n iteratees = [];\n } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {\n iteratees = [iteratees[0]];\n }\n return baseOrderBy(collection, baseFlatten(iteratees, 1), []);\n});\n\nmodule.exports = sortBy;\n","export default function(a, b) {\n return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN;\n}\n","export var slice = Array.prototype.slice;\n\nexport default function(x) {\n return typeof x === \"object\" && \"length\" in x\n ? x // Array, TypedArray, NodeList, array-like\n : Array.from(x); // Map, Set, iterable, string, or anything else\n}\n","import _isObject from \"lodash/isObject\";\nimport _isFunction from \"lodash/isFunction\";\nimport _isNil from \"lodash/isNil\";\nimport _last from \"lodash/last\";\nimport _isArray from \"lodash/isArray\";\n\nfunction _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\nimport React, { cloneElement } from 'react';\nimport { Label } from './Label';\nimport { Layer } from '../container/Layer';\nimport { findAllByType } from '../util/ReactUtils';\nimport { getValueByDataKey } from '../util/ChartUtils';\nimport { filterProps } from '../util/types';\nvar defaultProps = {\n valueAccessor: function valueAccessor(entry) {\n return _isArray(entry.value) ? _last(entry.value) : entry.value;\n }\n};\nexport function LabelList(props) {\n var data = props.data,\n valueAccessor = props.valueAccessor,\n dataKey = props.dataKey,\n clockWise = props.clockWise,\n id = props.id,\n textBreakAll = props.textBreakAll,\n others = _objectWithoutProperties(props, [\"data\", \"valueAccessor\", \"dataKey\", \"clockWise\", \"id\", \"textBreakAll\"]);\n\n if (!data || !data.length) {\n return null;\n }\n\n return /*#__PURE__*/React.createElement(Layer, {\n className: \"recharts-label-list\"\n }, data.map(function (entry, index) {\n var value = _isNil(dataKey) ? valueAccessor(entry, index) : getValueByDataKey(entry && entry.payload, dataKey);\n var idProps = _isNil(id) ? {} : {\n id: \"\".concat(id, \"-\").concat(index)\n };\n return /*#__PURE__*/React.createElement(Label, _extends({}, filterProps(entry, true), others, idProps, {\n parentViewBox: entry.parentViewBox,\n index: index,\n value: value,\n textBreakAll: textBreakAll,\n viewBox: Label.parseViewBox(_isNil(clockWise) ? entry : _objectSpread(_objectSpread({}, entry), {}, {\n clockWise: clockWise\n })),\n key: \"label-\".concat(index) // eslint-disable-line react/no-array-index-key\n\n }));\n }));\n}\nLabelList.displayName = 'LabelList';\n\nfunction parseLabelList(label, data) {\n if (!label) {\n return null;\n }\n\n if (label === true) {\n return /*#__PURE__*/React.createElement(LabelList, {\n key: \"labelList-implicit\",\n data: data\n });\n }\n\n if ( /*#__PURE__*/React.isValidElement(label) || _isFunction(label)) {\n return /*#__PURE__*/React.createElement(LabelList, {\n key: \"labelList-implicit\",\n data: data,\n content: label\n });\n }\n\n if (_isObject(label)) {\n return /*#__PURE__*/React.createElement(LabelList, _extends({\n data: data\n }, label, {\n key: \"labelList-implicit\"\n }));\n }\n\n return null;\n}\n\nfunction renderCallByParent(parentProps, data) {\n var ckeckPropsLabel = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;\n\n if (!parentProps || !parentProps.children && ckeckPropsLabel && !parentProps.label) {\n return null;\n }\n\n var children = parentProps.children;\n var explicitChilren = findAllByType(children, LabelList.displayName).map(function (child, index) {\n return /*#__PURE__*/cloneElement(child, {\n data: data,\n key: \"labelList-\".concat(index)\n });\n });\n\n if (!ckeckPropsLabel) {\n return explicitChilren;\n }\n\n var implicitLabelList = parseLabelList(parentProps.label, data);\n return [implicitLabelList].concat(_toConsumableArray(explicitChilren));\n}\n\nLabelList.renderCallByParent = renderCallByParent;\nLabelList.defaultProps = defaultProps;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\");\n\nvar _interopRequireWildcard = require(\"@babel/runtime/helpers/interopRequireWildcard\");\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\n\nvar React = _interopRequireWildcard(require(\"react\"));\n\nvar _createSvgIcon = _interopRequireDefault(require(\"./utils/createSvgIcon\"));\n\nvar _default = (0, _createSvgIcon.default)( /*#__PURE__*/React.createElement(\"path\", {\n d: \"M19 13h-6v6h-2v-6H5v-2h6V5h2v6h6v2z\"\n}), 'Add');\n\nexports.default = _default;","import React from 'react';\nexport default React.createContext(null);","var createRange = require('./_createRange');\n\n/**\n * Creates an array of numbers (positive and/or negative) progressing from\n * `start` up to, but not including, `end`. A step of `-1` is used if a negative\n * `start` is specified without an `end` or `step`. If `end` is not specified,\n * it's set to `start` with `start` then set to `0`.\n *\n * **Note:** JavaScript follows the IEEE-754 standard for resolving\n * floating-point values which can produce unexpected results.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @param {number} [step=1] The value to increment or decrement by.\n * @returns {Array} Returns the range of numbers.\n * @see _.inRange, _.rangeRight\n * @example\n *\n * _.range(4);\n * // => [0, 1, 2, 3]\n *\n * _.range(-4);\n * // => [0, -1, -2, -3]\n *\n * _.range(1, 5);\n * // => [1, 2, 3, 4]\n *\n * _.range(0, 20, 5);\n * // => [0, 5, 10, 15]\n *\n * _.range(0, -4, -1);\n * // => [0, -1, -2, -3]\n *\n * _.range(1, 4, 0);\n * // => [1, 1, 1]\n *\n * _.range(0);\n * // => []\n */\nvar range = createRange();\n\nmodule.exports = range;\n","var baseIteratee = require('./_baseIteratee'),\n baseUniq = require('./_baseUniq');\n\n/**\n * This method is like `_.uniq` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * uniqueness is computed. The order of result values is determined by the\n * order they occur in the array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniqBy([2.1, 1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\nfunction uniqBy(array, iteratee) {\n return (array && array.length) ? baseUniq(array, baseIteratee(iteratee, 2)) : [];\n}\n\nmodule.exports = uniqBy;\n","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _get from \"lodash/get\";\nimport _isFunction from \"lodash/isFunction\";\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Cartesian Axis\n */\nimport React, { Component } from 'react';\nimport classNames from 'classnames';\nimport { shallowEqual } from '../util/ShallowEqual';\nimport { getStringSize } from '../util/DOMUtils';\nimport { Layer } from '../container/Layer';\nimport { Text } from '../component/Text';\nimport { Label } from '../component/Label';\nimport { Global } from '../util/Global';\nimport { isNumber, mathSign } from '../util/DataUtils';\nimport { filterProps, adaptEventsOfChild } from '../util/types';\nexport var CartesianAxis = /*#__PURE__*/function (_Component) {\n _inherits(CartesianAxis, _Component);\n\n var _super = _createSuper(CartesianAxis);\n\n function CartesianAxis() {\n _classCallCheck(this, CartesianAxis);\n\n return _super.apply(this, arguments);\n }\n\n _createClass(CartesianAxis, [{\n key: \"shouldComponentUpdate\",\n value: function shouldComponentUpdate(_ref) {\n var viewBox = _ref.viewBox,\n restProps = _objectWithoutProperties(_ref, [\"viewBox\"]);\n\n // props.viewBox is sometimes generated every time -\n // check that specially as object equality is likely to fail\n var _this$props = this.props,\n viewBoxOld = _this$props.viewBox,\n restPropsOld = _objectWithoutProperties(_this$props, [\"viewBox\"]);\n\n return !shallowEqual(viewBox, viewBoxOld) || !shallowEqual(restProps, restPropsOld);\n }\n /**\n * Calculate the coordinates of endpoints in ticks\n * @param {Object} data The data of a simple tick\n * @return {Object} (x1, y1): The coordinate of endpoint close to tick text\n * (x2, y2): The coordinate of endpoint close to axis\n */\n\n }, {\n key: \"getTickLineCoord\",\n value: function getTickLineCoord(data) {\n var _this$props2 = this.props,\n x = _this$props2.x,\n y = _this$props2.y,\n width = _this$props2.width,\n height = _this$props2.height,\n orientation = _this$props2.orientation,\n tickSize = _this$props2.tickSize,\n mirror = _this$props2.mirror,\n tickMargin = _this$props2.tickMargin;\n var x1, x2, y1, y2, tx, ty;\n var sign = mirror ? -1 : 1;\n var finalTickSize = data.tickSize || tickSize;\n var tickCoord = isNumber(data.tickCoord) ? data.tickCoord : data.coordinate;\n\n switch (orientation) {\n case 'top':\n x1 = x2 = data.coordinate;\n y2 = y + +!mirror * height;\n y1 = y2 - sign * finalTickSize;\n ty = y1 - sign * tickMargin;\n tx = tickCoord;\n break;\n\n case 'left':\n y1 = y2 = data.coordinate;\n x2 = x + +!mirror * width;\n x1 = x2 - sign * finalTickSize;\n tx = x1 - sign * tickMargin;\n ty = tickCoord;\n break;\n\n case 'right':\n y1 = y2 = data.coordinate;\n x2 = x + +mirror * width;\n x1 = x2 + sign * finalTickSize;\n tx = x1 + sign * tickMargin;\n ty = tickCoord;\n break;\n\n default:\n x1 = x2 = data.coordinate;\n y2 = y + +mirror * height;\n y1 = y2 + sign * finalTickSize;\n ty = y1 + sign * tickMargin;\n tx = tickCoord;\n break;\n }\n\n return {\n line: {\n x1: x1,\n y1: y1,\n x2: x2,\n y2: y2\n },\n tick: {\n x: tx,\n y: ty\n }\n };\n }\n }, {\n key: \"getTickTextAnchor\",\n value: function getTickTextAnchor() {\n var _this$props3 = this.props,\n orientation = _this$props3.orientation,\n mirror = _this$props3.mirror;\n var textAnchor;\n\n switch (orientation) {\n case 'left':\n textAnchor = mirror ? 'start' : 'end';\n break;\n\n case 'right':\n textAnchor = mirror ? 'end' : 'start';\n break;\n\n default:\n textAnchor = 'middle';\n break;\n }\n\n return textAnchor;\n }\n }, {\n key: \"getTickVerticalAnchor\",\n value: function getTickVerticalAnchor() {\n var _this$props4 = this.props,\n orientation = _this$props4.orientation,\n mirror = _this$props4.mirror;\n var verticalAnchor = 'end';\n\n switch (orientation) {\n case 'left':\n case 'right':\n verticalAnchor = 'middle';\n break;\n\n case 'top':\n verticalAnchor = mirror ? 'start' : 'end';\n break;\n\n default:\n verticalAnchor = mirror ? 'end' : 'start';\n break;\n }\n\n return verticalAnchor;\n }\n }, {\n key: \"renderAxisLine\",\n value: function renderAxisLine() {\n var _this$props5 = this.props,\n x = _this$props5.x,\n y = _this$props5.y,\n width = _this$props5.width,\n height = _this$props5.height,\n orientation = _this$props5.orientation,\n mirror = _this$props5.mirror,\n axisLine = _this$props5.axisLine;\n\n var props = _objectSpread(_objectSpread(_objectSpread({}, filterProps(this.props)), filterProps(axisLine)), {}, {\n fill: 'none'\n });\n\n if (orientation === 'top' || orientation === 'bottom') {\n var needHeight = +(orientation === 'top' && !mirror || orientation === 'bottom' && mirror);\n props = _objectSpread(_objectSpread({}, props), {}, {\n x1: x,\n y1: y + needHeight * height,\n x2: x + width,\n y2: y + needHeight * height\n });\n } else {\n var needWidth = +(orientation === 'left' && !mirror || orientation === 'right' && mirror);\n props = _objectSpread(_objectSpread({}, props), {}, {\n x1: x + needWidth * width,\n y1: y,\n x2: x + needWidth * width,\n y2: y + height\n });\n }\n\n return /*#__PURE__*/React.createElement(\"line\", _extends({}, props, {\n className: classNames('recharts-cartesian-axis-line', _get(axisLine, 'className'))\n }));\n }\n }, {\n key: \"renderTicks\",\n value:\n /**\n * render the ticks\n * @param {Array} ticks The ticks to actually render (overrides what was passed in props)\n * @return {ReactComponent} renderedTicks\n */\n function renderTicks(ticks) {\n var _this = this;\n\n var _this$props6 = this.props,\n tickLine = _this$props6.tickLine,\n stroke = _this$props6.stroke,\n tick = _this$props6.tick,\n tickFormatter = _this$props6.tickFormatter,\n unit = _this$props6.unit;\n var finalTicks = CartesianAxis.getTicks(_objectSpread(_objectSpread({}, this.props), {}, {\n ticks: ticks\n }));\n var textAnchor = this.getTickTextAnchor();\n var verticalAnchor = this.getTickVerticalAnchor();\n var axisProps = filterProps(this.props);\n var customTickProps = filterProps(tick);\n\n var tickLineProps = _objectSpread(_objectSpread({}, axisProps), {}, {\n fill: 'none'\n }, filterProps(tickLine));\n\n var items = finalTicks.map(function (entry, i) {\n var _this$getTickLineCoor = _this.getTickLineCoord(entry),\n lineCoord = _this$getTickLineCoor.line,\n tickCoord = _this$getTickLineCoor.tick;\n\n var tickProps = _objectSpread(_objectSpread(_objectSpread(_objectSpread({\n textAnchor: textAnchor,\n verticalAnchor: verticalAnchor\n }, axisProps), {}, {\n stroke: 'none',\n fill: stroke\n }, customTickProps), tickCoord), {}, {\n index: i,\n payload: entry,\n visibleTicksCount: finalTicks.length,\n tickFormatter: tickFormatter\n });\n\n return /*#__PURE__*/React.createElement(Layer, _extends({\n className: \"recharts-cartesian-axis-tick\",\n key: \"tick-\".concat(i) // eslint-disable-line react/no-array-index-key\n\n }, adaptEventsOfChild(_this.props, entry, i)), tickLine && /*#__PURE__*/React.createElement(\"line\", _extends({}, tickLineProps, lineCoord, {\n className: classNames('recharts-cartesian-axis-tick-line', _get(tickLine, 'className'))\n })), tick && CartesianAxis.renderTickItem(tick, tickProps, \"\".concat(_isFunction(tickFormatter) ? tickFormatter(entry.value, i) : entry.value).concat(unit || '')));\n });\n return /*#__PURE__*/React.createElement(\"g\", {\n className: \"recharts-cartesian-axis-ticks\"\n }, items);\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props7 = this.props,\n axisLine = _this$props7.axisLine,\n width = _this$props7.width,\n height = _this$props7.height,\n ticksGenerator = _this$props7.ticksGenerator,\n className = _this$props7.className,\n hide = _this$props7.hide;\n\n if (hide) {\n return null;\n }\n\n var _this$props8 = this.props,\n ticks = _this$props8.ticks,\n noTicksProps = _objectWithoutProperties(_this$props8, [\"ticks\"]);\n\n var finalTicks = ticks;\n\n if (_isFunction(ticksGenerator)) {\n finalTicks = ticks && ticks.length > 0 ? ticksGenerator(this.props) : ticksGenerator(noTicksProps);\n }\n\n if (width <= 0 || height <= 0 || !finalTicks || !finalTicks.length) {\n return null;\n }\n\n return /*#__PURE__*/React.createElement(Layer, {\n className: classNames('recharts-cartesian-axis', className)\n }, axisLine && this.renderAxisLine(), this.renderTicks(finalTicks), Label.renderCallByParent(this.props));\n }\n }], [{\n key: \"getTicks\",\n value: // todo Array \n function getTicks(props) {\n var tick = props.tick,\n ticks = props.ticks,\n viewBox = props.viewBox,\n minTickGap = props.minTickGap,\n orientation = props.orientation,\n interval = props.interval,\n tickFormatter = props.tickFormatter,\n unit = props.unit;\n\n if (!ticks || !ticks.length || !tick) {\n return [];\n }\n\n if (isNumber(interval) || Global.isSsr) {\n return CartesianAxis.getNumberIntervalTicks(ticks, typeof interval === 'number' && isNumber(interval) ? interval : 0);\n }\n\n if (interval === 'preserveStartEnd') {\n return CartesianAxis.getTicksStart({\n ticks: ticks,\n tickFormatter: tickFormatter,\n viewBox: viewBox,\n orientation: orientation,\n minTickGap: minTickGap,\n unit: unit\n }, true);\n }\n\n if (interval === 'preserveStart') {\n return CartesianAxis.getTicksStart({\n ticks: ticks,\n tickFormatter: tickFormatter,\n viewBox: viewBox,\n orientation: orientation,\n minTickGap: minTickGap,\n unit: unit\n });\n }\n\n return CartesianAxis.getTicksEnd({\n ticks: ticks,\n tickFormatter: tickFormatter,\n viewBox: viewBox,\n orientation: orientation,\n minTickGap: minTickGap,\n unit: unit\n });\n }\n }, {\n key: \"getNumberIntervalTicks\",\n value: function getNumberIntervalTicks(ticks, interval) {\n return ticks.filter(function (entry, i) {\n return i % (interval + 1) === 0;\n });\n }\n }, {\n key: \"getTicksStart\",\n value: function getTicksStart(_ref2, preserveEnd) {\n var ticks = _ref2.ticks,\n tickFormatter = _ref2.tickFormatter,\n viewBox = _ref2.viewBox,\n orientation = _ref2.orientation,\n minTickGap = _ref2.minTickGap,\n unit = _ref2.unit;\n var x = viewBox.x,\n y = viewBox.y,\n width = viewBox.width,\n height = viewBox.height;\n var sizeKey = orientation === 'top' || orientation === 'bottom' ? 'width' : 'height';\n var result = (ticks || []).slice(); // we need add the width of 'unit' only when sizeKey === 'width'\n\n var unitSize = unit && sizeKey === 'width' ? getStringSize(unit)[sizeKey] : 0;\n var len = result.length;\n var sign = len >= 2 ? mathSign(result[1].coordinate - result[0].coordinate) : 1;\n var start, end;\n\n if (sign === 1) {\n start = sizeKey === 'width' ? x : y;\n end = sizeKey === 'width' ? x + width : y + height;\n } else {\n start = sizeKey === 'width' ? x + width : y + height;\n end = sizeKey === 'width' ? x : y;\n }\n\n if (preserveEnd) {\n // Try to guarantee the tail to be displayed\n var tail = ticks[len - 1];\n var tailContent = _isFunction(tickFormatter) ? tickFormatter(tail.value, len - 1) : tail.value;\n var tailSize = getStringSize(tailContent)[sizeKey] + unitSize;\n var tailGap = sign * (tail.coordinate + sign * tailSize / 2 - end);\n result[len - 1] = tail = _objectSpread(_objectSpread({}, tail), {}, {\n tickCoord: tailGap > 0 ? tail.coordinate - tailGap * sign : tail.coordinate\n });\n var isTailShow = sign * (tail.tickCoord - sign * tailSize / 2 - start) >= 0 && sign * (tail.tickCoord + sign * tailSize / 2 - end) <= 0;\n\n if (isTailShow) {\n end = tail.tickCoord - sign * (tailSize / 2 + minTickGap);\n result[len - 1] = _objectSpread(_objectSpread({}, tail), {}, {\n isShow: true\n });\n }\n }\n\n var count = preserveEnd ? len - 1 : len;\n\n for (var i = 0; i < count; i++) {\n var entry = result[i];\n var content = _isFunction(tickFormatter) ? tickFormatter(entry.value, i) : entry.value;\n var size = getStringSize(content)[sizeKey] + unitSize;\n\n if (i === 0) {\n var gap = sign * (entry.coordinate - sign * size / 2 - start);\n result[i] = entry = _objectSpread(_objectSpread({}, entry), {}, {\n tickCoord: gap < 0 ? entry.coordinate - gap * sign : entry.coordinate\n });\n } else {\n result[i] = entry = _objectSpread(_objectSpread({}, entry), {}, {\n tickCoord: entry.coordinate\n });\n }\n\n var isShow = sign * (entry.tickCoord - sign * size / 2 - start) >= 0 && sign * (entry.tickCoord + sign * size / 2 - end) <= 0;\n\n if (isShow) {\n start = entry.tickCoord + sign * (size / 2 + minTickGap);\n result[i] = _objectSpread(_objectSpread({}, entry), {}, {\n isShow: true\n });\n }\n }\n\n return result.filter(function (entry) {\n return entry.isShow;\n });\n }\n }, {\n key: \"getTicksEnd\",\n value: function getTicksEnd(_ref3) {\n var ticks = _ref3.ticks,\n tickFormatter = _ref3.tickFormatter,\n viewBox = _ref3.viewBox,\n orientation = _ref3.orientation,\n minTickGap = _ref3.minTickGap,\n unit = _ref3.unit;\n var x = viewBox.x,\n y = viewBox.y,\n width = viewBox.width,\n height = viewBox.height;\n var sizeKey = orientation === 'top' || orientation === 'bottom' ? 'width' : 'height'; // we need add the width of 'unit' only when sizeKey === 'width'\n\n var unitSize = unit && sizeKey === 'width' ? getStringSize(unit)[sizeKey] : 0;\n var result = (ticks || []).slice();\n var len = result.length;\n var sign = len >= 2 ? mathSign(result[1].coordinate - result[0].coordinate) : 1;\n var start, end;\n\n if (sign === 1) {\n start = sizeKey === 'width' ? x : y;\n end = sizeKey === 'width' ? x + width : y + height;\n } else {\n start = sizeKey === 'width' ? x + width : y + height;\n end = sizeKey === 'width' ? x : y;\n }\n\n for (var i = len - 1; i >= 0; i--) {\n var entry = result[i];\n var content = _isFunction(tickFormatter) ? tickFormatter(entry.value, len - i - 1) : entry.value;\n var size = getStringSize(content)[sizeKey] + unitSize;\n\n if (i === len - 1) {\n var gap = sign * (entry.coordinate + sign * size / 2 - end);\n result[i] = entry = _objectSpread(_objectSpread({}, entry), {}, {\n tickCoord: gap > 0 ? entry.coordinate - gap * sign : entry.coordinate\n });\n } else {\n result[i] = entry = _objectSpread(_objectSpread({}, entry), {}, {\n tickCoord: entry.coordinate\n });\n }\n\n var isShow = sign * (entry.tickCoord - sign * size / 2 - start) >= 0 && sign * (entry.tickCoord + sign * size / 2 - end) <= 0;\n\n if (isShow) {\n end = entry.tickCoord - sign * (size / 2 + minTickGap);\n result[i] = _objectSpread(_objectSpread({}, entry), {}, {\n isShow: true\n });\n }\n }\n\n return result.filter(function (entry) {\n return entry.isShow;\n });\n }\n }, {\n key: \"renderTickItem\",\n value: function renderTickItem(option, props, value) {\n var tickItem;\n\n if ( /*#__PURE__*/React.isValidElement(option)) {\n tickItem = /*#__PURE__*/React.cloneElement(option, props);\n } else if (_isFunction(option)) {\n tickItem = option(props);\n } else {\n tickItem = /*#__PURE__*/React.createElement(Text, _extends({}, props, {\n className: \"recharts-cartesian-axis-tick-value\"\n }), value);\n }\n\n return tickItem;\n }\n }]);\n\n return CartesianAxis;\n}(Component);\nCartesianAxis.displayName = 'CartesianAxis';\nCartesianAxis.defaultProps = {\n x: 0,\n y: 0,\n width: 0,\n height: 0,\n viewBox: {\n x: 0,\n y: 0,\n width: 0,\n height: 0\n },\n // The orientation of axis\n orientation: 'bottom',\n // The ticks\n ticks: [],\n stroke: '#666',\n tickLine: true,\n axisLine: true,\n tick: true,\n mirror: false,\n minTickGap: 5,\n // The width or height of tick\n tickSize: 6,\n tickMargin: 2,\n interval: 'preserveEnd'\n};","var root = require('./_root');\n\n/** Built-in value references. */\nvar Symbol = root.Symbol;\n\nmodule.exports = Symbol;\n","var isFunction = require('./isFunction'),\n isLength = require('./isLength');\n\n/**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\nfunction isArrayLike(value) {\n return value != null && isLength(value.length) && !isFunction(value);\n}\n\nmodule.exports = isArrayLike;\n","export default function deprecatedPropType(validator, reason) {\n if (process.env.NODE_ENV === 'production') {\n return function () {\n return null;\n };\n }\n\n return function (props, propName, componentName, location, propFullName) {\n var componentNameSafe = componentName || '< >';\n var propFullNameSafe = propFullName || propName;\n\n if (typeof props[propName] !== 'undefined') {\n return new Error(\"The \".concat(location, \" `\").concat(propFullNameSafe, \"` of \") + \"`\".concat(componentNameSafe, \"` is deprecated. \").concat(reason));\n }\n\n return null;\n };\n}","import {initRange} from \"./init.js\";\n\nexport const implicit = Symbol(\"implicit\");\n\nexport default function ordinal() {\n var index = new Map(),\n domain = [],\n range = [],\n unknown = implicit;\n\n function scale(d) {\n var key = d + \"\", i = index.get(key);\n if (!i) {\n if (unknown !== implicit) return unknown;\n index.set(key, i = domain.push(d));\n }\n return range[(i - 1) % range.length];\n }\n\n scale.domain = function(_) {\n if (!arguments.length) return domain.slice();\n domain = [], index = new Map();\n for (const value of _) {\n const key = value + \"\";\n if (index.has(key)) continue;\n index.set(key, domain.push(value));\n }\n return scale;\n };\n\n scale.range = function(_) {\n return arguments.length ? (range = Array.from(_), scale) : range.slice();\n };\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : unknown;\n };\n\n scale.copy = function() {\n return ordinal(domain, range).unknown(unknown);\n };\n\n initRange.apply(scale, arguments);\n\n return scale;\n}\n","export default function _arrayLikeToArray(arr, len) {\n if (len == null || len > arr.length) len = arr.length;\n\n for (var i = 0, arr2 = new Array(len); i < len; i++) {\n arr2[i] = arr[i];\n }\n\n return arr2;\n}","export default function _arrayLikeToArray(arr, len) {\n if (len == null || len > arr.length) len = arr.length;\n\n for (var i = 0, arr2 = new Array(len); i < len; i++) {\n arr2[i] = arr[i];\n }\n\n return arr2;\n}","function _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\n/**\n * @fileOverview Surface\n */\nimport React from 'react';\nimport classNames from 'classnames';\nimport { filterProps } from '../util/types';\nexport function Surface(props) {\n var children = props.children,\n width = props.width,\n height = props.height,\n viewBox = props.viewBox,\n className = props.className,\n style = props.style,\n others = _objectWithoutProperties(props, [\"children\", \"width\", \"height\", \"viewBox\", \"className\", \"style\"]);\n\n var svgView = viewBox || {\n width: width,\n height: height,\n x: 0,\n y: 0\n };\n var layerClass = classNames('recharts-surface', className);\n return /*#__PURE__*/React.createElement(\"svg\", _extends({}, filterProps(others, true, true), {\n className: layerClass,\n width: width,\n height: height,\n style: style,\n viewBox: \"\".concat(svgView.x, \" \").concat(svgView.y, \" \").concat(svgView.width, \" \").concat(svgView.height),\n version: \"1.1\"\n }), children);\n}","export default function(x) {\n return x === null ? NaN : +x;\n}\n\nexport function* numbers(values, valueof) {\n if (valueof === undefined) {\n for (let value of values) {\n if (value != null && (value = +value) >= value) {\n yield value;\n }\n }\n } else {\n let index = -1;\n for (let value of values) {\n if ((value = valueof(value, ++index, values)) != null && (value = +value) >= value) {\n yield value;\n }\n }\n }\n}\n","export default function(a, b) {\n return a = +a, b = +b, function(t) {\n return a * (1 - t) + b * t;\n };\n}\n","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Sector\n */\nimport React, { PureComponent } from 'react';\nimport classNames from 'classnames';\nimport { filterProps } from '../util/types';\nimport { polarToCartesian, RADIAN } from '../util/PolarUtils';\nimport { getPercentValue, mathSign } from '../util/DataUtils';\n\nvar getDeltaAngle = function getDeltaAngle(startAngle, endAngle) {\n var sign = mathSign(endAngle - startAngle);\n var deltaAngle = Math.min(Math.abs(endAngle - startAngle), 359.999);\n return sign * deltaAngle;\n};\n\nvar getTangentCircle = function getTangentCircle(_ref) {\n var cx = _ref.cx,\n cy = _ref.cy,\n radius = _ref.radius,\n angle = _ref.angle,\n sign = _ref.sign,\n isExternal = _ref.isExternal,\n cornerRadius = _ref.cornerRadius,\n cornerIsExternal = _ref.cornerIsExternal;\n var centerRadius = cornerRadius * (isExternal ? 1 : -1) + radius;\n var theta = Math.asin(cornerRadius / centerRadius) / RADIAN;\n var centerAngle = cornerIsExternal ? angle : angle + sign * theta;\n var center = polarToCartesian(cx, cy, centerRadius, centerAngle); // The coordinate of point which is tangent to the circle\n\n var circleTangency = polarToCartesian(cx, cy, radius, centerAngle); // The coordinate of point which is tangent to the radius line\n\n var lineTangencyAngle = cornerIsExternal ? angle - sign * theta : angle;\n var lineTangency = polarToCartesian(cx, cy, centerRadius * Math.cos(theta * RADIAN), lineTangencyAngle);\n return {\n center: center,\n circleTangency: circleTangency,\n lineTangency: lineTangency,\n theta: theta\n };\n};\n\nvar getSectorPath = function getSectorPath(_ref2) {\n var cx = _ref2.cx,\n cy = _ref2.cy,\n innerRadius = _ref2.innerRadius,\n outerRadius = _ref2.outerRadius,\n startAngle = _ref2.startAngle,\n endAngle = _ref2.endAngle;\n var angle = getDeltaAngle(startAngle, endAngle); // When the angle of sector equals to 360, star point and end point coincide\n\n var tempEndAngle = startAngle + angle;\n var outerStartPoint = polarToCartesian(cx, cy, outerRadius, startAngle);\n var outerEndPoint = polarToCartesian(cx, cy, outerRadius, tempEndAngle);\n var path = \"M \".concat(outerStartPoint.x, \",\").concat(outerStartPoint.y, \"\\n A \").concat(outerRadius, \",\").concat(outerRadius, \",0,\\n \").concat(+(Math.abs(angle) > 180), \",\").concat(+(startAngle > tempEndAngle), \",\\n \").concat(outerEndPoint.x, \",\").concat(outerEndPoint.y, \"\\n \");\n\n if (innerRadius > 0) {\n var innerStartPoint = polarToCartesian(cx, cy, innerRadius, startAngle);\n var innerEndPoint = polarToCartesian(cx, cy, innerRadius, tempEndAngle);\n path += \"L \".concat(innerEndPoint.x, \",\").concat(innerEndPoint.y, \"\\n A \").concat(innerRadius, \",\").concat(innerRadius, \",0,\\n \").concat(+(Math.abs(angle) > 180), \",\").concat(+(startAngle <= tempEndAngle), \",\\n \").concat(innerStartPoint.x, \",\").concat(innerStartPoint.y, \" Z\");\n } else {\n path += \"L \".concat(cx, \",\").concat(cy, \" Z\");\n }\n\n return path;\n};\n\nvar getSectorWithCorner = function getSectorWithCorner(_ref3) {\n var cx = _ref3.cx,\n cy = _ref3.cy,\n innerRadius = _ref3.innerRadius,\n outerRadius = _ref3.outerRadius,\n cornerRadius = _ref3.cornerRadius,\n forceCornerRadius = _ref3.forceCornerRadius,\n cornerIsExternal = _ref3.cornerIsExternal,\n startAngle = _ref3.startAngle,\n endAngle = _ref3.endAngle;\n var sign = mathSign(endAngle - startAngle);\n\n var _getTangentCircle = getTangentCircle({\n cx: cx,\n cy: cy,\n radius: outerRadius,\n angle: startAngle,\n sign: sign,\n cornerRadius: cornerRadius,\n cornerIsExternal: cornerIsExternal\n }),\n soct = _getTangentCircle.circleTangency,\n solt = _getTangentCircle.lineTangency,\n sot = _getTangentCircle.theta;\n\n var _getTangentCircle2 = getTangentCircle({\n cx: cx,\n cy: cy,\n radius: outerRadius,\n angle: endAngle,\n sign: -sign,\n cornerRadius: cornerRadius,\n cornerIsExternal: cornerIsExternal\n }),\n eoct = _getTangentCircle2.circleTangency,\n eolt = _getTangentCircle2.lineTangency,\n eot = _getTangentCircle2.theta;\n\n var outerArcAngle = cornerIsExternal ? Math.abs(startAngle - endAngle) : Math.abs(startAngle - endAngle) - sot - eot;\n\n if (outerArcAngle < 0) {\n if (forceCornerRadius) {\n return \"M \".concat(solt.x, \",\").concat(solt.y, \"\\n a\").concat(cornerRadius, \",\").concat(cornerRadius, \",0,0,1,\").concat(cornerRadius * 2, \",0\\n a\").concat(cornerRadius, \",\").concat(cornerRadius, \",0,0,1,\").concat(-cornerRadius * 2, \",0\\n \");\n }\n\n return getSectorPath({\n cx: cx,\n cy: cy,\n innerRadius: innerRadius,\n outerRadius: outerRadius,\n startAngle: startAngle,\n endAngle: endAngle\n });\n }\n\n var path = \"M \".concat(solt.x, \",\").concat(solt.y, \"\\n A\").concat(cornerRadius, \",\").concat(cornerRadius, \",0,0,\").concat(+(sign < 0), \",\").concat(soct.x, \",\").concat(soct.y, \"\\n A\").concat(outerRadius, \",\").concat(outerRadius, \",0,\").concat(+(outerArcAngle > 180), \",\").concat(+(sign < 0), \",\").concat(eoct.x, \",\").concat(eoct.y, \"\\n A\").concat(cornerRadius, \",\").concat(cornerRadius, \",0,0,\").concat(+(sign < 0), \",\").concat(eolt.x, \",\").concat(eolt.y, \"\\n \");\n\n if (innerRadius > 0) {\n var _getTangentCircle3 = getTangentCircle({\n cx: cx,\n cy: cy,\n radius: innerRadius,\n angle: startAngle,\n sign: sign,\n isExternal: true,\n cornerRadius: cornerRadius,\n cornerIsExternal: cornerIsExternal\n }),\n sict = _getTangentCircle3.circleTangency,\n silt = _getTangentCircle3.lineTangency,\n sit = _getTangentCircle3.theta;\n\n var _getTangentCircle4 = getTangentCircle({\n cx: cx,\n cy: cy,\n radius: innerRadius,\n angle: endAngle,\n sign: -sign,\n isExternal: true,\n cornerRadius: cornerRadius,\n cornerIsExternal: cornerIsExternal\n }),\n eict = _getTangentCircle4.circleTangency,\n eilt = _getTangentCircle4.lineTangency,\n eit = _getTangentCircle4.theta;\n\n var innerArcAngle = cornerIsExternal ? Math.abs(startAngle - endAngle) : Math.abs(startAngle - endAngle) - sit - eit;\n\n if (innerArcAngle < 0 && cornerRadius === 0) {\n return \"\".concat(path, \"L\").concat(cx, \",\").concat(cy, \"Z\");\n }\n\n path += \"L\".concat(eilt.x, \",\").concat(eilt.y, \"\\n A\").concat(cornerRadius, \",\").concat(cornerRadius, \",0,0,\").concat(+(sign < 0), \",\").concat(eict.x, \",\").concat(eict.y, \"\\n A\").concat(innerRadius, \",\").concat(innerRadius, \",0,\").concat(+(innerArcAngle > 180), \",\").concat(+(sign > 0), \",\").concat(sict.x, \",\").concat(sict.y, \"\\n A\").concat(cornerRadius, \",\").concat(cornerRadius, \",0,0,\").concat(+(sign < 0), \",\").concat(silt.x, \",\").concat(silt.y, \"Z\");\n } else {\n path += \"L\".concat(cx, \",\").concat(cy, \"Z\");\n }\n\n return path;\n};\n\nexport var Sector = /*#__PURE__*/function (_PureComponent) {\n _inherits(Sector, _PureComponent);\n\n var _super = _createSuper(Sector);\n\n function Sector() {\n _classCallCheck(this, Sector);\n\n return _super.apply(this, arguments);\n }\n\n _createClass(Sector, [{\n key: \"render\",\n value: function render() {\n var _this$props = this.props,\n cx = _this$props.cx,\n cy = _this$props.cy,\n innerRadius = _this$props.innerRadius,\n outerRadius = _this$props.outerRadius,\n cornerRadius = _this$props.cornerRadius,\n forceCornerRadius = _this$props.forceCornerRadius,\n cornerIsExternal = _this$props.cornerIsExternal,\n startAngle = _this$props.startAngle,\n endAngle = _this$props.endAngle,\n className = _this$props.className;\n\n if (outerRadius < innerRadius || startAngle === endAngle) {\n return null;\n }\n\n var layerClass = classNames('recharts-sector', className);\n var deltaRadius = outerRadius - innerRadius;\n var cr = getPercentValue(cornerRadius, deltaRadius, 0, true);\n var path;\n\n if (cr > 0 && Math.abs(startAngle - endAngle) < 360) {\n path = getSectorWithCorner({\n cx: cx,\n cy: cy,\n innerRadius: innerRadius,\n outerRadius: outerRadius,\n cornerRadius: Math.min(cr, deltaRadius / 2),\n forceCornerRadius: forceCornerRadius,\n cornerIsExternal: cornerIsExternal,\n startAngle: startAngle,\n endAngle: endAngle\n });\n } else {\n path = getSectorPath({\n cx: cx,\n cy: cy,\n innerRadius: innerRadius,\n outerRadius: outerRadius,\n startAngle: startAngle,\n endAngle: endAngle\n });\n }\n\n return /*#__PURE__*/React.createElement(\"path\", _extends({}, filterProps(this.props, true), {\n className: layerClass,\n d: path\n }));\n }\n }]);\n\n return Sector;\n}(PureComponent);\nSector.defaultProps = {\n cx: 0,\n cy: 0,\n innerRadius: 0,\n outerRadius: 0,\n startAngle: 0,\n endAngle: 0,\n cornerRadius: 0,\n forceCornerRadius: false,\n cornerIsExternal: false\n};","export var abs = Math.abs;\nexport var atan2 = Math.atan2;\nexport var cos = Math.cos;\nexport var max = Math.max;\nexport var min = Math.min;\nexport var sin = Math.sin;\nexport var sqrt = Math.sqrt;\n\nexport var epsilon = 1e-12;\nexport var pi = Math.PI;\nexport var halfPi = pi / 2;\nexport var tau = 2 * pi;\n\nexport function acos(x) {\n return x > 1 ? 