mirror of
https://github.com/versity/versitygw.git
synced 2026-02-02 08:22:03 +00:00
Compare commits
1 Commits
sis/list-m
...
ben/plugin
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
db9cefa27c |
25
.github/SECURITY.md
vendored
25
.github/SECURITY.md
vendored
@@ -1,25 +0,0 @@
|
||||
# Security Policy
|
||||
|
||||
## Reporting a Vulnerability
|
||||
|
||||
If you discover a security vulnerability in `versitygw`, we strongly encourage you to report it privately and responsibly.
|
||||
|
||||
Please do **not** create public issues or pull requests that contain details about the vulnerability.
|
||||
|
||||
Instead, report the issue using GitHub's private **Security Advisories** feature:
|
||||
|
||||
- Go to [versitygw's Security Advisories page](https://github.com/versity/versitygw/security/advisories)
|
||||
- Click on **"Report a vulnerability"**
|
||||
|
||||
We aim to respond within **2 business days** and work with you to quickly resolve the issue.
|
||||
|
||||
## Supported Versions
|
||||
|
||||
| Version | Supported |
|
||||
| --------------- | --------- |
|
||||
| Latest (v1.x.x) | ✅ |
|
||||
| Older versions | ❌ |
|
||||
|
||||
## Responsible Disclosure
|
||||
|
||||
We appreciate responsible disclosures and are committed to fixing vulnerabilities in a timely manner. Thank you for helping keep `versitygw` secure.
|
||||
4
.github/dependabot.yml
vendored
4
.github/dependabot.yml
vendored
@@ -12,7 +12,3 @@ updates:
|
||||
# Allow both direct and indirect updates for all packages
|
||||
- dependency-type: "all"
|
||||
|
||||
- package-ecosystem: "github-actions"
|
||||
directory: "/"
|
||||
schedule:
|
||||
interval: "weekly"
|
||||
|
||||
6
.github/workflows/azurite.yml
vendored
6
.github/workflows/azurite.yml
vendored
@@ -1,5 +1,5 @@
|
||||
name: azurite functional tests
|
||||
permissions: {}
|
||||
|
||||
on: pull_request
|
||||
|
||||
jobs:
|
||||
@@ -8,10 +8,10 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v6
|
||||
uses: actions/setup-go@v5
|
||||
with:
|
||||
go-version: 'stable'
|
||||
id: go
|
||||
|
||||
108
.github/workflows/codeql.yml
vendored
108
.github/workflows/codeql.yml
vendored
@@ -1,108 +0,0 @@
|
||||
# For most projects, this workflow file will not need changing; you simply need
|
||||
# to commit it to your repository.
|
||||
#
|
||||
# You may wish to alter this file to override the set of languages analyzed,
|
||||
# or to provide custom queries or build logic.
|
||||
#
|
||||
# ******** NOTE ********
|
||||
# We have attempted to detect the languages in your repository. Please check
|
||||
# the `language` matrix defined below to confirm you have the correct set of
|
||||
# supported CodeQL languages.
|
||||
#
|
||||
name: "CodeQL Advanced"
|
||||
|
||||
on:
|
||||
push:
|
||||
branches: [ "main" ]
|
||||
pull_request:
|
||||
branches: [ "main" ]
|
||||
schedule:
|
||||
- cron: '21 17 * * 2'
|
||||
|
||||
jobs:
|
||||
analyze:
|
||||
name: Analyze (${{ matrix.language }})
|
||||
# Runner size impacts CodeQL analysis time. To learn more, please see:
|
||||
# - https://gh.io/recommended-hardware-resources-for-running-codeql
|
||||
# - https://gh.io/supported-runners-and-hardware-resources
|
||||
# - https://gh.io/using-larger-runners (GitHub.com only)
|
||||
# Consider using larger runners or machines with greater resources for possible analysis time improvements.
|
||||
runs-on: ${{ (matrix.language == 'swift' && 'macos-latest') || 'ubuntu-latest' }}
|
||||
permissions:
|
||||
# required for all workflows
|
||||
security-events: write
|
||||
|
||||
# required to fetch internal or private CodeQL packs
|
||||
packages: read
|
||||
|
||||
# only required for workflows in private repositories
|
||||
actions: read
|
||||
contents: read
|
||||
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
include:
|
||||
- language: actions
|
||||
build-mode: none
|
||||
- language: go
|
||||
build-mode: autobuild
|
||||
- language: javascript-typescript
|
||||
build-mode: none
|
||||
paths-ignore:
|
||||
# ignore embedded 3rd party assets
|
||||
- 'webui/web/assets/**'
|
||||
- language: python
|
||||
build-mode: none
|
||||
# CodeQL supports the following values keywords for 'language': 'actions', 'c-cpp', 'csharp', 'go', 'java-kotlin', 'javascript-typescript', 'python', 'ruby', 'rust', 'swift'
|
||||
# Use `c-cpp` to analyze code written in C, C++ or both
|
||||
# Use 'java-kotlin' to analyze code written in Java, Kotlin or both
|
||||
# Use 'javascript-typescript' to analyze code written in JavaScript, TypeScript or both
|
||||
# To learn more about changing the languages that are analyzed or customizing the build mode for your analysis,
|
||||
# see https://docs.github.com/en/code-security/code-scanning/creating-an-advanced-setup-for-code-scanning/customizing-your-advanced-setup-for-code-scanning.
|
||||
# If you are analyzing a compiled language, you can modify the 'build-mode' for that language to customize how
|
||||
# your codebase is analyzed, see https://docs.github.com/en/code-security/code-scanning/creating-an-advanced-setup-for-code-scanning/codeql-code-scanning-for-compiled-languages
|
||||
steps:
|
||||
- name: Checkout repository
|
||||
uses: actions/checkout@v6
|
||||
|
||||
# Add any setup steps before running the `github/codeql-action/init` action.
|
||||
# This includes steps like installing compilers or runtimes (`actions/setup-node`
|
||||
# or others). This is typically only required for manual builds.
|
||||
# - name: Setup runtime (example)
|
||||
# uses: actions/setup-example@v1
|
||||
|
||||
# Initializes the CodeQL tools for scanning.
|
||||
- name: Initialize CodeQL
|
||||
uses: github/codeql-action/init@v4
|
||||
with:
|
||||
languages: ${{ matrix.language }}
|
||||
build-mode: ${{ matrix.build-mode }}
|
||||
# If you wish to specify custom queries, you can do so here or in a config file.
|
||||
# By default, queries listed here will override any specified in a config file.
|
||||
# Prefix the list here with "+" to use these queries and those in the config file.
|
||||
|
||||
# For more details on CodeQL's query packs, refer to: https://docs.github.com/en/code-security/code-scanning/automatically-scanning-your-code-for-vulnerabilities-and-errors/configuring-code-scanning#using-queries-in-ql-packs
|
||||
# queries: security-extended,security-and-quality
|
||||
|
||||
# If the analyze step fails for one of the languages you are analyzing with
|
||||
# "We were unable to automatically build your code", modify the matrix above
|
||||
# to set the build mode to "manual" for that language. Then modify this step
|
||||
# to build your code.
|
||||
# ℹ️ Command-line programs to run using the OS shell.
|
||||
# 📚 See https://docs.github.com/en/actions/using-workflows/workflow-syntax-for-github-actions#jobsjob_idstepsrun
|
||||
- name: Run manual build steps
|
||||
if: matrix.build-mode == 'manual'
|
||||
shell: bash
|
||||
run: |
|
||||
echo 'If you are using a "manual" build mode for one or more of the' \
|
||||
'languages you are analyzing, replace this with the commands to build' \
|
||||
'your code, for example:'
|
||||
echo ' make bootstrap'
|
||||
echo ' make release'
|
||||
exit 1
|
||||
|
||||
- name: Perform CodeQL Analysis
|
||||
uses: github/codeql-action/analyze@v4
|
||||
with:
|
||||
category: "/language:${{matrix.language}}"
|
||||
5
.github/workflows/docker-bats.yml
vendored
5
.github/workflows/docker-bats.yml
vendored
@@ -1,5 +1,5 @@
|
||||
name: docker bats tests
|
||||
permissions: {}
|
||||
|
||||
on: pull_request
|
||||
|
||||
jobs:
|
||||
@@ -8,12 +8,13 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Build Docker Image
|
||||
run: |
|
||||
cp tests/.env.docker.default tests/.env.docker
|
||||
cp tests/.secrets.default tests/.secrets
|
||||
# see https://github.com/versity/versitygw/issues/1034
|
||||
docker build \
|
||||
--build-arg="GO_LIBRARY=go1.23.1.linux-amd64.tar.gz" \
|
||||
--build-arg="AWS_CLI=awscli-exe-linux-x86_64.zip" \
|
||||
|
||||
5
.github/workflows/docker.yml
vendored
5
.github/workflows/docker.yml
vendored
@@ -1,4 +1,5 @@
|
||||
name: Publish Docker image
|
||||
|
||||
on:
|
||||
release:
|
||||
types: [published]
|
||||
@@ -12,7 +13,7 @@ jobs:
|
||||
contents: read
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Set up QEMU
|
||||
uses: docker/setup-qemu-action@v3
|
||||
@@ -43,7 +44,7 @@ jobs:
|
||||
ghcr.io/${{ github.repository }}
|
||||
|
||||
- name: Build and push Docker images
|
||||
uses: docker/build-push-action@v6
|
||||
uses: docker/build-push-action@v5
|
||||
with:
|
||||
context: .
