Files
tendermint/node/node.go
Cyrus Goh 5182ffee25 docs: master → docs-staging (#5990)
* Makefile: always pull image in proto-gen-docker. (#5953)

The `proto-gen-docker` target didn't pull an updated Docker image, and would use a local image if present which could be outdated and produce wrong results.

* test: fix TestPEXReactorRunning data race (#5955)

Fixes #5941.

Not entirely sure that this will fix the problem (couldn't reproduce), but in any case this is an artifact of a hack in the P2P transport refactor to make it work with the legacy P2P stack, and will be removed when the refactor is done anyway.

* test/fuzz: move fuzz tests into this repo (#5918)

Co-authored-by: Emmanuel T Odeke <emmanuel@orijtech.com>

Closes #5907

- add init-corpus to blockchain reactor
- remove validator-set FromBytes test
now that we have proto, we don't need to test it! bye amino
- simplify mempool test
do we want to test remote ABCI app?
- do not recreate mux on every crash in jsonrpc test
- update p2p pex reactor test
- remove p2p/listener test
the API has changed + I did not understand what it's tested anyway
- update secretconnection test
- add readme and makefile
- list inputs in readme
- add nightly workflow
- remove blockchain fuzz test
EncodeMsg / DecodeMsg no longer exist

* docker: dont login when in PR (#5961)

* docker: release Linux/ARM64 image (#5925)

Co-authored-by: Marko <marbar3778@yahoo.com>

* p2p: make PeerManager.DialNext() and EvictNext() block (#5947)

See #5936 and #5938 for background.

The plan was initially to have `DialNext()` and `EvictNext()` return a channel. However, implementing this became unnecessarily complicated and error-prone. As an example, the channel would be both consumed and populated (via method calls) by the same driving method (e.g. `Router.dialPeers()`) which could easily cause deadlocks where a method call blocked while sending on the channel that the caller itself was responsible for consuming (but couldn't since it was busy making the method call). It would also require a set of goroutines in the peer manager that would interact with the goroutines in the router in non-obvious ways, and fully populating the channel on startup could cause deadlocks with other startup tasks. Several issues like these made the solution hard to reason about.

I therefore simply made `DialNext()` and `EvictNext()` block until the next peer was available, using internal triggers to wake these methods up in a non-blocking fashion when any relevant state changes occurred. This proved much simpler to reason about, since there are no goroutines in the peer manager (except for trivial retry timers), nor any blocking channel sends, and it instead relies entirely on the existing goroutine structure of the router for concurrency. This also happens to be the same pattern used by the `Transport.Accept()` API, following Go stdlib conventions, so all router goroutines end up using a consistent pattern as well.

* libs/log: format []byte as hexidecimal string (uppercased) (#5960)

Closes: #5806 

Co-authored-by: Lanie Hei <heixx011@umn.edu>

* docs: log level docs (#5945)

## Description

add section on configuring log levels

Closes: #XXX

* .github: fix fuzz-nightly job (#5965)

outputs is a property of the job, not an individual step.

* e2e: add control over the log level of nodes (#5958)

* mempool: fix reactor tests (#5967)

## Description

Update the faux router to either drop channel errors or handle them based on an argument. This prevents deadlocks in tests where we try to send an error on the mempool channel but there is no reader.

Closes: #5956

* p2p: improve peerStore prototype (#5954)

This improves the `peerStore` prototype by e.g.:

* Using a database with Protobuf for persistence, but also keeping full peer set in memory for performance.
* Simplifying the API, by taking/returning struct copies for safety, and removing errors for in-memory operations.
* Caching the ranked peer set, as a temporary solution until a better data structure is implemented.
* Adding `PeerManagerOptions.MaxPeers` and pruning the peer store (based on rank) when it's full.
* Rewriting `PeerAddress` to be independent of `url.URL`, normalizing it and tightening semantics.

* p2p: simplify PeerManager upgrade logic (#5962)

Follow-up from #5947, branched off of #5954.

This simplifies the upgrade logic by adding explicit eviction requests, which can also be useful for other use-cases (e.g. if we need to ban a peer that's misbehaving). Changes:

* Add `evict` map which queues up peers to explicitly evict.
* `upgrading` now only tracks peers that we're upgrading via dialing (`DialNext` → `Dialed`/`DialFailed`).
* `Dialed` will unmark `upgrading`, and queue `evict` if still beyond capacity.
* `Accepted` will pick a random lower-scored peer to upgrade to, if appropriate, and doesn't care about `upgrading` (the dial will fail later, since it's already connected).
* `EvictNext` will return a peer scheduled in `evict` if any, otherwise if beyond capacity just evict the lowest-scored peer.

This limits all of the `upgrading` logic to `DialNext`, `Dialed`, and `DialFailed`, making it much simplier, and it should generally do the right thing in all cases I can think of.

* p2p: add PeerManager.Advertise() (#5957)

Adds a naïve `PeerManager.Advertise()` method that the new PEX reactor can use to fetch addresses to advertise, as well as some other `FIXME`s on address advertisement.

* blockchain v0: fix waitgroup data race (#5970)

## Description

Fixes the data race in usage of `WaitGroup`. Specifically, the case where we invoke `Wait` _before_ the first delta `Add` call when the current waitgroup counter is zero. See https://golang.org/pkg/sync/#WaitGroup.Add.

Still not sure how this manifests itself in a test since the reactor has to be stopped virtually immediately after being started (I think?).

Regardless, this is the appropriate fix.

closes: #5968

* tests: fix `make test` (#5966)

## Description
 
- bump deadlock dep to master
  - fixes `make test` since we now use `deadlock.Once`

Closes: #XXX

* terminate go-fuzz gracefully (w/ SIGINT) (#5973)

and preserve exit code.

```
2021/01/26 03:34:49 workers: 2, corpus: 4 (8m28s ago), crashers: 0, restarts: 1/9976, execs: 11013732 (21596/sec), cover: 121, uptime: 8m30s
make: *** [fuzz-mempool] Terminated
Makefile:5: recipe for target 'fuzz-mempool' failed
Error: Process completed with exit code 124.
```

https://github.com/tendermint/tendermint/runs/1766661614

`continue-on-error` should make GH ignore any error codes.

* p2p: add prototype PEX reactor for new stack (#5971)

This adds a prototype PEX reactor for the new P2P stack.

* proto/p2p: rename PEX messages and fields (#5974)

Fixes #5899 by renaming a bunch of P2P Protobuf entities (while maintaining wire compatibility):

* `Message` to `PexMessage` (as it's only used for PEX messages).
* `PexAddrs` to `PexResponse`.
* `PexResponse.Addrs` to `PexResponse.Addresses`.
* `NetAddress` to `PexAddress` (as it's only used by PEX).

* p2p: resolve PEX addresses in PEX reactor (#5980)

This changes the new prototype PEX reactor to resolve peer address URLs into IP/port PEX addresses itself. Branched off of #5974.

I've spent some time thinking about address handling in the P2P stack. We currently use `PeerAddress` URLs everywhere, except for two places: when dialing a peer, and when exchanging addresses via PEX. We had two options:

1. Resolve addresses to endpoints inside `PeerManager`. This would introduce a lot of added complexity: we would have to track connection statistics per endpoint, have goroutines that asynchronously resolve and refresh these endpoints, deal with resolve scheduling before dialing (which is trickier than it sounds since it involves multiple goroutines in the peer manager and router and messes with peer rating order), handle IP address visibility issues, and so on.

2. Resolve addresses to endpoints (IP/port) only where they're used: when dialing, and in PEX. Everywhere else we use URLs.