0 : x < -1 ? pi : Math.acos(x);\n}\n\nexport function asin(x) {\n return x >= 1 ? halfPi : x <= -1 ? -halfPi : Math.asin(x);\n}\n","import {pi, tau} from \"../math.js\";\n\nexport default {\n draw: function(context, size) {\n var r = Math.sqrt(size / pi);\n context.moveTo(r, 0);\n context.arc(0, 0, r, 0, tau);\n }\n};\n","export default {\n draw: function(context, size) {\n var r = Math.sqrt(size / 5) / 2;\n context.moveTo(-3 * r, -r);\n context.lineTo(-r, -r);\n context.lineTo(-r, -3 * r);\n context.lineTo(r, -3 * r);\n context.lineTo(r, -r);\n context.lineTo(3 * r, -r);\n context.lineTo(3 * r, r);\n context.lineTo(r, r);\n context.lineTo(r, 3 * r);\n context.lineTo(-r, 3 * r);\n context.lineTo(-r, r);\n context.lineTo(-3 * r, r);\n context.closePath();\n }\n};\n","var tan30 = Math.sqrt(1 / 3),\n tan30_2 = tan30 * 2;\n\nexport default {\n draw: function(context, size) {\n var y = Math.sqrt(size / tan30_2),\n x = y * tan30;\n context.moveTo(0, -y);\n context.lineTo(x, 0);\n context.lineTo(0, y);\n context.lineTo(-x, 0);\n context.closePath();\n }\n};\n","export default {\n draw: function(context, size) {\n var w = Math.sqrt(size),\n x = -w / 2;\n context.rect(x, x, w, w);\n }\n};\n","import {pi, tau} from \"../math.js\";\n\nvar ka = 0.89081309152928522810,\n kr = Math.sin(pi / 10) / Math.sin(7 * pi / 10),\n kx = Math.sin(tau / 10) * kr,\n ky = -Math.cos(tau / 10) * kr;\n\nexport default {\n draw: function(context, size) {\n var r = Math.sqrt(size * ka),\n x = kx * r,\n y = ky * r;\n context.moveTo(0, -r);\n context.lineTo(x, y);\n for (var i = 1; i < 5; ++i) {\n var a = tau * i / 5,\n c = Math.cos(a),\n s = Math.sin(a);\n context.lineTo(s * r, -c * r);\n context.lineTo(c * x - s * y, s * x + c * y);\n }\n context.closePath();\n }\n};\n","var sqrt3 = Math.sqrt(3);\n\nexport default {\n draw: function(context, size) {\n var y = -Math.sqrt(size / (sqrt3 * 3));\n context.moveTo(0, y * 2);\n context.lineTo(-sqrt3 * y, -y);\n context.lineTo(sqrt3 * y, -y);\n context.closePath();\n }\n};\n","var c = -0.5,\n s = Math.sqrt(3) / 2,\n k = 1 / Math.sqrt(12),\n a = (k / 2 + 1) * 3;\n\nexport default {\n draw: function(context, size) {\n var r = Math.sqrt(size / a),\n x0 = r / 2,\n y0 = r * k,\n x1 = x0,\n y1 = r * k + r,\n x2 = -x1,\n y2 = y1;\n context.moveTo(x0, y0);\n context.lineTo(x1, y1);\n context.lineTo(x2, y2);\n context.lineTo(c * x0 - s * y0, s * x0 + c * y0);\n context.lineTo(c * x1 - s * y1, s * x1 + c * y1);\n context.lineTo(c * x2 - s * y2, s * x2 + c * y2);\n context.lineTo(c * x0 + s * y0, c * y0 - s * x0);\n context.lineTo(c * x1 + s * y1, c * y1 - s * x1);\n context.lineTo(c * x2 + s * y2, c * y2 - s * x2);\n context.closePath();\n }\n};\n","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _upperFirst from \"lodash/upperFirst\";\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Curve\n */\nimport React, { PureComponent } from 'react';\nimport { symbol as shapeSymbol, symbolCircle, symbolCross, symbolDiamond, symbolSquare, symbolStar, symbolTriangle, symbolWye } from 'd3-shape';\nimport classNames from 'classnames';\nimport { filterProps } from '../util/types';\nvar symbolFactories = {\n symbolCircle: symbolCircle,\n symbolCross: symbolCross,\n symbolDiamond: symbolDiamond,\n symbolSquare: symbolSquare,\n symbolStar: symbolStar,\n symbolTriangle: symbolTriangle,\n symbolWye: symbolWye\n};\nvar RADIAN = Math.PI / 180;\n\nvar getSymbolFactory = function getSymbolFactory(type) {\n var name = \"symbol\".concat(_upperFirst(type));\n return symbolFactories[name] || symbolCircle;\n};\n\nvar calculateAreaSize = function calculateAreaSize(size, sizeType, type) {\n if (sizeType === 'area') {\n return size;\n }\n\n switch (type) {\n case 'cross':\n return 5 * size * size / 9;\n\n case 'diamond':\n return 0.5 * size * size / Math.sqrt(3);\n\n case 'square':\n return size * size;\n\n case 'star':\n {\n var angle = 18 * RADIAN;\n return 1.25 * size * size * (Math.tan(angle) - Math.tan(angle * 2) * Math.pow(Math.tan(angle), 2));\n }\n\n case 'triangle':\n return Math.sqrt(3) * size * size / 4;\n\n case 'wye':\n return (21 - 10 * Math.sqrt(3)) * size * size / 8;\n\n default:\n return Math.PI * size * size / 4;\n }\n};\n\nexport var Symbols = /*#__PURE__*/function (_PureComponent) {\n _inherits(Symbols, _PureComponent);\n\n var _super = _createSuper(Symbols);\n\n function Symbols() {\n _classCallCheck(this, Symbols);\n\n return _super.apply(this, arguments);\n }\n\n _createClass(Symbols, [{\n key: \"getPath\",\n value:\n /**\n * Calculate the path of curve\n * @return {String} path\n */\n function getPath() {\n var _this$props = this.props,\n size = _this$props.size,\n sizeType = _this$props.sizeType,\n type = _this$props.type;\n var symbolFactory = getSymbolFactory(type);\n var symbol = shapeSymbol().type(symbolFactory).size(calculateAreaSize(size, sizeType, type));\n return symbol();\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props2 = this.props,\n className = _this$props2.className,\n cx = _this$props2.cx,\n cy = _this$props2.cy,\n size = _this$props2.size;\n\n if (cx === +cx && cy === +cy && size === +size) {\n return /*#__PURE__*/React.createElement(\"path\", _extends({}, filterProps(this.props, true), {\n className: classNames('recharts-symbols', className),\n transform: \"translate(\".concat(cx, \", \").concat(cy, \")\"),\n d: this.getPath()\n }));\n }\n\n return null;\n }\n }]);\n\n return Symbols;\n}(PureComponent);\nSymbols.defaultProps = {\n type: 'circle',\n size: 64,\n sizeType: 'area'\n};\n\nSymbols.registerSymbol = function (key, factory) {\n symbolFactories[\"symbol\".concat(_upperFirst(key))] = factory;\n};","import {path} from \"d3-path\";\nimport circle from \"./symbol/circle.js\";\nimport cross from \"./symbol/cross.js\";\nimport diamond from \"./symbol/diamond.js\";\nimport star from \"./symbol/star.js\";\nimport square from \"./symbol/square.js\";\nimport triangle from \"./symbol/triangle.js\";\nimport wye from \"./symbol/wye.js\";\nimport constant from \"./constant.js\";\n\nexport var symbols = [\n circle,\n cross,\n diamond,\n square,\n star,\n triangle,\n wye\n];\n\nexport default function(type, size) {\n var context = null;\n type = typeof type === \"function\" ? type : constant(type || circle);\n size = typeof size === \"function\" ? size : constant(size === undefined ? 64 : +size);\n\n function symbol() {\n var buffer;\n if (!context) context = buffer = path();\n type.apply(this, arguments).draw(context, +size.apply(this, arguments));\n if (buffer) return context = null, buffer + \"\" || null;\n }\n\n symbol.type = function(_) {\n return arguments.length ? (type = typeof _ === \"function\" ? _ : constant(_), symbol) : type;\n };\n\n symbol.size = function(_) {\n return arguments.length ? (size = typeof _ === \"function\" ? _ : constant(+_), symbol) : size;\n };\n\n symbol.context = function(_) {\n return arguments.length ? (context = _ == null ? null : _, symbol) : context;\n };\n\n return symbol;\n}\n","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Default Legend Content\n */\nimport React, { PureComponent } from 'react';\nimport classNames from 'classnames';\nimport { Surface } from '../container/Surface';\nimport { Symbols } from '../shape/Symbols';\nimport { adaptEventsOfChild } from '../util/types';\nvar SIZE = 32;\nexport var DefaultLegendContent = /*#__PURE__*/function (_PureComponent) {\n _inherits(DefaultLegendContent, _PureComponent);\n\n var _super = _createSuper(DefaultLegendContent);\n\n function DefaultLegendContent() {\n _classCallCheck(this, DefaultLegendContent);\n\n return _super.apply(this, arguments);\n }\n\n _createClass(DefaultLegendContent, [{\n key: \"renderIcon\",\n value:\n /**\n * Render the path of icon\n * @param {Object} data Data of each legend item\n * @return {String} Path element\n */\n function renderIcon(data) {\n var inactiveColor = this.props.inactiveColor;\n var halfSize = SIZE / 2;\n var sixthSize = SIZE / 6;\n var thirdSize = SIZE / 3;\n var color = data.inactive ? inactiveColor : data.color;\n\n if (data.type === 'plainline') {\n return /*#__PURE__*/React.createElement(\"line\", {\n strokeWidth: 4,\n fill: \"none\",\n stroke: color,\n strokeDasharray: data.payload.strokeDasharray,\n x1: 0,\n y1: halfSize,\n x2: SIZE,\n y2: halfSize,\n className: \"recharts-legend-icon\"\n });\n }\n\n if (data.type === 'line') {\n return /*#__PURE__*/React.createElement(\"path\", {\n strokeWidth: 4,\n fill: \"none\",\n stroke: color,\n d: \"M0,\".concat(halfSize, \"h\").concat(thirdSize, \"\\n A\").concat(sixthSize, \",\").concat(sixthSize, \",0,1,1,\").concat(2 * thirdSize, \",\").concat(halfSize, \"\\n H\").concat(SIZE, \"M\").concat(2 * thirdSize, \",\").concat(halfSize, \"\\n A\").concat(sixthSize, \",\").concat(sixthSize, \",0,1,1,\").concat(thirdSize, \",\").concat(halfSize),\n className: \"recharts-legend-icon\"\n });\n }\n\n if (data.type === 'rect') {\n return /*#__PURE__*/React.createElement(\"path\", {\n stroke: \"none\",\n fill: color,\n d: \"M0,\".concat(SIZE / 8, \"h\").concat(SIZE, \"v\").concat(SIZE * 3 / 4, \"h\").concat(-SIZE, \"z\"),\n className: \"recharts-legend-icon\"\n });\n }\n\n if ( /*#__PURE__*/React.isValidElement(data.legendIcon)) {\n var iconProps = _objectSpread({}, data);\n\n delete iconProps.legendIcon;\n return /*#__PURE__*/React.cloneElement(data.legendIcon, iconProps);\n }\n\n return /*#__PURE__*/React.createElement(Symbols, {\n fill: color,\n cx: halfSize,\n cy: halfSize,\n size: SIZE,\n sizeType: \"diameter\",\n type: data.type\n });\n }\n /**\n * Draw items of legend\n * @return {ReactElement} Items\n */\n\n }, {\n key: \"renderItems\",\n value: function renderItems() {\n var _this = this;\n\n var _this$props = this.props,\n payload = _this$props.payload,\n iconSize = _this$props.iconSize,\n layout = _this$props.layout,\n formatter = _this$props.formatter,\n inactiveColor = _this$props.inactiveColor;\n var viewBox = {\n x: 0,\n y: 0,\n width: SIZE,\n height: SIZE\n };\n var itemStyle = {\n display: layout === 'horizontal' ? 'inline-block' : 'block',\n marginRight: 10\n };\n var svgStyle = {\n display: 'inline-block',\n verticalAlign: 'middle',\n marginRight: 4\n };\n return payload.map(function (entry, i) {\n var _classNames;\n\n var finalFormatter = entry.formatter || formatter;\n var className = classNames((_classNames = {\n 'recharts-legend-item': true\n }, _defineProperty(_classNames, \"legend-item-\".concat(i), true), _defineProperty(_classNames, \"inactive\", entry.inactive), _classNames));\n\n if (entry.type === 'none') {\n return null;\n }\n\n var color = entry.inactive ? inactiveColor : entry.color;\n return /*#__PURE__*/React.createElement(\"li\", _extends({\n className: className,\n style: itemStyle,\n key: \"legend-item-\".concat(i) // eslint-disable-line react/no-array-index-key\n\n }, adaptEventsOfChild(_this.props, entry, i)), /*#__PURE__*/React.createElement(Surface, {\n width: iconSize,\n height: iconSize,\n viewBox: viewBox,\n style: svgStyle\n }, _this.renderIcon(entry)), /*#__PURE__*/React.createElement(\"span\", {\n className: \"recharts-legend-item-text\",\n style: {\n color: color\n }\n }, finalFormatter ? finalFormatter(entry.value, entry, i) : entry.value));\n });\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props2 = this.props,\n payload = _this$props2.payload,\n layout = _this$props2.layout,\n align = _this$props2.align;\n\n if (!payload || !payload.length) {\n return null;\n }\n\n var finalStyle = {\n padding: 0,\n margin: 0,\n textAlign: layout === 'horizontal' ? align : 'left'\n };\n return /*#__PURE__*/React.createElement(\"ul\", {\n className: \"recharts-default-legend\",\n style: finalStyle\n }, this.renderItems());\n }\n }]);\n\n return DefaultLegendContent;\n}(PureComponent);\nDefaultLegendContent.displayName = 'Legend';\nDefaultLegendContent.defaultProps = {\n iconSize: 14,\n layout: 'horizontal',\n align: 'center',\n verticalAlign: 'middle',\n inactiveColor: '#ccc'\n};","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _isFunction from \"lodash/isFunction\";\nimport _uniqBy from \"lodash/uniqBy\";\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nfunction _objectWithoutProperties(source, excluded) { if (source == null) return {}; var target = _objectWithoutPropertiesLoose(source, excluded); var key, i; if (Object.getOwnPropertySymbols) { var sourceSymbolKeys = Object.getOwnPropertySymbols(source); for (i = 0; i < sourceSymbolKeys.length; i++) { key = sourceSymbolKeys[i]; if (excluded.indexOf(key) >= 0) continue; if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; target[key] = source[key]; } } return target; }\n\nfunction _objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }\n\n/**\n * @fileOverview Legend\n */\nimport React, { PureComponent } from 'react';\nimport { DefaultLegendContent } from './DefaultLegendContent';\nimport { isNumber } from '../util/DataUtils';\n\nfunction defaultUniqBy(entry) {\n return entry.value;\n}\n\nfunction getUniqPayload(option, payload) {\n if (option === true) {\n return _uniqBy(payload, defaultUniqBy);\n }\n\n if (_isFunction(option)) {\n return _uniqBy(payload, option);\n }\n\n return payload;\n}\n\nfunction renderContent(content, props) {\n if ( /*#__PURE__*/React.isValidElement(content)) {\n return /*#__PURE__*/React.cloneElement(content, props);\n }\n\n if (_isFunction(content)) {\n return /*#__PURE__*/React.createElement(content, props);\n }\n\n var ref = props.ref,\n otherProps = _objectWithoutProperties(props, [\"ref\"]);\n\n return /*#__PURE__*/React.createElement(DefaultLegendContent, otherProps);\n}\n\nvar EPS = 1;\nexport var Legend = /*#__PURE__*/function (_PureComponent) {\n _inherits(Legend, _PureComponent);\n\n var _super = _createSuper(Legend);\n\n function Legend() {\n var _this;\n\n _classCallCheck(this, Legend);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _super.call.apply(_super, [this].concat(args));\n _this.wrapperNode = void 0;\n _this.state = {\n boxWidth: -1,\n boxHeight: -1\n };\n return _this;\n }\n\n _createClass(Legend, [{\n key: \"componentDidMount\",\n value: function componentDidMount() {\n this.updateBBox();\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate() {\n this.updateBBox();\n }\n }, {\n key: \"getBBox\",\n value: function getBBox() {\n if (this.wrapperNode && this.wrapperNode.getBoundingClientRect) {\n return this.wrapperNode.getBoundingClientRect();\n }\n\n return null;\n }\n }, {\n key: \"getBBoxSnapshot\",\n value: function getBBoxSnapshot() {\n var _this$state = this.state,\n boxWidth = _this$state.boxWidth,\n boxHeight = _this$state.boxHeight;\n\n if (boxWidth >= 0 && boxHeight >= 0) {\n return {\n width: boxWidth,\n height: boxHeight\n };\n }\n\n return null;\n }\n }, {\n key: \"getDefaultPosition\",\n value: function getDefaultPosition(style) {\n var _this$props = this.props,\n layout = _this$props.layout,\n align = _this$props.align,\n verticalAlign = _this$props.verticalAlign,\n margin = _this$props.margin,\n chartWidth = _this$props.chartWidth,\n chartHeight = _this$props.chartHeight;\n var hPos, vPos;\n\n if (!style || (style.left === undefined || style.left === null) && (style.right === undefined || style.right === null)) {\n if (align === 'center' && layout === 'vertical') {\n var _box = this.getBBoxSnapshot() || {\n width: 0\n };\n\n hPos = {\n left: ((chartWidth || 0) - _box.width) / 2\n };\n } else {\n hPos = align === 'right' ? {\n right: margin && margin.right || 0\n } : {\n left: margin && margin.left || 0\n };\n }\n }\n\n if (!style || (style.top === undefined || style.top === null) && (style.bottom === undefined || style.bottom === null)) {\n if (verticalAlign === 'middle') {\n var _box2 = this.getBBoxSnapshot() || {\n height: 0\n };\n\n vPos = {\n top: ((chartHeight || 0) - _box2.height) / 2\n };\n } else {\n vPos = verticalAlign === 'bottom' ? {\n bottom: margin && margin.bottom || 0\n } : {\n top: margin && margin.top || 0\n };\n }\n }\n\n return _objectSpread(_objectSpread({}, hPos), vPos);\n }\n }, {\n key: \"updateBBox\",\n value: function updateBBox() {\n var _this$state2 = this.state,\n boxWidth = _this$state2.boxWidth,\n boxHeight = _this$state2.boxHeight;\n var onBBoxUpdate = this.props.onBBoxUpdate;\n\n if (this.wrapperNode && this.wrapperNode.getBoundingClientRect) {\n var _box3 = this.wrapperNode.getBoundingClientRect();\n\n if (Math.abs(_box3.width - boxWidth) > EPS || Math.abs(_box3.height - boxHeight) > EPS) {\n this.setState({\n boxWidth: _box3.width,\n boxHeight: _box3.height\n }, function () {\n if (onBBoxUpdate) {\n onBBoxUpdate(_box3);\n }\n });\n }\n } else if (boxWidth !== -1 || boxHeight !== -1) {\n this.setState({\n boxWidth: -1,\n boxHeight: -1\n }, function () {\n if (onBBoxUpdate) {\n onBBoxUpdate(null);\n }\n });\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this2 = this;\n\n var _this$props2 = this.props,\n content = _this$props2.content,\n width = _this$props2.width,\n height = _this$props2.height,\n wrapperStyle = _this$props2.wrapperStyle,\n payloadUniqBy = _this$props2.payloadUniqBy,\n payload = _this$props2.payload;\n\n var outerStyle = _objectSpread(_objectSpread({\n position: 'absolute',\n width: width || 'auto',\n height: height || 'auto'\n }, this.getDefaultPosition(wrapperStyle)), wrapperStyle);\n\n return /*#__PURE__*/React.createElement(\"div\", {\n className: \"recharts-legend-wrapper\",\n style: outerStyle,\n ref: function ref(node) {\n _this2.wrapperNode = node;\n }\n }, renderContent(content, _objectSpread(_objectSpread({}, this.props), {}, {\n payload: getUniqPayload(payloadUniqBy, payload)\n })));\n }\n }], [{\n key: \"getWithHeight\",\n value: function getWithHeight(item, chartWidth) {\n var layout = item.props.layout;\n\n if (layout === 'vertical' && isNumber(item.props.height)) {\n return {\n height: item.props.height\n };\n }\n\n if (layout === 'horizontal') {\n return {\n width: item.props.width || chartWidth\n };\n }\n\n return null;\n }\n }]);\n\n return Legend;\n}(PureComponent);\nLegend.displayName = 'Legend';\nLegend.defaultProps = {\n iconSize: 14,\n layout: 'horizontal',\n align: 'center',\n verticalAlign: 'bottom'\n};","var baseExtremum = require('./_baseExtremum'),\n baseLt = require('./_baseLt'),\n identity = require('./identity');\n\n/**\n * Computes the minimum value of `array`. If `array` is empty or falsey,\n * `undefined` is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Math\n * @param {Array} array The array to iterate over.\n * @returns {*} Returns the minimum value.\n * @example\n *\n * _.min([4, 2, 8, 6]);\n * // => 2\n *\n * _.min([]);\n * // => undefined\n */\nfunction min(array) {\n return (array && array.length)\n ? baseExtremum(array, identity, baseLt)\n : undefined;\n}\n\nmodule.exports = min;\n","import defineProperty from \"./defineProperty.js\";\n\nfunction ownKeys(object, enumerableOnly) {\n var keys = Object.keys(object);\n\n if (Object.getOwnPropertySymbols) {\n var symbols = Object.getOwnPropertySymbols(object);\n\n if (enumerableOnly) {\n symbols = symbols.filter(function (sym) {\n return Object.getOwnPropertyDescriptor(object, sym).enumerable;\n });\n }\n\n keys.push.apply(keys, symbols);\n }\n\n return keys;\n}\n\nexport default function _objectSpread2(target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i] != null ? arguments[i] : {};\n\n if (i % 2) {\n ownKeys(Object(source), true).forEach(function (key) {\n defineProperty(target, key, source[key]);\n });\n } else if (Object.getOwnPropertyDescriptors) {\n Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));\n } else {\n ownKeys(Object(source)).forEach(function (key) {\n Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));\n });\n }\n }\n\n return target;\n}","import _objectSpread from '@babel/runtime/helpers/esm/objectSpread2';\n\n/**\n * Adapted from React: https://github.com/facebook/react/blob/master/packages/shared/formatProdErrorMessage.js\n *\n * Do not require this module directly! Use normal throw error calls. These messages will be replaced with error codes\n * during build.\n * @param {number} code\n */\nfunction formatProdErrorMessage(code) {\n return \"Minified Redux error #\" + code + \"; visit https://redux.js.org/Errors?code=\" + code + \" for the full message or \" + 'use the non-minified dev environment for full errors. ';\n}\n\n// Inlined version of the `symbol-observable` polyfill\nvar $$observable = (function () {\n return typeof Symbol === 'function' && Symbol.observable || '@@observable';\n})();\n\n/**\n * These are private action types reserved by Redux.\n * For any unknown actions, you must return the current state.\n * If the current state is undefined, you must return the initial state.\n * Do not reference these action types directly in your code.\n */\nvar randomString = function randomString() {\n return Math.random().toString(36).substring(7).split('').join('.');\n};\n\nvar ActionTypes = {\n INIT: \"@@redux/INIT\" + randomString(),\n REPLACE: \"@@redux/REPLACE\" + randomString(),\n PROBE_UNKNOWN_ACTION: function PROBE_UNKNOWN_ACTION() {\n return \"@@redux/PROBE_UNKNOWN_ACTION\" + randomString();\n }\n};\n\n/**\n * @param {any} obj The object to inspect.\n * @returns {boolean} True if the argument appears to be a plain object.\n */\nfunction isPlainObject(obj) {\n if (typeof obj !== 'object' || obj === null) return false;\n var proto = obj;\n\n while (Object.getPrototypeOf(proto) !== null) {\n proto = Object.getPrototypeOf(proto);\n }\n\n return Object.getPrototypeOf(obj) === proto;\n}\n\nfunction kindOf(val) {\n var typeOfVal = typeof val;\n\n if (process.env.NODE_ENV !== 'production') {\n // Inlined / shortened version of `kindOf` from https://github.com/jonschlinkert/kind-of\n function miniKindOf(val) {\n if (val === void 0) return 'undefined';\n if (val === null) return 'null';\n var type = typeof val;\n\n switch (type) {\n case 'boolean':\n case 'string':\n case 'number':\n case 'symbol':\n case 'function':\n {\n return type;\n }\n }\n\n if (Array.isArray(val)) return 'array';\n if (isDate(val)) return 'date';\n if (isError(val)) return 'error';\n var constructorName = ctorName(val);\n\n switch (constructorName) {\n case 'Symbol':\n case 'Promise':\n case 'WeakMap':\n case 'WeakSet':\n case 'Map':\n case 'Set':\n return constructorName;\n } // other\n\n\n return type.slice(8, -1).toLowerCase().replace(/\\s/g, '');\n }\n\n function ctorName(val) {\n return typeof val.constructor === 'function' ? val.constructor.name : null;\n }\n\n function isError(val) {\n return val instanceof Error || typeof val.message === 'string' && val.constructor && typeof val.constructor.stackTraceLimit === 'number';\n }\n\n function isDate(val) {\n if (val instanceof Date) return true;\n return typeof val.toDateString === 'function' && typeof val.getDate === 'function' && typeof val.setDate === 'function';\n }\n\n typeOfVal = miniKindOf(val);\n }\n\n return typeOfVal;\n}\n\n/**\n * Creates a Redux store that holds the state tree.\n * The only way to change the data in the store is to call `dispatch()` on it.\n *\n * There should only be a single store in your app. To specify how different\n * parts of the state tree respond to actions, you may combine several reducers\n * into a single reducer function by using `combineReducers`.\n *\n * @param {Function} reducer A function that returns the next state tree, given\n * the current state tree and the action to handle.\n *\n * @param {any} [preloadedState] The initial state. You may optionally specify it\n * to hydrate the state from the server in universal apps, or to restore a\n * previously serialized user session.\n * If you use `combineReducers` to produce the root reducer function, this must be\n * an object with the same shape as `combineReducers` keys.\n *\n * @param {Function} [enhancer] The store enhancer. You may optionally specify it\n * to enhance the store with third-party capabilities such as middleware,\n * time travel, persistence, etc. The only store enhancer that ships with Redux\n * is `applyMiddleware()`.\n *\n * @returns {Store} A Redux store that lets you read the state, dispatch actions\n * and subscribe to changes.\n */\n\nfunction createStore(reducer, preloadedState, enhancer) {\n var _ref2;\n\n if (typeof preloadedState === 'function' && typeof enhancer === 'function' || typeof enhancer === 'function' && typeof arguments[3] === 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(0) : 'It looks like you are passing several store enhancers to ' + 'createStore(). This is not supported. Instead, compose them ' + 'together to a single function. See https://redux.js.org/tutorials/fundamentals/part-4-store#creating-a-store-with-enhancers for an example.');\n }\n\n if (typeof preloadedState === 'function' && typeof enhancer === 'undefined') {\n enhancer = preloadedState;\n preloadedState = undefined;\n }\n\n if (typeof enhancer !== 'undefined') {\n if (typeof enhancer !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(1) : \"Expected the enhancer to be a function. Instead, received: '\" + kindOf(enhancer) + \"'\");\n }\n\n return enhancer(createStore)(reducer, preloadedState);\n }\n\n if (typeof reducer !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(2) : \"Expected the root reducer to be a function. Instead, received: '\" + kindOf(reducer) + \"'\");\n }\n\n var currentReducer = reducer;\n var currentState = preloadedState;\n var currentListeners = [];\n var nextListeners = currentListeners;\n var isDispatching = false;\n /**\n * This makes a shallow copy of currentListeners so we can use\n * nextListeners as a temporary list while dispatching.\n *\n * This prevents any bugs around consumers calling\n * subscribe/unsubscribe in the middle of a dispatch.\n */\n\n function ensureCanMutateNextListeners() {\n if (nextListeners === currentListeners) {\n nextListeners = currentListeners.slice();\n }\n }\n /**\n * Reads the state tree managed by the store.\n *\n * @returns {any} The current state tree of your application.\n */\n\n\n function getState() {\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(3) : 'You may not call store.getState() while the reducer is executing. ' + 'The reducer has already received the state as an argument. ' + 'Pass it down from the top reducer instead of reading it from the store.');\n }\n\n return currentState;\n }\n /**\n * Adds a change listener. It will be called any time an action is dispatched,\n * and some part of the state tree may potentially have changed. You may then\n * call `getState()` to read the current state tree inside the callback.\n *\n * You may call `dispatch()` from a change listener, with the following\n * caveats:\n *\n * 1. The subscriptions are snapshotted just before every `dispatch()` call.\n * If you subscribe or unsubscribe while the listeners are being invoked, this\n * will not have any effect on the `dispatch()` that is currently in progress.\n * However, the next `dispatch()` call, whether nested or not, will use a more\n * recent snapshot of the subscription list.\n *\n * 2. The listener should not expect to see all state changes, as the state\n * might have been updated multiple times during a nested `dispatch()` before\n * the listener is called. It is, however, guaranteed that all subscribers\n * registered before the `dispatch()` started will be called with the latest\n * state by the time it exits.\n *\n * @param {Function} listener A callback to be invoked on every dispatch.\n * @returns {Function} A function to remove this change listener.\n */\n\n\n function subscribe(listener) {\n if (typeof listener !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(4) : \"Expected the listener to be a function. Instead, received: '\" + kindOf(listener) + \"'\");\n }\n\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(5) : 'You may not call store.subscribe() while the reducer is executing. ' + 'If you would like to be notified after the store has been updated, subscribe from a ' + 'component and invoke store.getState() in the callback to access the latest state. ' + 'See https://redux.js.org/api/store#subscribelistener for more details.');\n }\n\n var isSubscribed = true;\n ensureCanMutateNextListeners();\n nextListeners.push(listener);\n return function unsubscribe() {\n if (!isSubscribed) {\n return;\n }\n\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(6) : 'You may not unsubscribe from a store listener while the reducer is executing. ' + 'See https://redux.js.org/api/store#subscribelistener for more details.');\n }\n\n isSubscribed = false;\n ensureCanMutateNextListeners();\n var index = nextListeners.indexOf(listener);\n nextListeners.splice(index, 1);\n currentListeners = null;\n };\n }\n /**\n * Dispatches an action. It is the only way to trigger a state change.\n *\n * The `reducer` function, used to create the store, will be called with the\n * current state tree and the given `action`. Its return value will\n * be considered the **next** state of the tree, and the change listeners\n * will be notified.\n *\n * The base implementation only supports plain object actions. If you want to\n * dispatch a Promise, an Observable, a thunk, or something else, you need to\n * wrap your store creating function into the corresponding middleware. For\n * example, see the documentation for the `redux-thunk` package. Even the\n * middleware will eventually dispatch plain object actions using this method.\n *\n * @param {Object} action A plain object representing “what changed”. It is\n * a good idea to keep actions serializable so you can record and replay user\n * sessions, or use the time travelling `redux-devtools`. An action must have\n * a `type` property which may not be `undefined`. It is a good idea to use\n * string constants for action types.\n *\n * @returns {Object} For convenience, the same action object you dispatched.\n *\n * Note that, if you use a custom middleware, it may wrap `dispatch()` to\n * return something else (for example, a Promise you can await).\n */\n\n\n function dispatch(action) {\n if (!isPlainObject(action)) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(7) : \"Actions must be plain objects. Instead, the actual type was: '\" + kindOf(action) + \"'. You may need to add middleware to your store setup to handle dispatching other values, such as 'redux-thunk' to handle dispatching functions. See https://redux.js.org/tutorials/fundamentals/part-4-store#middleware and https://redux.js.org/tutorials/fundamentals/part-6-async-logic#using-the-redux-thunk-middleware for examples.\");\n }\n\n if (typeof action.type === 'undefined') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(8) : 'Actions may not have an undefined \"type\" property. You may have misspelled an action type string constant.');\n }\n\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(9) : 'Reducers may not dispatch actions.');\n }\n\n try {\n isDispatching = true;\n currentState = currentReducer(currentState, action);\n } finally {\n isDispatching = false;\n }\n\n var listeners = currentListeners = nextListeners;\n\n for (var i = 0; i < listeners.length; i++) {\n var listener = listeners[i];\n listener();\n }\n\n return action;\n }\n /**\n * Replaces the reducer currently used by the store to calculate the state.\n *\n * You might need this if your app implements code splitting and you want to\n * load some of the reducers dynamically. You might also need this if you\n * implement a hot reloading mechanism for Redux.\n *\n * @param {Function} nextReducer The reducer for the store to use instead.\n * @returns {void}\n */\n\n\n function replaceReducer(nextReducer) {\n if (typeof nextReducer !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(10) : \"Expected the nextReducer to be a function. Instead, received: '\" + kindOf(nextReducer));\n }\n\n currentReducer = nextReducer; // This action has a similiar effect to ActionTypes.INIT.\n // Any reducers that existed in both the new and old rootReducer\n // will receive the previous state. This effectively populates\n // the new state tree with any relevant data from the old one.\n\n dispatch({\n type: ActionTypes.REPLACE\n });\n }\n /**\n * Interoperability point for observable/reactive libraries.\n * @returns {observable} A minimal observable of state changes.\n * For more information, see the observable proposal:\n * https://github.com/tc39/proposal-observable\n */\n\n\n function observable() {\n var _ref;\n\n var outerSubscribe = subscribe;\n return _ref = {\n /**\n * The minimal observable subscription method.\n * @param {Object} observer Any object that can be used as an observer.\n * The observer object should have a `next` method.\n * @returns {subscription} An object with an `unsubscribe` method that can\n * be used to unsubscribe the observable from the store, and prevent further\n * emission of values from the observable.\n */\n subscribe: function subscribe(observer) {\n if (typeof observer !== 'object' || observer === null) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(11) : \"Expected the observer to be an object. Instead, received: '\" + kindOf(observer) + \"'\");\n }\n\n function observeState() {\n if (observer.next) {\n observer.next(getState());\n }\n }\n\n observeState();\n var unsubscribe = outerSubscribe(observeState);\n return {\n unsubscribe: unsubscribe\n };\n }\n }, _ref[$$observable] = function () {\n return this;\n }, _ref;\n } // When a store is created, an \"INIT\" action is dispatched so that every\n // reducer returns their initial state. This effectively populates\n // the initial state tree.