|
||||
push: true
|
||||
|
||||
6
.github/workflows/functional.yml
vendored
6
.github/workflows/functional.yml
vendored
@@ -1,5 +1,5 @@
|
||||
name: functional tests
|
||||
permissions: {}
|
||||
|
||||
on: pull_request
|
||||
|
||||
jobs:
|
||||
@@ -9,10 +9,10 @@ jobs:
|
||||
steps:
|
||||
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v6
|
||||
uses: actions/setup-go@v5
|
||||
with:
|
||||
go-version: 'stable'
|
||||
id: go
|
||||
|
||||
34
.github/workflows/go.yml
vendored
34
.github/workflows/go.yml
vendored
@@ -1,18 +1,17 @@
|
||||
name: general
|
||||
permissions: {}
|
||||
on: pull_request
|
||||
jobs:
|
||||
|
||||
build:
|
||||
name: Go Basic Checks
|
||||
name: Build
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
|
||||
- name: Check out code into the Go module directory
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v6
|
||||
uses: actions/setup-go@v5
|
||||
with:
|
||||
go-version: 'stable'
|
||||
id: go
|
||||
@@ -24,6 +23,9 @@ jobs:
|
||||
run: |
|
||||
go get -v -t -d ./...
|
||||
|
||||
- name: Build
|
||||
run: make
|
||||
|
||||
- name: Test
|
||||
run: go test -coverprofile profile.txt -race -v -timeout 30s -tags=github ./...
|
||||
|
||||
@@ -33,26 +35,4 @@ jobs:
|
||||
|
||||
- name: Run govulncheck
|
||||
run: govulncheck ./...
|
||||
shell: bash
|
||||
|
||||
verify-build:
|
||||
name: Verify Build Targets
|
||||
needs: build
|
||||
runs-on: ubuntu-latest
|
||||
strategy:
|
||||
matrix:
|
||||
os: [darwin, freebsd, linux]
|
||||
arch: [amd64, arm64]
|
||||
steps:
|
||||
|
||||
- name: Check out code
|
||||
uses: actions/checkout@v6
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v6
|
||||
with:
|
||||
go-version: 'stable'
|
||||
|
||||
- name: Build for ${{ matrix.os }}/${{ matrix.arch }}
|
||||
run: |
|
||||
GOOS=${{ matrix.os }} GOARCH=${{ matrix.arch }} go build -o versitygw-${{ matrix.os }}-${{ matrix.arch }} cmd/versitygw/*.go
|
||||
shell: bash
|
||||
16
.github/workflows/goreleaser.yml
vendored
16
.github/workflows/goreleaser.yml
vendored
@@ -1,18 +1,22 @@
|
||||
name: goreleaser
|
||||
permissions:
|
||||
contents: write
|
||||
|
||||
on:
|
||||
push:
|
||||
# run only against tags
|
||||
tags:
|
||||
- '*'
|
||||
|
||||
permissions:
|
||||
contents: write
|
||||
# packages: write
|
||||
# issues: write
|
||||
|
||||
jobs:
|
||||
goreleaser:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
with:
|
||||
fetch-depth: 0
|
||||
|
||||
@@ -20,15 +24,15 @@ jobs:
|
||||
run: git fetch --force --tags
|
||||
|
||||
- name: Setup Go
|
||||
uses: actions/setup-go@v6
|
||||
uses: actions/setup-go@v5
|
||||
with:
|
||||
go-version: stable
|
||||
|
||||
- name: Run Releaser
|
||||
uses: goreleaser/goreleaser-action@v6
|
||||
uses: goreleaser/goreleaser-action@v5
|
||||
with:
|
||||
distribution: goreleaser
|
||||
version: '~> v2'
|
||||
version: latest
|
||||
args: release --clean
|
||||
env:
|
||||
GITHUB_TOKEN: ${{ secrets.TOKEN }}
|
||||
|
||||
13
.github/workflows/host-style-tests.yml
vendored
13
.github/workflows/host-style-tests.yml
vendored
@@ -1,13 +0,0 @@
|
||||
name: host style tests
|
||||
permissions: {}
|
||||
on: pull_request
|
||||
|
||||
jobs:
|
||||
build-and-run:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v6
|
||||
|
||||
- name: run host-style tests
|
||||
run: make test-host-style
|
||||
3
.github/workflows/shellcheck.yml
vendored
3
.github/workflows/shellcheck.yml
vendored
@@ -1,5 +1,4 @@
|
||||
name: shellcheck
|
||||
permissions: {}
|
||||
on: pull_request
|
||||
jobs:
|
||||
|
||||
@@ -9,7 +8,7 @@ jobs:
|
||||
steps:
|
||||
|
||||
- name: Check out code
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Run checks
|
||||
run: |
|
||||
|
||||
84
.github/workflows/skips.yml
vendored
84
.github/workflows/skips.yml
vendored
@@ -1,84 +0,0 @@
|
||||
name: skips check
|
||||
permissions: {}
|
||||
on: workflow_dispatch
|
||||
jobs:
|
||||
skip-ticket-check:
|
||||
runs-on: ubuntu-latest
|
||||
permissions:
|
||||
contents: read
|
||||
steps:
|
||||
- uses: actions/checkout@v6
|
||||
|
||||
- name: Fail if any skip descriptions are empty or point to closed issues/PRs
|
||||
env:
|
||||
GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
# Find uncommented lines with "skip " (ignore lines whose first non-space char is #)
|
||||
mapfile -t MATCHES < <(
|
||||
git ls-files 'tests/test_*.sh' \
|
||||
| xargs -r grep -nE '^[[:space:]]*[^#][[:space:]]*skip[[:space:]]*$' \
|
||||
|| true
|
||||
)
|
||||
|
||||
if [ ${#MATCHES[@]} -ne 0 ]; then
|
||||
echo "${#MATCHES[@]} skip(s) lack a description"
|
||||
printf ' - %s\n' "${MATCHES[@]}"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
mapfile -t MATCHES < <(
|
||||
git ls-files 'tests/test_*.sh' \
|
||||
| xargs -r grep -nE '^[[:space:]]*[^#][[:space:]]*skip[[:space:]]*"https://github.com' \
|
||||
|| true
|
||||
)
|
||||
|
||||
urls=()
|
||||
for m in "${MATCHES[@]}"; do
|
||||
# Extract first GitHub issue/PR URL on the line:
|
||||
# supports /issues/123 and /pull/123 (with or without extra suffix)
|
||||
url="$(echo "$m" | grep -oE 'https://github\.com/[A-Za-z0-9_.-]+/[A-Za-z0-9_.-]+/(issues|pull)/[0-9]+' | head -n1 || true)"
|
||||
if [ -n "$url" ]; then
|
||||
urls+=("$url")
|
||||
fi
|
||||
done
|
||||
|
||||
if [ ${#urls[@]} -eq 0 ]; then
|
||||
echo "Found skip lines, but no recognizable GitHub issue/PR URLs."