I went with 2, because this significantly simplifies the handling of hostname resolution, and because I really think the PEX reactor should migrate to exchanging URLs instead of IP/port numbers anyway -- this allows operators to use DNS names for validators (and can easily migrate them to new IPs and/or load balance requests), and also allows different protocols (e.g. QUIC and `MemoryTransport`). Happy to discuss this.

* test/p2p: close transports to avoid goroutine leak failures (#5982)

* mempool: fix TestReactorNoBroadcastToSender (#5984)

## Description

Looks like I missed a test in the original PR when fixing the tests.

Closes: #5956

* mempool: fix mempool tests timeout (#5988)

* p2p: use stopCtx when dialing peers in Router (#5983)

This ensures we don't leak dial goroutines when shutting down the router.

* docs: fix typo in state sync example (#5989)

Co-authored-by: Erik Grinaker <erik@interchain.berlin>
Co-authored-by: Anton Kaliaev <anton.kalyaev@gmail.com>
Co-authored-by: Marko <marbar3778@yahoo.com>
Co-authored-by: odidev <odidev@puresoftware.com>
Co-authored-by: Lanie Hei <heixx011@umn.edu>
Co-authored-by: Callum Waters <cmwaters19@gmail.com>
Co-authored-by: Aleksandr Bezobchuk <alexanderbez@users.noreply.github.com>
Co-authored-by: Sergey <52304443+c29r3@users.noreply.github.com>
2021-01-26 11:46:21 -08:00