\n\n\n dispatch({\n type: ActionTypes.INIT\n });\n return _ref2 = {\n dispatch: dispatch,\n subscribe: subscribe,\n getState: getState,\n replaceReducer: replaceReducer\n }, _ref2[$$observable] = observable, _ref2;\n}\n\n/**\n * Prints a warning in the console if it exists.\n *\n * @param {String} message The warning message.\n * @returns {void}\n */\nfunction warning(message) {\n /* eslint-disable no-console */\n if (typeof console !== 'undefined' && typeof console.error === 'function') {\n console.error(message);\n }\n /* eslint-enable no-console */\n\n\n try {\n // This error was thrown as a convenience so that if you enable\n // \"break on all exceptions\" in your console,\n // it would pause the execution at this line.\n throw new Error(message);\n } catch (e) {} // eslint-disable-line no-empty\n\n}\n\nfunction getUnexpectedStateShapeWarningMessage(inputState, reducers, action, unexpectedKeyCache) {\n var reducerKeys = Object.keys(reducers);\n var argumentName = action && action.type === ActionTypes.INIT ? 'preloadedState argument passed to createStore' : 'previous state received by the reducer';\n\n if (reducerKeys.length === 0) {\n return 'Store does not have a valid reducer. Make sure the argument passed ' + 'to combineReducers is an object whose values are reducers.';\n }\n\n if (!isPlainObject(inputState)) {\n return \"The \" + argumentName + \" has unexpected type of \\\"\" + kindOf(inputState) + \"\\\". Expected argument to be an object with the following \" + (\"keys: \\\"\" + reducerKeys.join('\", \"') + \"\\\"\");\n }\n\n var unexpectedKeys = Object.keys(inputState).filter(function (key) {\n return !reducers.hasOwnProperty(key) && !unexpectedKeyCache[key];\n });\n unexpectedKeys.forEach(function (key) {\n unexpectedKeyCache[key] = true;\n });\n if (action && action.type === ActionTypes.REPLACE) return;\n\n if (unexpectedKeys.length > 0) {\n return \"Unexpected \" + (unexpectedKeys.length > 1 ? 'keys' : 'key') + \" \" + (\"\\\"\" + unexpectedKeys.join('\", \"') + \"\\\" found in \" + argumentName + \". \") + \"Expected to find one of the known reducer keys instead: \" + (\"\\\"\" + reducerKeys.join('\", \"') + \"\\\". Unexpected keys will be ignored.\");\n }\n}\n\nfunction assertReducerShape(reducers) {\n Object.keys(reducers).forEach(function (key) {\n var reducer = reducers[key];\n var initialState = reducer(undefined, {\n type: ActionTypes.INIT\n });\n\n if (typeof initialState === 'undefined') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(12) : \"The slice reducer for key \\\"\" + key + \"\\\" returned undefined during initialization. \" + \"If the state passed to the reducer is undefined, you must \" + \"explicitly return the initial state. The initial state may \" + \"not be undefined. If you don't want to set a value for this reducer, \" + \"you can use null instead of undefined.\");\n }\n\n if (typeof reducer(undefined, {\n type: ActionTypes.PROBE_UNKNOWN_ACTION()\n }) === 'undefined') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(13) : \"The slice reducer for key \\\"\" + key + \"\\\" returned undefined when probed with a random type. \" + (\"Don't try to handle '\" + ActionTypes.INIT + \"' or other actions in \\\"redux/*\\\" \") + \"namespace. They are considered private. Instead, you must return the \" + \"current state for any unknown actions, unless it is undefined, \" + \"in which case you must return the initial state, regardless of the \" + \"action type. The initial state may not be undefined, but can be null.\");\n }\n });\n}\n/**\n * Turns an object whose values are different reducer functions, into a single\n * reducer function. It will call every child reducer, and gather their results\n * into a single state object, whose keys correspond to the keys of the passed\n * reducer functions.\n *\n * @param {Object} reducers An object whose values correspond to different\n * reducer functions that need to be combined into one. One handy way to obtain\n * it is to use ES6 `import * as reducers` syntax. The reducers may never return\n * undefined for any action. Instead, they should return their initial state\n * if the state passed to them was undefined, and the current state for any\n * unrecognized action.\n *\n * @returns {Function} A reducer function that invokes every reducer inside the\n * passed object, and builds a state object with the same shape.\n */\n\n\nfunction combineReducers(reducers) {\n var reducerKeys = Object.keys(reducers);\n var finalReducers = {};\n\n for (var i = 0; i < reducerKeys.length; i++) {\n var key = reducerKeys[i];\n\n if (process.env.NODE_ENV !== 'production') {\n if (typeof reducers[key] === 'undefined') {\n warning(\"No reducer provided for key \\\"\" + key + \"\\\"\");\n }\n }\n\n if (typeof reducers[key] === 'function') {\n finalReducers[key] = reducers[key];\n }\n }\n\n var finalReducerKeys = Object.keys(finalReducers); // This is used to make sure we don't warn about the same\n // keys multiple times.\n\n var unexpectedKeyCache;\n\n if (process.env.NODE_ENV !== 'production') {\n unexpectedKeyCache = {};\n }\n\n var shapeAssertionError;\n\n try {\n assertReducerShape(finalReducers);\n } catch (e) {\n shapeAssertionError = e;\n }\n\n return function combination(state, action) {\n if (state === void 0) {\n state = {};\n }\n\n if (shapeAssertionError) {\n throw shapeAssertionError;\n }\n\n if (process.env.NODE_ENV !== 'production') {\n var warningMessage = getUnexpectedStateShapeWarningMessage(state, finalReducers, action, unexpectedKeyCache);\n\n if (warningMessage) {\n warning(warningMessage);\n }\n }\n\n var hasChanged = false;\n var nextState = {};\n\n for (var _i = 0; _i < finalReducerKeys.length; _i++) {\n var _key = finalReducerKeys[_i];\n var reducer = finalReducers[_key];\n var previousStateForKey = state[_key];\n var nextStateForKey = reducer(previousStateForKey, action);\n\n if (typeof nextStateForKey === 'undefined') {\n var actionType = action && action.type;\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(14) : \"When called with an action of type \" + (actionType ? \"\\\"\" + String(actionType) + \"\\\"\" : '(unknown type)') + \", the slice reducer for key \\\"\" + _key + \"\\\" returned undefined. \" + \"To ignore an action, you must explicitly return the previous state. \" + \"If you want this reducer to hold no value, you can return null instead of undefined.\");\n }\n\n nextState[_key] = nextStateForKey;\n hasChanged = hasChanged || nextStateForKey !== previousStateForKey;\n }\n\n hasChanged = hasChanged || finalReducerKeys.length !== Object.keys(state).length;\n return hasChanged ? nextState : state;\n };\n}\n\nfunction bindActionCreator(actionCreator, dispatch) {\n return function () {\n return dispatch(actionCreator.apply(this, arguments));\n };\n}\n/**\n * Turns an object whose values are action creators, into an object with the\n * same keys, but with every function wrapped into a `dispatch` call so they\n * may be invoked directly. This is just a convenience method, as you can call\n * `store.dispatch(MyActionCreators.doSomething())` yourself just fine.\n *\n * For convenience, you can also pass an action creator as the first argument,\n * and get a dispatch wrapped function in return.\n *\n * @param {Function|Object} actionCreators An object whose values are action\n * creator functions. One handy way to obtain it is to use ES6 `import * as`\n * syntax. You may also pass a single function.\n *\n * @param {Function} dispatch The `dispatch` function available on your Redux\n * store.\n *\n * @returns {Function|Object} The object mimicking the original object, but with\n * every action creator wrapped into the `dispatch` call. If you passed a\n * function as `actionCreators`, the return value will also be a single\n * function.\n */\n\n\nfunction bindActionCreators(actionCreators, dispatch) {\n if (typeof actionCreators === 'function') {\n return bindActionCreator(actionCreators, dispatch);\n }\n\n if (typeof actionCreators !== 'object' || actionCreators === null) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(16) : \"bindActionCreators expected an object or a function, but instead received: '\" + kindOf(actionCreators) + \"'. \" + \"Did you write \\\"import ActionCreators from\\\" instead of \\\"import * as ActionCreators from\\\"?\");\n }\n\n var boundActionCreators = {};\n\n for (var key in actionCreators) {\n var actionCreator = actionCreators[key];\n\n if (typeof actionCreator === 'function') {\n boundActionCreators[key] = bindActionCreator(actionCreator, dispatch);\n }\n }\n\n return boundActionCreators;\n}\n\n/**\n * Composes single-argument functions from right to left. The rightmost\n * function can take multiple arguments as it provides the signature for\n * the resulting composite function.\n *\n * @param {...Function} funcs The functions to compose.\n * @returns {Function} A function obtained by composing the argument functions\n * from right to left. For example, compose(f, g, h) is identical to doing\n * (...args) => f(g(h(...args))).\n */\nfunction compose() {\n for (var _len = arguments.length, funcs = new Array(_len), _key = 0; _key < _len; _key++) {\n funcs[_key] = arguments[_key];\n }\n\n if (funcs.length === 0) {\n return function (arg) {\n return arg;\n };\n }\n\n if (funcs.length === 1) {\n return funcs[0];\n }\n\n return funcs.reduce(function (a, b) {\n return function () {\n return a(b.apply(void 0, arguments));\n };\n });\n}\n\n/**\n * Creates a store enhancer that applies middleware to the dispatch method\n * of the Redux store. This is handy for a variety of tasks, such as expressing\n * asynchronous actions in a concise manner, or logging every action payload.\n *\n * See `redux-thunk` package as an example of the Redux middleware.\n *\n * Because middleware is potentially asynchronous, this should be the first\n * store enhancer in the composition chain.\n *\n * Note that each middleware will be given the `dispatch` and `getState` functions\n * as named arguments.\n *\n * @param {...Function} middlewares The middleware chain to be applied.\n * @returns {Function} A store enhancer applying the middleware.\n */\n\nfunction applyMiddleware() {\n for (var _len = arguments.length, middlewares = new Array(_len), _key = 0; _key < _len; _key++) {\n middlewares[_key] = arguments[_key];\n }\n\n return function (createStore) {\n return function () {\n var store = createStore.apply(void 0, arguments);\n\n var _dispatch = function dispatch() {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(15) : 'Dispatching while constructing your middleware is not allowed. ' + 'Other middleware would not be applied to this dispatch.');\n };\n\n var middlewareAPI = {\n getState: store.getState,\n dispatch: function dispatch() {\n return _dispatch.apply(void 0, arguments);\n }\n };\n var chain = middlewares.map(function (middleware) {\n return middleware(middlewareAPI);\n });\n _dispatch = compose.apply(void 0, chain)(store.dispatch);\n return _objectSpread(_objectSpread({}, store), {}, {\n dispatch: _dispatch\n });\n };\n };\n}\n\n/*\n * This is a dummy function to check if the function name has been altered by minification.\n * If the function has been minified and NODE_ENV !== 'production', warn the user.\n */\n\nfunction isCrushed() {}\n\nif (process.env.NODE_ENV !== 'production' && typeof isCrushed.name === 'string' && isCrushed.name !== 'isCrushed') {\n warning('You are currently using minified code outside of NODE_ENV === \"production\". ' + 'This means that you are running a slower development build of Redux. ' + 'You can use loose-envify (https://github.com/zertosh/loose-envify) for browserify ' + 'or setting mode to production in webpack (https://webpack.js.org/concepts/mode/) ' + 'to ensure you have the correct code for your production build.');\n}\n\nexport { ActionTypes as __DO_NOT_USE__ActionTypes, applyMiddleware, bindActionCreators, combineReducers, compose, createStore };\n","export default {\n disabled: false\n};","import _objectWithoutPropertiesLoose from \"@babel/runtime/helpers/esm/objectWithoutPropertiesLoose\";\nimport _inheritsLoose from \"@babel/runtime/helpers/esm/inheritsLoose\";\nimport PropTypes from 'prop-types';\nimport React from 'react';\nimport ReactDOM from 'react-dom';\nimport config from './config';\nimport { timeoutsShape } from './utils/PropTypes';\nimport TransitionGroupContext from './TransitionGroupContext';\nexport var UNMOUNTED = 'unmounted';\nexport var EXITED = 'exited';\nexport var ENTERING = 'entering';\nexport var ENTERED = 'entered';\nexport var EXITING = 'exiting';\n/**\n * The Transition component lets you describe a transition from one component\n * state to another _over time_ with a simple declarative API. Most commonly\n * it's used to animate the mounting and unmounting of a component, but can also\n * be used to describe in-place transition states as well.\n *\n * ---\n *\n * **Note**: `Transition` is a platform-agnostic base component. If you're using\n * transitions in CSS, you'll probably want to use\n * [`CSSTransition`](https://reactcommunity.org/react-transition-group/css-transition)\n * instead. It inherits all the features of `Transition`, but contains\n * additional features necessary to play nice with CSS transitions (hence the\n * name of the component).\n *\n * ---\n *\n * By default the `Transition` component does not alter the behavior of the\n * component it renders, it only tracks \"enter\" and \"exit\" states for the\n * components. It's up to you to give meaning and effect to those states. For\n * example we can add styles to a component when it enters or exits:\n *\n * ```jsx\n * import { Transition } from 'react-transition-group';\n *\n * const duration = 300;\n *\n * const defaultStyle = {\n * transition: `opacity ${duration}ms ease-in-out`,\n * opacity: 0,\n * }\n *\n * const transitionStyles = {\n * entering: { opacity: 1 },\n * entered: { opacity: 1 },\n * exiting: { opacity: 0 },\n * exited: { opacity: 0 },\n * };\n *\n * const Fade = ({ in: inProp }) => (\n * \n * {state => (\n * \n * );\n * ```\n *\n * There are 4 main states a Transition can be in:\n * - `'entering'`\n * - `'entered'`\n * - `'exiting'`\n * - `'exited'`\n *\n * Transition state is toggled via the `in` prop. When `true` the component\n * begins the \"Enter\" stage. During this stage, the component will shift from\n * its current transition state, to `'entering'` for the duration of the\n * transition and then to the `'entered'` stage once it's complete. Let's take\n * the following example (we'll use the\n * [useState](https://reactjs.org/docs/hooks-reference.html#usestate) hook):\n *\n * ```jsx\n * function App() {\n * const [inProp, setInProp] = useState(false);\n * return (\n *\n * I'm a fade Transition!\n *\n * )}\n *\n *\n * );\n * }\n * ```\n *\n * When the button is clicked the component will shift to the `'entering'` state\n * and stay there for 500ms (the value of `timeout`) before it finally switches\n * to `'entered'`.\n *\n * When `in` is `false` the same thing happens except the state moves from\n * `'exiting'` to `'exited'`.\n */\n\nvar Transition = /*#__PURE__*/function (_React$Component) {\n _inheritsLoose(Transition, _React$Component);\n\n function Transition(props, context) {\n var _this;\n\n _this = _React$Component.call(this, props, context) || this;\n var parentGroup = context; // In the context of a TransitionGroup all enters are really appears\n\n var appear = parentGroup && !parentGroup.isMounting ? props.enter : props.appear;\n var initialStatus;\n _this.appearStatus = null;\n\n if (props.in) {\n if (appear) {\n initialStatus = EXITED;\n _this.appearStatus = ENTERING;\n } else {\n initialStatus = ENTERED;\n }\n } else {\n if (props.unmountOnExit || props.mountOnEnter) {\n initialStatus = UNMOUNTED;\n } else {\n initialStatus = EXITED;\n }\n }\n\n _this.state = {\n status: initialStatus\n };\n _this.nextCallback = null;\n return _this;\n }\n\n Transition.getDerivedStateFromProps = function getDerivedStateFromProps(_ref, prevState) {\n var nextIn = _ref.in;\n\n if (nextIn && prevState.status === UNMOUNTED) {\n return {\n status: EXITED\n };\n }\n\n return null;\n } // getSnapshotBeforeUpdate(prevProps) {\n // let nextStatus = null\n // if (prevProps !== this.props) {\n // const { status } = this.state\n // if (this.props.in) {\n // if (status !== ENTERING && status !== ENTERED) {\n // nextStatus = ENTERING\n // }\n // } else {\n // if (status === ENTERING || status === ENTERED) {\n // nextStatus = EXITING\n // }\n // }\n // }\n // return { nextStatus }\n // }\n ;\n\n var _proto = Transition.prototype;\n\n _proto.componentDidMount = function componentDidMount() {\n this.updateStatus(true, this.appearStatus);\n };\n\n _proto.componentDidUpdate = function componentDidUpdate(prevProps) {\n var nextStatus = null;\n\n if (prevProps !== this.props) {\n var status = this.state.status;\n\n if (this.props.in) {\n if (status !== ENTERING && status !== ENTERED) {\n nextStatus = ENTERING;\n }\n } else {\n if (status === ENTERING || status === ENTERED) {\n nextStatus = EXITING;\n }\n }\n }\n\n this.updateStatus(false, nextStatus);\n };\n\n _proto.componentWillUnmount = function componentWillUnmount() {\n this.cancelNextCallback();\n };\n\n _proto.getTimeouts = function getTimeouts() {\n var timeout = this.props.timeout;\n var exit, enter, appear;\n exit = enter = appear = timeout;\n\n if (timeout != null && typeof timeout !== 'number') {\n exit = timeout.exit;\n enter = timeout.enter; // TODO: remove fallback for next major\n\n appear = timeout.appear !== undefined ? timeout.appear : enter;\n }\n\n return {\n exit: exit,\n enter: enter,\n appear: appear\n };\n };\n\n _proto.updateStatus = function updateStatus(mounting, nextStatus) {\n if (mounting === void 0) {\n mounting = false;\n }\n\n if (nextStatus !== null) {\n // nextStatus will always be ENTERING or EXITING.\n this.cancelNextCallback();\n\n if (nextStatus === ENTERING) {\n this.performEnter(mounting);\n } else {\n this.performExit();\n }\n } else if (this.props.unmountOnExit && this.state.status === EXITED) {\n this.setState({\n status: UNMOUNTED\n });\n }\n };\n\n _proto.performEnter = function performEnter(mounting) {\n var _this2 = this;\n\n var enter = this.props.enter;\n var appearing = this.context ? this.context.isMounting : mounting;\n\n var _ref2 = this.props.nodeRef ? [appearing] : [ReactDOM.findDOMNode(this), appearing],\n maybeNode = _ref2[0],\n maybeAppearing = _ref2[1];\n\n var timeouts = this.getTimeouts();\n var enterTimeout = appearing ? timeouts.appear : timeouts.enter; // no enter animation skip right to ENTERED\n // if we are mounting and running this it means appear _must_ be set\n\n if (!mounting && !enter || config.disabled) {\n this.safeSetState({\n status: ENTERED\n }, function () {\n _this2.props.onEntered(maybeNode);\n });\n return;\n }\n\n this.props.onEnter(maybeNode, maybeAppearing);\n this.safeSetState({\n status: ENTERING\n }, function () {\n _this2.props.onEntering(maybeNode, maybeAppearing);\n\n _this2.onTransitionEnd(enterTimeout, function () {\n _this2.safeSetState({\n status: ENTERED\n }, function () {\n _this2.props.onEntered(maybeNode, maybeAppearing);\n });\n });\n });\n };\n\n _proto.performExit = function performExit() {\n var _this3 = this;\n\n var exit = this.props.exit;\n var timeouts = this.getTimeouts();\n var maybeNode = this.props.nodeRef ? undefined : ReactDOM.findDOMNode(this); // no exit animation skip right to EXITED\n\n if (!exit || config.disabled) {\n this.safeSetState({\n status: EXITED\n }, function () {\n _this3.props.onExited(maybeNode);\n });\n return;\n }\n\n this.props.onExit(maybeNode);\n this.safeSetState({\n status: EXITING\n }, function () {\n _this3.props.onExiting(maybeNode);\n\n _this3.onTransitionEnd(timeouts.exit, function () {\n _this3.safeSetState({\n status: EXITED\n }, function () {\n _this3.props.onExited(maybeNode);\n });\n });\n });\n };\n\n _proto.cancelNextCallback = function cancelNextCallback() {\n if (this.nextCallback !== null) {\n this.nextCallback.cancel();\n this.nextCallback = null;\n }\n };\n\n _proto.safeSetState = function safeSetState(nextState, callback) {\n // This shouldn't be necessary, but there are weird race conditions with\n // setState callbacks and unmounting in testing, so always make sure that\n // we can cancel any pending setState callbacks after we unmount.\n callback = this.setNextCallback(callback);\n this.setState(nextState, callback);\n };\n\n _proto.setNextCallback = function setNextCallback(callback) {\n var _this4 = this;\n\n var active = true;\n\n this.nextCallback = function (event) {\n if (active) {\n active = false;\n _this4.nextCallback = null;\n callback(event);\n }\n };\n\n this.nextCallback.cancel = function () {\n active = false;\n };\n\n return this.nextCallback;\n };\n\n _proto.onTransitionEnd = function onTransitionEnd(timeout, handler) {\n this.setNextCallback(handler);\n var node = this.props.nodeRef ? this.props.nodeRef.current : ReactDOM.findDOMNode(this);\n var doesNotHaveTimeoutOrListener = timeout == null && !this.props.addEndListener;\n\n if (!node || doesNotHaveTimeoutOrListener) {\n setTimeout(this.nextCallback, 0);\n return;\n }\n\n if (this.props.addEndListener) {\n var _ref3 = this.props.nodeRef ? [this.nextCallback] : [node, this.nextCallback],\n maybeNode = _ref3[0],\n maybeNextCallback = _ref3[1];\n\n this.props.addEndListener(maybeNode, maybeNextCallback);\n }\n\n if (timeout != null) {\n setTimeout(this.nextCallback, timeout);\n }\n };\n\n _proto.render = function render() {\n var status = this.state.status;\n\n if (status === UNMOUNTED) {\n return null;\n }\n\n var _this$props = this.props,\n children = _this$props.children,\n _in = _this$props.in,\n _mountOnEnter = _this$props.mountOnEnter,\n _unmountOnExit = _this$props.unmountOnExit,\n _appear = _this$props.appear,\n _enter = _this$props.enter,\n _exit = _this$props.exit,\n _timeout = _this$props.timeout,\n _addEndListener = _this$props.addEndListener,\n _onEnter = _this$props.onEnter,\n _onEntering = _this$props.onEntering,\n _onEntered = _this$props.onEntered,\n _onExit = _this$props.onExit,\n _onExiting = _this$props.onExiting,\n _onExited = _this$props.onExited,\n _nodeRef = _this$props.nodeRef,\n childProps = _objectWithoutPropertiesLoose(_this$props, [\"children\", \"in\", \"mountOnEnter\", \"unmountOnExit\", \"appear\", \"enter\", \"exit\", \"timeout\", \"addEndListener\", \"onEnter\", \"onEntering\", \"onEntered\", \"onExit\", \"onExiting\", \"onExited\", \"nodeRef\"]);\n\n return (\n /*#__PURE__*/\n // allows for nested Transitions\n React.createElement(TransitionGroupContext.Provider, {\n value: null\n }, typeof children === 'function' ? children(status, childProps) : React.cloneElement(React.Children.only(children), childProps))\n );\n };\n\n return Transition;\n}(React.Component);\n\nTransition.contextType = TransitionGroupContext;\nTransition.propTypes = process.env.NODE_ENV !== \"production\" ? {\n /**\n * A React reference to DOM element that need to transition:\n * https://stackoverflow.com/a/51127130/4671932\n *\n * - When `nodeRef` prop is used, `node` is not passed to callback functions\n * (e.g. `onEnter`) because user already has direct access to the node.\n * - When changing `key` prop of `Transition` in a `TransitionGroup` a new\n * `nodeRef` need to be provided to `Transition` with changed `key` prop\n * (see\n * [test/CSSTransition-test.js](https://github.com/reactjs/react-transition-group/blob/13435f897b3ab71f6e19d724f145596f5910581c/test/CSSTransition-test.js#L362-L437)).\n */\n nodeRef: PropTypes.shape({\n current: typeof Element === 'undefined' ? PropTypes.any : function (propValue, key, componentName, location, propFullName, secret) {\n var value = propValue[key];\n return PropTypes.instanceOf(value && 'ownerDocument' in value ? value.ownerDocument.defaultView.Element : Element)(propValue, key, componentName, location, propFullName, secret);\n }\n }),\n\n /**\n * A `function` child can be used instead of a React element. This function is\n * called with the current transition status (`'entering'`, `'entered'`,\n * `'exiting'`, `'exited'`), which can be used to apply context\n * specific props to a component.\n *\n * ```jsx\n *\n * {state => (\n * // ...\n * )}\n * \n * \n *\n * {state => (\n * \n * ```\n */\n children: PropTypes.oneOfType([PropTypes.func.isRequired, PropTypes.element.isRequired]).isRequired,\n\n /**\n * Show the component; triggers the enter or exit states\n */\n in: PropTypes.bool,\n\n /**\n * By default the child component is mounted immediately along with\n * the parent `Transition` component. If you want to \"lazy mount\" the component on the\n * first `in={true}` you can set `mountOnEnter`. After the first enter transition the component will stay\n * mounted, even on \"exited\", unless you also specify `unmountOnExit`.\n */\n mountOnEnter: PropTypes.bool,\n\n /**\n * By default the child component stays mounted after it reaches the `'exited'` state.\n * Set `unmountOnExit` if you'd prefer to unmount the component after it finishes exiting.\n */\n unmountOnExit: PropTypes.bool,\n\n /**\n * By default the child component does not perform the enter transition when\n * it first mounts, regardless of the value of `in`. If you want this\n * behavior, set both `appear` and `in` to `true`.\n *\n * > **Note**: there are no special appear states like `appearing`/`appeared`, this prop\n * > only adds an additional enter transition. However, in the\n * > `\n * )}\n * ` component that first enter transition does result in\n * > additional `.appear-*` classes, that way you can choose to style it\n * > differently.\n */\n appear: PropTypes.bool,\n\n /**\n * Enable or disable enter transitions.\n */\n enter: PropTypes.bool,\n\n /**\n * Enable or disable exit transitions.\n */\n exit: PropTypes.bool,\n\n /**\n * The duration of the transition, in milliseconds.\n * Required unless `addEndListener` is provided.\n *\n * You may specify a single timeout for all transitions:\n *\n * ```jsx\n * timeout={500}\n * ```\n *\n * or individually:\n *\n * ```jsx\n * timeout={{\n * appear: 500,\n * enter: 300,\n * exit: 500,\n * }}\n * ```\n *\n * - `appear` defaults to the value of `enter`\n * - `enter` defaults to `0`\n * - `exit` defaults to `0`\n *\n * @type {number | { enter?: number, exit?: number, appear?: number }}\n */\n timeout: function timeout(props) {\n var pt = timeoutsShape;\n if (!props.addEndListener) pt = pt.isRequired;\n\n for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {\n args[_key - 1] = arguments[_key];\n }\n\n return pt.apply(void 0, [props].concat(args));\n },\n\n /**\n * Add a custom transition end trigger. Called with the transitioning\n * DOM node and a `done` callback. Allows for more fine grained transition end\n * logic. Timeouts are still used as a fallback if provided.\n *\n * **Note**: when `nodeRef` prop is passed, `node` is not passed.\n *\n * ```jsx\n * addEndListener={(node, done) => {\n * // use the css transitionend event to mark the finish of a transition\n * node.addEventListener('transitionend', done, false);\n * }}\n * ```\n */\n addEndListener: PropTypes.func,\n\n /**\n * Callback fired before the \"entering\" status is applied. An extra parameter\n * `isAppearing` is supplied to indicate if the enter stage is occurring on the initial mount\n *\n * **Note**: when `nodeRef` prop is passed, `node` is not passed.\n *\n * @type Function(node: HtmlElement, isAppearing: bool) -> void\n */\n onEnter: PropTypes.func,\n\n /**\n * Callback fired after the \"entering\" status is applied. An extra parameter\n * `isAppearing` is supplied to indicate if the enter stage is occurring on the initial mount\n *\n * **Note**: when `nodeRef` prop is passed, `node` is not passed.\n *\n * @type Function(node: HtmlElement, isAppearing: bool)\n */\n onEntering: PropTypes.func,\n\n /**\n * Callback fired after the \"entered\" status is applied. An extra parameter\n * `isAppearing` is supplied to indicate if the enter stage is occurring on the initial mount\n *\n * **Note**: when `nodeRef` prop is passed, `node` is not passed.\n *\n * @type Function(node: HtmlElement, isAppearing: bool) -> void\n */\n onEntered: PropTypes.func,\n\n /**\n * Callback fired before the \"exiting\" status is applied.\n *\n * **Note**: when `nodeRef` prop is passed, `node` is not passed.\n *\n * @type Function(node: HtmlElement) -> void\n */\n onExit: PropTypes.func,\n\n /**\n * Callback fired after the \"exiting\" status is applied.\n *\n * **Note**: when `nodeRef` prop is passed, `node` is not passed.\n *\n * @type Function(node: HtmlElement) -> void\n */\n onExiting: PropTypes.func,\n\n /**\n * Callback fired after the \"exited\" status is applied.\n *\n * **Note**: when `nodeRef` prop is passed, `node` is not passed\n *\n * @type Function(node: HtmlElement) -> void\n */\n onExited: PropTypes.func\n} : {}; // Name the function so it is clearer in the documentation\n\nfunction noop() {}\n\nTransition.defaultProps = {\n in: false,\n mountOnEnter: false,\n unmountOnExit: false,\n appear: false,\n enter: true,\n exit: true,\n onEnter: noop,\n onEntering: noop,\n onEntered: noop,\n onExit: noop,\n onExiting: noop,\n onExited: noop\n};\nTransition.UNMOUNTED = UNMOUNTED;\nTransition.EXITED = EXITED;\nTransition.ENTERING = ENTERING;\nTransition.ENTERED = ENTERED;\nTransition.EXITING = EXITING;\nexport default Transition;","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _isNil from \"lodash/isNil\";\nimport _sortBy from \"lodash/sortBy\";\nimport _isArray from \"lodash/isArray\";\n\nfunction _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction _iterableToArrayLimit(arr, i) { if (typeof Symbol === \"undefined\" || !(Symbol.iterator in Object(arr))) return; var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nimport React, { PureComponent } from 'react';\nimport classNames from 'classnames';\nimport { isNumOrStr } from '../util/DataUtils';\n\nfunction defaultFormatter(value) {\n return _isArray(value) && isNumOrStr(value[0]) && isNumOrStr(value[1]) ? value.join(' ~ ') : value;\n}\n\nexport var DefaultTooltipContent = /*#__PURE__*/function (_PureComponent) {\n _inherits(DefaultTooltipContent, _PureComponent);\n\n var _super = _createSuper(DefaultTooltipContent);\n\n function DefaultTooltipContent() {\n _classCallCheck(this, DefaultTooltipContent);\n\n return _super.apply(this, arguments);\n }\n\n _createClass(DefaultTooltipContent, [{\n key: \"renderContent\",\n value: function renderContent() {\n var _this$props = this.props,\n payload = _this$props.payload,\n separator = _this$props.separator,\n formatter = _this$props.formatter,\n itemStyle = _this$props.itemStyle,\n itemSorter = _this$props.itemSorter;\n\n if (payload && payload.length) {\n var listStyle = {\n padding: 0,\n margin: 0\n };\n var items = (itemSorter ? _sortBy(payload, itemSorter) : payload).map(function (entry, i) {\n if (entry.type === 'none') {\n return null;\n }\n\n var finalItemStyle = _objectSpread({\n display: 'block',\n paddingTop: 4,\n paddingBottom: 4,\n color: entry.color || '#000'\n }, itemStyle);\n\n var finalFormatter = entry.formatter || formatter || defaultFormatter;\n var name = entry.name,\n value = entry.value;\n\n if (finalFormatter) {\n var formatted = finalFormatter(value, name, entry, i, payload);\n\n if (Array.isArray(formatted)) {\n var _formatted = _slicedToArray(formatted, 2);\n\n value = _formatted[0];\n name = _formatted[1];\n } else {\n value = formatted;\n }\n }\n\n return (\n /*#__PURE__*/\n // eslint-disable-next-line react/no-array-index-key\n React.createElement(\"li\", {\n className: \"recharts-tooltip-item\",\n key: \"tooltip-item-\".concat(i),\n style: finalItemStyle\n }, isNumOrStr(name) ? /*#__PURE__*/React.createElement(\"span\", {\n className: \"recharts-tooltip-item-name\"\n }, name) : null, isNumOrStr(name) ? /*#__PURE__*/React.createElement(\"span\", {\n className: \"recharts-tooltip-item-separator\"\n }, separator) : null, /*#__PURE__*/React.createElement(\"span\", {\n className: \"recharts-tooltip-item-value\"\n }, value), /*#__PURE__*/React.createElement(\"span\", {\n className: \"recharts-tooltip-item-unit\"\n }, entry.unit || ''))\n );\n });\n return /*#__PURE__*/React.createElement(\"ul\", {\n className: \"recharts-tooltip-item-list\",\n style: listStyle\n }, items);\n }\n\n return null;\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props2 = this.props,\n wrapperClassName = _this$props2.wrapperClassName,\n contentStyle = _this$props2.contentStyle,\n labelClassName = _this$props2.labelClassName,\n labelStyle = _this$props2.labelStyle,\n label = _this$props2.label,\n labelFormatter = _this$props2.labelFormatter,\n payload = _this$props2.payload;\n\n var finalStyle = _objectSpread({\n margin: 0,\n padding: 10,\n backgroundColor: '#fff',\n border: '1px solid #ccc',\n whiteSpace: 'nowrap'\n }, contentStyle);\n\n var finalLabelStyle = _objectSpread({\n margin: 0\n }, labelStyle);\n\n var hasLabel = !