|
||||
exit 0
|
||||
fi
|
||||
|
||||
echo "Found skip ticket URLs:"
|
||||
printf ' - %s\n' "${urls[@]}"
|
||||
|
||||
closed=()
|
||||
|
||||
for url in "${urls[@]}"; do
|
||||
# Parse owner/repo and number from URL
|
||||
# url format: https://github.com/OWNER/REPO/issues/123 or /pull/123
|
||||
path="${url#https://github.com/}"
|
||||
owner="$(echo "$path" | cut -d/ -f1)"
|
||||
repo="$(echo "$path" | cut -d/ -f2)"
|
||||
num="$(echo "$path" | cut -d/ -f4)"
|
||||
|
||||
# Issues API works for both issues and PRs; state=open/closed
|
||||
state="$(curl -fsSL \
|
||||
-H "Authorization: Bearer $GH_TOKEN" \
|
||||
-H "Accept: application/vnd.github+json" \
|
||||
"https://api.github.com/repos/$owner/$repo/issues/$num" \
|
||||
| python -c "import sys,json; print(json.load(sys.stdin).get('state',''))")"
|
||||
|
||||
echo "$url -> $state"
|
||||
if [ "$state" = "closed" ]; then
|
||||
closed+=("$url")
|
||||
fi
|
||||
done
|
||||
|
||||
if [ ${#closed[@]} -gt 0 ]; then
|
||||
echo "::error::Closed tickets referenced by uncommented skip URLs:"
|
||||
printf '::error:: - %s\n' "${closed[@]}"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
echo "All referenced tickets are open. ✅"
|
||||
5
.github/workflows/static.yml
vendored
5
.github/workflows/static.yml
vendored
@@ -1,5 +1,4 @@
|
||||
name: staticcheck
|
||||
permissions: {}
|
||||
on: pull_request
|
||||
jobs:
|
||||
|
||||
@@ -9,12 +8,12 @@ jobs:
|
||||
steps:
|
||||
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
with:
|
||||
fetch-depth: 1
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v6
|
||||
uses: actions/setup-go@v5
|
||||
with:
|
||||
go-version: 'stable'
|
||||
id: go
|
||||
|
||||
140
.github/workflows/system.yml
vendored
140
.github/workflows/system.yml
vendored
@@ -1,37 +1,112 @@
|
||||
name: system tests
|
||||
permissions: {}
|
||||
on: pull_request
|
||||
jobs:
|
||||
generate:
|
||||
runs-on: ubuntu-latest
|
||||
outputs:
|
||||
matrix: ${{ steps.make.outputs.matrix }}
|
||||
steps:
|
||||
- uses: actions/checkout@v6
|
||||
- id: make
|
||||
run: |
|
||||
if ! matrix_output=$(tests/generate_matrix.sh 2>&1); then
|
||||
echo "error generating matrix: $matrix_output"
|
||||
exit 1
|
||||
fi
|
||||
MATRIX_JSON=$(echo -n "$matrix_output" | jq -c . )
|
||||
echo "matrix=$MATRIX_JSON" >> "$GITHUB_OUTPUT"
|
||||
|
||||
build:
|
||||
name: RunTests
|
||||
needs: generate
|
||||
runs-on: ubuntu-latest
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix: ${{ fromJson(needs.generate.outputs.matrix) }}
|
||||
matrix:
|
||||
include:
|
||||
- set: "mc, posix, non-file count, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "mc-non-file-count"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "mc, posix, file count, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "mc-file-count"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "REST, posix, non-static, all, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "rest"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3, posix, non-file count, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3-non-file-count"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3, posix, file count, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3-file-count"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, bucket|object|multipart, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3api-bucket,s3api-object,s3api-multipart"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, policy, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3api-policy"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, user, non-static, s3 IAM"
|
||||
IAM_TYPE: s3
|
||||
RUN_SET: "s3api-user"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, bucket, static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3api-bucket"
|
||||
RECREATE_BUCKETS: "false"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, multipart, static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3api-multipart"
|
||||
RECREATE_BUCKETS: "false"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, object, static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3api-object"
|
||||
RECREATE_BUCKETS: "false"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, policy, static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3api-policy"
|
||||
RECREATE_BUCKETS: "false"
|
||||
BACKEND: "posix"
|
||||
- set: "s3api, posix, user, static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3api-user"
|
||||
RECREATE_BUCKETS: "false"
|
||||
BACKEND: "posix"
|
||||
# TODO fix/debug s3 gateway
|
||||
#- set: "s3api, s3, multipart|object, non-static, folder IAM"
|
||||
# IAM_TYPE: folder
|
||||
# RUN_SET: "s3api-bucket,s3api-object,s3api-multipart"
|
||||
# RECREATE_BUCKETS: "true"
|
||||
# BACKEND: "s3"
|
||||
#- set: "s3api, s3, policy|user, non-static, folder IAM"
|
||||
# IAM_TYPE: folder
|
||||
# RUN_SET: "s3api-policy,s3api-user"
|
||||
# RECREATE_BUCKETS: "true"
|
||||
# BACKEND: "s3"
|
||||
- set: "s3cmd, posix, file count, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3cmd-file-count"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3cmd, posix, non-user, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3cmd-non-user"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
- set: "s3cmd, posix, user, non-static, folder IAM"
|
||||
IAM_TYPE: folder
|
||||
RUN_SET: "s3cmd-user"
|
||||
RECREATE_BUCKETS: "true"
|
||||
BACKEND: "posix"
|
||||
steps:
|
||||
- name: Check out code into the Go module directory
|
||||
uses: actions/checkout@v6
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v6
|
||||
uses: actions/setup-go@v5
|
||||
with:
|
||||
go-version: "stable"
|
||||
go-version: 'stable'
|
||||
id: go
|
||||
|
||||
- name: Get Dependencies
|
||||
@@ -47,7 +122,6 @@ jobs:
|
||||
|
||||
- name: Install s3cmd
|
||||
run: |
|
||||
sudo apt-get update
|
||||
sudo apt-get install s3cmd
|
||||
|
||||
- name: Install mc
|
||||
@@ -55,10 +129,9 @@ jobs:
|
||||
curl https://dl.min.io/client/mc/release/linux-amd64/mc --create-dirs -o /usr/local/bin/mc
|
||||
chmod 755 /usr/local/bin/mc
|
||||
|
||||
- name: Install xml libraries (for rest)
|
||||
- name: Install xmllint (for rest)
|
||||
run: |
|
||||
sudo apt-get update
|
||||
sudo apt-get install libxml2-utils xmlstarlet
|
||||
sudo apt-get install libxml2-utils
|
||||
|
||||
# see https://github.com/versity/versitygw/issues/1034
|
||||
- name: Install AWS cli
|
||||
@@ -77,7 +150,6 @@ jobs:
|
||||
RUN_VERSITYGW: true
|
||||
BACKEND: ${{ matrix.BACKEND }}
|
||||
RECREATE_BUCKETS: ${{ matrix.RECREATE_BUCKETS }}
|
||||
DELETE_BUCKETS_AFTER_TEST: ${{ matrix.DELETE_BUCKETS_AFTER_TEST }}
|
||||
CERT: ${{ github.workspace }}/cert.pem
|
||||
KEY: ${{ github.workspace }}/versitygw.pem
|
||||
LOCAL_FOLDER: /tmp/gw
|
||||
@@ -91,9 +163,9 @@ jobs:
|
||||
MC_ALIAS: versity
|
||||
LOG_LEVEL: 4
|
||||
GOCOVERDIR: ${{ github.workspace }}/cover
|
||||
USERNAME_ONE: HIJKLMN
|
||||
USERNAME_ONE: ABCDEFG
|
||||
PASSWORD_ONE: 1234567
|
||||
USERNAME_TWO: OPQRSTU
|
||||
USERNAME_TWO: HIJKLMN
|
||||
PASSWORD_TWO: 8901234
|
||||
TEST_FILE_FOLDER: ${{ github.workspace }}/versity-gwtest-files
|
||||
REMOVE_TEST_FILE_FOLDER: true
|
||||
@@ -101,14 +173,11 @@ jobs:
|
||||
COMMAND_LOG: command.log
|
||||
TIME_LOG: time.log
|
||||
PYTHON_ENV_FOLDER: ${{ github.workspace }}/env
|
||||
AUTOGENERATE_USERS: true
|
||||
USER_AUTOGENERATION_PREFIX: github-actions-test-
|
||||
AWS_REGION: ${{ matrix.AWS_REGION }}
|
||||
run: |
|
||||
make testbin
|
||||
export AWS_ACCESS_KEY_ID=ABCDEFGHIJKLMNOPQRST
|
||||
export AWS_SECRET_ACCESS_KEY=ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmn
|
||||
export AWS_REGION=$AWS_REGION
|
||||
export AWS_REGION=us-east-1
|
||||
export AWS_ACCESS_KEY_ID_TWO=user
|
||||
export AWS_SECRET_ACCESS_KEY_TWO=pass
|
||||
export AWS_REQUEST_CHECKSUM_CALCULATION=WHEN_REQUIRED
|
||||
@@ -123,13 +192,10 @@ jobs:
|
||||
if [[ $RECREATE_BUCKETS == "false" ]]; then
|
||||
BYPASS_ENV_FILE=true ${{ github.workspace }}/tests/setup_static.sh
|
||||
fi
|
||||
BYPASS_ENV_FILE=true $HOME/bin/bats ${{ github.workspace }}/$RUN_SET
|
||||
BYPASS_ENV_FILE=true ${{ github.workspace }}/tests/run.sh $RUN_SET
|
||||
|
||||
- name: Time report
|
||||
run: |
|
||||
if [ -e ${{ github.workspace }}/time.log ]; then
|
||||
cat ${{ github.workspace }}/time.log
|
||||
fi
|
||||
run: cat ${{ github.workspace }}/time.log
|
||||
|
||||
- name: Coverage report
|
||||
run: |
|
||||
|
||||
@@ -1,5 +1,3 @@
|
||||
version: 2
|
||||
|
||||
before:
|
||||
hooks:
|
||||
- go mod tidy
|
||||
@@ -25,7 +23,7 @@ builds:
|
||||
- -X=main.Build={{.Commit}} -X=main.BuildTime={{.Date}} -X=main.Version={{.Version}}
|
||||
|
||||
archives:
|
||||
- formats: [ 'tar.gz' ]
|
||||
- format: tar.gz
|
||||
# this name template makes the OS and Arch compatible with the results of uname.
|
||||
name_template: >-
|
||||
{{ .ProjectName }}_v{{ .Version }}_
|
||||
@@ -45,7 +43,7 @@ archives:
|
||||
# use zip for windows archives
|
||||
format_overrides:
|
||||
- goos: windows
|
||||
formats: [ 'zip' ]
|
||||
format: zip
|
||||
|
||||
# Additional files/globs you want to add to the archive.
|
||||
#
|
||||
@@ -60,7 +58,7 @@ checksum:
|
||||
name_template: 'checksums.txt'
|
||||
|
||||
snapshot:
|
||||
version_template: "{{ incpatch .Version }}-{{.ShortCommit}}"
|
||||
name_template: "{{ incpatch .Version }}-next"
|
||||
|
||||
changelog:
|
||||
sort: asc
|
||||
@@ -88,7 +86,7 @@ nfpms:
|
||||
|
||||
license: Apache 2.0
|
||||
|
||||
ids:
|
||||
builds:
|
||||
- versitygw
|
||||
|
||||
formats:
|
||||
|
||||
@@ -23,16 +23,13 @@ RUN go build -ldflags "-X=main.Build=${BUILD} -X=main.BuildTime=${TIME} -X=main.