1528 lines
46 KiB
Go

package node
import (
"bytes"
"context"
"errors"
"fmt"
"net"
"net/http"
_ "net/http/pprof" // nolint: gosec // securely exposed on separate, optional port
"time"
"github.com/prometheus/client_golang/prometheus"
"github.com/prometheus/client_golang/prometheus/promhttp"
"github.com/rs/cors"
dbm "github.com/tendermint/tm-db"
abci "github.com/tendermint/tendermint/abci/types"
bcv0 "github.com/tendermint/tendermint/blockchain/v0"
bcv2 "github.com/tendermint/tendermint/blockchain/v2"
cfg "github.com/tendermint/tendermint/config"
cs "github.com/tendermint/tendermint/consensus"
"github.com/tendermint/tendermint/crypto"
"github.com/tendermint/tendermint/evidence"
tmjson "github.com/tendermint/tendermint/libs/json"
"github.com/tendermint/tendermint/libs/log"
tmnet "github.com/tendermint/tendermint/libs/net"
tmpubsub "github.com/tendermint/tendermint/libs/pubsub"
"github.com/tendermint/tendermint/libs/service"
"github.com/tendermint/tendermint/light"
mempl "github.com/tendermint/tendermint/mempool"
"github.com/tendermint/tendermint/p2p"
"github.com/tendermint/tendermint/p2p/pex"
"github.com/tendermint/tendermint/privval"
tmgrpc "github.com/tendermint/tendermint/privval/grpc"
"github.com/tendermint/tendermint/proxy"
rpccore "github.com/tendermint/tendermint/rpc/core"
grpccore "github.com/tendermint/tendermint/rpc/grpc"
rpcserver "github.com/tendermint/tendermint/rpc/jsonrpc/server"
sm "github.com/tendermint/tendermint/state"
"github.com/tendermint/tendermint/state/txindex"
"github.com/tendermint/tendermint/state/txindex/kv"
"github.com/tendermint/tendermint/state/txindex/null"
"github.com/tendermint/tendermint/statesync"
"github.com/tendermint/tendermint/store"
"github.com/tendermint/tendermint/types"
tmtime "github.com/tendermint/tendermint/types/time"
"github.com/tendermint/tendermint/version"
)
//------------------------------------------------------------------------------
// DBContext specifies config information for loading a new DB.
type DBContext struct {
ID string
Config *cfg.Config
}
// DBProvider takes a DBContext and returns an instantiated DB.
type DBProvider func(*DBContext) (dbm.DB, error)
// DefaultDBProvider returns a database using the DBBackend and DBDir
// specified in the ctx.Config.
func DefaultDBProvider(ctx *DBContext) (dbm.DB, error) {
dbType := dbm.BackendType(ctx.Config.DBBackend)
return dbm.NewDB(ctx.ID, dbType, ctx.Config.DBDir())
}
// GenesisDocProvider returns a GenesisDoc.
// It allows the GenesisDoc to be pulled from sources other than the
// filesystem, for instance from a distributed key-value store cluster.
type GenesisDocProvider func() (*types.GenesisDoc, error)
// DefaultGenesisDocProviderFunc returns a GenesisDocProvider that loads
// the GenesisDoc from the config.GenesisFile() on the filesystem.
func DefaultGenesisDocProviderFunc(config *cfg.Config) GenesisDocProvider {
return func() (*types.GenesisDoc, error) {
return types.GenesisDocFromFile(config.GenesisFile())
}
}
// Provider takes a config and a logger and returns a ready to go Node.
type Provider func(*cfg.Config, log.Logger) (*Node, error)
// DefaultNewNode returns a Tendermint node with default settings for the
// PrivValidator, ClientCreator, GenesisDoc, and DBProvider.
// It implements NodeProvider.
func DefaultNewNode(config *cfg.Config, logger log.Logger) (*Node, error) {
nodeKey, err := p2p.LoadOrGenNodeKey(config.NodeKeyFile())
if err != nil {
return nil, fmt.Errorf("failed to load or gen node key %s: %w", config.NodeKeyFile(), err)
}
pval, err := privval.LoadOrGenFilePV(config.PrivValidatorKeyFile(), config.PrivValidatorStateFile())
if err != nil {
return nil, err
}
return NewNode(config,
pval,
nodeKey,
proxy.DefaultClientCreator(config.ProxyApp, config.ABCI, config.DBDir()),
DefaultGenesisDocProviderFunc(config),
DefaultDBProvider,
DefaultMetricsProvider(config.Instrumentation),
logger,
)
}
// MetricsProvider returns a consensus, p2p and mempool Metrics.
type MetricsProvider func(chainID string) (*cs.Metrics, *p2p.Metrics, *mempl.Metrics, *sm.Metrics)
// DefaultMetricsProvider returns Metrics build using Prometheus client library
// if Prometheus is enabled. Otherwise, it returns no-op Metrics.
func DefaultMetricsProvider(config *cfg.InstrumentationConfig) MetricsProvider {
return func(chainID string) (*cs.Metrics, *p2p.Metrics, *mempl.Metrics, *sm.Metrics) {
if config.Prometheus {
return cs.PrometheusMetrics(config.Namespace, "chain_id", chainID),
p2p.PrometheusMetrics(config.Namespace, "chain_id", chainID),
mempl.PrometheusMetrics(config.Namespace, "chain_id", chainID),
sm.PrometheusMetrics(config.Namespace, "chain_id", chainID)
}
return cs.NopMetrics(), p2p.NopMetrics(), mempl.NopMetrics(), sm.NopMetrics()
}
}
// Option sets a parameter for the node.
type Option func(*Node)
// Temporary interface for switching to fast sync, we should get rid of v0.
// See: https://github.com/tendermint/tendermint/issues/4595
type fastSyncReactor interface {
SwitchToFastSync(sm.State) error
}
// CustomReactors allows you to add custom reactors (name -> p2p.Reactor) to
// the node's Switch.
//
// WARNING: using any name from the below list of the existing reactors will
// result in replacing it with the custom one.
//
// - MEMPOOL
// - BLOCKCHAIN
// - CONSENSUS
// - EVIDENCE
// - PEX
// - STATESYNC
func CustomReactors(reactors map[string]p2p.Reactor) Option {
return func(n *Node) {
for name, reactor := range reactors {
if existingReactor := n.sw.Reactor(name); existingReactor != nil {
n.sw.Logger.Info("Replacing existing reactor with a custom one",
"name", name, "existing", existingReactor, "custom", reactor)
n.sw.RemoveReactor(name, existingReactor)
}
n.sw.AddReactor(name, reactor)
}
}
}
// StateProvider overrides the state provider used by state sync to retrieve trusted app hashes and
// build a State object for bootstrapping the node.
// WARNING: this interface is considered unstable and subject to change.
func StateProvider(stateProvider statesync.StateProvider) Option {
return func(n *Node) {
n.stateSyncProvider = stateProvider
}
}
//------------------------------------------------------------------------------
// Node is the highest level interface to a full Tendermint node.
// It includes all configuration information and running services.
type Node struct {
service.BaseService
// config
config *cfg.Config
genesisDoc *types.GenesisDoc // initial validator set
privValidator types.PrivValidator // local node's validator key
// network
transport *p2p.MConnTransport
sw *p2p.Switch // p2p connections
addrBook pex.AddrBook // known peers
nodeInfo p2p.NodeInfo
nodeKey p2p.NodeKey // our node privkey
isListening bool
// services
eventBus *types.EventBus // pub/sub for services
stateStore sm.Store
blockStore *store.BlockStore // store the blockchain to disk
bcReactor service.Service // for fast-syncing
mempoolReactor *mempl.Reactor // for gossipping transactions
mempool mempl.Mempool
stateSync bool // whether the node should state sync on startup
stateSyncReactor *statesync.Reactor // for hosting and restoring state sync snapshots
stateSyncProvider statesync.StateProvider // provides state data for bootstrapping a node
stateSyncGenesis sm.State // provides the genesis state for state sync
consensusState *cs.State // latest consensus state
consensusReactor *cs.Reactor // for participating in the consensus