_isNil(label);\n var finalLabel = hasLabel ? label : '';\n var wrapperCN = classNames('recharts-default-tooltip', wrapperClassName);\n var labelCN = classNames('recharts-tooltip-label', labelClassName);\n\n if (hasLabel && labelFormatter) {\n finalLabel = labelFormatter(label, payload);\n }\n\n return /*#__PURE__*/React.createElement(\"div\", {\n className: wrapperCN,\n style: finalStyle\n }, /*#__PURE__*/React.createElement(\"p\", {\n className: labelCN,\n style: finalLabelStyle\n }, /*#__PURE__*/React.isValidElement(finalLabel) ? finalLabel : \"\".concat(finalLabel)), this.renderContent());\n }\n }]);\n\n return DefaultTooltipContent;\n}(PureComponent);\nDefaultTooltipContent.displayName = 'DefaultTooltipContent';\nDefaultTooltipContent.defaultProps = {\n separator: ' : ',\n contentStyle: {},\n itemStyle: {},\n labelStyle: {}\n};","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _isNil from \"lodash/isNil\";\nimport _isFunction from \"lodash/isFunction\";\nimport _uniqBy from \"lodash/uniqBy\";\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Tooltip\n */\nimport React, { PureComponent } from 'react';\nimport { translateStyle } from 'react-smooth';\nimport classNames from 'classnames';\nimport { DefaultTooltipContent } from './DefaultTooltipContent';\nimport { Global } from '../util/Global';\nimport { isNumber } from '../util/DataUtils';\nvar CLS_PREFIX = 'recharts-tooltip-wrapper';\nvar EPS = 1;\n\nfunction defaultUniqBy(entry) {\n return entry.dataKey;\n}\n\nfunction getUniqPayload(option, payload) {\n if (option === true) {\n return _uniqBy(payload, defaultUniqBy);\n }\n\n if (_isFunction(option)) {\n return _uniqBy(payload, option);\n }\n\n return payload;\n}\n\nfunction renderContent(content, props) {\n if ( /*#__PURE__*/React.isValidElement(content)) {\n return /*#__PURE__*/React.cloneElement(content, props);\n }\n\n if (_isFunction(content)) {\n return /*#__PURE__*/React.createElement(content, props);\n }\n\n return /*#__PURE__*/React.createElement(DefaultTooltipContent, props);\n}\n\nexport var Tooltip = /*#__PURE__*/function (_PureComponent) {\n _inherits(Tooltip, _PureComponent);\n\n var _super = _createSuper(Tooltip);\n\n function Tooltip() {\n var _this;\n\n _classCallCheck(this, Tooltip);\n\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n _this = _super.call.apply(_super, [this].concat(args));\n _this.state = {\n boxWidth: -1,\n boxHeight: -1\n };\n _this.wrapperNode = void 0;\n\n _this.getTranslate = function (_ref) {\n var key = _ref.key,\n tooltipDimension = _ref.tooltipDimension,\n viewBoxDimension = _ref.viewBoxDimension;\n var _this$props = _this.props,\n allowEscapeViewBox = _this$props.allowEscapeViewBox,\n coordinate = _this$props.coordinate,\n offset = _this$props.offset,\n position = _this$props.position,\n viewBox = _this$props.viewBox;\n\n if (position && isNumber(position[key])) {\n return position[key];\n }\n\n var restricted = coordinate[key] - tooltipDimension - offset;\n var unrestricted = coordinate[key] + offset;\n\n if (allowEscapeViewBox[key]) {\n return unrestricted;\n }\n\n var tooltipBoundary = coordinate[key] + tooltipDimension + offset;\n var viewBoxBoundary = viewBox[key] + viewBoxDimension;\n\n if (tooltipBoundary > viewBoxBoundary) {\n return Math.max(restricted, viewBox[key]);\n }\n\n return Math.max(unrestricted, viewBox[key]);\n };\n\n return _this;\n }\n\n _createClass(Tooltip, [{\n key: \"componentDidMount\",\n value: function componentDidMount() {\n this.updateBBox();\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate() {\n this.updateBBox();\n }\n }, {\n key: \"updateBBox\",\n value: function updateBBox() {\n var _this$state = this.state,\n boxWidth = _this$state.boxWidth,\n boxHeight = _this$state.boxHeight;\n\n if (this.wrapperNode && this.wrapperNode.getBoundingClientRect) {\n var box = this.wrapperNode.getBoundingClientRect();\n\n if (Math.abs(box.width - boxWidth) > EPS || Math.abs(box.height - boxHeight) > EPS) {\n this.setState({\n boxWidth: box.width,\n boxHeight: box.height\n });\n }\n } else if (boxWidth !== -1 || boxHeight !== -1) {\n this.setState({\n boxWidth: -1,\n boxHeight: -1\n });\n }\n }\n }, {\n key: \"render\",\n value: function render() {\n var _classNames,\n _this2 = this;\n\n var _this$props2 = this.props,\n payload = _this$props2.payload,\n isAnimationActive = _this$props2.isAnimationActive,\n animationDuration = _this$props2.animationDuration,\n animationEasing = _this$props2.animationEasing,\n filterNull = _this$props2.filterNull,\n payloadUniqBy = _this$props2.payloadUniqBy;\n var finalPayload = getUniqPayload(payloadUniqBy, filterNull && payload && payload.length ? payload.filter(function (entry) {\n return !_isNil(entry.value);\n }) : payload);\n var hasPayload = finalPayload && finalPayload.length;\n var _this$props3 = this.props,\n content = _this$props3.content,\n viewBox = _this$props3.viewBox,\n coordinate = _this$props3.coordinate,\n position = _this$props3.position,\n active = _this$props3.active,\n wrapperStyle = _this$props3.wrapperStyle;\n\n var outerStyle = _objectSpread({\n pointerEvents: 'none',\n visibility: active && hasPayload ? 'visible' : 'hidden',\n position: 'absolute',\n top: 0,\n left: 0\n }, wrapperStyle);\n\n var translateX, translateY;\n\n if (position && isNumber(position.x) && isNumber(position.y)) {\n translateX = position.x;\n translateY = position.y;\n } else {\n var _this$state2 = this.state,\n boxWidth = _this$state2.boxWidth,\n boxHeight = _this$state2.boxHeight;\n\n if (boxWidth > 0 && boxHeight > 0 && coordinate) {\n translateX = this.getTranslate({\n key: 'x',\n tooltipDimension: boxWidth,\n viewBoxDimension: viewBox.width\n });\n translateY = this.getTranslate({\n key: 'y',\n tooltipDimension: boxHeight,\n viewBoxDimension: viewBox.height\n });\n } else {\n outerStyle.visibility = 'hidden';\n }\n }\n\n outerStyle = _objectSpread(_objectSpread({}, translateStyle({\n transform: this.props.useTranslate3d ? \"translate3d(\".concat(translateX, \"px, \").concat(translateY, \"px, 0)\") : \"translate(\".concat(translateX, \"px, \").concat(translateY, \"px)\")\n })), outerStyle);\n\n if (isAnimationActive && active) {\n outerStyle = _objectSpread(_objectSpread({}, translateStyle({\n transition: \"transform \".concat(animationDuration, \"ms \").concat(animationEasing)\n })), outerStyle);\n }\n\n var cls = classNames(CLS_PREFIX, (_classNames = {}, _defineProperty(_classNames, \"\".concat(CLS_PREFIX, \"-right\"), isNumber(translateX) && coordinate && isNumber(coordinate.x) && translateX >= coordinate.x), _defineProperty(_classNames, \"\".concat(CLS_PREFIX, \"-left\"), isNumber(translateX) && coordinate && isNumber(coordinate.x) && translateX < coordinate.x), _defineProperty(_classNames, \"\".concat(CLS_PREFIX, \"-bottom\"), isNumber(translateY) && coordinate && isNumber(coordinate.y) && translateY >= coordinate.y), _defineProperty(_classNames, \"\".concat(CLS_PREFIX, \"-top\"), isNumber(translateY) && coordinate && isNumber(coordinate.y) && translateY < coordinate.y), _classNames));\n return /*#__PURE__*/React.createElement(\"div\", {\n className: cls,\n style: outerStyle,\n ref: function ref(node) {\n _this2.wrapperNode = node;\n }\n }, renderContent(content, _objectSpread(_objectSpread({}, this.props), {}, {\n payload: finalPayload\n })));\n }\n }]);\n\n return Tooltip;\n}(PureComponent);\nTooltip.displayName = 'Tooltip';\nTooltip.defaultProps = {\n active: false,\n allowEscapeViewBox: {\n x: false,\n y: false\n },\n offset: 10,\n viewBox: {\n x1: 0,\n x2: 0,\n y1: 0,\n y2: 0\n },\n coordinate: {\n x: 0,\n y: 0\n },\n cursorStyle: {},\n separator: ' : ',\n wrapperStyle: {},\n contentStyle: {},\n itemStyle: {},\n labelStyle: {},\n cursor: true,\n trigger: 'hover',\n isAnimationActive: !Global.isSsr,\n animationEasing: 'ease',\n animationDuration: 400,\n filterNull: true,\n useTranslate3d: false\n};","var getNative = require('./_getNative');\n\n/* Built-in method references that are verified to be native. */\nvar nativeCreate = getNative(Object, 'create');\n\nmodule.exports = nativeCreate;\n","var listCacheClear = require('./_listCacheClear'),\n listCacheDelete = require('./_listCacheDelete'),\n listCacheGet = require('./_listCacheGet'),\n listCacheHas = require('./_listCacheHas'),\n listCacheSet = require('./_listCacheSet');\n\n/**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction ListCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n}\n\n// Add methods to `ListCache`.\nListCache.prototype.clear = listCacheClear;\nListCache.prototype['delete'] = listCacheDelete;\nListCache.prototype.get = listCacheGet;\nListCache.prototype.has = listCacheHas;\nListCache.prototype.set = listCacheSet;\n\nmodule.exports = ListCache;\n","var eq = require('./eq');\n\n/**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\nfunction assocIndexOf(array, key) {\n var length = array.length;\n while (length--) {\n if (eq(array[length][0], key)) {\n return length;\n }\n }\n return -1;\n}\n\nmodule.exports = assocIndexOf;\n","var isKeyable = require('./_isKeyable');\n\n/**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\nfunction getMapData(map, key) {\n var data = map.__data__;\n return isKeyable(key)\n ? data[typeof key == 'string' ? 'string' : 'hash']\n : data.map;\n}\n\nmodule.exports = getMapData;\n","var isSymbol = require('./isSymbol');\n\n/** Used as references for various `Number` constants. */\nvar INFINITY = 1 / 0;\n\n/**\n * Converts `value` to a string key if it's not a string or symbol.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {string|symbol} Returns the key.\n */\nfunction toKey(value) {\n if (typeof value == 'string' || isSymbol(value)) {\n return value;\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n}\n\nmodule.exports = toKey;\n","'use strict';\n\nif (process.env.NODE_ENV === 'production') {\n module.exports = require('./cjs/react-is.production.min.js');\n} else {\n module.exports = require('./cjs/react-is.development.js');\n}\n","export default function unsupportedProp(props, propName, componentName, location, propFullName) {\n if (process.env.NODE_ENV === 'production') {\n return null;\n }\n\n var propFullNameSafe = propFullName || propName;\n\n if (typeof props[propName] !== 'undefined') {\n return new Error(\"The prop `\".concat(propFullNameSafe, \"` is not supported. Please remove it.\"));\n }\n\n return null;\n}","module.exports = function(module) {\n\tif (!module.webpackPolyfill) {\n\t\tmodule.deprecate = function() {};\n\t\tmodule.paths = [];\n\t\t// module.parent = undefined by default\n\t\tif (!module.children) module.children = [];\n\t\tObject.defineProperty(module, \"loaded\", {\n\t\t\tenumerable: true,\n\t\t\tget: function() {\n\t\t\t\treturn module.l;\n\t\t\t}\n\t\t});\n\t\tObject.defineProperty(module, \"id\", {\n\t\t\tenumerable: true,\n\t\t\tget: function() {\n\t\t\t\treturn module.i;\n\t\t\t}\n\t\t});\n\t\tmodule.webpackPolyfill = 1;\n\t}\n\treturn module;\n};\n","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.findInArray = findInArray;\nexports.isFunction = isFunction;\nexports.isNum = isNum;\nexports.int = int;\nexports.dontSetMe = dontSetMe;\n\n// @credits https://gist.github.com/rogozhnikoff/a43cfed27c41e4e68cdc\nfunction findInArray(array\n/*: Array | TouchList*/\n, callback\n/*: Function*/\n)\n/*: any*/\n{\n for (var i = 0, length = array.length; i < length; i++) {\n if (callback.apply(callback, [array[i], i, array])) return array[i];\n }\n}\n\nfunction isFunction(func\n/*: any*/\n)\n/*: boolean %checks*/\n{\n return typeof func === 'function' || Object.prototype.toString.call(func) === '[object Function]';\n}\n\nfunction isNum(num\n/*: any*/\n)\n/*: boolean %checks*/\n{\n return typeof num === 'number' && !isNaN(num);\n}\n\nfunction int(a\n/*: string*/\n)\n/*: number*/\n{\n return parseInt(a, 10);\n}\n\nfunction dontSetMe(props\n/*: Object*/\n, propName\n/*: string*/\n, componentName\n/*: string*/\n) {\n if (props[propName]) {\n return new Error(\"Invalid prop \".concat(propName, \" passed to \").concat(componentName, \" - do not set this, set it on the child.\"));\n }\n}","// shim for using process in browser\nvar process = module.exports = {};\n\n// cached from whatever global is present so that test runners that stub it\n// don't break things. But we need to wrap it in a try catch in case it is\n// wrapped in strict mode code which doesn't define any globals. It's inside a\n// function because try/catches deoptimize in certain engines.\n\nvar cachedSetTimeout;\nvar cachedClearTimeout;\n\nfunction defaultSetTimout() {\n throw new Error('setTimeout has not been defined');\n}\nfunction defaultClearTimeout () {\n throw new Error('clearTimeout has not been defined');\n}\n(function () {\n try {\n if (typeof setTimeout === 'function') {\n cachedSetTimeout = setTimeout;\n } else {\n cachedSetTimeout = defaultSetTimout;\n }\n } catch (e) {\n cachedSetTimeout = defaultSetTimout;\n }\n try {\n if (typeof clearTimeout === 'function') {\n cachedClearTimeout = clearTimeout;\n } else {\n cachedClearTimeout = defaultClearTimeout;\n }\n } catch (e) {\n cachedClearTimeout = defaultClearTimeout;\n }\n} ())\nfunction runTimeout(fun) {\n if (cachedSetTimeout === setTimeout) {\n //normal enviroments in sane situations\n return setTimeout(fun, 0);\n }\n // if setTimeout wasn't available but was latter defined\n if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {\n cachedSetTimeout = setTimeout;\n return setTimeout(fun, 0);\n }\n try {\n // when when somebody has screwed with setTimeout but no I.E. maddness\n return cachedSetTimeout(fun, 0);\n } catch(e){\n try {\n // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally\n return cachedSetTimeout.call(null, fun, 0);\n } catch(e){\n // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error\n return cachedSetTimeout.call(this, fun, 0);\n }\n }\n\n\n}\nfunction runClearTimeout(marker) {\n if (cachedClearTimeout === clearTimeout) {\n //normal enviroments in sane situations\n return clearTimeout(marker);\n }\n // if clearTimeout wasn't available but was latter defined\n if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {\n cachedClearTimeout = clearTimeout;\n return clearTimeout(marker);\n }\n try {\n // when when somebody has screwed with setTimeout but no I.E. maddness\n return cachedClearTimeout(marker);\n } catch (e){\n try {\n // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally\n return cachedClearTimeout.call(null, marker);\n } catch (e){\n // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.\n // Some versions of I.E. have different rules for clearTimeout vs setTimeout\n return cachedClearTimeout.call(this, marker);\n }\n }\n\n\n\n}\nvar queue = [];\nvar draining = false;\nvar currentQueue;\nvar queueIndex = -1;\n\nfunction cleanUpNextTick() {\n if (!draining || !currentQueue) {\n return;\n }\n draining = false;\n if (currentQueue.length) {\n queue = currentQueue.concat(queue);\n } else {\n queueIndex = -1;\n }\n if (queue.length) {\n drainQueue();\n }\n}\n\nfunction drainQueue() {\n if (draining) {\n return;\n }\n var timeout = runTimeout(cleanUpNextTick);\n draining = true;\n\n var len = queue.length;\n while(len) {\n currentQueue = queue;\n queue = [];\n while (++queueIndex < len) {\n if (currentQueue) {\n currentQueue[queueIndex].run();\n }\n }\n queueIndex = -1;\n len = queue.length;\n }\n currentQueue = null;\n draining = false;\n runClearTimeout(timeout);\n}\n\nprocess.nextTick = function (fun) {\n var args = new Array(arguments.length - 1);\n if (arguments.length > 1) {\n for (var i = 1; i < arguments.length; i++) {\n args[i - 1] = arguments[i];\n }\n }\n queue.push(new Item(fun, args));\n if (queue.length === 1 && !draining) {\n runTimeout(drainQueue);\n }\n};\n\n// v8 likes predictible objects\nfunction Item(fun, array) {\n this.fun = fun;\n this.array = array;\n}\nItem.prototype.run = function () {\n this.fun.apply(null, this.array);\n};\nprocess.title = 'browser';\nprocess.browser = true;\nprocess.env = {};\nprocess.argv = [];\nprocess.version = ''; // empty string to avoid regexp issues\nprocess.versions = {};\n\nfunction noop() {}\n\nprocess.on = noop;\nprocess.addListener = noop;\nprocess.once = noop;\nprocess.off = noop;\nprocess.removeListener = noop;\nprocess.removeAllListeners = noop;\nprocess.emit = noop;\nprocess.prependListener = noop;\nprocess.prependOnceListener = noop;\n\nprocess.listeners = function (name) { return [] }\n\nprocess.binding = function (name) {\n throw new Error('process.binding is not supported');\n};\n\nprocess.cwd = function () { return '/' };\nprocess.chdir = function (dir) {\n throw new Error('process.chdir is not supported');\n};\nprocess.umask = function() { return 0; };\n","var baseForOwn = require('./_baseForOwn'),\n createBaseEach = require('./_createBaseEach');\n\n/**\n * The base implementation of `_.forEach` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\nvar baseEach = createBaseEach(baseForOwn);\n\nmodule.exports = baseEach;\n","var arrayLikeKeys = require('./_arrayLikeKeys'),\n baseKeys = require('./_baseKeys'),\n isArrayLike = require('./isArrayLike');\n\n/**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\nfunction keys(object) {\n return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n}\n\nmodule.exports = keys;\n","var eq = require('./eq'),\n isArrayLike = require('./isArrayLike'),\n isIndex = require('./_isIndex'),\n isObject = require('./isObject');\n\n/**\n * Checks if the given arguments are from an iteratee call.\n *\n * @private\n * @param {*} value The potential iteratee value argument.\n * @param {*} index The potential iteratee index or key argument.\n * @param {*} object The potential iteratee object argument.\n * @returns {boolean} Returns `true` if the arguments are from an iteratee call,\n * else `false`.\n */\nfunction isIterateeCall(value, index, object) {\n if (!isObject(object)) {\n return false;\n }\n var type = typeof index;\n if (type == 'number'\n ? (isArrayLike(object) && isIndex(index, object.length))\n : (type == 'string' && index in object)\n ) {\n return eq(object[index], value);\n }\n return false;\n}\n\nmodule.exports = isIterateeCall;\n","var isSymbol = require('./isSymbol');\n\n/**\n * The base implementation of methods like `_.max` and `_.min` which accepts a\n * `comparator` to determine the extremum value.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The iteratee invoked per iteration.\n * @param {Function} comparator The comparator used to compare values.\n * @returns {*} Returns the extremum value.\n */\nfunction baseExtremum(array, iteratee, comparator) {\n var index = -1,\n length = array.length;\n\n while (++index < length) {\n var value = array[index],\n current = iteratee(value);\n\n if (current != null && (computed === undefined\n ? (current === current && !isSymbol(current))\n : comparator(current, computed)\n )) {\n var computed = current,\n result = value;\n }\n }\n return result;\n}\n\nmodule.exports = baseExtremum;\n","'use strict';\n\nif (process.env.NODE_ENV === 'production') {\n module.exports = require('./cjs/react-is.production.min.js');\n} else {\n module.exports = require('./cjs/react-is.development.js');\n}\n","function _typeof(obj) {\n \"@babel/helpers - typeof\";\n\n if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") {\n module.exports = _typeof = function _typeof(obj) {\n return typeof obj;\n };\n\n module.exports[\"default\"] = module.exports, module.exports.__esModule = true;\n } else {\n module.exports = _typeof = function _typeof(obj) {\n return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj;\n };\n\n module.exports[\"default\"] = module.exports, module.exports.__esModule = true;\n }\n\n return _typeof(obj);\n}\n\nmodule.exports = _typeof;\nmodule.exports[\"default\"] = module.exports, module.exports.__esModule = true;","import {tickStep} from \"d3-array\";\nimport {format, formatPrefix, formatSpecifier, precisionFixed, precisionPrefix, precisionRound} from \"d3-format\";\n\nexport default function tickFormat(start, stop, count, specifier) {\n var step = tickStep(start, stop, count),\n precision;\n specifier = formatSpecifier(specifier == null ? \",f\" : specifier);\n switch (specifier.type) {\n case \"s\": {\n var value = Math.max(Math.abs(start), Math.abs(stop));\n if (specifier.precision == null && !isNaN(precision = precisionPrefix(step, value))) specifier.precision = precision;\n return formatPrefix(specifier, value);\n }\n case \"\":\n case \"e\":\n case \"g\":\n case \"p\":\n case \"r\": {\n if (specifier.precision == null && !isNaN(precision = precisionRound(step, Math.max(Math.abs(start), Math.abs(stop))))) specifier.precision = precision - (specifier.type === \"e\");\n break;\n }\n case \"f\":\n case \"%\": {\n if (specifier.precision == null && !isNaN(precision = precisionFixed(step))) specifier.precision = precision - (specifier.type === \"%\") * 2;\n break;\n }\n }\n return format(specifier);\n}\n","import exponent from \"./exponent.js\";\n\nexport default function(step, value) {\n return Math.max(0, Math.max(-8, Math.min(8, Math.floor(exponent(value) / 3))) * 3 - exponent(Math.abs(step)));\n}\n","import exponent from \"./exponent.js\";\n\nexport default function(step, max) {\n step = Math.abs(step), max = Math.abs(max) - step;\n return Math.max(0, exponent(max) - exponent(step)) + 1;\n}\n","import exponent from \"./exponent.js\";\n\nexport default function(step) {\n return Math.max(0, -exponent(Math.abs(step)));\n}\n","/**\n * Root reference for iframes.\n */\n\nlet root;\nif (typeof window !== 'undefined') {\n // Browser window\n root = window;\n} else if (typeof self === 'undefined') {\n // Other environments\n console.warn(\n 'Using browser-only version of superagent in non-browser environment'\n );\n root = this;\n} else {\n // Web Worker\n root = self;\n}\n\nconst Emitter = require('component-emitter');\nconst safeStringify = require('fast-safe-stringify');\nconst RequestBase = require('./request-base');\nconst isObject = require('./is-object');\nconst ResponseBase = require('./response-base');\nconst Agent = require('./agent-base');\n\n/**\n * Noop.\n */\n\nfunction noop() {}\n\n/**\n * Expose `request`.\n */\n\nmodule.exports = function(method, url) {\n // callback\n if (typeof url === 'function') {\n return new exports.Request('GET', method).end(url);\n }\n\n // url first\n if (arguments.length === 1) {\n return new exports.Request('GET', method);\n }\n\n return new exports.Request(method, url);\n};\n\nexports = module.exports;\n\nconst request = exports;\n\nexports.Request = Request;\n\n/**\n * Determine XHR.\n */\n\nrequest.getXHR = () => {\n if (\n root.XMLHttpRequest &&\n (!root.location ||\n root.location.protocol !== 'file:' ||\n !root.ActiveXObject)\n ) {\n return new XMLHttpRequest();\n }\n\n try {\n return new ActiveXObject('Microsoft.XMLHTTP');\n } catch {}\n\n try {\n return new ActiveXObject('Msxml2.XMLHTTP.6.0');\n } catch {}\n\n try {\n return new ActiveXObject('Msxml2.XMLHTTP.3.0');\n } catch {}\n\n try {\n return new ActiveXObject('Msxml2.XMLHTTP');\n } catch {}\n\n throw new Error('Browser-only version of superagent could not find XHR');\n};\n\n/**\n * Removes leading and trailing whitespace, added to support IE.\n *\n * @param {String} s\n * @return {String}\n * @api private\n */\n\nconst trim = ''.trim ? s => s.trim() : s => s.replace(/(^\\s*|\\s*$)/g, '');\n\n/**\n * Serialize the given `obj`.\n *\n * @param {Object} obj\n * @return {String}\n * @api private\n */\n\nfunction serialize(obj) {\n if (!isObject(obj)) return obj;\n const pairs = [];\n for (const key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key))\n pushEncodedKeyValuePair(pairs, key, obj[key]);\n }\n\n return pairs.join('&');\n}\n\n/**\n * Helps 'serialize' with serializing arrays.\n * Mutates the pairs array.\n *\n * @param {Array} pairs\n * @param {String} key\n * @param {Mixed} val\n */\n\nfunction pushEncodedKeyValuePair(pairs, key, val) {\n if (val === undefined) return;\n if (val === null) {\n pairs.push(encodeURI(key));\n return;\n }\n\n if (Array.isArray(val)) {\n val.forEach(v => {\n pushEncodedKeyValuePair(pairs, key, v);\n });\n } else if (isObject(val)) {\n for (const subkey in val) {\n if (Object.prototype.hasOwnProperty.call(val, subkey))\n pushEncodedKeyValuePair(pairs, `${key}[${subkey}]`, val[subkey]);\n }\n } else {\n pairs.push(encodeURI(key) + '=' + encodeURIComponent(val));\n }\n}\n\n/**\n * Expose serialization method.\n */\n\nrequest.serializeObject = serialize;\n\n/**\n * Parse the given x-www-form-urlencoded `str`.\n *\n * @param {String} str\n * @return {Object}\n * @api private\n */\n\nfunction parseString(str) {\n const obj = {};\n const pairs = str.split('&');\n let pair;\n let pos;\n\n for (let i = 0, len = pairs.length; i < len; ++i) {\n pair = pairs[i];\n pos = pair.indexOf('=');\n if (pos === -1) {\n obj[decodeURIComponent(pair)] = '';\n } else {\n obj[decodeURIComponent(pair.slice(0, pos))] = decodeURIComponent(\n pair.slice(pos + 1)\n );\n }\n }\n\n return obj;\n}\n\n/**\n * Expose parser.\n */\n\nrequest.parseString = parseString;\n\n/**\n * Default MIME type map.\n *\n * superagent.types.xml = 'application/xml';\n *\n */\n\nrequest.types = {\n html: 'text/html',\n json: 'application/json',\n xml: 'text/xml',\n urlencoded: 'application/x-www-form-urlencoded',\n form: 'application/x-www-form-urlencoded',\n 'form-data': 'application/x-www-form-urlencoded'\n};\n\n/**\n * Default serialization map.\n *\n * superagent.serialize['application/xml'] = function(obj){\n * return 'generated xml here';\n * };\n *\n */\n\nrequest.serialize = {\n 'application/x-www-form-urlencoded': serialize,\n 'application/json': safeStringify\n};\n\n/**\n * Default parsers.\n *\n * superagent.parse['application/xml'] = function(str){\n * return { object parsed from str };\n * };\n *\n */\n\nrequest.parse = {\n 'application/x-www-form-urlencoded': parseString,\n 'application/json': JSON.parse\n};\n\n/**\n * Parse the given header `str` into\n * an object containing the mapped fields.\n *\n * @param {String} str\n * @return {Object}\n * @api private\n */\n\nfunction parseHeader(str) {\n const lines = str.split(/\\r?\\n/);\n const fields = {};\n let index;\n let line;\n let field;\n let val;\n\n for (let i = 0, len = lines.length; i < len; ++i) {\n line = lines[i];\n index = line.indexOf(':');\n if (index === -1) {\n // could be empty line, just skip it\n continue;\n }\n\n field = line.slice(0, index).toLowerCase();\n val = trim(line.slice(index + 1));\n fields[field] = val;\n }\n\n return fields;\n}\n\n/**\n * Check if `mime` is json or has +json structured syntax suffix.\n *\n * @param {String} mime\n * @return {Boolean}\n * @api private\n */\n\nfunction isJSON(mime) {\n // should match /json or +json\n // but not /json-seq\n return /[/+]json($|[^-\\w])/.test(mime);\n}\n\n/**\n * Initialize a new `Response` with the given `xhr`.\n *\n * - set flags (.ok, .error, etc)\n * - parse header\n *\n * Examples:\n *\n * Aliasing `superagent` as `request` is nice:\n *\n * request = superagent;\n *\n * We can use the promise-like API, or pass callbacks:\n *\n * request.get('/').end(function(res){});\n * request.get('/', function(res){});\n *\n * Sending data can be chained:\n *\n * request\n * .post('/user')\n * .send({ name: 'tj' })\n * .end(function(res){});\n *\n * Or passed to `.send()`:\n *\n * request\n * .post('/user')\n * .send({ name: 'tj' }, function(res){});\n *\n * Or passed to `.post()`:\n *\n * request\n * .post('/user', { name: 'tj' })\n * .end(function(res){});\n *\n * Or further reduced to a single call for simple cases:\n *\n * request\n * .post('/user', { name: 'tj' }, function(res){});\n *\n * @param {XMLHTTPRequest} xhr\n * @param {Object} options\n * @api private\n */\n\nfunction Response(req) {\n this.req = req;\n this.xhr = this.req.xhr;\n // responseText is accessible only if responseType is '' or 'text' and on older browsers\n this.text =\n (this.req.method !== 'HEAD' &&\n (this.xhr.responseType === '' || this.xhr.responseType === 'text')) ||\n typeof this.xhr.responseType === 'undefined'\n ? this.xhr.responseText\n : null;\n this.statusText = this.req.xhr.statusText;\n let { status } = this.xhr;\n // handle IE9 bug: http://stackoverflow.com/questions/10046972/msie-returns-status-code-of-1223-for-ajax-request\n if (status === 1223) {\n status = 204;\n }\n\n this._setStatusProperties(status);\n this.headers = parseHeader(this.xhr.getAllResponseHeaders());\n this.header = this.headers;\n // getAllResponseHeaders sometimes falsely returns \"\" for CORS requests, but\n // getResponseHeader still works. so we get content-type even if getting\n // other headers fails.\n this.header['content-type'] = this.xhr.getResponseHeader('content-type');\n this._setHeaderProperties(this.header);\n\n if (this.text === null && req._responseType) {\n this.body = this.xhr.response;\n } else {\n this.body =\n this.req.method === 'HEAD'\n ? null\n : this._parseBody(this.text ? this.text : this.xhr.response);\n }\n}\n\n// eslint-disable-next-line new-cap\nResponseBase(Response.prototype);\n\n/**\n * Parse the given body `str`.\n *\n * Used for auto-parsing of bodies. Parsers\n * are defined on the `superagent.parse` object.\n *\n * @param {String} str\n * @return {Mixed}\n * @api private\n */\n\nResponse.prototype._parseBody = function(str) {\n let parse = request.parse[this.type];\n if (this.req._parser) {\n return this.req._parser(this, str);\n }\n\n if (!parse && isJSON(this.type)) {\n parse = request.parse['application/json'];\n }\n\n return parse && str && (str.length > 0 || str instanceof Object)\n ? parse(str)\n : null;\n};\n\n/**\n * Return an `Error` representative of this response.\n *\n * @return {Error}\n * @api public\n */\n\nResponse.prototype.toError = function() {\n const { req } = this;\n const { method } = req;\n const { url } = req;\n\n const msg = `cannot ${method} ${url} (${this.status})`;\n const err = new Error(msg);\n err.status = this.status;\n err.method = method;\n err.url = url;\n\n return err;\n};\n\n/**\n * Expose `Response`.\n */\n\nrequest.Response = Response;\n\n/**\n * Initialize a new `Request` with the given `method` and `url`.\n *\n * @param {String} method\n * @param {String} url\n * @api public\n */\n\nfunction Request(method, url) {\n const self = this;\n this._query = this._query || [];\n this.method = method;\n this.url = url;\n this.header = {}; // preserves header name case\n this._header = {}; // coerces header names to lowercase\n this.on('end', () => {\n let err = null;\n let res = null;\n\n try {\n res = new Response(self);\n } catch (err_) {\n err = new Error('Parser is unable to parse the response');\n err.parse = true;\n err.original = err_;\n // issue #675: return the raw response if the response parsing fails\n if (self.xhr) {\n // ie9 doesn't have 'response' property\n err.rawResponse =\n typeof self.xhr.responseType === 'undefined'\n ? self.xhr.responseText\n : self.xhr.response;\n // issue #876: return the http status code if the response parsing fails\n err.status = self.xhr.status ? self.xhr.status : null;\n err.statusCode = err.status; // backwards-compat only\n } else {\n err.rawResponse = null;\n err.status = null;\n }\n\n return self.callback(err);\n }\n\n self.emit('response', res);\n\n let new_err;\n try {\n if (!self._isResponseOK(res)) {\n new_err = new Error(\n res.statusText || res.text || 'Unsuccessful HTTP response'\n );\n }\n } catch (err_) {\n new_err = err_; // ok() callback can throw\n }\n\n // #1000 don't catch errors from the callback to avoid double calling it\n if (new_err) {\n new_err.original = err;\n new_err.response = res;\n new_err.status = res.status;\n self.callback(new_err, res);\n } else {\n self.callback(null, res);\n }\n });\n}\n\n/**\n * Mixin `Emitter` and `RequestBase`.\n */\n\n// eslint-disable-next-line new-cap\nEmitter(Request.prototype);\n// eslint-disable-next-line new-cap\nRequestBase(Request.prototype);\n\n/**\n * Set Content-Type to `type`, mapping values from `request.types`.\n *\n * Examples:\n *\n * superagent.types.xml = 'application/xml';\n *\n * request.post('/')\n * .type('xml')\n * .send(xmlstring)\n * .end(callback);\n *\n * request.post('/')\n * .type('application/xml')\n * .send(xmlstring)\n * .end(callback);\n *\n * @param {String} type\n * @return {Request} for chaining\n * @api public\n */\n\nRequest.prototype.type = function(type) {\n this.set('Content-Type', request.types[type] || type);\n return this;\n};\n\n/**\n * Set Accept to `type`, mapping values from `request.types`.\n *\n * Examples:\n *\n * superagent.types.json = 'application/json';\n *\n * request.get('/agent')\n * .accept('json')\n * .end(callback);\n *\n * request.get('/agent')\n * .accept('application/json')\n * .end(callback);\n *\n * @param {String} accept\n * @return {Request} for chaining\n * @api public\n */\n\nRequest.prototype.accept = function(type) {\n this.set('Accept', request.types[type] || type);\n return this;\n};\n\n/**\n * Set Authorization field value with `user` and `pass`.\n *\n * @param {String} user\n * @param {String} [pass] optional in case of using 'bearer' as type\n * @param {Object} options with 'type' property 'auto', 'basic' or 'bearer' (default 'basic')\n * @return {Request} for chaining\n * @api public\n */\n\nRequest.prototype.auth = function(user, pass, options) {\n if (arguments.length === 1) pass = '';\n if (typeof pass === 'object' && pass !== null) {\n // pass is optional and can be replaced with options\n options = pass;\n pass = '';\n }\n\n if (!options) {\n options = {\n type: typeof btoa === 'function' ? 'basic' : 'auto'\n };\n }\n\n const encoder = string => {\n if (typeof btoa === 'function') {\n return btoa(string);\n }\n\n throw new Error('Cannot use basic auth, btoa is not a function');\n };\n\n return this._auth(user, pass, options, encoder);\n};\n\n/**\n * Add query-string `val`.\n *\n * Examples:\n *\n * request.get('/shoes')\n * .query('size=10')\n * .query({ color: 'blue' })\n *\n * @param {Object|String} val\n * @return {Request} for chaining\n * @api public\n */\n\nRequest.prototype.query = function(val) {\n if (typeof val !== 'string') val = serialize(val);\n if (val) this._query.push(val);\n return this;\n};\n\n/**\n * Queue the given `file` as an attachment to the specified `field`,\n * with optional `options` (or filename).