|
||||
|
||||
FROM alpine:latest
|
||||
|
||||
# These arguments can be overridden when building the image
|
||||
# These arguments can be overriden when building the image
|
||||
ARG IAM_DIR=/tmp/vgw
|
||||
ARG SETUP_DIR=/tmp/vgw
|
||||
|
||||
RUN mkdir -p $IAM_DIR
|
||||
RUN mkdir -p $SETUP_DIR
|
||||
|
||||
COPY --from=0 /app/cmd/versitygw/versitygw /usr/local/bin/versitygw
|
||||
COPY --from=0 /app/cmd/versitygw/versitygw /app/versitygw
|
||||
|
||||
COPY docker-entrypoint.sh /usr/local/bin/docker-entrypoint.sh
|
||||
RUN chmod +x /usr/local/bin/docker-entrypoint.sh
|
||||
|
||||
ENTRYPOINT [ "/usr/local/bin/docker-entrypoint.sh" ]
|
||||
ENTRYPOINT [ "/app/versitygw" ]
|
||||
|
||||
11
Makefile
11
Makefile
@@ -72,11 +72,6 @@ dist:
|
||||
rm -f VERSION
|
||||
gzip -f $(TARFILE)
|
||||
|
||||
.PHONY: snapshot
|
||||
snapshot:
|
||||
# brew install goreleaser/tap/goreleaser
|
||||
goreleaser release --snapshot --skip publish --clean
|
||||
|
||||
# Creates and runs S3 gateway instance in a docker container
|
||||
.PHONY: up-posix
|
||||
up-posix:
|
||||
@@ -96,9 +91,3 @@ up-azurite:
|
||||
.PHONY: up-app
|
||||
up-app:
|
||||
$(DOCKERCOMPOSE) up
|
||||
|
||||
# Run the host-style tests in docker containers
|
||||
.PHONY: test-host-style
|
||||
test-host-style:
|
||||
docker compose -f tests/host-style-tests/docker-compose.yml up --build --abort-on-container-exit --exit-code-from test
|
||||
|
||||
|
||||
23
README.md
23
README.md
@@ -70,29 +70,6 @@ versitygw [global options] command [command options] [arguments...]
|
||||
```
|
||||
The [global options](https://github.com/versity/versitygw/wiki/Global-Options) are specified before the backend type and the backend options are specified after.
|
||||
|
||||
### Run the gateway in Docker
|
||||
|
||||
Use the published image like the native binary by passing CLI arguments:
|
||||
|
||||
```bash
|
||||
docker run --rm versity/versitygw:latest --version
|
||||
```
|
||||
|
||||
When no command arguments are supplied, the container looks for `VGW_BACKEND` and optional `VGW_BACKEND_ARG`/`VGW_BACKEND_ARGS` environment variables to determine which backend to start. Backend-specific configuration continues to come from the existing environment flags (for example `ROOT_ACCESS_KEY`, `VGW_PORT`, and others).
|
||||
|
||||
```bash
|
||||
docker run --rm \
|
||||
-e ROOT_ACCESS_KEY=testuser \
|
||||
-e ROOT_SECRET_KEY=secret \
|
||||
-e VGW_BACKEND=posix \
|
||||
-e VGW_BACKEND_ARG=/data \
|
||||
-p 10000:7070 \
|
||||
-v $(pwd)/data:/data \
|
||||
versity/versitygw:latest
|
||||
```
|
||||
|
||||
If you need to pass additional CLI options, set `VGW_ARGS` with a space-delimited list, or continue passing arguments directly to `docker run`.
|
||||
|
||||
***
|
||||
|
||||
#### Versity gives you clarity and control over your archival storage, so you can allocate more resources to your core mission.
|
||||
|
||||
@@ -1,189 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"strings"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func VerifyObjectCopyAccess(ctx context.Context, be backend.Backend, copySource string, opts AccessOptions) error {
|
||||
if opts.IsRoot {
|
||||
return nil
|
||||
}
|
||||
if opts.Acc.Role == RoleAdmin {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Verify destination bucket access
|
||||
if err := VerifyAccess(ctx, be, opts); err != nil {
|
||||
return err
|
||||
}
|
||||
// Verify source bucket access
|
||||
srcBucket, srcObject, found := strings.Cut(copySource, "/")
|
||||
if !found {
|
||||
return s3err.GetAPIError(s3err.ErrInvalidCopySourceBucket)
|
||||
}
|
||||
|
||||
// Get source bucket ACL
|
||||
srcBucketACLBytes, err := be.GetBucketAcl(ctx, &s3.GetBucketAclInput{Bucket: &srcBucket})
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
var srcBucketAcl ACL
|
||||
if err := json.Unmarshal(srcBucketACLBytes, &srcBucketAcl); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if err := VerifyAccess(ctx, be, AccessOptions{
|
||||
Acl: srcBucketAcl,
|
||||
AclPermission: PermissionRead,
|
||||
IsRoot: opts.IsRoot,
|
||||
Acc: opts.Acc,
|
||||
Bucket: srcBucket,
|
||||
Object: srcObject,
|
||||
Action: GetObjectAction,
|
||||
}); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
type AccessOptions struct {
|
||||
Acl ACL
|
||||
AclPermission Permission
|
||||
IsRoot bool
|
||||
Acc Account
|
||||
Bucket string
|
||||
Object string
|
||||
Action Action
|
||||
Readonly bool
|
||||
IsPublicRequest bool
|
||||
}
|
||||
|
||||
func VerifyAccess(ctx context.Context, be backend.Backend, opts AccessOptions) error {
|
||||
if opts.Readonly {
|
||||
if opts.AclPermission == PermissionWrite || opts.AclPermission == PermissionWriteAcp {
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
}
|
||||
// Skip the access check for public bucket requests
|
||||
if opts.IsPublicRequest {
|
||||
return nil
|
||||
}
|
||||
if opts.IsRoot {
|
||||
return nil
|
||||
}
|
||||
if opts.Acc.Role == RoleAdmin {
|
||||
return nil
|
||||
}
|
||||
|
||||
policy, policyErr := be.GetBucketPolicy(ctx, opts.Bucket)
|
||||
if policyErr != nil {
|
||||
if !errors.Is(policyErr, s3err.GetAPIError(s3err.ErrNoSuchBucketPolicy)) {
|
||||
return policyErr
|
||||
}
|
||||
} else {
|
||||
return VerifyBucketPolicy(policy, opts.Acc.Access, opts.Bucket, opts.Object, opts.Action)
|
||||
}
|
||||
|
||||
if err := verifyACL(opts.Acl, opts.Acc.Access, opts.AclPermission); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Detects if the action is policy related
|
||||
// e.g.