pexReactor *pex.Reactor // for exchanging peer addresses
evidenceReactor *evidence.Reactor
evidencePool *evidence.Pool // tracking evidence
proxyApp proxy.AppConns // connection to the application
rpcListeners []net.Listener // rpc servers
txIndexer txindex.TxIndexer
indexerService *txindex.IndexerService
prometheusSrv *http.Server
}
func initDBs(config *cfg.Config, dbProvider DBProvider) (blockStore *store.BlockStore, stateDB dbm.DB, err error) {
var blockStoreDB dbm.DB
blockStoreDB, err = dbProvider(&DBContext{"blockstore", config})
if err != nil {
return
}
blockStore = store.NewBlockStore(blockStoreDB)
stateDB, err = dbProvider(&DBContext{"state", config})
if err != nil {
return
}
return
}
func createAndStartProxyAppConns(clientCreator proxy.ClientCreator, logger log.Logger) (proxy.AppConns, error) {
proxyApp := proxy.NewAppConns(clientCreator)
proxyApp.SetLogger(logger.With("module", "proxy"))
if err := proxyApp.Start(); err != nil {
return nil, fmt.Errorf("error starting proxy app connections: %v", err)
}
return proxyApp, nil
}
func createAndStartEventBus(logger log.Logger) (*types.EventBus, error) {
eventBus := types.NewEventBus()
eventBus.SetLogger(logger.With("module", "events"))
if err := eventBus.Start(); err != nil {
return nil, err
}
return eventBus, nil
}
func createAndStartIndexerService(config *cfg.Config, dbProvider DBProvider,
eventBus *types.EventBus, logger log.Logger) (*txindex.IndexerService, txindex.TxIndexer, error) {
var txIndexer txindex.TxIndexer
switch config.TxIndex.Indexer {
case "kv":
store, err := dbProvider(&DBContext{"tx_index", config})
if err != nil {
return nil, nil, err
}
txIndexer = kv.NewTxIndex(store)
default:
txIndexer = &null.TxIndex{}
}
indexerService := txindex.NewIndexerService(txIndexer, eventBus)
indexerService.SetLogger(logger.With("module", "txindex"))
if err := indexerService.Start(); err != nil {
return nil, nil, err
}
return indexerService, txIndexer, nil
}
func doHandshake(
stateStore sm.Store,
state sm.State,
blockStore sm.BlockStore,
genDoc *types.GenesisDoc,
eventBus types.BlockEventPublisher,
proxyApp proxy.AppConns,
consensusLogger log.Logger) error {
handshaker := cs.NewHandshaker(stateStore, state, blockStore, genDoc)
handshaker.SetLogger(consensusLogger)
handshaker.SetEventBus(eventBus)
if err := handshaker.Handshake(proxyApp); err != nil {
return fmt.Errorf("error during handshake: %v", err)
}
return nil
}
func logNodeStartupInfo(state sm.State, pubKey crypto.PubKey, logger, consensusLogger log.Logger) {
// Log the version info.
logger.Info("Version info",
"software", version.TMCoreSemVer,
"block", version.BlockProtocol,
"p2p", version.P2PProtocol,
)
// If the state and software differ in block version, at least log it.
if state.Version.Consensus.Block != version.BlockProtocol {
logger.Info("Software and state have different block protocols",
"software", version.BlockProtocol,
"state", state.Version.Consensus.Block,
)
}
addr := pubKey.Address()
// Log whether this node is a validator or an observer
if state.Validators.HasAddress(addr) {
consensusLogger.Info("This node is a validator", "addr", addr, "pubKey", pubKey)
} else {
consensusLogger.Info("This node is not a validator", "addr", addr, "pubKey", pubKey)
}
}
func onlyValidatorIsUs(state sm.State, pubKey crypto.PubKey) bool {
if state.Validators.Size() > 1 {
return false
}
addr, _ := state.Validators.GetByIndex(0)
return bytes.Equal(pubKey.Address(), addr)
}
func createMempoolReactor(
config *cfg.Config,
proxyApp proxy.AppConns,
state sm.State,
memplMetrics *mempl.Metrics,
peerMgr *p2p.PeerManager,
logger log.Logger,
) (*p2p.ReactorShim, *mempl.Reactor, *mempl.CListMempool) {
logger = logger.With("module", "mempool")
mempool := mempl.NewCListMempool(
config.Mempool,
proxyApp.Mempool(),
state.LastBlockHeight,
mempl.WithMetrics(memplMetrics),
mempl.WithPreCheck(sm.TxPreCheck(state)),
mempl.WithPostCheck(sm.TxPostCheck(state)),
)
mempool.SetLogger(logger)
reactorShim := p2p.NewReactorShim(logger, "MempoolShim", mempl.GetChannelShims(config.Mempool))
reactor := mempl.NewReactor(
logger,
config.Mempool,
peerMgr,
mempool,
reactorShim.GetChannel(mempl.MempoolChannel),
reactorShim.PeerUpdates,
)
if config.Consensus.WaitForTxs() {
mempool.EnableTxsAvailable()
}
return reactorShim, reactor, mempool
}
func createEvidenceReactor(
config *cfg.Config,
dbProvider DBProvider,
stateDB dbm.DB,
blockStore *store.BlockStore,
logger log.Logger,
) (*p2p.ReactorShim, *evidence.Reactor, *evidence.Pool, error) {
evidenceDB, err := dbProvider(&DBContext{"evidence", config})
if err != nil {
return nil, nil, nil, err
}
logger = logger.With("module", "evidence")
evidencePool, err := evidence.NewPool(logger, evidenceDB, sm.NewStore(stateDB), blockStore)
if err != nil {
return nil, nil, nil, err
}
evidenceReactorShim := p2p.NewReactorShim(logger, "EvidenceShim", evidence.ChannelShims)
evidenceReactor := evidence.NewReactor(
logger,
evidenceReactorShim.GetChannel(evidence.EvidenceChannel),
evidenceReactorShim.PeerUpdates,
evidencePool,
)
return evidenceReactorShim, evidenceReactor, evidencePool, nil
}
func createBlockchainReactor(
logger log.Logger,
config *cfg.Config,
state sm.State,
blockExec *sm.BlockExecutor,
blockStore *store.BlockStore,
csReactor *cs.Reactor,
fastSync bool,
) (*p2p.ReactorShim, service.Service, error) {
logger = logger.With("module", "blockchain")
switch config.FastSync.Version {
case "v0":
reactorShim := p2p.NewReactorShim(logger, "BlockchainShim", bcv0.ChannelShims)
reactor, err := bcv0.NewReactor(
logger, state.Copy(), blockExec, blockStore, csReactor,
reactorShim.GetChannel(bcv0.BlockchainChannel), reactorShim.PeerUpdates, fastSync,
)
if err != nil {
return nil, nil, err
}
return reactorShim, reactor, nil
case "v2":
reactor := bcv2.NewBlockchainReactor(state.Copy(), blockExec, blockStore, fastSync)
reactor.SetLogger(logger)
return nil, reactor, nil
default:
return nil, nil, fmt.Errorf("unknown fastsync version %s", config.FastSync.Version)
}
}
func createConsensusReactor(config *cfg.Config,
state sm.State,
blockExec *sm.BlockExecutor,
blockStore sm.BlockStore,
mempool *mempl.CListMempool,
evidencePool *evidence.Pool,
privValidator types.PrivValidator,
csMetrics *cs.Metrics,
waitSync bool,
eventBus *types.EventBus,
consensusLogger log.Logger) (*cs.Reactor, *cs.State) {
consensusState := cs.NewState(
config.Consensus,
state.Copy(),
blockExec,
blockStore,
mempool,
evidencePool,
cs.StateMetrics(csMetrics),
)
consensusState.SetLogger(consensusLogger)
if privValidator != nil {
consensusState.SetPrivValidator(privValidator)
}
consensusReactor := cs.NewReactor(consensusState, waitSync, cs.ReactorMetrics(csMetrics))
consensusReactor.SetLogger(consensusLogger)
// services which will be publishing and/or subscribing for messages (events)
// consensusReactor will set it on consensusState and blockExecutor
consensusReactor.SetEventBus(eventBus)
return consensusReactor, consensusState
}
func createTransport(
logger log.Logger,
config *cfg.Config,
nodeInfo p2p.NodeInfo,
nodeKey p2p.NodeKey,
proxyApp proxy.AppConns,
) (
*p2p.MConnTransport,
[]p2p.PeerFilterFunc,
) {
var (
connFilters = []p2p.ConnFilterFunc{}
peerFilters = []p2p.PeerFilterFunc{}
)
if !config.P2P.AllowDuplicateIP {
connFilters = append(connFilters, p2p.ConnDuplicateIPFilter)
}
// Filter peers by addr or pubkey with an ABCI query.
// If the query return code is OK, add peer.
if config.FilterPeers {