\n *\n * ``` js\n * request.post('/upload')\n * .attach('content', new Blob(['hey!'], { type: \"text/html\"}))\n * .end(callback);\n * ```\n *\n * @param {String} field\n * @param {Blob|File} file\n * @param {String|Object} options\n * @return {Request} for chaining\n * @api public\n */\n\nRequest.prototype.attach = function(field, file, options) {\n if (file) {\n if (this._data) {\n throw new Error(\"superagent can't mix .send() and .attach()\");\n }\n\n this._getFormData().append(field, file, options || file.name);\n }\n\n return this;\n};\n\nRequest.prototype._getFormData = function() {\n if (!this._formData) {\n this._formData = new root.FormData();\n }\n\n return this._formData;\n};\n\n/**\n * Invoke the callback with `err` and `res`\n * and handle arity check.\n *\n * @param {Error} err\n * @param {Response} res\n * @api private\n */\n\nRequest.prototype.callback = function(err, res) {\n if (this._shouldRetry(err, res)) {\n return this._retry();\n }\n\n const fn = this._callback;\n this.clearTimeout();\n\n if (err) {\n if (this._maxRetries) err.retries = this._retries - 1;\n this.emit('error', err);\n }\n\n fn(err, res);\n};\n\n/**\n * Invoke callback with x-domain error.\n *\n * @api private\n */\n\nRequest.prototype.crossDomainError = function() {\n const err = new Error(\n 'Request has been terminated\\nPossible causes: the network is offline, Origin is not allowed by Access-Control-Allow-Origin, the page is being unloaded, etc.'\n );\n err.crossDomain = true;\n\n err.status = this.status;\n err.method = this.method;\n err.url = this.url;\n\n this.callback(err);\n};\n\n// This only warns, because the request is still likely to work\nRequest.prototype.agent = function() {\n console.warn('This is not supported in browser version of superagent');\n return this;\n};\n\nRequest.prototype.ca = Request.prototype.agent;\nRequest.prototype.buffer = Request.prototype.ca;\n\n// This throws, because it can't send/receive data as expected\nRequest.prototype.write = () => {\n throw new Error(\n 'Streaming is not supported in browser version of superagent'\n );\n};\n\nRequest.prototype.pipe = Request.prototype.write;\n\n/**\n * Check if `obj` is a host object,\n * we don't want to serialize these :)\n *\n * @param {Object} obj host object\n * @return {Boolean} is a host object\n * @api private\n */\nRequest.prototype._isHost = function(obj) {\n // Native objects stringify to [object File], [object Blob], [object FormData], etc.\n return (\n obj &&\n typeof obj === 'object' &&\n !Array.isArray(obj) &&\n Object.prototype.toString.call(obj) !== '[object Object]'\n );\n};\n\n/**\n * Initiate request, invoking callback `fn(res)`\n * with an instanceof `Response`.\n *\n * @param {Function} fn\n * @return {Request} for chaining\n * @api public\n */\n\nRequest.prototype.end = function(fn) {\n if (this._endCalled) {\n console.warn(\n 'Warning: .end() was called twice. This is not supported in superagent'\n );\n }\n\n this._endCalled = true;\n\n // store callback\n this._callback = fn || noop;\n\n // querystring\n this._finalizeQueryString();\n\n this._end();\n};\n\nRequest.prototype._setUploadTimeout = function() {\n const self = this;\n\n // upload timeout it's wokrs only if deadline timeout is off\n if (this._uploadTimeout && !this._uploadTimeoutTimer) {\n this._uploadTimeoutTimer = setTimeout(() => {\n self._timeoutError(\n 'Upload timeout of ',\n self._uploadTimeout,\n 'ETIMEDOUT'\n );\n }, this._uploadTimeout);\n }\n};\n\n// eslint-disable-next-line complexity\nRequest.prototype._end = function() {\n if (this._aborted)\n return this.callback(\n new Error('The request has been aborted even before .end() was called')\n );\n\n const self = this;\n this.xhr = request.getXHR();\n const { xhr } = this;\n let data = this._formData || this._data;\n\n this._setTimeouts();\n\n // state change\n xhr.onreadystatechange = () => {\n const { readyState } = xhr;\n if (readyState >= 2 && self._responseTimeoutTimer) {\n clearTimeout(self._responseTimeoutTimer);\n }\n\n if (readyState !== 4) {\n return;\n }\n\n // In IE9, reads to any property (e.g. status) off of an aborted XHR will\n // result in the error \"Could not complete the operation due to error c00c023f\"\n let status;\n try {\n status = xhr.status;\n } catch {\n status = 0;\n }\n\n if (!status) {\n if (self.timedout || self._aborted) return;\n return self.crossDomainError();\n }\n\n self.emit('end');\n };\n\n // progress\n const handleProgress = (direction, e) => {\n if (e.total > 0) {\n e.percent = (e.loaded / e.total) * 100;\n\n if (e.percent === 100) {\n clearTimeout(self._uploadTimeoutTimer);\n }\n }\n\n e.direction = direction;\n self.emit('progress', e);\n };\n\n if (this.hasListeners('progress')) {\n try {\n xhr.addEventListener('progress', handleProgress.bind(null, 'download'));\n if (xhr.upload) {\n xhr.upload.addEventListener(\n 'progress',\n handleProgress.bind(null, 'upload')\n );\n }\n } catch {\n // Accessing xhr.upload fails in IE from a web worker, so just pretend it doesn't exist.\n // Reported here:\n // https://connect.microsoft.com/IE/feedback/details/837245/xmlhttprequest-upload-throws-invalid-argument-when-used-from-web-worker-context\n }\n }\n\n if (xhr.upload) {\n this._setUploadTimeout();\n }\n\n // initiate request\n try {\n if (this.username && this.password) {\n xhr.open(this.method, this.url, true, this.username, this.password);\n } else {\n xhr.open(this.method, this.url, true);\n }\n } catch (err) {\n // see #1149\n return this.callback(err);\n }\n\n // CORS\n if (this._withCredentials) xhr.withCredentials = true;\n\n // body\n if (\n !this._formData &&\n this.method !== 'GET' &&\n this.method !== 'HEAD' &&\n typeof data !== 'string' &&\n !this._isHost(data)\n ) {\n // serialize stuff\n const contentType = this._header['content-type'];\n let serialize =\n this._serializer ||\n request.serialize[contentType ? contentType.split(';')[0] : ''];\n if (!serialize && isJSON(contentType)) {\n serialize = request.serialize['application/json'];\n }\n\n if (serialize) data = serialize(data);\n }\n\n // set header fields\n for (const field in this.header) {\n if (this.header[field] === null) continue;\n\n if (Object.prototype.hasOwnProperty.call(this.header, field))\n xhr.setRequestHeader(field, this.header[field]);\n }\n\n if (this._responseType) {\n xhr.responseType = this._responseType;\n }\n\n // send stuff\n this.emit('request', this);\n\n // IE11 xhr.send(undefined) sends 'undefined' string as POST payload (instead of nothing)\n // We need null here if data is undefined\n xhr.send(typeof data === 'undefined' ? null : data);\n};\n\nrequest.agent = () => new Agent();\n\n['GET', 'POST', 'OPTIONS', 'PATCH', 'PUT', 'DELETE'].forEach(method => {\n Agent.prototype[method.toLowerCase()] = function(url, fn) {\n const req = new request.Request(method, url);\n this._setDefaults(req);\n if (fn) {\n req.end(fn);\n }\n\n return req;\n };\n});\n\nAgent.prototype.del = Agent.prototype.delete;\n\n/**\n * GET `url` with optional callback `fn(res)`.\n *\n * @param {String} url\n * @param {Mixed|Function} [data] or fn\n * @param {Function} [fn]\n * @return {Request}\n * @api public\n */\n\nrequest.get = (url, data, fn) => {\n const req = request('GET', url);\n if (typeof data === 'function') {\n fn = data;\n data = null;\n }\n\n if (data) req.query(data);\n if (fn) req.end(fn);\n return req;\n};\n\n/**\n * HEAD `url` with optional callback `fn(res)`.\n *\n * @param {String} url\n * @param {Mixed|Function} [data] or fn\n * @param {Function} [fn]\n * @return {Request}\n * @api public\n */\n\nrequest.head = (url, data, fn) => {\n const req = request('HEAD', url);\n if (typeof data === 'function') {\n fn = data;\n data = null;\n }\n\n if (data) req.query(data);\n if (fn) req.end(fn);\n return req;\n};\n\n/**\n * OPTIONS query to `url` with optional callback `fn(res)`.\n *\n * @param {String} url\n * @param {Mixed|Function} [data] or fn\n * @param {Function} [fn]\n * @return {Request}\n * @api public\n */\n\nrequest.options = (url, data, fn) => {\n const req = request('OPTIONS', url);\n if (typeof data === 'function') {\n fn = data;\n data = null;\n }\n\n if (data) req.send(data);\n if (fn) req.end(fn);\n return req;\n};\n\n/**\n * DELETE `url` with optional `data` and callback `fn(res)`.\n *\n * @param {String} url\n * @param {Mixed} [data]\n * @param {Function} [fn]\n * @return {Request}\n * @api public\n */\n\nfunction del(url, data, fn) {\n const req = request('DELETE', url);\n if (typeof data === 'function') {\n fn = data;\n data = null;\n }\n\n if (data) req.send(data);\n if (fn) req.end(fn);\n return req;\n}\n\nrequest.del = del;\nrequest.delete = del;\n\n/**\n * PATCH `url` with optional `data` and callback `fn(res)`.\n *\n * @param {String} url\n * @param {Mixed} [data]\n * @param {Function} [fn]\n * @return {Request}\n * @api public\n */\n\nrequest.patch = (url, data, fn) => {\n const req = request('PATCH', url);\n if (typeof data === 'function') {\n fn = data;\n data = null;\n }\n\n if (data) req.send(data);\n if (fn) req.end(fn);\n return req;\n};\n\n/**\n * POST `url` with optional `data` and callback `fn(res)`.\n *\n * @param {String} url\n * @param {Mixed} [data]\n * @param {Function} [fn]\n * @return {Request}\n * @api public\n */\n\nrequest.post = (url, data, fn) => {\n const req = request('POST', url);\n if (typeof data === 'function') {\n fn = data;\n data = null;\n }\n\n if (data) req.send(data);\n if (fn) req.end(fn);\n return req;\n};\n\n/**\n * PUT `url` with optional `data` and callback `fn(res)`.\n *\n * @param {String} url\n * @param {Mixed|Function} [data] or fn\n * @param {Function} [fn]\n * @return {Request}\n * @api public\n */\n\nrequest.put = (url, data, fn) => {\n const req = request('PUT', url);\n if (typeof data === 'function') {\n fn = data;\n data = null;\n }\n\n if (data) req.send(data);\n if (fn) req.end(fn);\n return req;\n};\n","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.MemoryStorage = exports.CookieStorage = exports.isSupported = exports.storage = undefined;\n\nvar _isSupported = require('./isSupported');\n\nvar _isSupported2 = _interopRequireDefault(_isSupported);\n\nvar _CookieStorage = require('./CookieStorage');\n\nvar _CookieStorage2 = _interopRequireDefault(_CookieStorage);\n\nvar _MemoryStorage = require('./MemoryStorage');\n\nvar _MemoryStorage2 = _interopRequireDefault(_MemoryStorage);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nvar storage = null;\n\nif ((0, _isSupported2.default)('localStorage')) {\n // use localStorage\n exports.storage = storage = window.localStorage;\n} else if ((0, _isSupported2.default)('sessionStorage')) {\n // use sessionStorage\n exports.storage = storage = window.sessionStorage;\n} else if ((0, _isSupported2.default)('cookieStorage')) {\n // use cookies\n exports.storage = storage = new _CookieStorage2.default();\n} else {\n // use memory\n exports.storage = storage = new _MemoryStorage2.default();\n}\n\nexports.default = storage;\nexports.storage = storage;\nexports.isSupported = _isSupported2.default;\nexports.CookieStorage = _CookieStorage2.default;\nexports.MemoryStorage = _MemoryStorage2.default;","export default function _setPrototypeOf(o, p) {\n _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {\n o.__proto__ = p;\n return o;\n };\n\n return _setPrototypeOf(o, p);\n}","import React from 'react';\nvar ThemeContext = React.createContext(null);\n\nif (process.env.NODE_ENV !== 'production') {\n ThemeContext.displayName = 'ThemeContext';\n}\n\nexport default ThemeContext;","import arrayLikeToArray from \"./arrayLikeToArray.js\";\nexport default function _unsupportedIterableToArray(o, minLen) {\n if (!o) return;\n if (typeof o === \"string\") return arrayLikeToArray(o, minLen);\n var n = Object.prototype.toString.call(o).slice(8, -1);\n if (n === \"Object\" && o.constructor) n = o.constructor.name;\n if (n === \"Map\" || n === \"Set\") return Array.from(o);\n if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen);\n}","var hasSymbol = typeof Symbol === 'function' && Symbol.for;\nexport default hasSymbol ? Symbol.for('mui.nested') : '__THEME_NESTED__';","import _toConsumableArray from \"@babel/runtime/helpers/esm/toConsumableArray\";\nimport _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _typeof from \"@babel/runtime/helpers/esm/typeof\";\nimport PropTypes from 'prop-types';\nimport merge from './merge'; // The breakpoint **start** at this value.\n// For instance with the first breakpoint xs: [xs, sm[.\n\nvar values = {\n xs: 0,\n sm: 600,\n md: 960,\n lg: 1280,\n xl: 1920\n};\nvar defaultBreakpoints = {\n // Sorted ASC by size. That's important.\n // It can't be configured as it's used statically for propTypes.\n keys: ['xs', 'sm', 'md', 'lg', 'xl'],\n up: function up(key) {\n return \"@media (min-width:\".concat(values[key], \"px)\");\n }\n};\nexport function handleBreakpoints(props, propValue, styleFromPropValue) {\n if (process.env.NODE_ENV !== 'production') {\n if (!props.theme) {\n console.error('Material-UI: You are calling a style function without a theme value.');\n }\n }\n\n if (Array.isArray(propValue)) {\n var themeBreakpoints = props.theme.breakpoints || defaultBreakpoints;\n return propValue.reduce(function (acc, item, index) {\n acc[themeBreakpoints.up(themeBreakpoints.keys[index])] = styleFromPropValue(propValue[index]);\n return acc;\n }, {});\n }\n\n if (_typeof(propValue) === 'object') {\n var _themeBreakpoints = props.theme.breakpoints || defaultBreakpoints;\n\n return Object.keys(propValue).reduce(function (acc, breakpoint) {\n acc[_themeBreakpoints.up(breakpoint)] = styleFromPropValue(propValue[breakpoint]);\n return acc;\n }, {});\n }\n\n var output = styleFromPropValue(propValue);\n return output;\n}\n\nfunction breakpoints(styleFunction) {\n var newStyleFunction = function newStyleFunction(props) {\n var base = styleFunction(props);\n var themeBreakpoints = props.theme.breakpoints || defaultBreakpoints;\n var extended = themeBreakpoints.keys.reduce(function (acc, key) {\n if (props[key]) {\n acc = acc || {};\n acc[themeBreakpoints.up(key)] = styleFunction(_extends({\n theme: props.theme\n }, props[key]));\n }\n\n return acc;\n }, null);\n return merge(base, extended);\n };\n\n newStyleFunction.propTypes = process.env.NODE_ENV !== 'production' ? _extends({}, styleFunction.propTypes, {\n xs: PropTypes.object,\n sm: PropTypes.object,\n md: PropTypes.object,\n lg: PropTypes.object,\n xl: PropTypes.object\n }) : {};\n newStyleFunction.filterProps = ['xs', 'sm', 'md', 'lg', 'xl'].concat(_toConsumableArray(styleFunction.filterProps));\n return newStyleFunction;\n}\n\nexport default breakpoints;","// We need to centralize the zIndex definitions as they work\n// like global values in the browser.\nvar zIndex = {\n mobileStepper: 1000,\n speedDial: 1050,\n appBar: 1100,\n drawer: 1200,\n modal: 1300,\n snackbar: 1400,\n tooltip: 1500\n};\nexport default zIndex;","// A change of the browser zoom change the scrollbar size.\n// Credit https://github.com/twbs/bootstrap/blob/3ffe3a5d82f6f561b82ff78d82b32a7d14aed558/js/src/modal.js#L512-L519\nexport default function getScrollbarSize() {\n var scrollDiv = document.createElement('div');\n scrollDiv.style.width = '99px';\n scrollDiv.style.height = '99px';\n scrollDiv.style.position = 'absolute';\n scrollDiv.style.top = '-9999px';\n scrollDiv.style.overflow = 'scroll';\n document.body.appendChild(scrollDiv);\n var scrollbarSize = scrollDiv.offsetWidth - scrollDiv.clientWidth;\n document.body.removeChild(scrollDiv);\n return scrollbarSize;\n}","/**\n * Detect Element Resize.\n * https://github.com/sdecima/javascript-detect-element-resize\n * Sebastian Decima\n *\n * Forked from version 0.5.3; includes the following modifications:\n * 1) Guard against unsafe 'window' and 'document' references (to support SSR).\n * 2) Defer initialization code via a top-level function wrapper (to support SSR).\n * 3) Avoid unnecessary reflows by not measuring size for scroll events bubbling from children.\n * 4) Add nonce for style element.\n * 5) Added support for injecting custom window object\n **/\nexport default function createDetectElementResize(nonce, hostWindow) {\n // Check `document` and `window` in case of server-side rendering\n var _window;\n\n if (typeof hostWindow !== 'undefined') {\n _window = hostWindow;\n } else if (typeof window !== 'undefined') {\n _window = window;\n } else if (typeof self !== 'undefined') {\n _window = self;\n } else {\n _window = global;\n }\n\n var attachEvent = typeof _window.document !== 'undefined' && _window.document.attachEvent;\n\n if (!attachEvent) {\n var requestFrame = function () {\n var raf = _window.requestAnimationFrame || _window.mozRequestAnimationFrame || _window.webkitRequestAnimationFrame || function (fn) {\n return _window.setTimeout(fn, 20);\n };\n\n return function (fn) {\n return raf(fn);\n };\n }();\n\n var cancelFrame = function () {\n var cancel = _window.cancelAnimationFrame || _window.mozCancelAnimationFrame || _window.webkitCancelAnimationFrame || _window.clearTimeout;\n return function (id) {\n return cancel(id);\n };\n }();\n\n var resetTriggers = function resetTriggers(element) {\n var triggers = element.__resizeTriggers__,\n expand = triggers.firstElementChild,\n contract = triggers.lastElementChild,\n expandChild = expand.firstElementChild;\n contract.scrollLeft = contract.scrollWidth;\n contract.scrollTop = contract.scrollHeight;\n expandChild.style.width = expand.offsetWidth + 1 + 'px';\n expandChild.style.height = expand.offsetHeight + 1 + 'px';\n expand.scrollLeft = expand.scrollWidth;\n expand.scrollTop = expand.scrollHeight;\n };\n\n var checkTriggers = function checkTriggers(element) {\n return element.offsetWidth != element.__resizeLast__.width || element.offsetHeight != element.__resizeLast__.height;\n };\n\n var scrollListener = function scrollListener(e) {\n // Don't measure (which forces) reflow for scrolls that happen inside of children!\n if (e.target.className && typeof e.target.className.indexOf === 'function' && e.target.className.indexOf('contract-trigger') < 0 && e.target.className.indexOf('expand-trigger') < 0) {\n return;\n }\n\n var element = this;\n resetTriggers(this);\n\n if (this.__resizeRAF__) {\n cancelFrame(this.__resizeRAF__);\n }\n\n this.__resizeRAF__ = requestFrame(function () {\n if (checkTriggers(element)) {\n element.__resizeLast__.width = element.offsetWidth;\n element.__resizeLast__.height = element.offsetHeight;\n\n element.__resizeListeners__.forEach(function (fn) {\n fn.call(element, e);\n });\n }\n });\n };\n /* Detect CSS Animations support to detect element display/re-attach */\n\n\n var animation = false,\n keyframeprefix = '',\n animationstartevent = 'animationstart',\n domPrefixes = 'Webkit Moz O ms'.split(' '),\n startEvents = 'webkitAnimationStart animationstart oAnimationStart MSAnimationStart'.split(' '),\n pfx = '';\n {\n var elm = _window.document.createElement('fakeelement');\n\n if (elm.style.animationName !== undefined) {\n animation = true;\n }\n\n if (animation === false) {\n for (var i = 0; i < domPrefixes.length; i++) {\n if (elm.style[domPrefixes[i] + 'AnimationName'] !== undefined) {\n pfx = domPrefixes[i];\n keyframeprefix = '-' + pfx.toLowerCase() + '-';\n animationstartevent = startEvents[i];\n animation = true;\n break;\n }\n }\n }\n }\n var animationName = 'resizeanim';\n var animationKeyframes = '@' + keyframeprefix + 'keyframes ' + animationName + ' { from { opacity: 0; } to { opacity: 0; } } ';\n var animationStyle = keyframeprefix + 'animation: 1ms ' + animationName + '; ';\n }\n\n var createStyles = function createStyles(doc) {\n if (!doc.getElementById('detectElementResize')) {\n //opacity:0 works around a chrome bug https://code.google.com/p/chromium/issues/detail?id=286360\n var css = (animationKeyframes ? animationKeyframes : '') + '.resize-triggers { ' + (animationStyle ? animationStyle : '') + 'visibility: hidden; opacity: 0; } ' + '.resize-triggers, .resize-triggers > div, .contract-trigger:before { content: \" \"; display: block; position: absolute; top: 0; left: 0; height: 100%; width: 100%; overflow: hidden; z-index: -1; } .resize-triggers > div { background: #eee; overflow: auto; } .contract-trigger:before { width: 200%; height: 200%; }',\n head = doc.head || doc.getElementsByTagName('head')[0],\n style = doc.createElement('style');\n style.id = 'detectElementResize';\n style.type = 'text/css';\n\n if (nonce != null) {\n style.setAttribute('nonce', nonce);\n }\n\n if (style.styleSheet) {\n style.styleSheet.cssText = css;\n } else {\n style.appendChild(doc.createTextNode(css));\n }\n\n head.appendChild(style);\n }\n };\n\n var addResizeListener = function addResizeListener(element, fn) {\n if (attachEvent) {\n element.attachEvent('onresize', fn);\n } else {\n if (!element.__resizeTriggers__) {\n var doc = element.ownerDocument;\n\n var elementStyle = _window.getComputedStyle(element);\n\n if (elementStyle && elementStyle.position == 'static') {\n element.style.position = 'relative';\n }\n\n createStyles(doc);\n element.__resizeLast__ = {};\n element.__resizeListeners__ = [];\n (element.__resizeTriggers__ = doc.createElement('div')).className = 'resize-triggers';\n var resizeTriggersHtml = '' + '';\n\n if (window.trustedTypes) {\n var staticPolicy = trustedTypes.createPolicy('react-virtualized-auto-sizer', {\n createHTML: function createHTML() {\n return resizeTriggersHtml;\n }\n });\n element.__resizeTriggers__.innerHTML = staticPolicy.createHTML('');\n } else {\n element.__resizeTriggers__.innerHTML = resizeTriggersHtml;\n }\n\n element.appendChild(element.__resizeTriggers__);\n resetTriggers(element);\n element.addEventListener('scroll', scrollListener, true);\n /* Listen for a css animation to detect element display/re-attach */\n\n if (animationstartevent) {\n element.__resizeTriggers__.__animationListener__ = function animationListener(e) {\n if (e.animationName == animationName) {\n resetTriggers(element);\n }\n };\n\n element.__resizeTriggers__.addEventListener(animationstartevent, element.__resizeTriggers__.__animationListener__);\n }\n }\n\n element.__resizeListeners__.push(fn);\n }\n };\n\n var removeResizeListener = function removeResizeListener(element, fn) {\n if (attachEvent) {\n element.detachEvent('onresize', fn);\n } else {\n element.__resizeListeners__.splice(element.__resizeListeners__.indexOf(fn), 1);\n\n if (!element.__resizeListeners__.length) {\n element.removeEventListener('scroll', scrollListener, true);\n\n if (element.__resizeTriggers__.__animationListener__) {\n element.__resizeTriggers__.removeEventListener(animationstartevent, element.__resizeTriggers__.__animationListener__);\n\n element.__resizeTriggers__.__animationListener__ = null;\n }\n\n try {\n element.__resizeTriggers__ = !element.removeChild(element.__resizeTriggers__);\n } catch (e) {// Preact compat; see developit/preact-compat/issues/228\n }\n }\n }\n };\n\n return {\n addResizeListener: addResizeListener,\n removeResizeListener: removeResizeListener\n };\n}","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\");\n\nvar _interopRequireWildcard = require(\"@babel/runtime/helpers/interopRequireWildcard\");\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\n\nvar React = _interopRequireWildcard(require(\"react\"));\n\nvar _createSvgIcon = _interopRequireDefault(require(\"./utils/createSvgIcon\"));\n\nvar _default = (0, _createSvgIcon.default)( /*#__PURE__*/React.createElement(\"path\", {\n d: \"M7 10l5 5 5-5z\"\n}), 'ArrowDropDown');\n\nexports.default = _default;","import * as React from 'react';\n/**\n * @ignore - internal component.\n */\n\nvar RadioGroupContext = React.createContext();\n\nif (process.env.NODE_ENV !== 'production') {\n RadioGroupContext.displayName = 'RadioGroupContext';\n}\n\nexport default RadioGroupContext;","import * as React from 'react';\n/**\n * @ignore - internal component.\n */\n\nvar TableContext = React.createContext();\n\nif (process.env.NODE_ENV !== 'production') {\n TableContext.displayName = 'TableContext';\n}\n\nexport default TableContext;","var arrayEvery = require('./_arrayEvery'),\n baseEvery = require('./_baseEvery'),\n baseIteratee = require('./_baseIteratee'),\n isArray = require('./isArray'),\n isIterateeCall = require('./_isIterateeCall');\n\n/**\n * Checks if `predicate` returns truthy for **all** elements of `collection`.\n * Iteration is stopped once `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * **Note:** This method returns `true` for\n * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because\n * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of\n * elements of empty collections.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n * @example\n *\n * _.every([true, 1, null, 'yes'], Boolean);\n * // => false\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.every(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.every(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.every(users, 'active');\n * // => false\n */\nfunction every(collection, predicate, guard) {\n var func = isArray(collection) ? arrayEvery : baseEvery;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, baseIteratee(predicate, 3));\n}\n\nmodule.exports = every;\n","\"use strict\";\n\nvar _CSSTransition = _interopRequireDefault(require(\"./CSSTransition\"));\n\nvar _ReplaceTransition = _interopRequireDefault(require(\"./ReplaceTransition\"));\n\nvar _TransitionGroup = _interopRequireDefault(require(\"./TransitionGroup\"));\n\nvar _Transition = _interopRequireDefault(require(\"./Transition\"));\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nmodule.exports = {\n Transition: _Transition.default,\n TransitionGroup: _TransitionGroup.default,\n ReplaceTransition: _ReplaceTransition.default,\n CSSTransition: _CSSTransition.default\n};","/**\n * @fileOverview X Axis\n */\n\n/** Define of XAxis props */\nexport var XAxis = function XAxis() {\n return null;\n};\nXAxis.displayName = 'XAxis';\nXAxis.defaultProps = {\n allowDecimals: true,\n hide: false,\n orientation: 'bottom',\n width: 0,\n height: 30,\n mirror: false,\n xAxisId: 0,\n tickCount: 5,\n type: 'category',\n domain: [0, 'auto'],\n padding: {\n left: 0,\n right: 0\n },\n allowDataOverflow: false,\n scale: 'auto',\n reversed: false,\n allowDuplicatedCategory: true\n};","/**\n * @fileOverview Y Axis\n */\nexport var YAxis = function YAxis() {\n return null;\n};\nYAxis.displayName = 'YAxis';\nYAxis.defaultProps = {\n allowDuplicatedCategory: true,\n allowDecimals: true,\n hide: false,\n orientation: 'left',\n width: 60,\n height: 0,\n mirror: false,\n yAxisId: 0,\n tickCount: 5,\n type: 'number',\n domain: [0, 'auto'],\n padding: {\n top: 0,\n bottom: 0\n },\n allowDataOverflow: false,\n scale: 'auto',\n reversed: false\n};","/**\n * @fileOverview Cross\n */\nexport var Cell = function Cell(props) {\n return null;\n};\nCell.displayName = 'Cell';","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\");\n\nvar _interopRequireWildcard = require(\"@babel/runtime/helpers/interopRequireWildcard\");\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\n\nvar React = _interopRequireWildcard(require(\"react\"));\n\nvar _createSvgIcon = _interopRequireDefault(require(\"./utils/createSvgIcon\"));\n\nvar _default = (0, _createSvgIcon.default)( /*#__PURE__*/React.createElement(\"path\", {\n d: \"M16 11c1.66 0 2.99-1.34 2.99-3S17.66 5 16 5c-1.66 0-3 1.34-3 3s1.34 3 3 3zm-8 0c1.66 0 2.99-1.34 2.99-3S9.66 5 8 5C6.34 5 5 6.34 5 8s1.34 3 3 3zm0 2c-2.33 0-7 1.17-7 3.5V19h14v-2.5c0-2.33-4.67-3.5-7-3.5zm8 0c-.29 0-.62.02-.97.05 1.16.84 1.97 1.97 1.97 3.45V19h6v-2.5c0-2.33-4.67-3.5-7-3.5z\"\n}), 'Group');\n\nexports.default = _default;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\");\n\nvar _interopRequireWildcard = require(\"@babel/runtime/helpers/interopRequireWildcard\");\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\n\nvar React = _interopRequireWildcard(require(\"react\"));\n\nvar _createSvgIcon = _interopRequireDefault(require(\"./utils/createSvgIcon\"));\n\nvar _default = (0, _createSvgIcon.default)( /*#__PURE__*/React.createElement(\"path\", {\n d: \"M12 8c1.1 0 2-.9 2-2s-.9-2-2-2-2 .9-2 2 .9 2 2 2zm0 2c-1.1 0-2 .9-2 2s.9 2 2 2 2-.9 2-2-.9-2-2-2zm0 6c-1.1 0-2 .9-2 2s.9 2 2 2 2-.9 2-2-.9-2-2-2z\"\n}), 'MoreVert');\n\nexports.default = _default;","import {linearish} from \"./linear.js\";\nimport number from \"./number.js\";\n\nexport default function identity(domain) {\n var unknown;\n\n function scale(x) {\n return x == null || isNaN(x = +x) ? unknown : x;\n }\n\n scale.invert = scale;\n\n scale.domain = scale.range = function(_) {\n return arguments.length ? (domain = Array.from(_, number), scale) : domain.slice();\n };\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : unknown;\n };\n\n scale.copy = function() {\n return identity(domain).unknown(unknown);\n };\n\n domain = arguments.length ? Array.from(domain, number) : [0, 1];\n\n return linearish(scale);\n}\n","export default function nice(domain, interval) {\n domain = domain.slice();\n\n var i0 = 0,\n i1 = domain.length - 1,\n x0 = domain[i0],\n x1 = domain[i1],\n t;\n\n if (x1 < x0) {\n t = i0, i0 = i1, i1 = t;\n t = x0, x0 = x1, x1 = t;\n }\n\n domain[i0] = interval.floor(x0);\n domain[i1] = interval.ceil(x1);\n return domain;\n}\n","import {ticks} from \"d3-array\";\nimport {format} from \"d3-format\";\nimport nice from \"./nice.js\";\nimport {copy, transformer} from \"./continuous.js\";\nimport {initRange} from \"./init.js\";\n\nfunction transformLog(x) {\n return Math.log(x);\n}\n\nfunction transformExp(x) {\n return Math.exp(x);\n}\n\nfunction transformLogn(x) {\n return -Math.log(-x);\n}\n\nfunction transformExpn(x) {\n return -Math.exp(-x);\n}\n\nfunction pow10(x) {\n return isFinite(x) ? +(\"1e\" + x) : x < 0 ? 0 : x;\n}\n\nfunction powp(base) {\n return base === 10 ? pow10\n : base === Math.E ? Math.exp\n : function(x) { return Math.pow(base, x); };\n}\n\nfunction logp(base) {\n return base === Math.E ? Math.log\n : base === 10 && Math.log10\n || base === 2 && Math.log2\n || (base = Math.log(base), function(x) { return Math.log(x) / base; });\n}\n\nfunction reflect(f) {\n return function(x) {\n return -f(-x);\n };\n}\n\nexport function loggish(transform) {\n var scale = transform(transformLog, transformExp),\n domain = scale.domain,\n base = 10,\n logs,\n pows;\n\n function rescale() {\n logs = logp(base), pows = powp(base);\n if (domain()[0] < 0) {\n logs = reflect(logs), pows = reflect(pows);\n transform(transformLogn, transformExpn);\n } else {\n transform(transformLog, transformExp);\n }\n return scale;\n }\n\n scale.base = function(_) {\n return arguments.length ? (base = +_, rescale()) : base;\n };\n\n scale.domain = function(_) {\n return arguments.length ? (domain(_), rescale()) : domain();\n };\n\n scale.ticks = function(count) {\n var d = domain(),\n u = d[0],\n v = d[d.length - 1],\n r;\n\n if (r = v < u) i = u, u = v, v = i;\n\n var i = logs(u),\n j = logs(v),\n p,\n k,\n t,\n n = count == null ? 10 : +count,\n z = [];\n\n if (!(base % 1) && j - i < n) {\n i = Math.floor(i), j = Math.ceil(j);\n if (u > 0) for (; i <= j; ++i) {\n for (k = 1, p = pows(i); k < base; ++k) {\n t = p * k;\n if (t < u) continue;\n if (t > v) break;\n z.push(t);\n }\n } else for (; i <= j; ++i) {\n for (k = base - 1, p = pows(i); k >= 1; --k) {\n t = p * k;\n if (t < u) continue;\n if (t > v) break;\n z.push(t);\n }\n }\n if (z.length * 2 < n) z = ticks(u, v, n);\n } else {\n z = ticks(i, j, Math.min(j - i, n)).map(pows);\n }\n\n return r ? z.reverse() : z;\n };\n\n scale.tickFormat = function(count, specifier) {\n if (specifier == null) specifier = base === 10 ? \".0e\" : \",\";\n if (typeof specifier !== \"function\") specifier = format(specifier);\n if (count === Infinity) return specifier;\n if (count == null) count = 10;\n var k = Math.max(1, base * count / scale.ticks().length); // TODO fast estimate?\n return function(d) {\n var i = d / pows(Math.round(logs(d)));\n if (i * base < base - 0.5) i *= base;\n return i <= k ? specifier(d) : \"\";\n };\n };\n\n scale.nice = function() {\n return domain(nice(domain(), {\n floor: function(x) { return pows(Math.floor(logs(x))); },\n ceil: function(x) { return pows(Math.ceil(logs(x))); }\n }));\n };\n\n return scale;\n}\n\nexport default function log() {\n var scale = loggish(transformer()).domain([1, 10]);\n\n scale.copy = function() {\n return copy(scale, log()).base(scale.base());\n };\n\n initRange.apply(scale, arguments);\n\n return scale;\n}\n","import {linearish} from \"./linear.js\";\nimport {copy, transformer} from \"./continuous.js\";\nimport {initRange} from \"./init.js\";\n\nfunction transformSymlog(c) {\n return function(x) {\n return Math.sign(x) * Math.log1p(Math.abs(x / c));\n };\n}\n\nfunction transformSymexp(c) {\n return function(x) {\n return Math.sign(x) * Math.expm1(Math.abs(x)) * c;\n };\n}\n\nexport function symlogish(transform) {\n var c = 1, scale = transform(transformSymlog(c), transformSymexp(c));\n\n scale.constant = function(_) {\n return arguments.length ? transform(transformSymlog(c = +_), transformSymexp(c)) : c;\n };\n\n return linearish(scale);\n}\n\nexport default function symlog() {\n var scale = symlogish(transformer());\n\n scale.copy = function() {\n return copy(scale, symlog()).constant(scale.constant());\n };\n\n return initRange.apply(scale, arguments);\n}\n","import {linearish} from \"./linear.js\";\nimport {copy, identity, transformer} from \"./continuous.js\";\nimport {initRange} from \"./init.js\";\n\nfunction transformPow(exponent) {\n return function(x) {\n return x < 0 ? -Math.pow(-x, exponent) : Math.pow(x, exponent);\n };\n}\n\nfunction transformSqrt(x) {\n return x < 0 ? -Math.sqrt(-x) : Math.sqrt(x);\n}\n\nfunction transformSquare(x) {\n return x < 0 ? -x * x : x * x;\n}\n\nexport function powish(transform) {\n var scale = transform(identity, identity),\n exponent = 1;\n\n function rescale() {\n return exponent === 1 ? transform(identity, identity)\n : exponent === 0.5 ? transform(transformSqrt, transformSquare)\n : transform(transformPow(exponent), transformPow(1 / exponent));\n }\n\n scale.exponent = function(_) {\n return arguments.length ? (exponent = +_, rescale()) : exponent;\n };\n\n return linearish(scale);\n}\n\nexport default function pow() {\n var scale = powish(transformer());\n\n scale.copy = function() {\n return copy(scale, pow()).exponent(scale.exponent());\n };\n\n initRange.apply(scale, arguments);\n\n return scale;\n}\n\nexport function sqrt() {\n return pow.apply(null, arguments).exponent(0.5);\n}\n","import continuous from \"./continuous.js\";\nimport {initRange} from \"./init.js\";\nimport {linearish} from \"./linear.js\";\nimport number from \"./number.js\";\n\nfunction square(x) {\n return Math.sign(x) * x * x;\n}\n\nfunction unsquare(x) {\n return Math.sign(x) * Math.sqrt(Math.abs(x));\n}\n\nexport default function radial() {\n var squared = continuous(),\n range = [0, 1],\n round = false,\n unknown;\n\n function scale(x) {\n var y = unsquare(squared(x));\n return isNaN(y) ? unknown : round ? Math.round(y) : y;\n }\n\n scale.invert = function(y) {\n return squared.invert(square(y));\n };\n\n scale.domain = function(_) {\n return arguments.length ? (squared.domain(_), scale) : squared.domain();\n };\n\n scale.range = function(_) {\n return arguments.length ? (squared.range((range = Array.from(_, number)).map(square)), scale) : range.slice();\n };\n\n scale.rangeRound = function(_) {\n return scale.range(_).round(true);\n };\n\n scale.round = function(_) {\n return arguments.length ? (round = !!