|
||||
// 'GetBucketPolicy', 'PutBucketPolicy'
|
||||
func isPolicyAction(action Action) bool {
|
||||
return action == GetBucketPolicyAction || action == PutBucketPolicyAction
|
||||
}
|
||||
|
||||
// VerifyPublicAccess checks if the bucket is publically accessible by ACL or Policy
|
||||
func VerifyPublicAccess(ctx context.Context, be backend.Backend, action Action, permission Permission, bucket, object string) error {
|
||||
// ACL disabled
|
||||
policy, err := be.GetBucketPolicy(ctx, bucket)
|
||||
if err != nil && !errors.Is(err, s3err.GetAPIError(s3err.ErrNoSuchBucketPolicy)) {
|
||||
return err
|
||||
}
|
||||
if err == nil {
|
||||
err = VerifyPublicBucketPolicy(policy, bucket, object, action)
|
||||
if err == nil {
|
||||
// if ACLs are disabled, and the bucket grants public access,
|
||||
// policy actions should return 'MethodNotAllowed'
|
||||
if isPolicyAction(action) {
|
||||
return s3err.GetAPIError(s3err.ErrMethodNotAllowed)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
// if the action is not in the ACL whitelist the access is denied
|
||||
_, ok := publicACLAllowedActions[action]
|
||||
if !ok {
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
err = VerifyPublicBucketACL(ctx, be, bucket, action, permission)
|
||||
if err != nil {
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func IsAdminOrOwner(acct Account, isRoot bool, acl ACL) error {
|
||||
// Owner check
|
||||
if acct.Access == acl.Owner {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Root user has access over almost everything
|
||||
if isRoot {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Admin user case
|
||||
if acct.Role == RoleAdmin {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Return access denied in all other cases
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
type PublicACLAllowedActions map[Action]struct{}
|
||||
|
||||
var publicACLAllowedActions PublicACLAllowedActions = PublicACLAllowedActions{
|
||||
ListBucketAction: struct{}{},
|
||||
PutObjectAction: struct{}{},
|
||||
ListBucketMultipartUploadsAction: struct{}{},
|
||||
DeleteObjectAction: struct{}{},
|
||||
ListBucketVersionsAction: struct{}{},
|
||||
GetObjectAction: struct{}{},
|
||||
GetObjectAttributesAction: struct{}{},
|
||||
GetObjectAclAction: struct{}{},
|
||||
}
|
||||
155
auth/acl.go
155
auth/acl.go
@@ -25,7 +25,6 @@ import (
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
@@ -34,17 +33,6 @@ type ACL struct {
|
||||
Grantees []Grantee
|
||||
}
|
||||
|
||||
// IsPublic specifies if the acl grants public read access
|
||||
func (acl *ACL) IsPublic(permission Permission) bool {
|
||||
for _, grt := range acl.Grantees {
|
||||
if grt.Permission == permission && grt.Type == types.TypeGroup && grt.Access == "all-users" {
|
||||
return true
|
||||
}
|
||||
}
|
||||
|
||||
return false
|
||||
}
|
||||
|
||||
type Grantee struct {
|
||||
Permission Permission
|
||||
Access string
|
||||
@@ -246,7 +234,7 @@ func ParseACLOutput(data []byte, owner string) (GetBucketAclOutput, error) {
|
||||
}, nil
|
||||
}
|
||||
|
||||
func UpdateACL(input *PutBucketAclInput, acl ACL, iam IAMService) ([]byte, error) {
|
||||
func UpdateACL(input *PutBucketAclInput, acl ACL, iam IAMService, isAdmin bool) ([]byte, error) {
|
||||
if input == nil {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidRequest)
|
||||
}
|
||||
@@ -386,7 +374,7 @@ func CheckIfAccountsExist(accs []string, iam IAMService) ([]string, error) {
|
||||
for _, acc := range accs {
|
||||
_, err := iam.GetUserAccount(acc)
|
||||
if err != nil {
|
||||
if err == ErrNoSuchUser || err == s3err.GetAPIError(s3err.ErrAdminUserNotFound) {
|
||||
if err == ErrNoSuchUser {
|
||||
result = append(result, acc)
|
||||
continue
|
||||
}
|
||||
@@ -447,61 +435,118 @@ func verifyACL(acl ACL, access string, permission Permission) error {
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
// Verifies if the bucket acl grants public access
|
||||
func VerifyPublicBucketACL(ctx context.Context, be backend.Backend, bucket string, action Action, permission Permission) error {
|
||||
aclBytes, err := be.GetBucketAcl(ctx, &s3.GetBucketAclInput{
|
||||
Bucket: &bucket,
|
||||
})
|
||||
if err != nil {
|
||||
return err
|
||||
func MayCreateBucket(acct Account, isRoot bool) error {
|
||||
if isRoot {
|
||||
return nil
|
||||
}
|
||||
|
||||
acl, err := ParseACL(aclBytes)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !acl.IsPublic(permission) {
|
||||
return ErrAccessDenied
|
||||
if acct.Role == RoleUser {
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// UpdateBucketACLOwner sets default ACL with new owner and removes
|
||||
// any previous bucket policy that was in place
|
||||
func UpdateBucketACLOwner(ctx context.Context, be backend.Backend, bucket, newOwner string) error {
|
||||
acl := ACL{
|
||||
Owner: newOwner,
|
||||
Grantees: []Grantee{
|
||||
{
|
||||
Permission: PermissionFullControl,
|
||||
Access: newOwner,
|
||||
Type: types.TypeCanonicalUser,
|
||||
},
|
||||
},
|
||||
func IsAdminOrOwner(acct Account, isRoot bool, acl ACL) error {
|
||||
// Owner check
|
||||
if acct.Access == acl.Owner {
|
||||
return nil
|
||||
}
|
||||
|
||||
result, err := json.Marshal(acl)
|
||||
if err != nil {
|
||||
return fmt.Errorf("marshal ACL: %w", err)
|
||||
// Root user has access over almost everything
|
||||
if isRoot {
|
||||
return nil
|
||||
}
|
||||
|
||||
err = be.PutBucketAcl(ctx, bucket, result)
|
||||
// Admin user case
|
||||
if acct.Role == RoleAdmin {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Return access denied in all other cases
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
type AccessOptions struct {
|
||||
Acl ACL
|
||||
AclPermission Permission
|
||||
IsRoot bool
|
||||
Acc Account
|
||||
Bucket string
|
||||
Object string
|
||||
Action Action
|
||||
Readonly bool
|
||||
}
|
||||
|
||||
func VerifyAccess(ctx context.Context, be backend.Backend, opts AccessOptions) error {
|
||||
if opts.Readonly {
|
||||
if opts.AclPermission == PermissionWrite || opts.AclPermission == PermissionWriteAcp {
|
||||
return s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
}
|
||||
if opts.IsRoot {
|
||||
return nil
|
||||
}
|
||||
if opts.Acc.Role == RoleAdmin {
|
||||
return nil
|
||||
}
|
||||
|
||||
policy, policyErr := be.GetBucketPolicy(ctx, opts.Bucket)
|
||||
if policyErr != nil {
|
||||
if !errors.Is(policyErr, s3err.GetAPIError(s3err.ErrNoSuchBucketPolicy)) {
|
||||
return policyErr
|
||||
}
|
||||
} else {
|
||||
return VerifyBucketPolicy(policy, opts.Acc.Access, opts.Bucket, opts.Object, opts.Action)
|
||||
}
|
||||
|
||||
if err := verifyACL(opts.Acl, opts.Acc.Access, opts.AclPermission); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func VerifyObjectCopyAccess(ctx context.Context, be backend.Backend, copySource string, opts AccessOptions) error {
|
||||
if opts.IsRoot {
|
||||
return nil
|
||||
}
|
||||
if opts.Acc.Role == RoleAdmin {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Verify destination bucket access
|
||||
if err := VerifyAccess(ctx, be, opts); err != nil {
|
||||
return err
|
||||
}
|
||||
// Verify source bucket access
|
||||
srcBucket, srcObject, found := strings.Cut(copySource, "/")
|
||||
if !found {
|
||||
return s3err.GetAPIError(s3err.ErrInvalidCopySource)
|
||||
}
|
||||
|
||||
// Get source bucket ACL
|
||||
srcBucketACLBytes, err := be.GetBucketAcl(ctx, &s3.GetBucketAclInput{Bucket: &srcBucket})
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return be.DeleteBucketPolicy(ctx, bucket)
|
||||
}
|
||||
|
||||
// ValidateCannedACL validates bucket canned acl value
|
||||
func ValidateCannedACL(acl string) error {
|
||||
switch types.BucketCannedACL(acl) {
|
||||
case types.BucketCannedACLPrivate, types.BucketCannedACLPublicRead, types.BucketCannedACLPublicReadWrite, "":
|
||||
return nil
|
||||
default:
|
||||
debuglogger.Logf("invalid bucket canned acl: %v", acl)
|
||||
return s3err.GetAPIError(s3err.ErrInvalidArgument)
|
||||
var srcBucketAcl ACL
|
||||
if err := json.Unmarshal(srcBucketACLBytes, &srcBucketAcl); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if err := VerifyAccess(ctx, be, AccessOptions{
|
||||
Acl: srcBucketAcl,
|
||||
AclPermission: PermissionRead,
|
||||
IsRoot: opts.IsRoot,
|
||||
Acc: opts.Acc,
|
||||
Bucket: srcBucket,
|
||||
Object: srcObject,
|
||||
Action: GetObjectAction,
|
||||
}); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -1,338 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
import (
|
||||
"encoding/xml"
|
||||
"fmt"
|
||||
"net/http"
|
||||
"regexp"
|
||||
"strings"
|
||||
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
// headerRegex is the regexp to validate http header names
|
||||
var headerRegex = regexp.MustCompile(`^[!#$%&'*+\-.^_` + "`" + `|~0-9A-Za-z]+$`)
|
||||
|
||||
type CORSHeader string
|
||||
type CORSHTTPMethod string
|
||||
|
||||
// IsValid validates the CORS http header
|
||||
// the rules are based on http RFC
|
||||
// https://datatracker.ietf.org/doc/html/rfc7230#section-3.2
|
||||
//
|
||||
// Empty values are considered as valid
|
||||
func (ch CORSHeader) IsValid() bool {
|
||||
return ch == "" || headerRegex.MatchString(ch.String())
|
||||
}
|
||||
|
||||
// String converts the header value to 'string'
|
||||
func (ch CORSHeader) String() string {
|
||||
return string(ch)
|
||||
}
|
||||
|
||||
// ToLower converts the header to lower case
|
||||
func (ch CORSHeader) ToLower() string {
|
||||
return strings.ToLower(string(ch))
|
||||
}
|
||||
|
||||
// IsValid validates the cors http request method:
|
||||
// the methods are case sensitive
|
||||
func (cm CORSHTTPMethod) IsValid() bool {
|
||||
return cm.IsEmpty() || cm == http.MethodGet || cm == http.MethodHead || cm == http.MethodPut ||
|
||||
cm == http.MethodPost || cm == http.MethodDelete
|
||||
}
|
||||
|
||||
// IsEmpty checks if the cors method is an empty string
|
||||
func (cm CORSHTTPMethod) IsEmpty() bool {
|
||||
return cm == ""
|
||||
}
|
||||
|
||||
// String converts the method value to 'string'
|
||||
func (cm CORSHTTPMethod) String() string {
|
||||
return string(cm)
|
||||
}
|
||||
|
||||
type CORSConfiguration struct {
|
||||
Rules []CORSRule `xml:"CORSRule"`
|
||||
}
|
||||
|
||||
// Validate validates the cors configuration rules
|
||||
func (cc *CORSConfiguration) Validate() error {
|
||||
if cc == nil || cc.Rules == nil {
|
||||
debuglogger.Logf("invalid CORS configuration")
|
||||
return s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
if len(cc.Rules) == 0 {
|
||||
debuglogger.Logf("empty CORS config rules")
|
||||
return s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
// validate each CORS rule
|
||||
for _, rule := range cc.Rules {
|
||||
if err := rule.Validate(); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
type CORSAllowanceConfig struct {
|
||||
Origin string
|
||||
Methods string
|
||||
ExposedHeaders string
|
||||
AllowCredentials string
|
||||
AllowHeaders string
|
||||
MaxAge *int32
|
||||
}
|
||||
|
||||
// IsAllowed walks through the CORS rules and finds the first one allowing access.