connFilters = append(
connFilters,
// ABCI query for address filtering.
func(_ p2p.ConnSet, c net.Conn, _ []net.IP) error {
res, err := proxyApp.Query().QuerySync(context.Background(), abci.RequestQuery{
Path: fmt.Sprintf("/p2p/filter/addr/%s", c.RemoteAddr().String()),
})
if err != nil {
return err
}
if res.IsErr() {
return fmt.Errorf("error querying abci app: %v", res)
}
return nil
},
)
peerFilters = append(
peerFilters,
// ABCI query for ID filtering.
func(_ p2p.IPeerSet, p p2p.Peer) error {
res, err := proxyApp.Query().QuerySync(context.Background(), abci.RequestQuery{
Path: fmt.Sprintf("/p2p/filter/id/%s", p.ID()),
})
if err != nil {
return err
}
if res.IsErr() {
return fmt.Errorf("error querying abci app: %v", res)
}
return nil
},
)
}
transport := p2p.NewMConnTransport(
logger, nodeInfo, nodeKey.PrivKey, p2p.MConnConfig(config.P2P),
p2p.MConnTransportConnFilters(connFilters...),
p2p.MConnTransportMaxIncomingConnections(config.P2P.MaxNumInboundPeers+
len(splitAndTrimEmpty(config.P2P.UnconditionalPeerIDs, ",", " "))),
)
return transport, peerFilters
}
func createSwitch(config *cfg.Config,
transport p2p.Transport,
p2pMetrics *p2p.Metrics,
peerFilters []p2p.PeerFilterFunc,
mempoolReactor *p2p.ReactorShim,
bcReactor p2p.Reactor,
stateSyncReactor *p2p.ReactorShim,
consensusReactor *cs.Reactor,
evidenceReactor *p2p.ReactorShim,
nodeInfo p2p.NodeInfo,
nodeKey p2p.NodeKey,
p2pLogger log.Logger) *p2p.Switch {
sw := p2p.NewSwitch(
config.P2P,
transport,
p2p.WithMetrics(p2pMetrics),
p2p.SwitchPeerFilters(peerFilters...),
)
sw.SetLogger(p2pLogger)
sw.AddReactor("MEMPOOL", mempoolReactor)
sw.AddReactor("BLOCKCHAIN", bcReactor)
sw.AddReactor("CONSENSUS", consensusReactor)
sw.AddReactor("EVIDENCE", evidenceReactor)
sw.AddReactor("STATESYNC", stateSyncReactor)
sw.SetNodeInfo(nodeInfo)
sw.SetNodeKey(nodeKey)
p2pLogger.Info("P2P Node ID", "ID", nodeKey.ID, "file", config.NodeKeyFile())
return sw
}
func createAddrBookAndSetOnSwitch(config *cfg.Config, sw *p2p.Switch,
p2pLogger log.Logger, nodeKey p2p.NodeKey) (pex.AddrBook, error) {
addrBook := pex.NewAddrBook(config.P2P.AddrBookFile(), config.P2P.AddrBookStrict)
addrBook.SetLogger(p2pLogger.With("book", config.P2P.AddrBookFile()))
// Add ourselves to addrbook to prevent dialing ourselves
if config.P2P.ExternalAddress != "" {
addr, err := p2p.NewNetAddressString(p2p.IDAddressString(nodeKey.ID, config.P2P.ExternalAddress))
if err != nil {
return nil, fmt.Errorf("p2p.external_address is incorrect: %w", err)
}
addrBook.AddOurAddress(addr)
}
if config.P2P.ListenAddress != "" {
addr, err := p2p.NewNetAddressString(p2p.IDAddressString(nodeKey.ID, config.P2P.ListenAddress))
if err != nil {
return nil, fmt.Errorf("p2p.laddr is incorrect: %w", err)
}
addrBook.AddOurAddress(addr)
}
sw.SetAddrBook(addrBook)
return addrBook, nil
}
func createPEXReactorAndAddToSwitch(addrBook pex.AddrBook, config *cfg.Config,
sw *p2p.Switch, logger log.Logger) *pex.Reactor {
// TODO persistent peers ? so we can have their DNS addrs saved
pexReactor := pex.NewReactor(addrBook,
&pex.ReactorConfig{
Seeds: splitAndTrimEmpty(config.P2P.Seeds, ",", " "),
SeedMode: config.P2P.SeedMode,
// See consensus/reactor.go: blocksToContributeToBecomeGoodPeer 10000
// blocks assuming 10s blocks ~ 28 hours.
// TODO (melekes): make it dynamic based on the actual block latencies
// from the live network.
// https://github.com/tendermint/tendermint/issues/3523
SeedDisconnectWaitPeriod: 28 * time.Hour,
PersistentPeersMaxDialPeriod: config.P2P.PersistentPeersMaxDialPeriod,
})
pexReactor.SetLogger(logger.With("module", "pex"))
sw.AddReactor("PEX", pexReactor)
return pexReactor
}
// startStateSync starts an asynchronous state sync process, then switches to fast sync mode.
func startStateSync(ssR *statesync.Reactor, bcR fastSyncReactor, conR *cs.Reactor,
stateProvider statesync.StateProvider, config *cfg.StateSyncConfig, fastSync bool,
stateStore sm.Store, blockStore *store.BlockStore, state sm.State) error {
ssR.Logger.Info("Starting state sync")
if stateProvider == nil {
var err error
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
defer cancel()
stateProvider, err = statesync.NewLightClientStateProvider(
ctx,
state.ChainID, state.Version, state.InitialHeight,
config.RPCServers, light.TrustOptions{
Period: config.TrustPeriod,
Height: config.TrustHeight,
Hash: config.TrustHashBytes(),
}, ssR.Logger.With("module", "light"))
if err != nil {
return fmt.Errorf("failed to set up light client state provider: %w", err)
}
}
go func() {
state, commit, err := ssR.Sync(stateProvider, config.DiscoveryTime)
if err != nil {
ssR.Logger.Error("State sync failed", "err", err)
return
}
err = stateStore.Bootstrap(state)
if err != nil {
ssR.Logger.Error("Failed to bootstrap node with new state", "err", err)
return
}
err = blockStore.SaveSeenCommit(state.LastBlockHeight, commit)
if err != nil {
ssR.Logger.Error("Failed to store last seen commit", "err", err)
return
}
if fastSync {
// FIXME Very ugly to have these metrics bleed through here.
conR.Metrics.StateSyncing.Set(0)
conR.Metrics.FastSyncing.Set(1)
err = bcR.SwitchToFastSync(state)
if err != nil {
ssR.Logger.Error("Failed to switch to fast sync", "err", err)
return
}
} else {
conR.SwitchToConsensus(state, true)
}
}()
return nil
}
// NewNode returns a new, ready to go, Tendermint Node.
func NewNode(config *cfg.Config,
privValidator types.PrivValidator,
nodeKey p2p.NodeKey,
clientCreator proxy.ClientCreator,
genesisDocProvider GenesisDocProvider,
dbProvider DBProvider,
metricsProvider MetricsProvider,
logger log.Logger,
options ...Option) (*Node, error) {
blockStore, stateDB, err := initDBs(config, dbProvider)
if err != nil {
return nil, err
}
stateStore := sm.NewStore(stateDB)
state, genDoc, err := LoadStateFromDBOrGenesisDocProvider(stateDB, genesisDocProvider)
if err != nil {
return nil, err
}
// Create the proxyApp and establish connections to the ABCI app (consensus, mempool, query).
proxyApp, err := createAndStartProxyAppConns(clientCreator, logger)
if err != nil {
return nil, err
}
// EventBus and IndexerService must be started before the handshake because
// we might need to index the txs of the replayed block as this might not have happened
// when the node stopped last time (i.e. the node stopped after it saved the block
// but before it indexed the txs, or, endblocker panicked)
eventBus, err := createAndStartEventBus(logger)
if err != nil {
return nil, err
}
// Transaction indexing
indexerService, txIndexer, err := createAndStartIndexerService(config, dbProvider, eventBus, logger)
if err != nil {
return nil, err
}
// If an address is provided, listen on the socket for a connection from an
// external signing process.
if config.PrivValidatorListenAddr != "" {
protocol, _ := tmnet.ProtocolAndAddress(config.PrivValidatorListenAddr)
// FIXME: we should start services inside OnStart
switch protocol {
case "grpc":
privValidator, err = createAndStartPrivValidatorGRPCClient(config, genDoc.ChainID, logger)
if err != nil {
return nil, fmt.Errorf("error with private validator grpc client: %w", err)
}
default:
privValidator, err = createAndStartPrivValidatorSocketClient(config.PrivValidatorListenAddr, genDoc.ChainID, logger)
if err != nil {
return nil, fmt.Errorf("error with private validator socket client: %w", err)
}
}
}
pubKey, err := privValidator.GetPubKey()
if err != nil {