_, scale) : round;\n };\n\n scale.clamp = function(_) {\n return arguments.length ? (squared.clamp(_), scale) : squared.clamp();\n };\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : unknown;\n };\n\n scale.copy = function() {\n return radial(squared.domain(), range)\n .round(round)\n .clamp(squared.clamp())\n .unknown(unknown);\n };\n\n initRange.apply(scale, arguments);\n\n return linearish(scale);\n}\n","export default function max(values, valueof) {\n let max;\n if (valueof === undefined) {\n for (const value of values) {\n if (value != null\n && (max < value || (max === undefined && value >= value))) {\n max = value;\n }\n }\n } else {\n let index = -1;\n for (let value of values) {\n if ((value = valueof(value, ++index, values)) != null\n && (max < value || (max === undefined && value >= value))) {\n max = value;\n }\n }\n }\n return max;\n}\n","export default function min(values, valueof) {\n let min;\n if (valueof === undefined) {\n for (const value of values) {\n if (value != null\n && (min > value || (min === undefined && value >= value))) {\n min = value;\n }\n }\n } else {\n let index = -1;\n for (let value of values) {\n if ((value = valueof(value, ++index, values)) != null\n && (min > value || (min === undefined && value >= value))) {\n min = value;\n }\n }\n }\n return min;\n}\n","import ascending from \"./ascending.js\";\n\n// Based on https://github.com/mourner/quickselect\n// ISC license, Copyright 2018 Vladimir Agafonkin.\nexport default function quickselect(array, k, left = 0, right = array.length - 1, compare = ascending) {\n while (right > left) {\n if (right - left > 600) {\n const n = right - left + 1;\n const m = k - left + 1;\n const z = Math.log(n);\n const s = 0.5 * Math.exp(2 * z / 3);\n const sd = 0.5 * Math.sqrt(z * s * (n - s) / n) * (m - n / 2 < 0 ? -1 : 1);\n const newLeft = Math.max(left, Math.floor(k - m * s / n + sd));\n const newRight = Math.min(right, Math.floor(k + (n - m) * s / n + sd));\n quickselect(array, k, newLeft, newRight, compare);\n }\n\n const t = array[k];\n let i = left;\n let j = right;\n\n swap(array, left, k);\n if (compare(array[right], t) > 0) swap(array, left, right);\n\n while (i < j) {\n swap(array, i, j), ++i, --j;\n while (compare(array[i], t) < 0) ++i;\n while (compare(array[j], t) > 0) --j;\n }\n\n if (compare(array[left], t) === 0) swap(array, left, j);\n else ++j, swap(array, j, right);\n\n if (j <= k) left = j + 1;\n if (k <= j) right = j - 1;\n }\n return array;\n}\n\nfunction swap(array, i, j) {\n const t = array[i];\n array[i] = array[j];\n array[j] = t;\n}\n","import max from \"./max.js\";\nimport min from \"./min.js\";\nimport quickselect from \"./quickselect.js\";\nimport number, {numbers} from \"./number.js\";\n\nexport default function quantile(values, p, valueof) {\n values = Float64Array.from(numbers(values, valueof));\n if (!(n = values.length)) return;\n if ((p = +p) <= 0 || n < 2) return min(values);\n if (p >= 1) return max(values);\n var n,\n i = (n - 1) * p,\n i0 = Math.floor(i),\n value0 = max(quickselect(values, i0).subarray(0, i0 + 1)),\n value1 = min(values.subarray(i0 + 1));\n return value0 + (value1 - value0) * (i - i0);\n}\n\nexport function quantileSorted(values, p, valueof = number) {\n if (!(n = values.length)) return;\n if ((p = +p) <= 0 || n < 2) return +valueof(values[0], 0, values);\n if (p >= 1) return +valueof(values[n - 1], n - 1, values);\n var n,\n i = (n - 1) * p,\n i0 = Math.floor(i),\n value0 = +valueof(values[i0], i0, values),\n value1 = +valueof(values[i0 + 1], i0 + 1, values);\n return value0 + (value1 - value0) * (i - i0);\n}\n","import {ascending, bisect, quantileSorted as threshold} from \"d3-array\";\nimport {initRange} from \"./init.js\";\n\nexport default function quantile() {\n var domain = [],\n range = [],\n thresholds = [],\n unknown;\n\n function rescale() {\n var i = 0, n = Math.max(1, range.length);\n thresholds = new Array(n - 1);\n while (++i < n) thresholds[i - 1] = threshold(domain, i / n);\n return scale;\n }\n\n function scale(x) {\n return x == null || isNaN(x = +x) ? unknown : range[bisect(thresholds, x)];\n }\n\n scale.invertExtent = function(y) {\n var i = range.indexOf(y);\n return i < 0 ? [NaN, NaN] : [\n i > 0 ? thresholds[i - 1] : domain[0],\n i < thresholds.length ? thresholds[i] : domain[domain.length - 1]\n ];\n };\n\n scale.domain = function(_) {\n if (!arguments.length) return domain.slice();\n domain = [];\n for (let d of _) if (d != null && !isNaN(d = +d)) domain.push(d);\n domain.sort(ascending);\n return rescale();\n };\n\n scale.range = function(_) {\n return arguments.length ? (range = Array.from(_), rescale()) : range.slice();\n };\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : unknown;\n };\n\n scale.quantiles = function() {\n return thresholds.slice();\n };\n\n scale.copy = function() {\n return quantile()\n .domain(domain)\n .range(range)\n .unknown(unknown);\n };\n\n return initRange.apply(scale, arguments);\n}\n","import {bisect} from \"d3-array\";\nimport {linearish} from \"./linear.js\";\nimport {initRange} from \"./init.js\";\n\nexport default function quantize() {\n var x0 = 0,\n x1 = 1,\n n = 1,\n domain = [0.5],\n range = [0, 1],\n unknown;\n\n function scale(x) {\n return x != null && x <= x ? range[bisect(domain, x, 0, n)] : unknown;\n }\n\n function rescale() {\n var i = -1;\n domain = new Array(n);\n while (++i < n) domain[i] = ((i + 1) * x1 - (i - n) * x0) / (n + 1);\n return scale;\n }\n\n scale.domain = function(_) {\n return arguments.length ? ([x0, x1] = _, x0 = +x0, x1 = +x1, rescale()) : [x0, x1];\n };\n\n scale.range = function(_) {\n return arguments.length ? (n = (range = Array.from(_)).length - 1, rescale()) : range.slice();\n };\n\n scale.invertExtent = function(y) {\n var i = range.indexOf(y);\n return i < 0 ? [NaN, NaN]\n : i < 1 ? [x0, domain[0]]\n : i >= n ? [domain[n - 1], x1]\n : [domain[i - 1], domain[i]];\n };\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : scale;\n };\n\n scale.thresholds = function() {\n return domain.slice();\n };\n\n scale.copy = function() {\n return quantize()\n .domain([x0, x1])\n .range(range)\n .unknown(unknown);\n };\n\n return initRange.apply(linearish(scale), arguments);\n}\n","import {bisect} from \"d3-array\";\nimport {initRange} from \"./init.js\";\n\nexport default function threshold() {\n var domain = [0.5],\n range = [0, 1],\n unknown,\n n = 1;\n\n function scale(x) {\n return x != null && x <= x ? range[bisect(domain, x, 0, n)] : unknown;\n }\n\n scale.domain = function(_) {\n return arguments.length ? (domain = Array.from(_), n = Math.min(domain.length, range.length - 1), scale) : domain.slice();\n };\n\n scale.range = function(_) {\n return arguments.length ? (range = Array.from(_), n = Math.min(domain.length, range.length - 1), scale) : range.slice();\n };\n\n scale.invertExtent = function(y) {\n var i = range.indexOf(y);\n return [domain[i - 1], domain[i]];\n };\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : unknown;\n };\n\n scale.copy = function() {\n return threshold()\n .domain(domain)\n .range(range)\n .unknown(unknown);\n };\n\n return initRange.apply(scale, arguments);\n}\n","export const durationSecond = 1000;\nexport const durationMinute = durationSecond * 60;\nexport const durationHour = durationMinute * 60;\nexport const durationDay = durationHour * 24;\nexport const durationWeek = durationDay * 7;\nexport const durationMonth = durationDay * 30;\nexport const durationYear = durationDay * 365;\n","var t0 = new Date,\n t1 = new Date;\n\nexport default function newInterval(floori, offseti, count, field) {\n\n function interval(date) {\n return floori(date = arguments.length === 0 ? new Date : new Date(+date)), date;\n }\n\n interval.floor = function(date) {\n return floori(date = new Date(+date)), date;\n };\n\n interval.ceil = function(date) {\n return floori(date = new Date(date - 1)), offseti(date, 1), floori(date), date;\n };\n\n interval.round = function(date) {\n var d0 = interval(date),\n d1 = interval.ceil(date);\n return date - d0 < d1 - date ? d0 : d1;\n };\n\n interval.offset = function(date, step) {\n return offseti(date = new Date(+date), step == null ? 1 : Math.floor(step)), date;\n };\n\n interval.range = function(start, stop, step) {\n var range = [], previous;\n start = interval.ceil(start);\n step = step == null ? 1 : Math.floor(step);\n if (!(start < stop) || !(step > 0)) return range; // also handles Invalid Date\n do range.push(previous = new Date(+start)), offseti(start, step), floori(start);\n while (previous < start && start < stop);\n return range;\n };\n\n interval.filter = function(test) {\n return newInterval(function(date) {\n if (date >= date) while (floori(date), !test(date)) date.setTime(date - 1);\n }, function(date, step) {\n if (date >= date) {\n if (step < 0) while (++step <= 0) {\n while (offseti(date, -1), !test(date)) {} // eslint-disable-line no-empty\n } else while (--step >= 0) {\n while (offseti(date, +1), !test(date)) {} // eslint-disable-line no-empty\n }\n }\n });\n };\n\n if (count) {\n interval.count = function(start, end) {\n t0.setTime(+start), t1.setTime(+end);\n floori(t0), floori(t1);\n return Math.floor(count(t0, t1));\n };\n\n interval.every = function(step) {\n step = Math.floor(step);\n return !isFinite(step) || !(step > 0) ? null\n : !(step > 1) ? interval\n : interval.filter(field\n ? function(d) { return field(d) % step === 0; }\n : function(d) { return interval.count(0, d) % step === 0; });\n };\n }\n\n return interval;\n}\n","import interval from \"./interval.js\";\n\nvar millisecond = interval(function() {\n // noop\n}, function(date, step) {\n date.setTime(+date + step);\n}, function(start, end) {\n return end - start;\n});\n\n// An optimized implementation for this simple case.\nmillisecond.every = function(k) {\n k = Math.floor(k);\n if (!isFinite(k) || !(k > 0)) return null;\n if (!(k > 1)) return millisecond;\n return interval(function(date) {\n date.setTime(Math.floor(date / k) * k);\n }, function(date, step) {\n date.setTime(+date + step * k);\n }, function(start, end) {\n return (end - start) / k;\n });\n};\n\nexport default millisecond;\nexport var milliseconds = millisecond.range;\n","import interval from \"./interval.js\";\nimport {durationSecond} from \"./duration.js\";\n\nvar second = interval(function(date) {\n date.setTime(date - date.getMilliseconds());\n}, function(date, step) {\n date.setTime(+date + step * durationSecond);\n}, function(start, end) {\n return (end - start) / durationSecond;\n}, function(date) {\n return date.getUTCSeconds();\n});\n\nexport default second;\nexport var seconds = second.range;\n","import interval from \"./interval.js\";\nimport {durationMinute, durationSecond} from \"./duration.js\";\n\nvar minute = interval(function(date) {\n date.setTime(date - date.getMilliseconds() - date.getSeconds() * durationSecond);\n}, function(date, step) {\n date.setTime(+date + step * durationMinute);\n}, function(start, end) {\n return (end - start) / durationMinute;\n}, function(date) {\n return date.getMinutes();\n});\n\nexport default minute;\nexport var minutes = minute.range;\n","import interval from \"./interval.js\";\nimport {durationHour, durationMinute, durationSecond} from \"./duration.js\";\n\nvar hour = interval(function(date) {\n date.setTime(date - date.getMilliseconds() - date.getSeconds() * durationSecond - date.getMinutes() * durationMinute);\n}, function(date, step) {\n date.setTime(+date + step * durationHour);\n}, function(start, end) {\n return (end - start) / durationHour;\n}, function(date) {\n return date.getHours();\n});\n\nexport default hour;\nexport var hours = hour.range;\n","import interval from \"./interval.js\";\nimport {durationDay, durationMinute} from \"./duration.js\";\n\nvar day = interval(\n date => date.setHours(0, 0, 0, 0),\n (date, step) => date.setDate(date.getDate() + step),\n (start, end) => (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute) / durationDay,\n date => date.getDate() - 1\n);\n\nexport default day;\nexport var days = day.range;\n","import interval from \"./interval.js\";\nimport {durationMinute, durationWeek} from \"./duration.js\";\n\nfunction weekday(i) {\n return interval(function(date) {\n date.setDate(date.getDate() - (date.getDay() + 7 - i) % 7);\n date.setHours(0, 0, 0, 0);\n }, function(date, step) {\n date.setDate(date.getDate() + step * 7);\n }, function(start, end) {\n return (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute) / durationWeek;\n });\n}\n\nexport var sunday = weekday(0);\nexport var monday = weekday(1);\nexport var tuesday = weekday(2);\nexport var wednesday = weekday(3);\nexport var thursday = weekday(4);\nexport var friday = weekday(5);\nexport var saturday = weekday(6);\n\nexport var sundays = sunday.range;\nexport var mondays = monday.range;\nexport var tuesdays = tuesday.range;\nexport var wednesdays = wednesday.range;\nexport var thursdays = thursday.range;\nexport var fridays = friday.range;\nexport var saturdays = saturday.range;\n","import interval from \"./interval.js\";\n\nvar month = interval(function(date) {\n date.setDate(1);\n date.setHours(0, 0, 0, 0);\n}, function(date, step) {\n date.setMonth(date.getMonth() + step);\n}, function(start, end) {\n return end.getMonth() - start.getMonth() + (end.getFullYear() - start.getFullYear()) * 12;\n}, function(date) {\n return date.getMonth();\n});\n\nexport default month;\nexport var months = month.range;\n","import interval from \"./interval.js\";\n\nvar year = interval(function(date) {\n date.setMonth(0, 1);\n date.setHours(0, 0, 0, 0);\n}, function(date, step) {\n date.setFullYear(date.getFullYear() + step);\n}, function(start, end) {\n return end.getFullYear() - start.getFullYear();\n}, function(date) {\n return date.getFullYear();\n});\n\n// An optimized implementation for this simple case.\nyear.every = function(k) {\n return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : interval(function(date) {\n date.setFullYear(Math.floor(date.getFullYear() / k) * k);\n date.setMonth(0, 1);\n date.setHours(0, 0, 0, 0);\n }, function(date, step) {\n date.setFullYear(date.getFullYear() + step * k);\n });\n};\n\nexport default year;\nexport var years = year.range;\n","import interval from \"./interval.js\";\nimport {durationMinute} from \"./duration.js\";\n\nvar utcMinute = interval(function(date) {\n date.setUTCSeconds(0, 0);\n}, function(date, step) {\n date.setTime(+date + step * durationMinute);\n}, function(start, end) {\n return (end - start) / durationMinute;\n}, function(date) {\n return date.getUTCMinutes();\n});\n\nexport default utcMinute;\nexport var utcMinutes = utcMinute.range;\n","import interval from \"./interval.js\";\nimport {durationHour} from \"./duration.js\";\n\nvar utcHour = interval(function(date) {\n date.setUTCMinutes(0, 0, 0);\n}, function(date, step) {\n date.setTime(+date + step * durationHour);\n}, function(start, end) {\n return (end - start) / durationHour;\n}, function(date) {\n return date.getUTCHours();\n});\n\nexport default utcHour;\nexport var utcHours = utcHour.range;\n","import interval from \"./interval.js\";\nimport {durationDay} from \"./duration.js\";\n\nvar utcDay = interval(function(date) {\n date.setUTCHours(0, 0, 0, 0);\n}, function(date, step) {\n date.setUTCDate(date.getUTCDate() + step);\n}, function(start, end) {\n return (end - start) / durationDay;\n}, function(date) {\n return date.getUTCDate() - 1;\n});\n\nexport default utcDay;\nexport var utcDays = utcDay.range;\n","import interval from \"./interval.js\";\nimport {durationWeek} from \"./duration.js\";\n\nfunction utcWeekday(i) {\n return interval(function(date) {\n date.setUTCDate(date.getUTCDate() - (date.getUTCDay() + 7 - i) % 7);\n date.setUTCHours(0, 0, 0, 0);\n }, function(date, step) {\n date.setUTCDate(date.getUTCDate() + step * 7);\n }, function(start, end) {\n return (end - start) / durationWeek;\n });\n}\n\nexport var utcSunday = utcWeekday(0);\nexport var utcMonday = utcWeekday(1);\nexport var utcTuesday = utcWeekday(2);\nexport var utcWednesday = utcWeekday(3);\nexport var utcThursday = utcWeekday(4);\nexport var utcFriday = utcWeekday(5);\nexport var utcSaturday = utcWeekday(6);\n\nexport var utcSundays = utcSunday.range;\nexport var utcMondays = utcMonday.range;\nexport var utcTuesdays = utcTuesday.range;\nexport var utcWednesdays = utcWednesday.range;\nexport var utcThursdays = utcThursday.range;\nexport var utcFridays = utcFriday.range;\nexport var utcSaturdays = utcSaturday.range;\n","import interval from \"./interval.js\";\n\nvar utcMonth = interval(function(date) {\n date.setUTCDate(1);\n date.setUTCHours(0, 0, 0, 0);\n}, function(date, step) {\n date.setUTCMonth(date.getUTCMonth() + step);\n}, function(start, end) {\n return end.getUTCMonth() - start.getUTCMonth() + (end.getUTCFullYear() - start.getUTCFullYear()) * 12;\n}, function(date) {\n return date.getUTCMonth();\n});\n\nexport default utcMonth;\nexport var utcMonths = utcMonth.range;\n","import interval from \"./interval.js\";\n\nvar utcYear = interval(function(date) {\n date.setUTCMonth(0, 1);\n date.setUTCHours(0, 0, 0, 0);\n}, function(date, step) {\n date.setUTCFullYear(date.getUTCFullYear() + step);\n}, function(start, end) {\n return end.getUTCFullYear() - start.getUTCFullYear();\n}, function(date) {\n return date.getUTCFullYear();\n});\n\n// An optimized implementation for this simple case.\nutcYear.every = function(k) {\n return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : interval(function(date) {\n date.setUTCFullYear(Math.floor(date.getUTCFullYear() / k) * k);\n date.setUTCMonth(0, 1);\n date.setUTCHours(0, 0, 0, 0);\n }, function(date, step) {\n date.setUTCFullYear(date.getUTCFullYear() + step * k);\n });\n};\n\nexport default utcYear;\nexport var utcYears = utcYear.range;\n","import {bisector, tickStep} from \"d3-array\";\nimport {durationDay, durationHour, durationMinute, durationMonth, durationSecond, durationWeek, durationYear} from \"./duration.js\";\nimport millisecond from \"./millisecond.js\";\nimport second from \"./second.js\";\nimport minute from \"./minute.js\";\nimport hour from \"./hour.js\";\nimport day from \"./day.js\";\nimport {sunday as week} from \"./week.js\";\nimport month from \"./month.js\";\nimport year from \"./year.js\";\nimport utcMinute from \"./utcMinute.js\";\nimport utcHour from \"./utcHour.js\";\nimport utcDay from \"./utcDay.js\";\nimport {utcSunday as utcWeek} from \"./utcWeek.js\";\nimport utcMonth from \"./utcMonth.js\";\nimport utcYear from \"./utcYear.js\";\n\nfunction ticker(year, month, week, day, hour, minute) {\n\n const tickIntervals = [\n [second, 1, durationSecond],\n [second, 5, 5 * durationSecond],\n [second, 15, 15 * durationSecond],\n [second, 30, 30 * durationSecond],\n [minute, 1, durationMinute],\n [minute, 5, 5 * durationMinute],\n [minute, 15, 15 * durationMinute],\n [minute, 30, 30 * durationMinute],\n [ hour, 1, durationHour ],\n [ hour, 3, 3 * durationHour ],\n [ hour, 6, 6 * durationHour ],\n [ hour, 12, 12 * durationHour ],\n [ day, 1, durationDay ],\n [ day, 2, 2 * durationDay ],\n [ week, 1, durationWeek ],\n [ month, 1, durationMonth ],\n [ month, 3, 3 * durationMonth ],\n [ year, 1, durationYear ]\n ];\n\n function ticks(start, stop, count) {\n const reverse = stop < start;\n if (reverse) [start, stop] = [stop, start];\n const interval = count && typeof count.range === \"function\" ? count : tickInterval(start, stop, count);\n const ticks = interval ? interval.range(start, +stop + 1) : []; // inclusive stop\n return reverse ? ticks.reverse() : ticks;\n }\n\n function tickInterval(start, stop, count) {\n const target = Math.abs(stop - start) / count;\n const i = bisector(([,, step]) => step).right(tickIntervals, target);\n if (i === tickIntervals.length) return year.every(tickStep(start / durationYear, stop / durationYear, count));\n if (i === 0) return millisecond.every(Math.max(tickStep(start, stop, count), 1));\n const [t, step] = tickIntervals[target / tickIntervals[i - 1][2] < tickIntervals[i][2] / target ? i - 1 : i];\n return t.every(step);\n }\n\n return [ticks, tickInterval];\n}\n\nconst [utcTicks, utcTickInterval] = ticker(utcYear, utcMonth, utcWeek, utcDay, utcHour, utcMinute);\nconst [timeTicks, timeTickInterval] = ticker(year, month, week, day, hour, minute);\n\nexport {utcTicks, utcTickInterval, timeTicks, timeTickInterval};\n","import {\n timeDay,\n timeSunday,\n timeMonday,\n timeThursday,\n timeYear,\n utcDay,\n utcSunday,\n utcMonday,\n utcThursday,\n utcYear\n} from \"d3-time\";\n\nfunction localDate(d) {\n if (0 <= d.y && d.y < 100) {\n var date = new Date(-1, d.m, d.d, d.H, d.M, d.S, d.L);\n date.setFullYear(d.y);\n return date;\n }\n return new Date(d.y, d.m, d.d, d.H, d.M, d.S, d.L);\n}\n\nfunction utcDate(d) {\n if (0 <= d.y && d.y < 100) {\n var date = new Date(Date.UTC(-1, d.m, d.d, d.H, d.M, d.S, d.L));\n date.setUTCFullYear(d.y);\n return date;\n }\n return new Date(Date.UTC(d.y, d.m, d.d, d.H, d.M, d.S, d.L));\n}\n\nfunction newDate(y, m, d) {\n return {y: y, m: m, d: d, H: 0, M: 0, S: 0, L: 0};\n}\n\nexport default function formatLocale(locale) {\n var locale_dateTime = locale.dateTime,\n locale_date = locale.date,\n locale_time = locale.time,\n locale_periods = locale.periods,\n locale_weekdays = locale.days,\n locale_shortWeekdays = locale.shortDays,\n locale_months = locale.months,\n locale_shortMonths = locale.shortMonths;\n\n var periodRe = formatRe(locale_periods),\n periodLookup = formatLookup(locale_periods),\n weekdayRe = formatRe(locale_weekdays),\n weekdayLookup = formatLookup(locale_weekdays),\n shortWeekdayRe = formatRe(locale_shortWeekdays),\n shortWeekdayLookup = formatLookup(locale_shortWeekdays),\n monthRe = formatRe(locale_months),\n monthLookup = formatLookup(locale_months),\n shortMonthRe = formatRe(locale_shortMonths),\n shortMonthLookup = formatLookup(locale_shortMonths);\n\n var formats = {\n \"a\": formatShortWeekday,\n \"A\": formatWeekday,\n \"b\": formatShortMonth,\n \"B\": formatMonth,\n \"c\": null,\n \"d\": formatDayOfMonth,\n \"e\": formatDayOfMonth,\n \"f\": formatMicroseconds,\n \"g\": formatYearISO,\n \"G\": formatFullYearISO,\n \"H\": formatHour24,\n \"I\": formatHour12,\n \"j\": formatDayOfYear,\n \"L\": formatMilliseconds,\n \"m\": formatMonthNumber,\n \"M\": formatMinutes,\n \"p\": formatPeriod,\n \"q\": formatQuarter,\n \"Q\": formatUnixTimestamp,\n \"s\": formatUnixTimestampSeconds,\n \"S\": formatSeconds,\n \"u\": formatWeekdayNumberMonday,\n \"U\": formatWeekNumberSunday,\n \"V\": formatWeekNumberISO,\n \"w\": formatWeekdayNumberSunday,\n \"W\": formatWeekNumberMonday,\n \"x\": null,\n \"X\": null,\n \"y\": formatYear,\n \"Y\": formatFullYear,\n \"Z\": formatZone,\n \"%\": formatLiteralPercent\n };\n\n var utcFormats = {\n \"a\": formatUTCShortWeekday,\n \"A\": formatUTCWeekday,\n \"b\": formatUTCShortMonth,\n \"B\": formatUTCMonth,\n \"c\": null,\n \"d\": formatUTCDayOfMonth,\n \"e\": formatUTCDayOfMonth,\n \"f\": formatUTCMicroseconds,\n \"g\": formatUTCYearISO,\n \"G\": formatUTCFullYearISO,\n \"H\": formatUTCHour24,\n \"I\": formatUTCHour12,\n \"j\": formatUTCDayOfYear,\n \"L\": formatUTCMilliseconds,\n \"m\": formatUTCMonthNumber,\n \"M\": formatUTCMinutes,\n \"p\": formatUTCPeriod,\n \"q\": formatUTCQuarter,\n \"Q\": formatUnixTimestamp,\n \"s\": formatUnixTimestampSeconds,\n \"S\": formatUTCSeconds,\n \"u\": formatUTCWeekdayNumberMonday,\n \"U\": formatUTCWeekNumberSunday,\n \"V\": formatUTCWeekNumberISO,\n \"w\": formatUTCWeekdayNumberSunday,\n \"W\": formatUTCWeekNumberMonday,\n \"x\": null,\n \"X\": null,\n \"y\": formatUTCYear,\n \"Y\": formatUTCFullYear,\n \"Z\": formatUTCZone,\n \"%\": formatLiteralPercent\n };\n\n var parses = {\n \"a\": parseShortWeekday,\n \"A\": parseWeekday,\n \"b\": parseShortMonth,\n \"B\": parseMonth,\n \"c\": parseLocaleDateTime,\n \"d\": parseDayOfMonth,\n \"e\": parseDayOfMonth,\n \"f\": parseMicroseconds,\n \"g\": parseYear,\n \"G\": parseFullYear,\n \"H\": parseHour24,\n \"I\": parseHour24,\n \"j\": parseDayOfYear,\n \"L\": parseMilliseconds,\n \"m\": parseMonthNumber,\n \"M\": parseMinutes,\n \"p\": parsePeriod,\n \"q\": parseQuarter,\n \"Q\": parseUnixTimestamp,\n \"s\": parseUnixTimestampSeconds,\n \"S\": parseSeconds,\n \"u\": parseWeekdayNumberMonday,\n \"U\": parseWeekNumberSunday,\n \"V\": parseWeekNumberISO,\n \"w\": parseWeekdayNumberSunday,\n \"W\": parseWeekNumberMonday,\n \"x\": parseLocaleDate,\n \"X\": parseLocaleTime,\n \"y\": parseYear,\n \"Y\": parseFullYear,\n \"Z\": parseZone,\n \"%\": parseLiteralPercent\n };\n\n // These recursive directive definitions must be deferred.\n formats.x = newFormat(locale_date, formats);\n formats.X = newFormat(locale_time, formats);\n formats.c = newFormat(locale_dateTime, formats);\n utcFormats.x = newFormat(locale_date, utcFormats);\n utcFormats.X = newFormat(locale_time, utcFormats);\n utcFormats.c = newFormat(locale_dateTime, utcFormats);\n\n function newFormat(specifier, formats) {\n return function(date) {\n var string = [],\n i = -1,\n j = 0,\n n = specifier.length,\n c,\n pad,\n format;\n\n if (!(date instanceof Date)) date = new Date(+date);\n\n while (++i < n) {\n if (specifier.charCodeAt(i) === 37) {\n string.push(specifier.slice(j, i));\n if ((pad = pads[c = specifier.charAt(++i)]) != null) c = specifier.charAt(++i);\n else pad = c === \"e\" ? \" \" : \"0\";\n if (format = formats[c]) c = format(date, pad);\n string.push(c);\n j = i + 1;\n }\n }\n\n string.push(specifier.slice(j, i));\n return string.join(\"\");\n };\n }\n\n function newParse(specifier, Z) {\n return function(string) {\n var d = newDate(1900, undefined, 1),\n i = parseSpecifier(d, specifier, string += \"\", 0),\n week, day;\n if (i != string.length) return null;\n\n // If a UNIX timestamp is specified, return it.\n if (\"Q\" in d) return new Date(d.Q);\n if (\"s\" in d) return new Date(d.s * 1000 + (\"L\" in d ? d.L : 0));\n\n // If this is utcParse, never use the local timezone.\n if (Z && !(\"Z\" in d)) d.Z = 0;\n\n // The am-pm flag is 0 for AM, and 1 for PM.\n if (\"p\" in d) d.H = d.H % 12 + d.p * 12;\n\n // If the month was not specified, inherit from the quarter.\n if (d.m === undefined) d.m = \"q\" in d ? d.q : 0;\n\n // Convert day-of-week and week-of-year to day-of-year.\n if (\"V\" in d) {\n if (d.V < 1 || d.V > 53) return null;\n if (!(\"w\" in d)) d.w = 1;\n if (\"Z\" in d) {\n week = utcDate(newDate(d.y, 0, 1)), day = week.getUTCDay();\n week = day > 4 || day === 0 ? utcMonday.ceil(week) : utcMonday(week);\n week = utcDay.offset(week, (d.V - 1) * 7);\n d.y = week.getUTCFullYear();\n d.m = week.getUTCMonth();\n d.d = week.getUTCDate() + (d.w + 6) % 7;\n } else {\n week = localDate(newDate(d.y, 0, 1)), day = week.getDay();\n week = day > 4 || day === 0 ? timeMonday.ceil(week) : timeMonday(week);\n week = timeDay.offset(week, (d.V - 1) * 7);\n d.y = week.getFullYear();\n d.m = week.getMonth();\n d.d = week.getDate() + (d.w + 6) % 7;\n }\n } else if (\"W\" in d || \"U\" in d) {\n if (!(\"w\" in d)) d.w = \"u\" in d ? d.u % 7 : \"W\" in d ? 1 : 0;\n day = \"Z\" in d ? utcDate(newDate(d.y, 0, 1)).getUTCDay() : localDate(newDate(d.y, 0, 1)).getDay();\n d.m = 0;\n d.d = \"W\" in d ? (d.w + 6) % 7 + d.W * 7 - (day + 5) % 7 : d.w + d.U * 7 - (day + 6) % 7;\n }\n\n // If a time zone is specified, all fields are interpreted as UTC and then\n // offset according to the specified time zone.\n if (\"Z\" in d) {\n d.H += d.Z / 100 | 0;\n d.M += d.Z % 100;\n return utcDate(d);\n }\n\n // Otherwise, all fields are in local time.\n return localDate(d);\n };\n }\n\n function parseSpecifier(d, specifier, string, j) {\n var i = 0,\n n = specifier.length,\n m = string.length,\n c,\n parse;\n\n while (i < n) {\n if (j >= m) return -1;\n c = specifier.charCodeAt(i++);\n if (c === 37) {\n c = specifier.charAt(i++);\n parse = parses[c in pads ? specifier.charAt(i++) : c];\n if (!parse || ((j = parse(d, string, j)) < 0)) return -1;\n } else if (c != string.charCodeAt(j++)) {\n return -1;\n }\n }\n\n return j;\n }\n\n function parsePeriod(d, string, i) {\n var n = periodRe.exec(string.slice(i));\n return n ? (d.p = periodLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n\n function parseShortWeekday(d, string, i) {\n var n = shortWeekdayRe.exec(string.slice(i));\n return n ? (d.w = shortWeekdayLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n\n function parseWeekday(d, string, i) {\n var n = weekdayRe.exec(string.slice(i));\n return n ? (d.w = weekdayLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n\n function parseShortMonth(d, string, i) {\n var n = shortMonthRe.exec(string.slice(i));\n return n ? (d.m = shortMonthLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n\n function parseMonth(d, string, i) {\n var n = monthRe.exec(string.slice(i));\n return n ? (d.m = monthLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n\n function parseLocaleDateTime(d, string, i) {\n return parseSpecifier(d, locale_dateTime, string, i);\n }\n\n function parseLocaleDate(d, string, i) {\n return parseSpecifier(d, locale_date, string, i);\n }\n\n function parseLocaleTime(d, string, i) {\n return parseSpecifier(d, locale_time, string, i);\n }\n\n function formatShortWeekday(d) {\n return locale_shortWeekdays[d.getDay()];\n }\n\n function formatWeekday(d) {\n return locale_weekdays[d.getDay()];\n }\n\n function formatShortMonth(d) {\n return locale_shortMonths[d.getMonth()];\n }\n\n function formatMonth(d) {\n return locale_months[d.getMonth()];\n }\n\n function formatPeriod(d) {\n return locale_periods[+(d.getHours() >= 12)];\n }\n\n function formatQuarter(d) {\n return 1 + ~~(d.getMonth() / 3);\n }\n\n function formatUTCShortWeekday(d) {\n return locale_shortWeekdays[d.getUTCDay()];\n }\n\n function formatUTCWeekday(d) {\n return locale_weekdays[d.getUTCDay()];\n }\n\n function formatUTCShortMonth(d) {\n return locale_shortMonths[d.getUTCMonth()];\n }\n\n function formatUTCMonth(d) {\n return locale_months[d.getUTCMonth()];\n }\n\n function formatUTCPeriod(d) {\n return locale_periods[+(d.getUTCHours() >= 12)];\n }\n\n function formatUTCQuarter(d) {\n return 1 + ~~(d.getUTCMonth() / 3);\n }\n\n return {\n format: function(specifier) {\n var f = newFormat(specifier += \"\", formats);\n f.toString = function() { return specifier; };\n return f;\n },\n parse: function(specifier) {\n var p = newParse(specifier += \"\", false);\n p.toString = function() { return specifier; };\n return p;\n },\n utcFormat: function(specifier) {\n var f = newFormat(specifier += \"\", utcFormats);\n f.toString = function() { return specifier; };\n return f;\n },\n utcParse: function(specifier) {\n var p = newParse(specifier += \"\", true);\n p.toString = function() { return specifier; };\n return p;\n }\n };\n}\n\nvar pads = {\"-\": \"\", \"_\": \" \", \"0\": \"0\"},\n numberRe = /^\\s*\\d+/, // note: ignores next directive\n percentRe = /^%/,\n requoteRe = /[\\\\^$*+?|[\\]().{}]/g;\n\nfunction pad(value, fill, width) {\n var sign = value < 0 ? \"-\" : \"\",\n string = (sign ? -value : value) + \"\",\n length = string.length;\n return sign + (length < width ? new Array(width - length + 1).join(fill) + string : string);\n}\n\nfunction requote(s) {\n return s.replace(requoteRe, \"\\\\$&\");\n}\n\nfunction formatRe(names) {\n return new RegExp(\"^(?:\" + names.map(requote).join(\"|\") + \")\", \"i\");\n}\n\nfunction formatLookup(names) {\n return new Map(names.map((name, i) => [name.toLowerCase(), i]));\n}\n\nfunction parseWeekdayNumberSunday(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 1));\n return n ? (d.w = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseWeekdayNumberMonday(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 1));\n return n ? (d.u = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseWeekNumberSunday(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.U = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseWeekNumberISO(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.V = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseWeekNumberMonday(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.W = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseFullYear(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 4));\n return n ? (d.y = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseYear(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.y = +n[0] + (+n[0] > 68 ? 