|
||||
// If no rule grants access, returns 'AccessForbidden'
|
||||
func (cc *CORSConfiguration) IsAllowed(origin string, method CORSHTTPMethod, headers []CORSHeader) (*CORSAllowanceConfig, error) {
|
||||
// if method is empty, anyways cors is forbidden
|
||||
// skip, without going through the rules
|
||||
if method.IsEmpty() {
|
||||
debuglogger.Logf("empty Access-Control-Request-Method")
|
||||
return nil, s3err.GetAPIError(s3err.ErrCORSForbidden)
|
||||
}
|
||||
for _, rule := range cc.Rules {
|
||||
// find the first rule granting access
|
||||
if isAllowed, wilcardOrigin := rule.Match(origin, method, headers); isAllowed {
|
||||
o := origin
|
||||
allowCredentials := "true"
|
||||
if wilcardOrigin {
|
||||
o = "*"
|
||||
allowCredentials = "false"
|
||||
}
|
||||
|
||||
return &CORSAllowanceConfig{
|
||||
Origin: o,
|
||||
AllowCredentials: allowCredentials,
|
||||
Methods: rule.GetAllowedMethods(),
|
||||
ExposedHeaders: rule.GetExposeHeaders(),
|
||||
AllowHeaders: buildAllowedHeaders(headers),
|
||||
MaxAge: rule.MaxAgeSeconds,
|
||||
}, nil
|
||||
}
|
||||
}
|
||||
|
||||
// if no matching rule is found, return AccessForbidden
|
||||
return nil, s3err.GetAPIError(s3err.ErrCORSForbidden)
|
||||
}
|
||||
|
||||
type CORSRule struct {
|
||||
AllowedMethods []CORSHTTPMethod `xml:"AllowedMethod"`
|
||||
AllowedHeaders []CORSHeader `xml:"AllowedHeader"`
|
||||
ExposeHeaders []CORSHeader `xml:"ExposeHeader"`
|
||||
AllowedOrigins []string `xml:"AllowedOrigin"`
|
||||
ID *string
|
||||
MaxAgeSeconds *int32
|
||||
}
|
||||
|
||||
// Validate validates and returns error if CORS configuration has invalid rule
|
||||
func (cr *CORSRule) Validate() error {
|
||||
// validate CORS allowed headers
|
||||
for _, header := range cr.AllowedHeaders {
|
||||
if !header.IsValid() {
|
||||
debuglogger.Logf("invalid CORS allowed header: %s", header)
|
||||
return s3err.GetInvalidCORSHeaderErr(header.String())
|
||||
}
|
||||
}
|
||||
// validate CORS allowed methods
|
||||
for _, method := range cr.AllowedMethods {
|
||||
if !method.IsValid() {
|
||||
debuglogger.Logf("invalid CORS allowed method: %s", method)
|
||||
return s3err.GetUnsopportedCORSMethodErr(method.String())
|
||||
}
|
||||
}
|
||||
// validate CORS expose headers
|
||||
for _, header := range cr.ExposeHeaders {
|
||||
if !header.IsValid() {
|
||||
debuglogger.Logf("invalid CORS exposed header: %s", header)
|
||||
return s3err.GetInvalidCORSHeaderErr(header.String())
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Match matches the provided origin, method and headers with the
|
||||
// CORS configuration rule
|
||||
// if the matching origin is "*", it returns true as the first argument
|
||||
func (cr *CORSRule) Match(origin string, method CORSHTTPMethod, headers []CORSHeader) (bool, bool) {
|
||||
wildcardOrigin := false
|
||||
originFound := false
|
||||
|
||||
// check if the provided origin exists in CORS AllowedOrigins
|
||||
for _, or := range cr.AllowedOrigins {
|
||||
if wildcardMatch(or, origin) {
|
||||
originFound = true
|
||||
if or == "*" {
|
||||
// mark wildcardOrigin as true, if "*" is found in AllowedOrigins
|
||||
wildcardOrigin = true
|
||||
}
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if !originFound {
|
||||
return false, false
|
||||
}
|
||||
|
||||
// cache the CORS AllowedMethods in a map
|
||||
allowedMethods := cacheCORSMethods(cr.AllowedMethods)
|
||||
// check if the provided method exists in CORS AllowedMethods
|
||||
if _, ok := allowedMethods[method]; !ok {
|
||||
return false, false
|
||||
}
|
||||
|
||||
// check is CORS rule allowed headers match
|
||||
// with the requested allowed headers
|
||||
for _, reqHeader := range headers {
|
||||
match := false
|
||||
for _, header := range cr.AllowedHeaders {
|
||||
if wildcardMatch(header.ToLower(), reqHeader.ToLower()) {
|
||||
match = true
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if !match {
|
||||
return false, false
|
||||
}
|
||||
}
|
||||
|
||||
return true, wildcardOrigin
|
||||
}
|
||||
|
||||
// GetExposeHeaders returns comma separated CORS expose headers
|
||||
func (cr *CORSRule) GetExposeHeaders() string {
|
||||
var result strings.Builder
|
||||
|
||||
for i, h := range cr.ExposeHeaders {
|
||||
if i > 0 {
|
||||
result.WriteString(", ")
|
||||
}
|
||||
result.WriteString(h.String())
|
||||
}
|
||||
|
||||
return result.String()
|
||||
}
|
||||
|
||||
// buildAllowedHeaders builds a comma separated string from []CORSHeader
|
||||
func buildAllowedHeaders(headers []CORSHeader) string {
|
||||
var result strings.Builder
|
||||
|
||||
for i, h := range headers {
|
||||
if i > 0 {
|
||||
result.WriteString(", ")
|
||||
}
|
||||
result.WriteString(h.ToLower())
|
||||
}
|
||||
|
||||
return result.String()
|
||||
}
|
||||
|
||||
// GetAllowedMethods returns comma separated CORS allowed methods
|
||||
func (cr *CORSRule) GetAllowedMethods() string {
|
||||
var result strings.Builder
|
||||
|
||||
for i, m := range cr.AllowedMethods {
|
||||
if i > 0 {
|
||||
result.WriteString(", ")
|
||||
}
|
||||
result.WriteString(m.String())
|
||||
}
|
||||
|
||||
return result.String()
|
||||
}
|
||||
|
||||
// ParseCORSOutput parses raw bytes to 'CORSConfiguration'
|
||||
func ParseCORSOutput(data []byte) (*CORSConfiguration, error) {
|
||||
var config CORSConfiguration
|
||||
err := xml.Unmarshal(data, &config)
|
||||
if err != nil {
|
||||
debuglogger.Logf("unmarshal cors output: %v", err)
|
||||
return nil, fmt.Errorf("failed to parse cors config: %w", err)
|
||||
}
|
||||
|
||||
return &config, nil
|
||||
}
|
||||
|
||||
func cacheCORSMethods(input []CORSHTTPMethod) map[CORSHTTPMethod]struct{} {
|
||||
result := make(map[CORSHTTPMethod]struct{}, len(input))
|
||||
for _, el := range input {
|
||||
result[el] = struct{}{}
|
||||
}
|
||||
|
||||
return result
|
||||
}
|
||||
|
||||
// ParseCORSHeaders parses/validates Access-Control-Request-Headers
|
||||
// and returns []CORSHeaders
|
||||
func ParseCORSHeaders(headers string) ([]CORSHeader, error) {
|
||||
result := []CORSHeader{}
|
||||
if headers == "" {
|
||||
return result, nil
|
||||
}
|
||||
|
||||
headersSplitted := strings.Split(headers, ",")
|
||||
for _, h := range headersSplitted {
|
||||
corsHeader := CORSHeader(strings.TrimSpace(h))
|
||||
if corsHeader == "" || !corsHeader.IsValid() {
|
||||
debuglogger.Logf("invalid access control header: %s", h)
|
||||
return nil, s3err.GetInvalidCORSRequestHeaderErr(h)
|
||||
}
|
||||
result = append(result, corsHeader)
|
||||
}
|
||||
|
||||
return result, nil
|
||||
}
|
||||
|
||||
func wildcardMatch(pattern, input string) bool {
|
||||
pIdx, sIdx := 0, 0
|
||||
starIdx, matchIdx := -1, 0
|
||||
|
||||
for sIdx < len(input) {
|
||||
if pIdx < len(pattern) && pattern[pIdx] == input[sIdx] {
|
||||
// exact match of current char
|
||||
sIdx++
|
||||
pIdx++
|
||||
} else if pIdx < len(pattern) && pattern[pIdx] == '*' {
|
||||
// remember star position
|
||||
starIdx = pIdx
|
||||
matchIdx = sIdx
|
||||
pIdx++
|
||||
} else if starIdx != -1 {
|
||||
// backtrack: try to match more characters with '*'
|
||||
pIdx = starIdx + 1
|
||||
matchIdx++
|
||||
sIdx = matchIdx
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
// skip trailing stars
|
||||
for pIdx < len(pattern) && pattern[pIdx] == '*' {
|
||||
pIdx++
|
||||
}
|
||||
|
||||
return pIdx == len(pattern)
|
||||
}
|
||||
@@ -1,736 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
import (
|
||||
"net/http"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func TestCORSHeader_IsValid(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