return nil, fmt.Errorf("can't get pubkey: %w", err)
}
// Determine whether we should attempt state sync.
stateSync := config.StateSync.Enable && !onlyValidatorIsUs(state, pubKey)
if stateSync && state.LastBlockHeight > 0 {
logger.Info("Found local state with non-zero height, skipping state sync")
stateSync = false
}
// Create the handshaker, which calls RequestInfo, sets the AppVersion on the state,
// and replays any blocks as necessary to sync tendermint with the app.
consensusLogger := logger.With("module", "consensus")
if !stateSync {
if err := doHandshake(stateStore, state, blockStore, genDoc, eventBus, proxyApp, consensusLogger); err != nil {
return nil, err
}
// Reload the state. It will have the Version.Consensus.App set by the
// Handshake, and may have other modifications as well (ie. depending on
// what happened during block replay).
state, err = stateStore.Load()
if err != nil {
return nil, fmt.Errorf("cannot load state: %w", err)
}
}
// Determine whether we should do fast sync. This must happen after the handshake, since the
// app may modify the validator set, specifying ourself as the only validator.
fastSync := config.FastSyncMode && !onlyValidatorIsUs(state, pubKey)
logNodeStartupInfo(state, pubKey, logger, consensusLogger)
// TODO: Fetch and provide real options and do proper p2p bootstrapping.
// TODO: Use a persistent peer database.
peerMgr, err := p2p.NewPeerManager(dbm.NewMemDB(), p2p.PeerManagerOptions{})
if err != nil {
return nil, err
}
csMetrics, p2pMetrics, memplMetrics, smMetrics := metricsProvider(genDoc.ChainID)
mpReactorShim, mpReactor, mempool := createMempoolReactor(config, proxyApp, state, memplMetrics, peerMgr, logger)
evReactorShim, evReactor, evPool, err := createEvidenceReactor(config, dbProvider, stateDB, blockStore, logger)
if err != nil {
return nil, err
}
// make block executor for consensus and blockchain reactors to execute blocks
blockExec := sm.NewBlockExecutor(
stateStore,
logger.With("module", "state"),
proxyApp.Consensus(),
mempool,
evPool,
sm.BlockExecutorWithMetrics(smMetrics),
)
csReactor, csState := createConsensusReactor(
config, state, blockExec, blockStore, mempool, evPool,
privValidator, csMetrics, stateSync || fastSync, eventBus, consensusLogger,
)
// Create the blockchain reactor. Note, we do not start fast sync if we're
// doing a state sync first.
bcReactorShim, bcReactor, err := createBlockchainReactor(
logger, config, state, blockExec, blockStore, csReactor, fastSync && !stateSync,
)
if err != nil {
return nil, fmt.Errorf("could not create blockchain reactor: %w", err)
}
// TODO: Remove this once the switch is removed.
var bcReactorForSwitch p2p.Reactor
if bcReactorShim != nil {
bcReactorForSwitch = bcReactorShim
} else {
bcReactorForSwitch = bcReactor.(p2p.Reactor)
}
// Make ConsensusReactor. Don't enable fully if doing a state sync and/or fast sync first.
// FIXME We need to update metrics here, since other reactors don't have access to them.
if stateSync {
csMetrics.StateSyncing.Set(1)
} else if fastSync {
csMetrics.FastSyncing.Set(1)
}
// Set up state sync reactor, and schedule a sync if requested.
// FIXME The way we do phased startups (e.g. replay -> fast sync -> consensus) is very messy,
// we should clean this whole thing up. See:
// https://github.com/tendermint/tendermint/issues/4644
stateSyncReactorShim := p2p.NewReactorShim(logger.With("module", "statesync"), "StateSyncShim", statesync.ChannelShims)
stateSyncReactor := statesync.NewReactor(
stateSyncReactorShim.Logger,
proxyApp.Snapshot(),
proxyApp.Query(),
stateSyncReactorShim.GetChannel(statesync.SnapshotChannel),
stateSyncReactorShim.GetChannel(statesync.ChunkChannel),
stateSyncReactorShim.PeerUpdates,
config.StateSync.TempDir,
)
nodeInfo, err := makeNodeInfo(config, nodeKey, txIndexer, genDoc, state)
if err != nil {
return nil, err
}
// Setup Transport and Switch.
p2pLogger := logger.With("module", "p2p")
transport, peerFilters := createTransport(p2pLogger, config, nodeInfo, nodeKey, proxyApp)
sw := createSwitch(
config, transport, p2pMetrics, peerFilters, mpReactorShim, bcReactorForSwitch,
stateSyncReactorShim, csReactor, evReactorShim, nodeInfo, nodeKey, p2pLogger,
)
err = sw.AddPersistentPeers(splitAndTrimEmpty(config.P2P.PersistentPeers, ",", " "))
if err != nil {
return nil, fmt.Errorf("could not add peers from persistent-peers field: %w", err)
}
err = sw.AddUnconditionalPeerIDs(splitAndTrimEmpty(config.P2P.UnconditionalPeerIDs, ",", " "))
if err != nil {
return nil, fmt.Errorf("could not add peer ids from unconditional_peer_ids field: %w", err)
}
addrBook, err := createAddrBookAndSetOnSwitch(config, sw, p2pLogger, nodeKey)
if err != nil {
return nil, fmt.Errorf("could not create addrbook: %w", err)
}
// Optionally, start the pex reactor
//
// TODO:
//
// We need to set Seeds and PersistentPeers on the switch,
// since it needs to be able to use these (and their DNS names)
// even if the PEX is off. We can include the DNS name in the NetAddress,
// but it would still be nice to have a clear list of the current "PersistentPeers"
// somewhere that we can return with net_info.
//
// If PEX is on, it should handle dialing the seeds. Otherwise the switch does it.
// Note we currently use the addrBook regardless at least for AddOurAddress
var pexReactor *pex.Reactor
if config.P2P.PexReactor {
pexReactor = createPEXReactorAndAddToSwitch(addrBook, config, sw, logger)
}
if config.RPC.PprofListenAddress != "" {
go func() {
logger.Info("Starting pprof server", "laddr", config.RPC.PprofListenAddress)
logger.Error("pprof server error", "err", http.ListenAndServe(config.RPC.PprofListenAddress, nil))
}()
}
node := &Node{
config: config,
genesisDoc: genDoc,
privValidator: privValidator,
transport: transport,
sw: sw,
addrBook: addrBook,
nodeInfo: nodeInfo,
nodeKey: nodeKey,
stateStore: stateStore,
blockStore: blockStore,
bcReactor: bcReactor,
mempoolReactor: mpReactor,
mempool: mempool,
consensusState: csState,
consensusReactor: csReactor,
stateSyncReactor: stateSyncReactor,
stateSync: stateSync,
stateSyncGenesis: state, // Shouldn't be necessary, but need a way to pass the genesis state
pexReactor: pexReactor,
evidenceReactor: evReactor,
evidencePool: evPool,
proxyApp: proxyApp,
txIndexer: txIndexer,
indexerService: indexerService,
eventBus: eventBus,
}
node.BaseService = *service.NewBaseService(logger, "Node", node)
for _, option := range options {
option(node)
}
return node, nil
}
// OnStart starts the Node. It implements service.Service.
func (n *Node) OnStart() error {
now := tmtime.Now()
genTime := n.genesisDoc.GenesisTime
if genTime.After(now) {
n.Logger.Info("Genesis time is in the future. Sleeping until then...", "genTime", genTime)
time.Sleep(genTime.Sub(now))
}
// Add private IDs to addrbook to block those peers being added
n.addrBook.AddPrivateIDs(splitAndTrimEmpty(n.config.P2P.PrivatePeerIDs, ",", " "))
// Start the RPC server before the P2P server
// so we can eg. receive txs for the first block
if n.config.RPC.ListenAddress != "" {
listeners, err := n.startRPC()
if err != nil {
return err
}
n.rpcListeners = listeners
}
if n.config.Instrumentation.Prometheus &&
n.config.Instrumentation.PrometheusListenAddr != "" {
n.prometheusSrv = n.startPrometheusServer(n.config.Instrumentation.PrometheusListenAddr)
}
// Start the mempool.
if n.config.Mempool.WalEnabled() {
err := n.mempool.InitWAL()
if err != nil {