1900 : 2000), i + n[0].length) : -1;\n}\n\nfunction parseZone(d, string, i) {\n var n = /^(Z)|([+-]\\d\\d)(?::?(\\d\\d))?/.exec(string.slice(i, i + 6));\n return n ? (d.Z = n[1] ? 0 : -(n[2] + (n[3] || \"00\")), i + n[0].length) : -1;\n}\n\nfunction parseQuarter(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 1));\n return n ? (d.q = n[0] * 3 - 3, i + n[0].length) : -1;\n}\n\nfunction parseMonthNumber(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.m = n[0] - 1, i + n[0].length) : -1;\n}\n\nfunction parseDayOfMonth(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.d = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseDayOfYear(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 3));\n return n ? (d.m = 0, d.d = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseHour24(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.H = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseMinutes(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.M = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseSeconds(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 2));\n return n ? (d.S = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseMilliseconds(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 3));\n return n ? (d.L = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseMicroseconds(d, string, i) {\n var n = numberRe.exec(string.slice(i, i + 6));\n return n ? (d.L = Math.floor(n[0] / 1000), i + n[0].length) : -1;\n}\n\nfunction parseLiteralPercent(d, string, i) {\n var n = percentRe.exec(string.slice(i, i + 1));\n return n ? i + n[0].length : -1;\n}\n\nfunction parseUnixTimestamp(d, string, i) {\n var n = numberRe.exec(string.slice(i));\n return n ? (d.Q = +n[0], i + n[0].length) : -1;\n}\n\nfunction parseUnixTimestampSeconds(d, string, i) {\n var n = numberRe.exec(string.slice(i));\n return n ? (d.s = +n[0], i + n[0].length) : -1;\n}\n\nfunction formatDayOfMonth(d, p) {\n return pad(d.getDate(), p, 2);\n}\n\nfunction formatHour24(d, p) {\n return pad(d.getHours(), p, 2);\n}\n\nfunction formatHour12(d, p) {\n return pad(d.getHours() % 12 || 12, p, 2);\n}\n\nfunction formatDayOfYear(d, p) {\n return pad(1 + timeDay.count(timeYear(d), d), p, 3);\n}\n\nfunction formatMilliseconds(d, p) {\n return pad(d.getMilliseconds(), p, 3);\n}\n\nfunction formatMicroseconds(d, p) {\n return formatMilliseconds(d, p) + \"000\";\n}\n\nfunction formatMonthNumber(d, p) {\n return pad(d.getMonth() + 1, p, 2);\n}\n\nfunction formatMinutes(d, p) {\n return pad(d.getMinutes(), p, 2);\n}\n\nfunction formatSeconds(d, p) {\n return pad(d.getSeconds(), p, 2);\n}\n\nfunction formatWeekdayNumberMonday(d) {\n var day = d.getDay();\n return day === 0 ? 7 : day;\n}\n\nfunction formatWeekNumberSunday(d, p) {\n return pad(timeSunday.count(timeYear(d) - 1, d), p, 2);\n}\n\nfunction dISO(d) {\n var day = d.getDay();\n return (day >= 4 || day === 0) ? timeThursday(d) : timeThursday.ceil(d);\n}\n\nfunction formatWeekNumberISO(d, p) {\n d = dISO(d);\n return pad(timeThursday.count(timeYear(d), d) + (timeYear(d).getDay() === 4), p, 2);\n}\n\nfunction formatWeekdayNumberSunday(d) {\n return d.getDay();\n}\n\nfunction formatWeekNumberMonday(d, p) {\n return pad(timeMonday.count(timeYear(d) - 1, d), p, 2);\n}\n\nfunction formatYear(d, p) {\n return pad(d.getFullYear() % 100, p, 2);\n}\n\nfunction formatYearISO(d, p) {\n d = dISO(d);\n return pad(d.getFullYear() % 100, p, 2);\n}\n\nfunction formatFullYear(d, p) {\n return pad(d.getFullYear() % 10000, p, 4);\n}\n\nfunction formatFullYearISO(d, p) {\n var day = d.getDay();\n d = (day >= 4 || day === 0) ? timeThursday(d) : timeThursday.ceil(d);\n return pad(d.getFullYear() % 10000, p, 4);\n}\n\nfunction formatZone(d) {\n var z = d.getTimezoneOffset();\n return (z > 0 ? \"-\" : (z *= -1, \"+\"))\n + pad(z / 60 | 0, \"0\", 2)\n + pad(z % 60, \"0\", 2);\n}\n\nfunction formatUTCDayOfMonth(d, p) {\n return pad(d.getUTCDate(), p, 2);\n}\n\nfunction formatUTCHour24(d, p) {\n return pad(d.getUTCHours(), p, 2);\n}\n\nfunction formatUTCHour12(d, p) {\n return pad(d.getUTCHours() % 12 || 12, p, 2);\n}\n\nfunction formatUTCDayOfYear(d, p) {\n return pad(1 + utcDay.count(utcYear(d), d), p, 3);\n}\n\nfunction formatUTCMilliseconds(d, p) {\n return pad(d.getUTCMilliseconds(), p, 3);\n}\n\nfunction formatUTCMicroseconds(d, p) {\n return formatUTCMilliseconds(d, p) + \"000\";\n}\n\nfunction formatUTCMonthNumber(d, p) {\n return pad(d.getUTCMonth() + 1, p, 2);\n}\n\nfunction formatUTCMinutes(d, p) {\n return pad(d.getUTCMinutes(), p, 2);\n}\n\nfunction formatUTCSeconds(d, p) {\n return pad(d.getUTCSeconds(), p, 2);\n}\n\nfunction formatUTCWeekdayNumberMonday(d) {\n var dow = d.getUTCDay();\n return dow === 0 ? 7 : dow;\n}\n\nfunction formatUTCWeekNumberSunday(d, p) {\n return pad(utcSunday.count(utcYear(d) - 1, d), p, 2);\n}\n\nfunction UTCdISO(d) {\n var day = d.getUTCDay();\n return (day >= 4 || day === 0) ? utcThursday(d) : utcThursday.ceil(d);\n}\n\nfunction formatUTCWeekNumberISO(d, p) {\n d = UTCdISO(d);\n return pad(utcThursday.count(utcYear(d), d) + (utcYear(d).getUTCDay() === 4), p, 2);\n}\n\nfunction formatUTCWeekdayNumberSunday(d) {\n return d.getUTCDay();\n}\n\nfunction formatUTCWeekNumberMonday(d, p) {\n return pad(utcMonday.count(utcYear(d) - 1, d), p, 2);\n}\n\nfunction formatUTCYear(d, p) {\n return pad(d.getUTCFullYear() % 100, p, 2);\n}\n\nfunction formatUTCYearISO(d, p) {\n d = UTCdISO(d);\n return pad(d.getUTCFullYear() % 100, p, 2);\n}\n\nfunction formatUTCFullYear(d, p) {\n return pad(d.getUTCFullYear() % 10000, p, 4);\n}\n\nfunction formatUTCFullYearISO(d, p) {\n var day = d.getUTCDay();\n d = (day >= 4 || day === 0) ? utcThursday(d) : utcThursday.ceil(d);\n return pad(d.getUTCFullYear() % 10000, p, 4);\n}\n\nfunction formatUTCZone() {\n return \"+0000\";\n}\n\nfunction formatLiteralPercent() {\n return \"%\";\n}\n\nfunction formatUnixTimestamp(d) {\n return +d;\n}\n\nfunction formatUnixTimestampSeconds(d) {\n return Math.floor(+d / 1000);\n}\n","import formatLocale from \"./locale.js\";\n\nvar locale;\nexport var timeFormat;\nexport var timeParse;\nexport var utcFormat;\nexport var utcParse;\n\ndefaultLocale({\n dateTime: \"%x, %X\",\n date: \"%-m/%-d/%Y\",\n time: \"%-I:%M:%S %p\",\n periods: [\"AM\", \"PM\"],\n days: [\"Sunday\", \"Monday\", \"Tuesday\", \"Wednesday\", \"Thursday\", \"Friday\", \"Saturday\"],\n shortDays: [\"Sun\", \"Mon\", \"Tue\", \"Wed\", \"Thu\", \"Fri\", \"Sat\"],\n months: [\"January\", \"February\", \"March\", \"April\", \"May\", \"June\", \"July\", \"August\", \"September\", \"October\", \"November\", \"December\"],\n shortMonths: [\"Jan\", \"Feb\", \"Mar\", \"Apr\", \"May\", \"Jun\", \"Jul\", \"Aug\", \"Sep\", \"Oct\", \"Nov\", \"Dec\"]\n});\n\nexport default function defaultLocale(definition) {\n locale = formatLocale(definition);\n timeFormat = locale.format;\n timeParse = locale.parse;\n utcFormat = locale.utcFormat;\n utcParse = locale.utcParse;\n return locale;\n}\n","import {timeYear, timeMonth, timeWeek, timeDay, timeHour, timeMinute, timeSecond, timeTicks, timeTickInterval} from \"d3-time\";\nimport {timeFormat} from \"d3-time-format\";\nimport continuous, {copy} from \"./continuous.js\";\nimport {initRange} from \"./init.js\";\nimport nice from \"./nice.js\";\n\nfunction date(t) {\n return new Date(t);\n}\n\nfunction number(t) {\n return t instanceof Date ? +t : +new Date(+t);\n}\n\nexport function calendar(ticks, tickInterval, year, month, week, day, hour, minute, second, format) {\n var scale = continuous(),\n invert = scale.invert,\n domain = scale.domain;\n\n var formatMillisecond = format(\".%L\"),\n formatSecond = format(\":%S\"),\n formatMinute = format(\"%I:%M\"),\n formatHour = format(\"%I %p\"),\n formatDay = format(\"%a %d\"),\n formatWeek = format(\"%b %d\"),\n formatMonth = format(\"%B\"),\n formatYear = format(\"%Y\");\n\n function tickFormat(date) {\n return (second(date) < date ? formatMillisecond\n : minute(date) < date ? formatSecond\n : hour(date) < date ? formatMinute\n : day(date) < date ? formatHour\n : month(date) < date ? (week(date) < date ? formatDay : formatWeek)\n : year(date) < date ? formatMonth\n : formatYear)(date);\n }\n\n scale.invert = function(y) {\n return new Date(invert(y));\n };\n\n scale.domain = function(_) {\n return arguments.length ? domain(Array.from(_, number)) : domain().map(date);\n };\n\n scale.ticks = function(interval) {\n var d = domain();\n return ticks(d[0], d[d.length - 1], interval == null ? 10 : interval);\n };\n\n scale.tickFormat = function(count, specifier) {\n return specifier == null ? tickFormat : format(specifier);\n };\n\n scale.nice = function(interval) {\n var d = domain();\n if (!interval || typeof interval.range !== \"function\") interval = tickInterval(d[0], d[d.length - 1], interval == null ? 10 : interval);\n return interval ? domain(nice(d, interval)) : scale;\n };\n\n scale.copy = function() {\n return copy(scale, calendar(ticks, tickInterval, year, month, week, day, hour, minute, second, format));\n };\n\n return scale;\n}\n\nexport default function time() {\n return initRange.apply(calendar(timeTicks, timeTickInterval, timeYear, timeMonth, timeWeek, timeDay, timeHour, timeMinute, timeSecond, timeFormat).domain([new Date(2000, 0, 1), new Date(2000, 0, 2)]), arguments);\n}\n","import {utcYear, utcMonth, utcWeek, utcDay, utcHour, utcMinute, utcSecond, utcTicks, utcTickInterval} from \"d3-time\";\nimport {utcFormat} from \"d3-time-format\";\nimport {calendar} from \"./time.js\";\nimport {initRange} from \"./init.js\";\n\nexport default function utcTime() {\n return initRange.apply(calendar(utcTicks, utcTickInterval, utcYear, utcMonth, utcWeek, utcDay, utcHour, utcMinute, utcSecond, utcFormat).domain([Date.UTC(2000, 0, 1), Date.UTC(2000, 0, 2)]), arguments);\n}\n","import {interpolate, interpolateRound} from \"d3-interpolate\";\nimport {identity} from \"./continuous.js\";\nimport {initInterpolator} from \"./init.js\";\nimport {linearish} from \"./linear.js\";\nimport {loggish} from \"./log.js\";\nimport {symlogish} from \"./symlog.js\";\nimport {powish} from \"./pow.js\";\n\nfunction transformer() {\n var x0 = 0,\n x1 = 1,\n t0,\n t1,\n k10,\n transform,\n interpolator = identity,\n clamp = false,\n unknown;\n\n function scale(x) {\n return x == null || isNaN(x = +x) ? unknown : interpolator(k10 === 0 ? 0.5 : (x = (transform(x) - t0) * k10, clamp ? Math.max(0, Math.min(1, x)) : x));\n }\n\n scale.domain = function(_) {\n return arguments.length ? ([x0, x1] = _, t0 = transform(x0 = +x0), t1 = transform(x1 = +x1), k10 = t0 === t1 ? 0 : 1 / (t1 - t0), scale) : [x0, x1];\n };\n\n scale.clamp = function(_) {\n return arguments.length ? (clamp = !!_, scale) : clamp;\n };\n\n scale.interpolator = function(_) {\n return arguments.length ? (interpolator = _, scale) : interpolator;\n };\n\n function range(interpolate) {\n return function(_) {\n var r0, r1;\n return arguments.length ? ([r0, r1] = _, interpolator = interpolate(r0, r1), scale) : [interpolator(0), interpolator(1)];\n };\n }\n\n scale.range = range(interpolate);\n\n scale.rangeRound = range(interpolateRound);\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : unknown;\n };\n\n return function(t) {\n transform = t, t0 = t(x0), t1 = t(x1), k10 = t0 === t1 ? 0 : 1 / (t1 - t0);\n return scale;\n };\n}\n\nexport function copy(source, target) {\n return target\n .domain(source.domain())\n .interpolator(source.interpolator())\n .clamp(source.clamp())\n .unknown(source.unknown());\n}\n\nexport default function sequential() {\n var scale = linearish(transformer()(identity));\n\n scale.copy = function() {\n return copy(scale, sequential());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function sequentialLog() {\n var scale = loggish(transformer()).domain([1, 10]);\n\n scale.copy = function() {\n return copy(scale, sequentialLog()).base(scale.base());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function sequentialSymlog() {\n var scale = symlogish(transformer());\n\n scale.copy = function() {\n return copy(scale, sequentialSymlog()).constant(scale.constant());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function sequentialPow() {\n var scale = powish(transformer());\n\n scale.copy = function() {\n return copy(scale, sequentialPow()).exponent(scale.exponent());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function sequentialSqrt() {\n return sequentialPow.apply(null, arguments).exponent(0.5);\n}\n","import {ascending, bisect, quantile} from \"d3-array\";\nimport {identity} from \"./continuous.js\";\nimport {initInterpolator} from \"./init.js\";\n\nexport default function sequentialQuantile() {\n var domain = [],\n interpolator = identity;\n\n function scale(x) {\n if (x != null && !isNaN(x = +x)) return interpolator((bisect(domain, x, 1) - 1) / (domain.length - 1));\n }\n\n scale.domain = function(_) {\n if (!arguments.length) return domain.slice();\n domain = [];\n for (let d of _) if (d != null && !isNaN(d = +d)) domain.push(d);\n domain.sort(ascending);\n return scale;\n };\n\n scale.interpolator = function(_) {\n return arguments.length ? (interpolator = _, scale) : interpolator;\n };\n\n scale.range = function() {\n return domain.map((d, i) => interpolator(i / (domain.length - 1)));\n };\n\n scale.quantiles = function(n) {\n return Array.from({length: n + 1}, (_, i) => quantile(domain, i / n));\n };\n\n scale.copy = function() {\n return sequentialQuantile(interpolator).domain(domain);\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n","import {default as value} from \"./value.js\";\n\nexport default function piecewise(interpolate, values) {\n if (values === undefined) values = interpolate, interpolate = value;\n var i = 0, n = values.length - 1, v = values[0], I = new Array(n < 0 ? 0 : n);\n while (i < n) I[i] = interpolate(v, v = values[++i]);\n return function(t) {\n var i = Math.max(0, Math.min(n - 1, Math.floor(t *= n)));\n return I[i](t - i);\n };\n}\n","import {interpolate, interpolateRound, piecewise} from \"d3-interpolate\";\nimport {identity} from \"./continuous.js\";\nimport {initInterpolator} from \"./init.js\";\nimport {linearish} from \"./linear.js\";\nimport {loggish} from \"./log.js\";\nimport {copy} from \"./sequential.js\";\nimport {symlogish} from \"./symlog.js\";\nimport {powish} from \"./pow.js\";\n\nfunction transformer() {\n var x0 = 0,\n x1 = 0.5,\n x2 = 1,\n s = 1,\n t0,\n t1,\n t2,\n k10,\n k21,\n interpolator = identity,\n transform,\n clamp = false,\n unknown;\n\n function scale(x) {\n return isNaN(x = +x) ? unknown : (x = 0.5 + ((x = +transform(x)) - t1) * (s * x < s * t1 ? k10 : k21), interpolator(clamp ? Math.max(0, Math.min(1, x)) : x));\n }\n\n scale.domain = function(_) {\n return arguments.length ? ([x0, x1, x2] = _, t0 = transform(x0 = +x0), t1 = transform(x1 = +x1), t2 = transform(x2 = +x2), k10 = t0 === t1 ? 0 : 0.5 / (t1 - t0), k21 = t1 === t2 ? 0 : 0.5 / (t2 - t1), s = t1 < t0 ? -1 : 1, scale) : [x0, x1, x2];\n };\n\n scale.clamp = function(_) {\n return arguments.length ? (clamp = !!_, scale) : clamp;\n };\n\n scale.interpolator = function(_) {\n return arguments.length ? (interpolator = _, scale) : interpolator;\n };\n\n function range(interpolate) {\n return function(_) {\n var r0, r1, r2;\n return arguments.length ? ([r0, r1, r2] = _, interpolator = piecewise(interpolate, [r0, r1, r2]), scale) : [interpolator(0), interpolator(0.5), interpolator(1)];\n };\n }\n\n scale.range = range(interpolate);\n\n scale.rangeRound = range(interpolateRound);\n\n scale.unknown = function(_) {\n return arguments.length ? (unknown = _, scale) : unknown;\n };\n\n return function(t) {\n transform = t, t0 = t(x0), t1 = t(x1), t2 = t(x2), k10 = t0 === t1 ? 0 : 0.5 / (t1 - t0), k21 = t1 === t2 ? 0 : 0.5 / (t2 - t1), s = t1 < t0 ? -1 : 1;\n return scale;\n };\n}\n\nexport default function diverging() {\n var scale = linearish(transformer()(identity));\n\n scale.copy = function() {\n return copy(scale, diverging());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function divergingLog() {\n var scale = loggish(transformer()).domain([0.1, 1, 10]);\n\n scale.copy = function() {\n return copy(scale, divergingLog()).base(scale.base());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function divergingSymlog() {\n var scale = symlogish(transformer());\n\n scale.copy = function() {\n return copy(scale, divergingSymlog()).constant(scale.constant());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function divergingPow() {\n var scale = powish(transformer());\n\n scale.copy = function() {\n return copy(scale, divergingPow()).exponent(scale.exponent());\n };\n\n return initInterpolator.apply(scale, arguments);\n}\n\nexport function divergingSqrt() {\n return divergingPow.apply(null, arguments).exponent(0.5);\n}\n","var red = {\n 50: '#ffebee',\n 100: '#ffcdd2',\n 200: '#ef9a9a',\n 300: '#e57373',\n 400: '#ef5350',\n 500: '#f44336',\n 600: '#e53935',\n 700: '#d32f2f',\n 800: '#c62828',\n 900: '#b71c1c',\n A100: '#ff8a80',\n A200: '#ff5252',\n A400: '#ff1744',\n A700: '#d50000'\n};\nexport default red;","module.exports = require(\"./build/ReactGridLayout\").default;\nmodule.exports.utils = require(\"./build/utils\");\nmodule.exports.Responsive = require(\"./build/ResponsiveReactGridLayout\").default;\nmodule.exports.Responsive.utils = require(\"./build/responsiveUtils\");\nmodule.exports.WidthProvider = require(\"./build/components/WidthProvider\").default;\n","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\n\nvar _postcssValueParser = require('postcss-value-parser');\n\nvar _postcssValueParser2 = _interopRequireDefault(_postcssValueParser);\n\nvar _parser = require('./parser');\n\nvar _reducer = require('./lib/reducer');\n\nvar _reducer2 = _interopRequireDefault(_reducer);\n\nvar _stringifier = require('./lib/stringifier');\n\nvar _stringifier2 = _interopRequireDefault(_stringifier);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\n// eslint-disable-line\nvar MATCH_CALC = /((?:\\-[a-z]+\\-)?calc)/;\n\nexports.default = function (value) {\n var precision = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 5;\n\n return (0, _postcssValueParser2.default)(value).walk(function (node) {\n // skip anything which isn't a calc() function\n if (node.type !== 'function' || !MATCH_CALC.test(node.value)) return;\n\n // stringify calc expression and produce an AST\n var contents = _postcssValueParser2.default.stringify(node.nodes);\n\n // skip constant() and env()\n if (contents.indexOf('constant') >= 0 || contents.indexOf('env') >= 0) return;\n\n var ast = _parser.parser.parse(contents);\n\n // reduce AST to its simplest form, that is, either to a single value\n // or a simplified calc expression\n var reducedAst = (0, _reducer2.default)(ast, precision);\n\n // stringify AST and write it back\n node.type = 'word';\n node.value = (0, _stringifier2.default)(node.value, reducedAst, precision);\n }, true).toString();\n};\n\nmodule.exports = exports['default'];","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\");\n\nvar _interopRequireWildcard = require(\"@babel/runtime/helpers/interopRequireWildcard\");\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\n\nvar React = _interopRequireWildcard(require(\"react\"));\n\nvar _createSvgIcon = _interopRequireDefault(require(\"./utils/createSvgIcon\"));\n\nvar _default = (0, _createSvgIcon.default)( /*#__PURE__*/React.createElement(\"path\", {\n d: \"M12 2C6.48 2 2 6.48 2 12s4.48 10 10 10 10-4.48 10-10S17.52 2 12 2zm-2 15l-5-5 1.41-1.41L10 14.17l7.59-7.59L19 8l-9 9z\"\n}), 'CheckCircle');\n\nexports.default = _default;","export var ifOverflowMatches = function ifOverflowMatches(props, value) {\n var alwaysShow = props.alwaysShow;\n var ifOverflow = props.ifOverflow;\n\n if (alwaysShow) {\n ifOverflow = 'extendDomain';\n }\n\n return ifOverflow === value;\n};","import _isFunction from \"lodash/isFunction\";\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n/**\n * @fileOverview Reference Dot\n */\nimport React from 'react';\nimport classNames from 'classnames';\nimport { Layer } from '../container/Layer';\nimport { Dot } from '../shape/Dot';\nimport { Label } from '../component/Label';\nimport { isNumOrStr } from '../util/DataUtils';\nimport { ifOverflowMatches } from '../util/IfOverflowMatches';\nimport { createLabeledScales } from '../util/CartesianUtils';\nimport { warn } from '../util/LogUtils';\nimport { filterProps } from '../util/types';\n\nvar getCoordinate = function getCoordinate(props) {\n var x = props.x,\n y = props.y,\n xAxis = props.xAxis,\n yAxis = props.yAxis;\n var scales = createLabeledScales({\n x: xAxis.scale,\n y: yAxis.scale\n });\n var result = scales.apply({\n x: x,\n y: y\n }, {\n bandAware: true\n });\n\n if (ifOverflowMatches(props, 'discard') && !scales.isInRange(result)) {\n return null;\n }\n\n return result;\n};\n\nexport function ReferenceDot(props) {\n var x = props.x,\n y = props.y,\n r = props.r,\n alwaysShow = props.alwaysShow,\n clipPathId = props.clipPathId;\n var isX = isNumOrStr(x);\n var isY = isNumOrStr(y);\n warn(alwaysShow === undefined, 'The alwaysShow prop is deprecated. Please use ifOverflow=\"extendDomain\" instead.');\n\n if (!isX || !isY) {\n return null;\n }\n\n var coordinate = getCoordinate(props);\n\n if (!coordinate) {\n return null;\n }\n\n var cx = coordinate.x,\n cy = coordinate.y;\n var shape = props.shape,\n className = props.className;\n var clipPath = ifOverflowMatches(props, 'hidden') ? \"url(#\".concat(clipPathId, \")\") : undefined;\n\n var dotProps = _objectSpread(_objectSpread({\n clipPath: clipPath\n }, filterProps(props, true)), {}, {\n cx: cx,\n cy: cy\n });\n\n return /*#__PURE__*/React.createElement(Layer, {\n className: classNames('recharts-reference-dot', className)\n }, ReferenceDot.renderDot(shape, dotProps), Label.renderCallByParent(props, {\n x: cx - r,\n y: cy - r,\n width: 2 * r,\n height: 2 * r\n }));\n}\nReferenceDot.displayName = 'ReferenceDot';\nReferenceDot.defaultProps = {\n isFront: false,\n ifOverflow: 'discard',\n xAxisId: 0,\n yAxisId: 0,\n r: 10,\n fill: '#fff',\n stroke: '#ccc',\n fillOpacity: 1,\n strokeWidth: 1\n};\n\nReferenceDot.renderDot = function (option, props) {\n var dot;\n\n if ( /*#__PURE__*/React.isValidElement(option)) {\n dot = /*#__PURE__*/React.cloneElement(option, props);\n } else if (_isFunction(option)) {\n dot = option(props);\n } else {\n dot = /*#__PURE__*/React.createElement(Dot, _extends({}, props, {\n cx: props.cx,\n cy: props.cy,\n className: \"recharts-reference-dot-dot\"\n }));\n }\n\n return dot;\n};","import _some from \"lodash/some\";\nimport _isFunction from \"lodash/isFunction\";\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction _iterableToArrayLimit(arr, i) { if (typeof Symbol === \"undefined\" || !(Symbol.iterator in Object(arr))) return; var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\n/**\n * @fileOverview Reference Line\n */\nimport React from 'react';\nimport classNames from 'classnames';\nimport { Layer } from '../container/Layer';\nimport { Label } from '../component/Label';\nimport { ifOverflowMatches } from '../util/IfOverflowMatches';\nimport { isNumOrStr } from '../util/DataUtils';\nimport { createLabeledScales, rectWithCoords } from '../util/CartesianUtils';\nimport { warn } from '../util/LogUtils';\nimport { filterProps } from '../util/types';\n\nvar renderLine = function renderLine(option, props) {\n var line;\n\n if ( /*#__PURE__*/React.isValidElement(option)) {\n line = /*#__PURE__*/React.cloneElement(option, props);\n } else if (_isFunction(option)) {\n line = option(props);\n } else {\n line = /*#__PURE__*/React.createElement(\"line\", _extends({}, props, {\n className: \"recharts-reference-line-line\"\n }));\n }\n\n return line;\n}; // TODO: ScaleHelper\n\n\nvar getEndPoints = function getEndPoints(scales, isFixedX, isFixedY, isSegment, props) {\n var _props$viewBox = props.viewBox,\n x = _props$viewBox.x,\n y = _props$viewBox.y,\n width = _props$viewBox.width,\n height = _props$viewBox.height,\n position = props.position;\n\n if (isFixedY) {\n var yCoord = props.y,\n orientation = props.yAxis.orientation;\n var coord = scales.y.apply(yCoord, {\n position: position\n });\n\n if (ifOverflowMatches(props, 'discard') && !scales.y.isInRange(coord)) {\n return null;\n }\n\n var points = [{\n x: x + width,\n y: coord\n }, {\n x: x,\n y: coord\n }];\n return orientation === 'left' ? points.reverse() : points;\n }\n\n if (isFixedX) {\n var xCoord = props.x,\n _orientation = props.xAxis.orientation;\n\n var _coord = scales.x.apply(xCoord, {\n position: position\n });\n\n if (ifOverflowMatches(props, 'discard') && !scales.x.isInRange(_coord)) {\n return null;\n }\n\n var _points = [{\n x: _coord,\n y: y + height\n }, {\n x: _coord,\n y: y\n }];\n return _orientation === 'top' ? _points.reverse() : _points;\n }\n\n if (isSegment) {\n var segment = props.segment;\n\n var _points2 = segment.map(function (p) {\n return scales.apply(p, {\n position: position\n });\n });\n\n if (ifOverflowMatches(props, 'discard') && _some(_points2, function (p) {\n return !scales.isInRange(p);\n })) {\n return null;\n }\n\n return _points2;\n }\n\n return null;\n};\n\nexport function ReferenceLine(props) {\n var fixedX = props.x,\n fixedY = props.y,\n segment = props.segment,\n xAxis = props.xAxis,\n yAxis = props.yAxis,\n shape = props.shape,\n className = props.className,\n alwaysShow = props.alwaysShow,\n clipPathId = props.clipPathId;\n warn(alwaysShow === undefined, 'The alwaysShow prop is deprecated. Please use ifOverflow=\"extendDomain\" instead.');\n var scales = createLabeledScales({\n x: xAxis.scale,\n y: yAxis.scale\n });\n var isX = isNumOrStr(fixedX);\n var isY = isNumOrStr(fixedY);\n var isSegment = segment && segment.length === 2;\n var endPoints = getEndPoints(scales, isX, isY, isSegment, props);\n\n if (!endPoints) {\n return null;\n }\n\n var _endPoints = _slicedToArray(endPoints, 2),\n _endPoints$ = _endPoints[0],\n x1 = _endPoints$.x,\n y1 = _endPoints$.y,\n _endPoints$2 = _endPoints[1],\n x2 = _endPoints$2.x,\n y2 = _endPoints$2.y;\n\n var clipPath = ifOverflowMatches(props, 'hidden') ? \"url(#\".concat(clipPathId, \")\") : undefined;\n\n var lineProps = _objectSpread(_objectSpread({\n clipPath: clipPath\n }, filterProps(props, true)), {}, {\n x1: x1,\n y1: y1,\n x2: x2,\n y2: y2\n });\n\n return /*#__PURE__*/React.createElement(Layer, {\n className: classNames('recharts-reference-line', className)\n }, renderLine(shape, lineProps), Label.renderCallByParent(props, rectWithCoords({\n x1: x1,\n y1: y1,\n x2: x2,\n y2: y2\n })));\n}\nReferenceLine.displayName = 'ReferenceLine';\nReferenceLine.defaultProps = {\n isFront: false,\n ifOverflow: 'discard',\n xAxisId: 0,\n yAxisId: 0,\n fill: 'none',\n stroke: '#ccc',\n fillOpacity: 1,\n strokeWidth: 1,\n position: 'middle'\n};","import _isFunction from \"lodash/isFunction\";\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n/**\n * @fileOverview Reference Line\n */\nimport React from 'react';\nimport classNames from 'classnames';\nimport { Layer } from '../container/Layer';\nimport { Label } from '../component/Label';\nimport { createLabeledScales, rectWithPoints } from '../util/CartesianUtils';\nimport { ifOverflowMatches } from '../util/IfOverflowMatches';\nimport { isNumOrStr } from '../util/DataUtils';\nimport { warn } from '../util/LogUtils';\nimport { Rectangle } from '../shape/Rectangle';\nimport { filterProps } from '../util/types';\n\nvar getRect = function getRect(hasX1, hasX2, hasY1, hasY2, props) {\n var xValue1 = props.x1,\n xValue2 = props.x2,\n yValue1 = props.y1,\n yValue2 = props.y2,\n xAxis = props.xAxis,\n yAxis = props.yAxis;\n var scales = createLabeledScales({\n x: xAxis.scale,\n y: yAxis.scale\n });\n var p1 = {\n x: hasX1 ? scales.x.apply(xValue1, {\n position: 'start'\n }) : scales.x.rangeMin,\n y: hasY1 ? scales.y.apply(yValue1, {\n position: 'start'\n }) : scales.y.rangeMin\n };\n var p2 = {\n x: hasX2 ? scales.x.apply(xValue2, {\n position: 'end'\n }) : scales.x.rangeMax,\n y: hasY2 ? scales.y.apply(yValue2, {\n position: 'end'\n }) : scales.y.rangeMax\n };\n\n if (ifOverflowMatches(props, 'discard') && (!scales.isInRange(p1) || !scales.isInRange(p2))) {\n return null;\n }\n\n return rectWithPoints(p1, p2);\n};\n\nexport function ReferenceArea(props) {\n var x1 = props.x1,\n x2 = props.x2,\n y1 = props.y1,\n y2 = props.y2,\n className = props.className,\n alwaysShow = props.alwaysShow,\n clipPathId = props.clipPathId;\n warn(alwaysShow === undefined, 'The alwaysShow prop is deprecated. Please use ifOverflow=\"extendDomain\" instead.');\n var hasX1 = isNumOrStr(x1);\n var hasX2 = isNumOrStr(x2);\n var hasY1 = isNumOrStr(y1);\n var hasY2 = isNumOrStr(y2);\n var shape = props.shape;\n\n if (!hasX1 && !hasX2 && !hasY1 && !hasY2 && !shape) {\n return null;\n }\n\n var rect = getRect(hasX1, hasX2, hasY1, hasY2, props);\n\n if (!rect && !shape) {\n return null;\n }\n\n var clipPath = ifOverflowMatches(props, 'hidden') ? \"url(#\".concat(clipPathId, \")\") : undefined;\n return /*#__PURE__*/React.createElement(Layer, {\n className: classNames('recharts-reference-area', className)\n }, ReferenceArea.renderRect(shape, _objectSpread(_objectSpread({\n clipPath: clipPath\n }, filterProps(props, true)), rect)), Label.renderCallByParent(props, rect));\n}\nReferenceArea.displayName = 'ReferenceArea';\nReferenceArea.defaultProps = {\n isFront: false,\n ifOverflow: 'discard',\n xAxisId: 0,\n yAxisId: 0,\n r: 10,\n fill: '#ccc',\n fillOpacity: 0.5,\n stroke: 'none',\n strokeWidth: 1\n};\n\nReferenceArea.renderRect = function (option, props) {\n var rect;\n\n if ( /*#__PURE__*/React.isValidElement(option)) {\n rect = /*#__PURE__*/React.cloneElement(option, props);\n } else if (_isFunction(option)) {\n rect = option(props);\n } else {\n rect = /*#__PURE__*/React.createElement(Rectangle, _extends({}, props, {\n className: \"recharts-reference-area-rect\"\n }));\n }\n\n return rect;\n};","import { ReferenceDot } from '../cartesian/ReferenceDot';\nimport { ReferenceLine } from '../cartesian/ReferenceLine';\nimport { ReferenceArea } from '../cartesian/ReferenceArea';\nimport { ifOverflowMatches } from './IfOverflowMatches';\nimport { findAllByType } from './ReactUtils';\nimport { isNumber } from './DataUtils';\nexport var detectReferenceElementsDomain = function detectReferenceElementsDomain(children, domain, axisId, axisType, specifiedTicks) {\n var lines = findAllByType(children, ReferenceLine.displayName);\n var dots = findAllByType(children, ReferenceDot.displayName);\n var elements = lines.concat(dots);\n var areas = findAllByType(children, ReferenceArea.displayName);\n var idKey = \"\".concat(axisType, \"Id\");\n var valueKey = axisType[0];\n var finalDomain = domain;\n\n if (elements.length) {\n finalDomain = elements.reduce(function (result, el) {\n if (el.props[idKey] === axisId && ifOverflowMatches(el.props, 'extendDomain') && isNumber(el.props[valueKey])) {\n var value = el.props[valueKey];\n return [Math.min(result[0], value), Math.max(result[1], value)];\n }\n\n return result;\n }, finalDomain);\n }\n\n if (areas.length) {\n var key1 = \"\".concat(valueKey, \"1\");\n var key2 = \"\".concat(valueKey, \"2\");\n finalDomain = areas.reduce(function (result, el) {\n if (el.props[idKey] === axisId && ifOverflowMatches(el.props, 'extendDomain') && isNumber(el.props[key1]) && isNumber(el.props[key2])) {\n var value1 = el.props[key1];\n var value2 = el.props[key2];\n return [Math.min(result[0], value1, value2), Math.max(result[1], value1, value2)];\n }\n\n return result;\n }, finalDomain);\n }\n\n if (specifiedTicks && specifiedTicks.length) {\n finalDomain = specifiedTicks.reduce(function (result, tick) {\n if (isNumber(tick)) {\n return [Math.min(result[0], tick), Math.max(result[1], tick)];\n }\n\n return result;\n }, finalDomain);\n }\n\n return finalDomain;\n};","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nvar PREFIX_LIST = ['Webkit', 'Moz', 'O', 'ms'];\nexport var generatePrefixStyle = function generatePrefixStyle(name, value) {\n if (!name) {\n return null;\n }\n\n var camelName = name.replace(/(\\w)/, function (v) {\n return v.toUpperCase();\n });\n var result = PREFIX_LIST.reduce(function (res, entry) {\n return _objectSpread(_objectSpread({}, res), {}, _defineProperty({}, entry + camelName, value));\n }, {});\n result[name] = value;\n return result;\n};","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nimport _isFunction from \"lodash/isFunction\";\nimport _range from \"lodash/range\";\n\nfunction _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nfunction _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _isNativeReflectConstruct() { if (typeof Reflect === \"undefined\" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === \"function\") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\n/**\n * @fileOverview Brush\n */\nimport React, { PureComponent, Children } from 'react';\nimport classNames from 'classnames';\nimport { scalePoint } from 'd3-scale';\nimport { Layer } from '../container/Layer';\nimport { Text } from '../component/Text';\nimport { getValueByDataKey } from '../util/ChartUtils';\nimport { isNumber } from '../util/DataUtils';\nimport { generatePrefixStyle } from '../util/CssPrefixUtils';\nimport { filterProps } from '../util/types';\n\nvar createScale = function createScale(_ref) {\n var data = _ref.data,\n startIndex = _ref.startIndex,\n endIndex = _ref.endIndex,\n x = _ref.x,\n width = _ref.width,\n travellerWidth = _ref.travellerWidth;\n\n if (!data || !data.length) {\n return {};\n }\n\n var len = data.length;\n var scale = scalePoint().domain(_range(0, len)).range([x, x + width - travellerWidth]);\n var scaleValues = scale.domain().map(function (entry) {\n return scale(entry);\n });\n return {\n isTextActive: false,\n isSlideMoving: false,\n isTravellerMoving: false,\n startX: scale(startIndex),\n endX: scale(endIndex),\n scale: scale,\n scaleValues: scaleValues\n };\n};\n\nvar isTouch = function isTouch(e) {\n return e.changedTouches && !!e.changedTouches.length;\n};\n\nexport var Brush = /*#__PURE__*/function (_PureComponent) {\n _inherits(Brush, _PureComponent);\n\n var _super = _createSuper(Brush);\n\n function Brush(props) {\n var _this;\n\n _classCallCheck(this, Brush);\n\n _this = _super.call(this, props);\n _this.leaveTimer = void 0;\n _this.travellerDragStartHandlers = void 0;\n\n _this.handleDrag = function (e) {\n if (_this.leaveTimer) {\n clearTimeout(_this.leaveTimer);\n _this.leaveTimer = null;\n }\n\n if (_this.state.isTravellerMoving) {\n _this.handleTravellerMove(e);\n } else if (_this.state.isSlideMoving) {\n _this.handleSlideDrag(e);\n }\n };\n\n _this.handleTouchMove = function (e) {\n if (e.changedTouches != null && e.changedTouches.length > 0) {\n _this.handleDrag(e.changedTouches[0]);\n }\n };\n\n _this.handleDragEnd = function () {\n _this.setState({\n isTravellerMoving: false,\n isSlideMoving: false\n });\n\n _this.detachDragEndListener();\n };\n\n _this.handleLeaveWrapper = function () {\n if (_this.state.isTravellerMoving || _this.state.isSlideMoving) {\n _this.leaveTimer = window.setTimeout(_this.handleDragEnd, _this.props.leaveTimeOut);\n }\n };\n\n _this.handleEnterSlideOrTraveller = function () {\n _this.setState({\n isTextActive: true\n });\n };\n\n _this.handleLeaveSlideOrTraveller = function () {\n _this.setState({\n isTextActive: false\n });\n };\n\n _this.handleSlideDragStart = function (e) {\n var event = isTouch(e) ? e.changedTouches[0] : e;\n\n _this.setState({\n isTravellerMoving: false,\n isSlideMoving: true,\n slideMoveStartX: event.pageX\n });\n\n _this.attachDragEndListener();\n };\n\n _this.travellerDragStartHandlers = {\n startX: _this.handleTravellerDragStart.bind(_assertThisInitialized(_this), 'startX'),\n endX: _this.handleTravellerDragStart.bind(_assertThisInitialized(_this), 'endX')\n };\n _this.state = {};\n return _this;\n }\n\n _createClass(Brush, [{\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n if (this.leaveTimer) {\n clearTimeout(this.leaveTimer);\n this.leaveTimer = null;\n }\n\n this.detachDragEndListener();\n }\n }, {\n key: \"getIndex\",\n value: function getIndex(_ref2) {\n var startX = _ref2.startX,\n endX = _ref2.endX;\n var scaleValues = this.state.scaleValues;\n var _this$props = this.props,\n gap = _this$props.gap,\n data = _this$props.data;\n var lastIndex = data.length - 1;\n var min = Math.min(startX, endX);\n var max = Math.max(startX, endX);\n var minIndex = Brush.getIndexInRange(scaleValues, min);\n var maxIndex = Brush.getIndexInRange(scaleValues, max);\n return {\n startIndex: minIndex - minIndex % gap,\n endIndex: maxIndex === lastIndex ? lastIndex : maxIndex - maxIndex % gap\n };\n }\n }, {\n key: \"getTextOfTick\",\n value: function getTextOfTick(index) {\n var _this$props2 = this.props,\n data = _this$props2.data,\n tickFormatter = _this$props2.tickFormatter,\n dataKey = _this$props2.dataKey;\n var text = getValueByDataKey(data[index], dataKey, index);\n return _isFunction(tickFormatter) ? tickFormatter(text, index) : text;\n }\n }, {\n key: \"attachDragEndListener\",\n value: function attachDragEndListener() {\n window.addEventListener('mouseup', this.handleDragEnd, true);\n window.addEventListener('touchend', this.handleDragEnd, true);\n }\n }, {\n key: \"detachDragEndListener\",\n value: function detachDragEndListener() {\n window.removeEventListener('mouseup', this.handleDragEnd, true);\n window.removeEventListener('touchend', this.handleDragEnd, true);\n }\n }, {\n key: \"handleSlideDrag\",\n value: function handleSlideDrag(e) {\n var _this$state = this.state,\n slideMoveStartX = _this$state.slideMoveStartX,\n startX = _this$state.startX,\n endX = _this$state.endX;\n var _this$props3 = this.props,\n x = _this$props3.x,\n width = _this$props3.width,\n travellerWidth = _this$props3.travellerWidth,\n startIndex = _this$props3.startIndex,\n endIndex = _this$props3.endIndex,\n onChange = _this$props3.onChange;\n var delta = e.pageX - slideMoveStartX;\n\n if (delta > 0) {\n delta = Math.min(delta, x + width - travellerWidth - endX, x + width - travellerWidth - startX);\n } else if (delta < 0) {\n delta = Math.max(delta, x - startX, x - endX);\n }\n\n var newIndex = this.getIndex({\n startX: startX + delta,\n endX: endX + delta\n });\n\n if ((newIndex.startIndex !