header CORSHeader
|
||||
want bool
|
||||
}{
|
||||
{"empty", "", true},
|
||||
{"valid", "X-Custom-Header", true},
|
||||
{"invalid_1", "Invalid Header", false},
|
||||
{"invalid_2", "invalid/header", false},
|
||||
{"invalid_3", "Invalid\tHeader", false},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
if got := tt.header.IsValid(); got != tt.want {
|
||||
t.Errorf("IsValid() = %v, want %v", got, tt.want)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCORSHTTPMethod_IsValid(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
method CORSHTTPMethod
|
||||
want bool
|
||||
}{
|
||||
{"empty valid", "", true},
|
||||
{"GET valid", http.MethodGet, true},
|
||||
{"HEAD valid", http.MethodHead, true},
|
||||
{"PUT valid", http.MethodPut, true},
|
||||
{"POST valid", http.MethodPost, true},
|
||||
{"DELETE valid", http.MethodDelete, true},
|
||||
{"get valid", "get", false},
|
||||
{"put valid", "put", false},
|
||||
{"post valid", "post", false},
|
||||
{"head valid", "head", false},
|
||||
{"invalid", "FOO", false},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
if got := tt.method.IsValid(); got != tt.want {
|
||||
t.Errorf("IsValid() = %v, want %v", got, tt.want)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCORSHeader_ToLower(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
header CORSHeader
|
||||
want string
|
||||
}{
|
||||
{
|
||||
name: "already lowercase",
|
||||
header: CORSHeader("content-type"),
|
||||
want: "content-type",
|
||||
},
|
||||
{
|
||||
name: "mixed case",
|
||||
header: CORSHeader("X-CuStOm-HeAdEr"),
|
||||
want: "x-custom-header",
|
||||
},
|
||||
{
|
||||
name: "uppercase",
|
||||
header: CORSHeader("AUTHORIZATION"),
|
||||
want: "authorization",
|
||||
},
|
||||
{
|
||||
name: "empty string",
|
||||
header: CORSHeader(""),
|
||||
want: "",
|
||||
},
|
||||
{
|
||||
name: "numeric and symbols",
|
||||
header: CORSHeader("X-123-HEADER"),
|
||||
want: "x-123-header",
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := tt.header.ToLower()
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCORSHTTPMethod_IsEmpty(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
method CORSHTTPMethod
|
||||
want bool
|
||||
}{
|
||||
{
|
||||
name: "empty string is empty",
|
||||
method: CORSHTTPMethod(""),
|
||||
want: true,
|
||||
},
|
||||
{
|
||||
name: "GET method is not empty",
|
||||
method: CORSHTTPMethod("GET"),
|
||||
want: false,
|
||||
},
|
||||
{
|
||||
name: "random string is not empty",
|
||||
method: CORSHTTPMethod("FOO"),
|
||||
want: false,
|
||||
},
|
||||
{
|
||||
name: "lowercase get is not empty (case sensitive)",
|
||||
method: CORSHTTPMethod("get"),
|
||||
want: false,
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := tt.method.IsEmpty()
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCORSConfiguration_Validate(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
cfg *CORSConfiguration
|
||||
want error
|
||||
}{
|
||||
{"nil config", nil, s3err.GetAPIError(s3err.ErrMalformedXML)},
|
||||
{"nil rules", &CORSConfiguration{}, s3err.GetAPIError(s3err.ErrMalformedXML)},
|
||||
{"empty rules", &CORSConfiguration{Rules: []CORSRule{}}, s3err.GetAPIError(s3err.ErrMalformedXML)},
|
||||
{"invalid rule", &CORSConfiguration{Rules: []CORSRule{{AllowedHeaders: []CORSHeader{"Invalid Header"}}}}, s3err.GetInvalidCORSHeaderErr("Invalid Header")},
|
||||
{"valid rule", &CORSConfiguration{Rules: []CORSRule{{
|
||||
AllowedOrigins: []string{"origin"},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
ExposeHeaders: []CORSHeader{"X-Expose"},
|
||||
}}}, nil},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
err := tt.cfg.Validate()
|
||||
assert.EqualValues(t, tt.want, err)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCORSConfiguration_IsAllowed(t *testing.T) {
|
||||
type input struct {
|
||||
cfg *CORSConfiguration
|
||||
origin string
|
||||
method CORSHTTPMethod
|
||||
headers []CORSHeader
|
||||
}
|
||||
type output struct {
|
||||
result *CORSAllowanceConfig
|
||||
err error
|
||||
}
|
||||
tests := []struct {
|
||||
name string
|
||||
input input
|
||||
output output
|
||||
}{
|
||||
{
|
||||
name: "allowed exact origin",
|
||||
input: input{
|
||||
cfg: &CORSConfiguration{Rules: []CORSRule{{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
}}},
|
||||
origin: "http://allowed.com",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{
|
||||
result: &CORSAllowanceConfig{
|
||||
Origin: "http://allowed.com",
|
||||
AllowCredentials: "true",
|
||||
Methods: http.MethodGet,
|
||||
AllowHeaders: "x-test",
|
||||
ExposedHeaders: "",
|
||||
MaxAge: nil,
|
||||
},
|
||||
err: nil,
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "allowed wildcard origin",
|
||||
input: input{
|
||||
cfg: &CORSConfiguration{Rules: []CORSRule{{
|
||||
AllowedOrigins: []string{"*"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
}}},
|
||||
origin: "anything",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{
|
||||
result: &CORSAllowanceConfig{
|
||||
Origin: "*",
|
||||
AllowCredentials: "false",
|
||||
AllowHeaders: "x-test",
|
||||
Methods: http.MethodGet,
|
||||
ExposedHeaders: "",
|
||||
MaxAge: nil,
|
||||
},
|
||||
err: nil,
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "forbidden no matching origin",
|
||||
input: input{
|
||||
cfg: &CORSConfiguration{Rules: []CORSRule{{
|
||||
AllowedOrigins: []string{"http://nope.com"},
|
||||
}}},
|
||||
origin: "http://not-allowed.com",
|
||||
method: http.MethodGet,
|
||||
},
|
||||
output: output{
|
||||
result: nil,
|
||||
err: s3err.GetAPIError(s3err.ErrCORSForbidden),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "forbidden method not allowed",
|
||||
input: input{
|
||||
cfg: &CORSConfiguration{Rules: []CORSRule{{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodPost},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
}}},
|
||||
origin: "http://allowed.com",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{
|
||||
result: nil,
|
||||
err: s3err.GetAPIError(s3err.ErrCORSForbidden),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "forbidden header not allowed",
|
||||
input: input{
|
||||
cfg: &CORSConfiguration{Rules: []CORSRule{{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
}}},
|
||||
origin: "http://allowed.com",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Nope"},
|
||||
},
|
||||
output: output{
|
||||
result: nil,
|
||||
err: s3err.GetAPIError(s3err.ErrCORSForbidden),
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got, err := tt.input.cfg.IsAllowed(tt.input.origin, tt.input.method, tt.input.headers)
|
||||
assert.EqualValues(t, tt.output.err, err)
|
||||
assert.EqualValues(t, tt.output.result, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCORSRule_Validate(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
rule CORSRule
|
||||
want error
|
||||
}{
|
||||
{
|
||||
name: "valid rule",
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
want: nil,
|
||||
},
|
||||
{
|
||||
name: "invalid allowed methods",
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{"invalid_method"},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
want: s3err.GetUnsopportedCORSMethodErr("invalid_method"),
|
||||
},
|
||||
{
|
||||
name: "invalid allowed header",
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"Invalid Header"},
|
||||
},
|
||||
want: s3err.GetInvalidCORSHeaderErr("Invalid Header"),
|
||||
},
|
||||
{
|
||||
name: "invalid allowed header",