return fmt.Errorf("init mempool WAL: %w", err)
}
}
// Start the switch (the P2P server).
err := n.sw.Start()
if err != nil {
return err
}
// Start the transport.
addr, err := p2p.NewNetAddressString(p2p.IDAddressString(n.nodeKey.ID, n.config.P2P.ListenAddress))
if err != nil {
return err
}
if err := n.transport.Listen(addr.Endpoint()); err != nil {
return err
}
n.isListening = true
if n.config.FastSync.Version == "v0" {
// Start the real blockchain reactor separately since the switch uses the shim.
if err := n.bcReactor.Start(); err != nil {
return err
}
}
// Start the real state sync reactor separately since the switch uses the shim.
if err := n.stateSyncReactor.Start(); err != nil {
return err
}
// Start the real mempool reactor separately since the switch uses the shim.
if err := n.mempoolReactor.Start(); err != nil {
return err
}
// Start the real evidence reactor separately since the switch uses the shim.
if err := n.evidenceReactor.Start(); err != nil {
return err
}
// Always connect to persistent peers
err = n.sw.DialPeersAsync(splitAndTrimEmpty(n.config.P2P.PersistentPeers, ",", " "))
if err != nil {
return fmt.Errorf("could not dial peers from persistent-peers field: %w", err)
}
// Run state sync
if n.stateSync {
bcR, ok := n.bcReactor.(fastSyncReactor)
if !ok {
return fmt.Errorf("this blockchain reactor does not support switching from state sync")
}
err := startStateSync(n.stateSyncReactor, bcR, n.consensusReactor, n.stateSyncProvider,
n.config.StateSync, n.config.FastSyncMode, n.stateStore, n.blockStore, n.stateSyncGenesis)
if err != nil {
return fmt.Errorf("failed to start state sync: %w", err)
}
}
return nil
}
// OnStop stops the Node. It implements service.Service.
func (n *Node) OnStop() {
n.BaseService.OnStop()
n.Logger.Info("Stopping Node")
// first stop the non-reactor services
if err := n.eventBus.Stop(); err != nil {
n.Logger.Error("Error closing eventBus", "err", err)
}
if err := n.indexerService.Stop(); err != nil {
n.Logger.Error("Error closing indexerService", "err", err)
}
// now stop the reactors
if err := n.sw.Stop(); err != nil {
n.Logger.Error("Error closing switch", "err", err)
}
if n.config.FastSync.Version == "v0" {
// Stop the real blockchain reactor separately since the switch uses the shim.
if err := n.bcReactor.Stop(); err != nil {
n.Logger.Error("failed to stop the blockchain reactor", "err", err)
}
}
// Stop the real state sync reactor separately since the switch uses the shim.
if err := n.stateSyncReactor.Stop(); err != nil {
n.Logger.Error("failed to stop the state sync reactor", "err", err)
}
// Stop the real mempool reactor separately since the switch uses the shim.
if err := n.mempoolReactor.Stop(); err != nil {
n.Logger.Error("failed to stop the mempool reactor", "err", err)
}
// Stop the real evidence reactor separately since the switch uses the shim.
if err := n.evidenceReactor.Stop(); err != nil {
n.Logger.Error("failed to stop the evidence reactor", "err", err)
}
// stop mempool WAL
if n.config.Mempool.WalEnabled() {
n.mempool.CloseWAL()
}
if err := n.transport.Close(); err != nil {
n.Logger.Error("Error closing transport", "err", err)
}
n.isListening = false
// finally stop the listeners / external services
for _, l := range n.rpcListeners {
n.Logger.Info("Closing rpc listener", "listener", l)
if err := l.Close(); err != nil {
n.Logger.Error("Error closing listener", "listener", l, "err", err)
}
}
if pvsc, ok := n.privValidator.(service.Service); ok {
if err := pvsc.Stop(); err != nil {
n.Logger.Error("Error closing private validator", "err", err)
}
}
if n.prometheusSrv != nil {
if err := n.prometheusSrv.Shutdown(context.Background()); err != nil {
// Error from closing listeners, or context timeout:
n.Logger.Error("Prometheus HTTP server Shutdown", "err", err)
}
}
}
// ConfigureRPC makes sure RPC has all the objects it needs to operate.
func (n *Node) ConfigureRPC() error {
pubKey, err := n.privValidator.GetPubKey()
if err != nil {
return fmt.Errorf("can't get pubkey: %w", err)
}
rpccore.SetEnvironment(&rpccore.Environment{
ProxyAppQuery: n.proxyApp.Query(),
ProxyAppMempool: n.proxyApp.Mempool(),
StateStore: n.stateStore,
BlockStore: n.blockStore,
EvidencePool: n.evidencePool,
ConsensusState: n.consensusState,
P2PPeers: n.sw,
P2PTransport: n,
PubKey: pubKey,
GenDoc: n.genesisDoc,
TxIndexer: n.txIndexer,
ConsensusReactor: n.consensusReactor,
EventBus: n.eventBus,
Mempool: n.mempool,
Logger: n.Logger.With("module", "rpc"),
Config: *n.config.RPC,
})
return nil
}
func (n *Node) startRPC() ([]net.Listener, error) {
err := n.ConfigureRPC()
if err != nil {
return nil, err
}
listenAddrs := splitAndTrimEmpty(n.config.RPC.ListenAddress, ",", " ")
if n.config.RPC.Unsafe {
rpccore.AddUnsafeRoutes()
}
config := rpcserver.DefaultConfig()
config.MaxBodyBytes = n.config.RPC.MaxBodyBytes
config.MaxHeaderBytes = n.config.RPC.MaxHeaderBytes
config.MaxOpenConnections = n.config.RPC.MaxOpenConnections
// If necessary adjust global WriteTimeout to ensure it's greater than
// TimeoutBroadcastTxCommit.
// See https://github.com/tendermint/tendermint/issues/3435
if config.WriteTimeout <= n.config.RPC.TimeoutBroadcastTxCommit {
config.WriteTimeout = n.config.RPC.TimeoutBroadcastTxCommit + 1*time.Second
}
// we may expose the rpc over both a unix and tcp socket
listeners := make([]net.Listener, len(listenAddrs))
for i, listenAddr := range listenAddrs {
mux := http.NewServeMux()
rpcLogger := n.Logger.With("module", "rpc-server")
wmLogger := rpcLogger.With("protocol", "websocket")
wm := rpcserver.NewWebsocketManager(rpccore.Routes,
rpcserver.OnDisconnect(func(remoteAddr string) {
err := n.eventBus.UnsubscribeAll(context.Background(), remoteAddr)
if err != nil && err != tmpubsub.ErrSubscriptionNotFound {
wmLogger.Error("Failed to unsubscribe addr from events", "addr", remoteAddr, "err", err)
}
}),
rpcserver.ReadLimit(config.MaxBodyBytes),
)
wm.SetLogger(wmLogger)
mux.HandleFunc("/websocket", wm.WebsocketHandler)
rpcserver.RegisterRPCFuncs(mux, rpccore.Routes, rpcLogger)
listener, err := rpcserver.Listen(
listenAddr,
config,
)
if err != nil {
return nil, err
}
var rootHandler http.Handler = mux
if n.config.RPC.IsCorsEnabled() {
corsMiddleware := cors.New(cors.Options{
AllowedOrigins: n.config.RPC.CORSAllowedOrigins,
AllowedMethods: n.config.RPC.CORSAllowedMethods,
AllowedHeaders: n.config.RPC.CORSAllowedHeaders,
})
rootHandler = corsMiddleware.Handler(mux)
}
if n.config.RPC.IsTLSEnabled() {
go func() {
if err := rpcserver.ServeTLS(
listener,
rootHandler,
n.config.RPC.CertFile(),
n.config.RPC.KeyFile(),
rpcLogger,
config,
); err != nil {
n.Logger.Error("Error serving server with TLS", "err", err)
}
}()
} else {
go func() {
if err := rpcserver.Serve(
listener,
rootHandler,
rpcLogger,
config,
); err != nil {
n.Logger.Error("Error serving server", "err", err)
}
}()
}
listeners[i] = listener
}
// we expose a simplified api over grpc for convenience to app devs
grpcListenAddr := n.config.RPC.GRPCListenAddress
if grpcListenAddr != "" {
config := rpcserver.DefaultConfig()
config.MaxBodyBytes = n.config.RPC.MaxBodyBytes
config.MaxHeaderBytes = n.config.RPC.MaxHeaderBytes
// NOTE: GRPCMaxOpenConnections is used, not MaxOpenConnections
config.MaxOpenConnections = n.config.RPC.GRPCMaxOpenConnections
// If necessary adjust global WriteTimeout to ensure it's greater than
// TimeoutBroadcastTxCommit.
// See https://github.com/tendermint/tendermint/issues/3435