== startIndex || newIndex.endIndex !== endIndex) && onChange) {\n onChange(newIndex);\n }\n\n this.setState({\n startX: startX + delta,\n endX: endX + delta,\n slideMoveStartX: e.pageX\n });\n }\n }, {\n key: \"handleTravellerDragStart\",\n value: function handleTravellerDragStart(id, e) {\n var event = isTouch(e) ? e.changedTouches[0] : e;\n this.setState({\n isSlideMoving: false,\n isTravellerMoving: true,\n movingTravellerId: id,\n brushMoveStartX: event.pageX\n });\n this.attachDragEndListener();\n }\n }, {\n key: \"handleTravellerMove\",\n value: function handleTravellerMove(e) {\n var _this$setState;\n\n var _this$state2 = this.state,\n brushMoveStartX = _this$state2.brushMoveStartX,\n movingTravellerId = _this$state2.movingTravellerId,\n endX = _this$state2.endX,\n startX = _this$state2.startX;\n var prevValue = this.state[movingTravellerId];\n var _this$props4 = this.props,\n x = _this$props4.x,\n width = _this$props4.width,\n travellerWidth = _this$props4.travellerWidth,\n onChange = _this$props4.onChange,\n gap = _this$props4.gap,\n data = _this$props4.data;\n var params = {\n startX: this.state.startX,\n endX: this.state.endX\n };\n var delta = e.pageX - brushMoveStartX;\n\n if (delta > 0) {\n delta = Math.min(delta, x + width - travellerWidth - prevValue);\n } else if (delta < 0) {\n delta = Math.max(delta, x - prevValue);\n }\n\n params[movingTravellerId] = prevValue + delta;\n var newIndex = this.getIndex(params);\n var startIndex = newIndex.startIndex,\n endIndex = newIndex.endIndex;\n\n var isFullGap = function isFullGap() {\n var lastIndex = data.length - 1;\n\n if (movingTravellerId === 'startX' && (endX > startX ? startIndex % gap === 0 : endIndex % gap === 0) || endX < startX && endIndex === lastIndex || movingTravellerId === 'endX' && (endX > startX ? endIndex % gap === 0 : startIndex % gap === 0) || endX > startX && endIndex === lastIndex) {\n return true;\n }\n\n return false;\n };\n\n this.setState((_this$setState = {}, _defineProperty(_this$setState, movingTravellerId, prevValue + delta), _defineProperty(_this$setState, \"brushMoveStartX\", e.pageX), _this$setState), function () {\n if (onChange) {\n if (isFullGap()) {\n onChange(newIndex);\n }\n }\n });\n }\n }, {\n key: \"renderBackground\",\n value: function renderBackground() {\n var _this$props5 = this.props,\n x = _this$props5.x,\n y = _this$props5.y,\n width = _this$props5.width,\n height = _this$props5.height,\n fill = _this$props5.fill,\n stroke = _this$props5.stroke;\n return /*#__PURE__*/React.createElement(\"rect\", {\n stroke: stroke,\n fill: fill,\n x: x,\n y: y,\n width: width,\n height: height\n });\n }\n }, {\n key: \"renderPanorama\",\n value: function renderPanorama() {\n var _this$props6 = this.props,\n x = _this$props6.x,\n y = _this$props6.y,\n width = _this$props6.width,\n height = _this$props6.height,\n data = _this$props6.data,\n children = _this$props6.children,\n padding = _this$props6.padding;\n var chartElement = Children.only(children);\n\n if (!chartElement) {\n return null;\n }\n\n return /*#__PURE__*/React.cloneElement(chartElement, {\n x: x,\n y: y,\n width: width,\n height: height,\n margin: padding,\n compact: true,\n data: data\n });\n }\n }, {\n key: \"renderTravellerLayer\",\n value: function renderTravellerLayer(travellerX, id) {\n var _this$props7 = this.props,\n y = _this$props7.y,\n travellerWidth = _this$props7.travellerWidth,\n height = _this$props7.height,\n traveller = _this$props7.traveller;\n var x = Math.max(travellerX, this.props.x);\n\n var travellerProps = _objectSpread(_objectSpread({}, filterProps(this.props)), {}, {\n x: x,\n y: y,\n width: travellerWidth,\n height: height\n });\n\n return /*#__PURE__*/React.createElement(Layer, {\n className: \"recharts-brush-traveller\",\n onMouseEnter: this.handleEnterSlideOrTraveller,\n onMouseLeave: this.handleLeaveSlideOrTraveller,\n onMouseDown: this.travellerDragStartHandlers[id],\n onTouchStart: this.travellerDragStartHandlers[id],\n style: {\n cursor: 'col-resize'\n }\n }, Brush.renderTraveller(traveller, travellerProps));\n }\n }, {\n key: \"renderSlide\",\n value: function renderSlide(startX, endX) {\n var _this$props8 = this.props,\n y = _this$props8.y,\n height = _this$props8.height,\n stroke = _this$props8.stroke,\n travellerWidth = _this$props8.travellerWidth;\n var x = Math.min(startX, endX) + travellerWidth;\n var width = Math.max(Math.abs(endX - startX) - travellerWidth, 0);\n return /*#__PURE__*/React.createElement(\"rect\", {\n className: \"recharts-brush-slide\",\n onMouseEnter: this.handleEnterSlideOrTraveller,\n onMouseLeave: this.handleLeaveSlideOrTraveller,\n onMouseDown: this.handleSlideDragStart,\n onTouchStart: this.handleSlideDragStart,\n style: {\n cursor: 'move'\n },\n stroke: \"none\",\n fill: stroke,\n fillOpacity: 0.2,\n x: x,\n y: y,\n width: width,\n height: height\n });\n }\n }, {\n key: \"renderText\",\n value: function renderText() {\n var _this$props9 = this.props,\n startIndex = _this$props9.startIndex,\n endIndex = _this$props9.endIndex,\n y = _this$props9.y,\n height = _this$props9.height,\n travellerWidth = _this$props9.travellerWidth,\n stroke = _this$props9.stroke;\n var _this$state3 = this.state,\n startX = _this$state3.startX,\n endX = _this$state3.endX;\n var offset = 5;\n var attrs = {\n pointerEvents: 'none',\n fill: stroke\n };\n return /*#__PURE__*/React.createElement(Layer, {\n className: \"recharts-brush-texts\"\n }, /*#__PURE__*/React.createElement(Text, _extends({\n textAnchor: \"end\",\n verticalAnchor: \"middle\",\n x: Math.min(startX, endX) - offset,\n y: y + height / 2\n }, attrs), this.getTextOfTick(startIndex)), /*#__PURE__*/React.createElement(Text, _extends({\n textAnchor: \"start\",\n verticalAnchor: \"middle\",\n x: Math.max(startX, endX) + travellerWidth + offset,\n y: y + height / 2\n }, attrs), this.getTextOfTick(endIndex)));\n }\n }, {\n key: \"render\",\n value: function render() {\n var _this$props10 = this.props,\n data = _this$props10.data,\n className = _this$props10.className,\n children = _this$props10.children,\n x = _this$props10.x,\n y = _this$props10.y,\n width = _this$props10.width,\n height = _this$props10.height,\n alwaysShowText = _this$props10.alwaysShowText;\n var _this$state4 = this.state,\n startX = _this$state4.startX,\n endX = _this$state4.endX,\n isTextActive = _this$state4.isTextActive,\n isSlideMoving = _this$state4.isSlideMoving,\n isTravellerMoving = _this$state4.isTravellerMoving;\n\n if (!data || !data.length || !isNumber(x) || !isNumber(y) || !isNumber(width) || !isNumber(height) || width <= 0 || height <= 0) {\n return null;\n }\n\n var layerClass = classNames('recharts-brush', className);\n var isPanoramic = React.Children.count(children) === 1;\n var style = generatePrefixStyle('userSelect', 'none');\n return /*#__PURE__*/React.createElement(Layer, {\n className: layerClass,\n onMouseMove: this.handleDrag,\n onMouseLeave: this.handleLeaveWrapper,\n onTouchMove: this.handleTouchMove,\n style: style\n }, this.renderBackground(), isPanoramic && this.renderPanorama(), this.renderSlide(startX, endX), this.renderTravellerLayer(startX, 'startX'), this.renderTravellerLayer(endX, 'endX'), (isTextActive || isSlideMoving || isTravellerMoving || alwaysShowText) && this.renderText());\n }\n }], [{\n key: \"renderDefaultTraveller\",\n value: function renderDefaultTraveller(props) {\n var x = props.x,\n y = props.y,\n width = props.width,\n height = props.height,\n stroke = props.stroke;\n var lineY = Math.floor(y + height / 2) - 1;\n return /*#__PURE__*/React.createElement(React.Fragment, null, /*#__PURE__*/React.createElement(\"rect\", {\n x: x,\n y: y,\n width: width,\n height: height,\n fill: stroke,\n stroke: \"none\"\n }), /*#__PURE__*/React.createElement(\"line\", {\n x1: x + 1,\n y1: lineY,\n x2: x + width - 1,\n y2: lineY,\n fill: \"none\",\n stroke: \"#fff\"\n }), /*#__PURE__*/React.createElement(\"line\", {\n x1: x + 1,\n y1: lineY + 2,\n x2: x + width - 1,\n y2: lineY + 2,\n fill: \"none\",\n stroke: \"#fff\"\n }));\n }\n }, {\n key: \"renderTraveller\",\n value: function renderTraveller(option, props) {\n var rectangle;\n\n if ( /*#__PURE__*/React.isValidElement(option)) {\n rectangle = /*#__PURE__*/React.cloneElement(option, props);\n } else if (_isFunction(option)) {\n rectangle = option(props);\n } else {\n rectangle = Brush.renderDefaultTraveller(props);\n }\n\n return rectangle;\n }\n }, {\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n var data = nextProps.data,\n width = nextProps.width,\n x = nextProps.x,\n travellerWidth = nextProps.travellerWidth,\n updateId = nextProps.updateId,\n startIndex = nextProps.startIndex,\n endIndex = nextProps.endIndex;\n\n if (data !== prevState.prevData || updateId !== prevState.prevUpdateId) {\n return _objectSpread({\n prevData: data,\n prevTravellerWidth: travellerWidth,\n prevUpdateId: updateId,\n prevX: x,\n prevWidth: width\n }, data && data.length ? createScale({\n data: data,\n width: width,\n x: x,\n travellerWidth: travellerWidth,\n startIndex: startIndex,\n endIndex: endIndex\n }) : {\n scale: null,\n scaleValues: null\n });\n }\n\n if (prevState.scale && (width !== prevState.prevWidth || x !== prevState.prevX || travellerWidth !== prevState.prevTravellerWidth)) {\n prevState.scale.range([x, x + width - travellerWidth]);\n var scaleValues = prevState.scale.domain().map(function (entry) {\n return prevState.scale(entry);\n });\n return {\n prevData: data,\n prevTravellerWidth: travellerWidth,\n prevUpdateId: updateId,\n prevX: x,\n prevWidth: width,\n startX: prevState.scale(nextProps.startIndex),\n endX: prevState.scale(nextProps.endIndex),\n scaleValues: scaleValues\n };\n }\n\n return null;\n }\n }, {\n key: \"getIndexInRange\",\n value: function getIndexInRange(range, x) {\n var len = range.length;\n var start = 0;\n var end = len - 1;\n\n while (end - start > 1) {\n var middle = Math.floor((start + end) / 2);\n\n if (range[middle] > x) {\n end = middle;\n } else {\n start = middle;\n }\n }\n\n return x >= range[end] ? end : start;\n }\n }]);\n\n return Brush;\n}(PureComponent);\nBrush.displayName = 'Brush';\nBrush.defaultProps = {\n height: 40,\n travellerWidth: 5,\n gap: 1,\n fill: '#fff',\n stroke: '#666',\n padding: {\n top: 1,\n right: 1,\n bottom: 1,\n left: 1\n },\n leaveTimeOut: 1000,\n alwaysShowText: false\n};","import * as React from 'react';\nimport PropTypes from 'prop-types';\nimport clsx from 'clsx';\nimport useEventCallback from '../utils/useEventCallback';\nvar useEnhancedEffect = typeof window === 'undefined' ? React.useEffect : React.useLayoutEffect;\n/**\n * @ignore - internal component.\n */\n\nfunction Ripple(props) {\n var classes = props.classes,\n _props$pulsate = props.pulsate,\n pulsate = _props$pulsate === void 0 ? false : _props$pulsate,\n rippleX = props.rippleX,\n rippleY = props.rippleY,\n rippleSize = props.rippleSize,\n inProp = props.in,\n _props$onExited = props.onExited,\n onExited = _props$onExited === void 0 ? function () {} : _props$onExited,\n timeout = props.timeout;\n\n var _React$useState = React.useState(false),\n leaving = _React$useState[0],\n setLeaving = _React$useState[1];\n\n var rippleClassName = clsx(classes.ripple, classes.rippleVisible, pulsate && classes.ripplePulsate);\n var rippleStyles = {\n width: rippleSize,\n height: rippleSize,\n top: -(rippleSize / 2) + rippleY,\n left: -(rippleSize / 2) + rippleX\n };\n var childClassName = clsx(classes.child, leaving && classes.childLeaving, pulsate && classes.childPulsate);\n var handleExited = useEventCallback(onExited); // Ripple is used for user feedback (e.g. click or press) so we want to apply styles with the highest priority\n\n useEnhancedEffect(function () {\n if (!inProp) {\n // react-transition-group#onExit\n setLeaving(true); // react-transition-group#onExited\n\n var timeoutId = setTimeout(handleExited, timeout);\n return function () {\n clearTimeout(timeoutId);\n };\n }\n\n return undefined;\n }, [handleExited, inProp, timeout]);\n return /*#__PURE__*/React.createElement(\"span\", {\n className: rippleClassName,\n style: rippleStyles\n }, /*#__PURE__*/React.createElement(\"span\", {\n className: childClassName\n }));\n}\n\nprocess.env.NODE_ENV !== \"production\" ? Ripple.propTypes = {\n /**\n * Override or extend the styles applied to the component.\n * See [CSS API](#css) below for more details.\n */\n classes: PropTypes.object.isRequired,\n\n /**\n * @ignore - injected from TransitionGroup\n */\n in: PropTypes.bool,\n\n /**\n * @ignore - injected from TransitionGroup\n */\n onExited: PropTypes.func,\n\n /**\n * If `true`, the ripple pulsates, typically indicating the keyboard focus state of an element.\n */\n pulsate: PropTypes.bool,\n\n /**\n * Diameter of the ripple.\n */\n rippleSize: PropTypes.number,\n\n /**\n * Horizontal position of the ripple center.\n */\n rippleX: PropTypes.number,\n\n /**\n * Vertical position of the ripple center.\n */\n rippleY: PropTypes.number,\n\n /**\n * exit delay\n */\n timeout: PropTypes.number.isRequired\n} : void 0;\nexport default Ripple;","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _toConsumableArray from \"@babel/runtime/helpers/esm/toConsumableArray\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport PropTypes from 'prop-types';\nimport { TransitionGroup } from 'react-transition-group';\nimport clsx from 'clsx';\nimport withStyles from '../styles/withStyles';\nimport Ripple from './Ripple';\nvar DURATION = 550;\nexport var DELAY_RIPPLE = 80;\nexport var styles = function styles(theme) {\n return {\n /* Styles applied to the root element. */\n root: {\n overflow: 'hidden',\n pointerEvents: 'none',\n position: 'absolute',\n zIndex: 0,\n top: 0,\n right: 0,\n bottom: 0,\n left: 0,\n borderRadius: 'inherit'\n },\n\n /* Styles applied to the internal `Ripple` components `ripple` class. */\n ripple: {\n opacity: 0,\n position: 'absolute'\n },\n\n /* Styles applied to the internal `Ripple` components `rippleVisible` class. */\n rippleVisible: {\n opacity: 0.3,\n transform: 'scale(1)',\n animation: \"$enter \".concat(DURATION, \"ms \").concat(theme.transitions.easing.easeInOut)\n },\n\n /* Styles applied to the internal `Ripple` components `ripplePulsate` class. */\n ripplePulsate: {\n animationDuration: \"\".concat(theme.transitions.duration.shorter, \"ms\")\n },\n\n /* Styles applied to the internal `Ripple` components `child` class. */\n child: {\n opacity: 1,\n display: 'block',\n width: '100%',\n height: '100%',\n borderRadius: '50%',\n backgroundColor: 'currentColor'\n },\n\n /* Styles applied to the internal `Ripple` components `childLeaving` class. */\n childLeaving: {\n opacity: 0,\n animation: \"$exit \".concat(DURATION, \"ms \").concat(theme.transitions.easing.easeInOut)\n },\n\n /* Styles applied to the internal `Ripple` components `childPulsate` class. */\n childPulsate: {\n position: 'absolute',\n left: 0,\n top: 0,\n animation: \"$pulsate 2500ms \".concat(theme.transitions.easing.easeInOut, \" 200ms infinite\")\n },\n '@keyframes enter': {\n '0%': {\n transform: 'scale(0)',\n opacity: 0.1\n },\n '100%': {\n transform: 'scale(1)',\n opacity: 0.3\n }\n },\n '@keyframes exit': {\n '0%': {\n opacity: 1\n },\n '100%': {\n opacity: 0\n }\n },\n '@keyframes pulsate': {\n '0%': {\n transform: 'scale(1)'\n },\n '50%': {\n transform: 'scale(0.92)'\n },\n '100%': {\n transform: 'scale(1)'\n }\n }\n };\n};\n/**\n * @ignore - internal component.\n *\n * TODO v5: Make private\n */\n\nvar TouchRipple = /*#__PURE__*/React.forwardRef(function TouchRipple(props, ref) {\n var _props$center = props.center,\n centerProp = _props$center === void 0 ? false : _props$center,\n classes = props.classes,\n className = props.className,\n other = _objectWithoutProperties(props, [\"center\", \"classes\", \"className\"]);\n\n var _React$useState = React.useState([]),\n ripples = _React$useState[0],\n setRipples = _React$useState[1];\n\n var nextKey = React.useRef(0);\n var rippleCallback = React.useRef(null);\n React.useEffect(function () {\n if (rippleCallback.current) {\n rippleCallback.current();\n rippleCallback.current = null;\n }\n }, [ripples]); // Used to filter out mouse emulated events on mobile.\n\n var ignoringMouseDown = React.useRef(false); // We use a timer in order to only show the ripples for touch \"click\" like events.\n // We don't want to display the ripple for touch scroll events.\n\n var startTimer = React.useRef(null); // This is the hook called once the previous timeout is ready.\n\n var startTimerCommit = React.useRef(null);\n var container = React.useRef(null);\n React.useEffect(function () {\n return function () {\n clearTimeout(startTimer.current);\n };\n }, []);\n var startCommit = React.useCallback(function (params) {\n var pulsate = params.pulsate,\n rippleX = params.rippleX,\n rippleY = params.rippleY,\n rippleSize = params.rippleSize,\n cb = params.cb;\n setRipples(function (oldRipples) {\n return [].concat(_toConsumableArray(oldRipples), [/*#__PURE__*/React.createElement(Ripple, {\n key: nextKey.current,\n classes: classes,\n timeout: DURATION,\n pulsate: pulsate,\n rippleX: rippleX,\n rippleY: rippleY,\n rippleSize: rippleSize\n })]);\n });\n nextKey.current += 1;\n rippleCallback.current = cb;\n }, [classes]);\n var start = React.useCallback(function () {\n var event = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var cb = arguments.length > 2 ? arguments[2] : undefined;\n var _options$pulsate = options.pulsate,\n pulsate = _options$pulsate === void 0 ? false : _options$pulsate,\n _options$center = options.center,\n center = _options$center === void 0 ? centerProp || options.pulsate : _options$center,\n _options$fakeElement = options.fakeElement,\n fakeElement = _options$fakeElement === void 0 ? false : _options$fakeElement;\n\n if (event.type === 'mousedown' && ignoringMouseDown.current) {\n ignoringMouseDown.current = false;\n return;\n }\n\n if (event.type === 'touchstart') {\n ignoringMouseDown.current = true;\n }\n\n var element = fakeElement ? null : container.current;\n var rect = element ? element.getBoundingClientRect() : {\n width: 0,\n height: 0,\n left: 0,\n top: 0\n }; // Get the size of the ripple\n\n var rippleX;\n var rippleY;\n var rippleSize;\n\n if (center || event.clientX === 0 && event.clientY === 0 || !event.clientX && !event.touches) {\n rippleX = Math.round(rect.width / 2);\n rippleY = Math.round(rect.height / 2);\n } else {\n var _ref = event.touches ? event.touches[0] : event,\n clientX = _ref.clientX,\n clientY = _ref.clientY;\n\n rippleX = Math.round(clientX - rect.left);\n rippleY = Math.round(clientY - rect.top);\n }\n\n if (center) {\n rippleSize = Math.sqrt((2 * Math.pow(rect.width, 2) + Math.pow(rect.height, 2)) / 3); // For some reason the animation is broken on Mobile Chrome if the size if even.\n\n if (rippleSize % 2 === 0) {\n rippleSize += 1;\n }\n } else {\n var sizeX = Math.max(Math.abs((element ? element.clientWidth : 0) - rippleX), rippleX) * 2 + 2;\n var sizeY = Math.max(Math.abs((element ? element.clientHeight : 0) - rippleY), rippleY) * 2 + 2;\n rippleSize = Math.sqrt(Math.pow(sizeX, 2) + Math.pow(sizeY, 2));\n } // Touche devices\n\n\n if (event.touches) {\n // check that this isn't another touchstart due to multitouch\n // otherwise we will only clear a single timer when unmounting while two\n // are running\n if (startTimerCommit.current === null) {\n // Prepare the ripple effect.\n startTimerCommit.current = function () {\n startCommit({\n pulsate: pulsate,\n rippleX: rippleX,\n rippleY: rippleY,\n rippleSize: rippleSize,\n cb: cb\n });\n }; // Delay the execution of the ripple effect.\n\n\n startTimer.current = setTimeout(function () {\n if (startTimerCommit.current) {\n startTimerCommit.current();\n startTimerCommit.current = null;\n }\n }, DELAY_RIPPLE); // We have to make a tradeoff with this value.\n }\n } else {\n startCommit({\n pulsate: pulsate,\n rippleX: rippleX,\n rippleY: rippleY,\n rippleSize: rippleSize,\n cb: cb\n });\n }\n }, [centerProp, startCommit]);\n var pulsate = React.useCallback(function () {\n start({}, {\n pulsate: true\n });\n }, [start]);\n var stop = React.useCallback(function (event, cb) {\n clearTimeout(startTimer.current); // The touch interaction occurs too quickly.\n // We still want to show ripple effect.\n\n if (event.type === 'touchend' && startTimerCommit.current) {\n event.persist();\n startTimerCommit.current();\n startTimerCommit.current = null;\n startTimer.current = setTimeout(function () {\n stop(event, cb);\n });\n return;\n }\n\n startTimerCommit.current = null;\n setRipples(function (oldRipples) {\n if (oldRipples.length > 0) {\n return oldRipples.slice(1);\n }\n\n return oldRipples;\n });\n rippleCallback.current = cb;\n }, []);\n React.useImperativeHandle(ref, function () {\n return {\n pulsate: pulsate,\n start: start,\n stop: stop\n };\n }, [pulsate, start, stop]);\n return /*#__PURE__*/React.createElement(\"span\", _extends({\n className: clsx(classes.root, className),\n ref: container\n }, other), /*#__PURE__*/React.createElement(TransitionGroup, {\n component: null,\n exit: true\n }, ripples));\n});\nprocess.env.NODE_ENV !== \"production\" ? TouchRipple.propTypes = {\n /**\n * If `true`, the ripple starts at the center of the component\n * rather than at the point of interaction.\n */\n center: PropTypes.bool,\n\n /**\n * Override or extend the styles applied to the component.\n * See [CSS API](#css) below for more details.\n */\n classes: PropTypes.object.isRequired,\n\n /**\n * @ignore\n */\n className: PropTypes.string\n} : void 0;\nexport default withStyles(styles, {\n flip: false,\n name: 'MuiTouchRipple'\n})( /*#__PURE__*/React.memo(TouchRipple));","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport PropTypes from 'prop-types';\nimport * as ReactDOM from 'react-dom';\nimport clsx from 'clsx';\nimport { elementTypeAcceptingRef, refType } from '@material-ui/utils';\nimport useForkRef from '../utils/useForkRef';\nimport useEventCallback from '../utils/useEventCallback';\nimport withStyles from '../styles/withStyles';\nimport useIsFocusVisible from '../utils/useIsFocusVisible';\nimport TouchRipple from './TouchRipple';\nexport var styles = {\n /* Styles applied to the root element. */\n root: {\n display: 'inline-flex',\n alignItems: 'center',\n justifyContent: 'center',\n position: 'relative',\n WebkitTapHighlightColor: 'transparent',\n backgroundColor: 'transparent',\n // Reset default value\n // We disable the focus ring for mouse, touch and keyboard users.\n outline: 0,\n border: 0,\n margin: 0,\n // Remove the margin in Safari\n borderRadius: 0,\n padding: 0,\n // Remove the padding in Firefox\n cursor: 'pointer',\n userSelect: 'none',\n verticalAlign: 'middle',\n '-moz-appearance': 'none',\n // Reset\n '-webkit-appearance': 'none',\n // Reset\n textDecoration: 'none',\n // So we take precedent over the style of a native element.\n color: 'inherit',\n '&::-moz-focus-inner': {\n borderStyle: 'none' // Remove Firefox dotted outline.\n\n },\n '&$disabled': {\n pointerEvents: 'none',\n // Disable link interactions\n cursor: 'default'\n },\n '@media print': {\n colorAdjust: 'exact'\n }\n },\n\n /* Pseudo-class applied to the root element if `disabled={true}`. */\n disabled: {},\n\n /* Pseudo-class applied to the root element if keyboard focused. */\n focusVisible: {}\n};\n/**\n * `ButtonBase` contains as few styles as possible.\n * It aims to be a simple building block for creating a button.\n * It contains a load of style reset and some focus/ripple logic.\n */\n\nvar ButtonBase = /*#__PURE__*/React.forwardRef(function ButtonBase(props, ref) {\n var action = props.action,\n buttonRefProp = props.buttonRef,\n _props$centerRipple = props.centerRipple,\n centerRipple = _props$centerRipple === void 0 ? false : _props$centerRipple,\n children = props.children,\n classes = props.classes,\n className = props.className,\n _props$component = props.component,\n component = _props$component === void 0 ? 'button' : _props$component,\n _props$disabled = props.disabled,\n disabled = _props$disabled === void 0 ? false : _props$disabled,\n _props$disableRipple = props.disableRipple,\n disableRipple = _props$disableRipple === void 0 ? false : _props$disableRipple,\n _props$disableTouchRi = props.disableTouchRipple,\n disableTouchRipple = _props$disableTouchRi === void 0 ? false : _props$disableTouchRi,\n _props$focusRipple = props.focusRipple,\n focusRipple = _props$focusRipple === void 0 ? false : _props$focusRipple,\n focusVisibleClassName = props.focusVisibleClassName,\n onBlur = props.onBlur,\n onClick = props.onClick,\n onFocus = props.onFocus,\n onFocusVisible = props.onFocusVisible,\n onKeyDown = props.onKeyDown,\n onKeyUp = props.onKeyUp,\n onMouseDown = props.onMouseDown,\n onMouseLeave = props.onMouseLeave,\n onMouseUp = props.onMouseUp,\n onTouchEnd = props.onTouchEnd,\n onTouchMove = props.onTouchMove,\n onTouchStart = props.onTouchStart,\n onDragLeave = props.onDragLeave,\n _props$tabIndex = props.tabIndex,\n tabIndex = _props$tabIndex === void 0 ? 0 : _props$tabIndex,\n TouchRippleProps = props.TouchRippleProps,\n _props$type = props.type,\n type = _props$type === void 0 ? 'button' : _props$type,\n other = _objectWithoutProperties(props, [\"action\", \"buttonRef\", \"centerRipple\", \"children\", \"classes\", \"className\", \"component\", \"disabled\", \"disableRipple\", \"disableTouchRipple\", \"focusRipple\", \"focusVisibleClassName\", \"onBlur\", \"onClick\", \"onFocus\", \"onFocusVisible\", \"onKeyDown\", \"onKeyUp\", \"onMouseDown\", \"onMouseLeave\", \"onMouseUp\", \"onTouchEnd\", \"onTouchMove\", \"onTouchStart\", \"onDragLeave\", \"tabIndex\", \"TouchRippleProps\", \"type\"]);\n\n var buttonRef = React.useRef(null);\n\n function getButtonNode() {\n // #StrictMode ready\n return ReactDOM.findDOMNode(buttonRef.current);\n }\n\n var rippleRef = React.useRef(null);\n\n var _React$useState = React.useState(false),\n focusVisible = _React$useState[0],\n setFocusVisible = _React$useState[1];\n\n if (disabled && focusVisible) {\n setFocusVisible(false);\n }\n\n var _useIsFocusVisible = useIsFocusVisible(),\n isFocusVisible = _useIsFocusVisible.isFocusVisible,\n onBlurVisible = _useIsFocusVisible.onBlurVisible,\n focusVisibleRef = _useIsFocusVisible.ref;\n\n React.useImperativeHandle(action, function () {\n return {\n focusVisible: function focusVisible() {\n setFocusVisible(true);\n buttonRef.current.focus();\n }\n };\n }, []);\n React.useEffect(function () {\n if (focusVisible && focusRipple && !disableRipple) {\n rippleRef.current.pulsate();\n }\n }, [disableRipple, focusRipple, focusVisible]);\n\n function useRippleHandler(rippleAction, eventCallback) {\n var skipRippleAction = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : disableTouchRipple;\n return useEventCallback(function (event) {\n if (eventCallback) {\n eventCallback(event);\n }\n\n var ignore = skipRippleAction;\n\n if (!ignore && rippleRef.current) {\n rippleRef.current[rippleAction](event);\n }\n\n return true;\n });\n }\n\n var handleMouseDown = useRippleHandler('start', onMouseDown);\n var handleDragLeave = useRippleHandler('stop', onDragLeave);\n var handleMouseUp = useRippleHandler('stop', onMouseUp);\n var handleMouseLeave = useRippleHandler('stop', function (event) {\n if (focusVisible) {\n event.preventDefault();\n }\n\n if (onMouseLeave) {\n onMouseLeave(event);\n }\n });\n var handleTouchStart = useRippleHandler('start', onTouchStart);\n var handleTouchEnd = useRippleHandler('stop', onTouchEnd);\n var handleTouchMove = useRippleHandler('stop', onTouchMove);\n var handleBlur = useRippleHandler('stop', function (event) {\n if (focusVisible) {\n onBlurVisible(event);\n setFocusVisible(false);\n }\n\n if (onBlur) {\n onBlur(event);\n }\n }, false);\n var handleFocus = useEventCallback(function (event) {\n // Fix for https://github.com/facebook/react/issues/7769\n if (!buttonRef.current) {\n buttonRef.current = event.currentTarget;\n }\n\n if (isFocusVisible(event)) {\n setFocusVisible(true);\n\n if (onFocusVisible) {\n onFocusVisible(event);\n }\n }\n\n if (onFocus) {\n onFocus(event);\n }\n });\n\n var isNonNativeButton = function isNonNativeButton() {\n var button = getButtonNode();\n return component && component !== 'button' && !(button.tagName === 'A' && button.href);\n };\n /**\n * IE 11 shim for https://developer.mozilla.org/en-US/docs/Web/API/KeyboardEvent/repeat\n */\n\n\n var keydownRef = React.useRef(false);\n var handleKeyDown = useEventCallback(function (event) {\n // Check if key is already down to avoid repeats being counted as multiple activations\n if (focusRipple && !keydownRef.current && focusVisible && rippleRef.current && event.key === ' ') {\n keydownRef.current = true;\n event.persist();\n rippleRef.current.stop(event, function () {\n rippleRef.current.start(event);\n });\n }\n\n if (event.target === event.currentTarget && isNonNativeButton() && event.key === ' ') {\n event.preventDefault();\n }\n\n if (onKeyDown) {\n onKeyDown(event);\n } // Keyboard accessibility for non interactive elements\n\n\n if (event.target === event.currentTarget && isNonNativeButton() && event.key === 'Enter' && !disabled) {\n event.preventDefault();\n\n if (onClick) {\n onClick(event);\n }\n }\n });\n var handleKeyUp = useEventCallback(function (event) {\n // calling preventDefault in keyUp on a