if config.WriteTimeout <= n.config.RPC.TimeoutBroadcastTxCommit {
config.WriteTimeout = n.config.RPC.TimeoutBroadcastTxCommit + 1*time.Second
}
listener, err := rpcserver.Listen(grpcListenAddr, config)
if err != nil {
return nil, err
}
go func() {
if err := grpccore.StartGRPCServer(listener); err != nil {
n.Logger.Error("Error starting gRPC server", "err", err)
}
}()
listeners = append(listeners, listener)
}
return listeners, nil
}
// startPrometheusServer starts a Prometheus HTTP server, listening for metrics
// collectors on addr.
func (n *Node) startPrometheusServer(addr string) *http.Server {
srv := &http.Server{
Addr: addr,
Handler: promhttp.InstrumentMetricHandler(
prometheus.DefaultRegisterer, promhttp.HandlerFor(
prometheus.DefaultGatherer,
promhttp.HandlerOpts{MaxRequestsInFlight: n.config.Instrumentation.MaxOpenConnections},
),
),
}
go func() {
if err := srv.ListenAndServe(); err != http.ErrServerClosed {
// Error starting or closing listener:
n.Logger.Error("Prometheus HTTP server ListenAndServe", "err", err)
}
}()
return srv
}
// Switch returns the Node's Switch.
func (n *Node) Switch() *p2p.Switch {
return n.sw
}
// BlockStore returns the Node's BlockStore.
func (n *Node) BlockStore() *store.BlockStore {
return n.blockStore
}
// ConsensusState returns the Node's ConsensusState.
func (n *Node) ConsensusState() *cs.State {
return n.consensusState
}
// ConsensusReactor returns the Node's ConsensusReactor.
func (n *Node) ConsensusReactor() *cs.Reactor {
return n.consensusReactor
}
// MempoolReactor returns the Node's mempool reactor.
func (n *Node) MempoolReactor() *mempl.Reactor {
return n.mempoolReactor
}
// Mempool returns the Node's mempool.
func (n *Node) Mempool() mempl.Mempool {
return n.mempool
}
// PEXReactor returns the Node's PEXReactor. It returns nil if PEX is disabled.
func (n *Node) PEXReactor() *pex.Reactor {
return n.pexReactor
}
// EvidencePool returns the Node's EvidencePool.
func (n *Node) EvidencePool() *evidence.Pool {
return n.evidencePool
}
// EventBus returns the Node's EventBus.
func (n *Node) EventBus() *types.EventBus {
return n.eventBus
}
// PrivValidator returns the Node's PrivValidator.
// XXX: for convenience only!
func (n *Node) PrivValidator() types.PrivValidator {
return n.privValidator
}
// GenesisDoc returns the Node's GenesisDoc.
func (n *Node) GenesisDoc() *types.GenesisDoc {
return n.genesisDoc
}
// ProxyApp returns the Node's AppConns, representing its connections to the ABCI application.
func (n *Node) ProxyApp() proxy.AppConns {
return n.proxyApp
}
// Config returns the Node's config.
func (n *Node) Config() *cfg.Config {
return n.config
}
//------------------------------------------------------------------------------
func (n *Node) Listeners() []string {
return []string{
fmt.Sprintf("Listener(@%v)", n.config.P2P.ExternalAddress),
}
}
func (n *Node) IsListening() bool {
return n.isListening
}
// NodeInfo returns the Node's Info from the Switch.
func (n *Node) NodeInfo() p2p.NodeInfo {
return n.nodeInfo
}
func makeNodeInfo(
config *cfg.Config,
nodeKey p2p.NodeKey,
txIndexer txindex.TxIndexer,
genDoc *types.GenesisDoc,
state sm.State,
) (p2p.NodeInfo, error) {
txIndexerStatus := "on"
if _, ok := txIndexer.(*null.TxIndex); ok {
txIndexerStatus = "off"
}
var bcChannel byte
switch config.FastSync.Version {
case "v0":
bcChannel = byte(bcv0.BlockchainChannel)
case "v2":
bcChannel = bcv2.BlockchainChannel
default:
return p2p.NodeInfo{}, fmt.Errorf("unknown fastsync version %s", config.FastSync.Version)
}
nodeInfo := p2p.NodeInfo{
ProtocolVersion: p2p.NewProtocolVersion(
version.P2PProtocol, // global
state.Version.Consensus.Block,
state.Version.Consensus.App,
),
NodeID: nodeKey.ID,
Network: genDoc.ChainID,
Version: version.TMCoreSemVer,
Channels: []byte{
bcChannel,
cs.StateChannel,
cs.DataChannel,
cs.VoteChannel,
cs.VoteSetBitsChannel,
byte(mempl.MempoolChannel),
byte(evidence.EvidenceChannel),
byte(statesync.SnapshotChannel),
byte(statesync.ChunkChannel),
},
Moniker: config.Moniker,
Other: p2p.NodeInfoOther{
TxIndex: txIndexerStatus,
RPCAddress: config.RPC.ListenAddress,
},
}
if config.P2P.PexReactor {
nodeInfo.Channels = append(nodeInfo.Channels, pex.PexChannel)
}
lAddr := config.P2P.ExternalAddress
if lAddr == "" {
lAddr = config.P2P.ListenAddress
}
nodeInfo.ListenAddr = lAddr
err := nodeInfo.Validate()
return nodeInfo, err
}
//------------------------------------------------------------------------------
var (
genesisDocKey = []byte("genesisDoc")
)
// LoadStateFromDBOrGenesisDocProvider attempts to load the state from the
// database, or creates one using the given genesisDocProvider. On success this also
// returns the genesis doc loaded through the given provider.
func LoadStateFromDBOrGenesisDocProvider(
stateDB dbm.DB,
genesisDocProvider GenesisDocProvider,
) (sm.State, *types.GenesisDoc, error) {
// Get genesis doc
genDoc, err := loadGenesisDoc(stateDB)
if err != nil {
genDoc, err = genesisDocProvider()
if err != nil {
return sm.State{}, nil, err
}
// save genesis doc to prevent a certain class of user errors (e.g. when it
// was changed, accidentally or not). Also good for audit trail.
if err := saveGenesisDoc(stateDB, genDoc); err != nil {
return sm.State{}, nil, err
}
}
stateStore := sm.NewStore(stateDB)
state, err := stateStore.LoadFromDBOrGenesisDoc(genDoc)
if err != nil {
return sm.State{}, nil, err
}
return state, genDoc, nil
}
// panics if failed to unmarshal bytes
func loadGenesisDoc(db dbm.DB) (*types.GenesisDoc, error) {
b, err := db.Get(genesisDocKey)
if err != nil {
panic(err)
}
if len(b) == 0 {
return nil, errors.New("genesis doc not found")
}
var genDoc *types.GenesisDoc
err = tmjson.Unmarshal(b, &genDoc)
if err != nil {
panic(fmt.Sprintf("Failed to load genesis doc due to unmarshaling error: %v (bytes: %X)", err, b))
}
return genDoc, nil
}
// panics if failed to marshal the given genesis document
func saveGenesisDoc(db dbm.DB, genDoc *types.GenesisDoc) error {
b, err := tmjson.Marshal(genDoc)
if err != nil {
return fmt.Errorf("failed to save genesis doc due to marshaling error: %w", err)
}
if err := db.SetSync(genesisDocKey, b); err != nil {
return err
}
return nil
}
func createAndStartPrivValidatorSocketClient(
listenAddr,
chainID string,
logger log.Logger,
) (types.PrivValidator, error) {
pve, err := privval.NewSignerListener(listenAddr, logger)
if err != nil {
return nil, fmt.Errorf("failed to start private validator: %w", err)
}
pvsc, err := privval.NewSignerClient(pve, chainID)
if err != nil {
return nil, fmt.Errorf("failed to start private validator: %w", err)
}
// try to get a pubkey from private validate first time
_, err = pvsc.GetPubKey()
if err != nil {
return nil, fmt.Errorf("can't get pubkey: %w", err)
}
const (
retries = 50 // 50 * 100ms = 5s total
timeout = 100 * time.Millisecond
)
pvscWithRetries := privval.NewRetrySignerClient(pvsc, retries, timeout)
return pvscWithRetries, nil
}
func createAndStartPrivValidatorGRPCClient(
config *cfg.Config,
chainID string,
logger log.Logger,
) (types.PrivValidator, error) {
pvsc, err := tmgrpc.DialRemoteSigner(config, chainID, logger)
if err != nil {
return nil, fmt.Errorf("failed to start private validator: %w", err)
}
// try to get a pubkey from private validate first time
_, err = pvsc.GetPubKey()
if err != nil {
return nil, fmt.Errorf("can't get pubkey: %w", err)
}
return pvsc, nil
}