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"Content-Length"},
|
||||
ExposeHeaders: []CORSHeader{"Content-Encoding", "invalid header"},
|
||||
},
|
||||
want: s3err.GetInvalidCORSHeaderErr("invalid header"),
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
err := tt.rule.Validate()
|
||||
assert.EqualValues(t, tt.want, err)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCORSRule_Match(t *testing.T) {
|
||||
type input struct {
|
||||
rule CORSRule
|
||||
origin string
|
||||
method CORSHTTPMethod
|
||||
headers []CORSHeader
|
||||
}
|
||||
type output struct {
|
||||
isAllowed bool
|
||||
isWildcard bool
|
||||
}
|
||||
tests := []struct {
|
||||
name string
|
||||
input input
|
||||
output output
|
||||
}{
|
||||
{
|
||||
name: "exact origin and method match",
|
||||
input: input{
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
origin: "http://allowed.com",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{isAllowed: true, isWildcard: false},
|
||||
},
|
||||
{
|
||||
name: "wildcard origin match",
|
||||
input: input{
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"*"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodPost},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
origin: "http://random.com",
|
||||
method: http.MethodPost,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{isAllowed: true, isWildcard: true},
|
||||
},
|
||||
{
|
||||
name: "wildcard containing origin match",
|
||||
input: input{
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://random*"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodPost},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
origin: "http://random.com",
|
||||
method: http.MethodPost,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{isAllowed: true, isWildcard: false},
|
||||
},
|
||||
{
|
||||
name: "wildcard allowed headers match",
|
||||
input: input{
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://something.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodPost},
|
||||
AllowedHeaders: []CORSHeader{"X-*"},
|
||||
},
|
||||
origin: "http://something.com",
|
||||
method: http.MethodPost,
|
||||
headers: []CORSHeader{"X-Test", "X-Something", "X-Anyting"},
|
||||
},
|
||||
output: output{isAllowed: true, isWildcard: false},
|
||||
},
|
||||
{
|
||||
name: "origin mismatch",
|
||||
input: input{
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
origin: "http://notallowed.com",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{isAllowed: false, isWildcard: false},
|
||||
},
|
||||
{
|
||||
name: "method mismatch",
|
||||
input: input{
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodPost},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
origin: "http://allowed.com",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Test"},
|
||||
},
|
||||
output: output{isAllowed: false, isWildcard: false},
|
||||
},
|
||||
{
|
||||
name: "header mismatch",
|
||||
input: input{
|
||||
rule: CORSRule{
|
||||
AllowedOrigins: []string{"http://allowed.com"},
|
||||
AllowedMethods: []CORSHTTPMethod{http.MethodGet},
|
||||
AllowedHeaders: []CORSHeader{"X-Test"},
|
||||
},
|
||||
origin: "http://allowed.com",
|
||||
method: http.MethodGet,
|
||||
headers: []CORSHeader{"X-Other"},
|
||||
},
|
||||
output: output{isAllowed: false, isWildcard: false},
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
isAllowed, wild := tt.input.rule.Match(tt.input.origin, tt.input.method, tt.input.headers)
|
||||
assert.Equal(t, tt.output.isAllowed, isAllowed)
|
||||
assert.Equal(t, tt.output.isWildcard, wild)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestGetExposeHeaders(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
rule CORSRule
|
||||
want string
|
||||
}{
|
||||
{"multiple headers", CORSRule{ExposeHeaders: []CORSHeader{"Content-Length", "Content-Type", "Content-Encoding"}}, "Content-Length, Content-Type, Content-Encoding"},
|
||||
{"single header", CORSRule{ExposeHeaders: []CORSHeader{"Authorization"}}, "Authorization"},
|
||||
{"no headers", CORSRule{}, ""},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := tt.rule.GetExposeHeaders()
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestBuildAllowedHeaders(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
headers []CORSHeader
|
||||
want string
|
||||
}{
|
||||
{
|
||||
name: "empty slice returns empty string",
|
||||
headers: []CORSHeader{},
|
||||
want: "",
|
||||
},
|
||||
{
|
||||
name: "single header lowercase",
|
||||
headers: []CORSHeader{"Content-Type"},
|
||||
want: "content-type",
|
||||
},
|
||||
{
|
||||
name: "multiple headers lowercased with commas",
|
||||
headers: []CORSHeader{"Content-Type", "X-Custom-Header", "Authorization"},
|
||||
want: "content-type, x-custom-header, authorization",
|
||||
},
|
||||
{
|
||||
name: "already lowercase header",
|
||||
headers: []CORSHeader{"accept"},
|
||||
want: "accept",
|
||||
},
|
||||
{
|
||||
name: "mixed case headers",
|
||||
headers: []CORSHeader{"ACCEPT", "x-Powered-By"},
|
||||
want: "accept, x-powered-by",
|
||||
},
|
||||
{
|
||||
name: "empty header value",
|
||||
headers: []CORSHeader{""},
|
||||
want: "",
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := buildAllowedHeaders(tt.headers)
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestGetAllowedMethods(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
rule CORSRule
|
||||
want string
|
||||
}{
|
||||
{"multiple methods", CORSRule{AllowedMethods: []CORSHTTPMethod{http.MethodGet, http.MethodPost, http.MethodPut}}, "GET, POST, PUT"},
|
||||
{"single method", CORSRule{AllowedMethods: []CORSHTTPMethod{http.MethodGet}}, "GET"},
|
||||
{"no methods", CORSRule{}, ""},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := tt.rule.GetAllowedMethods()
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestParseCORSOutput(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
data string
|
||||
want bool
|
||||
}{
|
||||
{"valid", `<CORSConfiguration><CORSRule></CORSRule></CORSConfiguration>`, true},
|
||||
{"invalid xml", `<CORSConfiguration><CORSRule>`, false},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
cfg, err := ParseCORSOutput([]byte(tt.data))
|
||||
if (err == nil) != tt.want {
|
||||
t.Errorf("ParseCORSOutput() err = %v, want success=%v", err, tt.want)
|
||||
}
|
||||
if tt.want && cfg == nil {
|
||||
t.Errorf("Expected non-nil config")
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestCacheCORSProps(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
in []CORSHTTPMethod
|
||||
want map[string]struct{}
|
||||
}{
|
||||
{
|
||||
name: "empty CORSHTTPMethod slice",
|
||||
in: []CORSHTTPMethod{},
|
||||
want: map[string]struct{}{},
|
||||
},
|
||||
{
|
||||
name: "single CORSHTTPMethod",
|
||||
in: []CORSHTTPMethod{http.MethodGet},
|
||||
want: map[string]struct{}{http.MethodGet: {}},
|
||||
},
|
||||
{
|
||||
name: "multiple CORSHTTPMethods",
|
||||
in: []CORSHTTPMethod{http.MethodGet, http.MethodPost, http.MethodPut},
|
||||
want: map[string]struct{}{
|
||||
http.MethodGet: {},
|
||||
http.MethodPost: {},
|
||||
http.MethodPut: {},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := cacheCORSMethods(tt.in)
|
||||
assert.Equal(t, len(tt.want), len(got))
|
||||
for key := range tt.want {
|
||||
_, ok := got[CORSHTTPMethod(key)]
|
||||
assert.True(t, ok)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestParseCORSHeaders(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
in string
|
||||
want []CORSHeader
|
||||
err error
|
||||
}{
|
||||
{
|
||||
name: "empty string",
|
||||
in: "",
|
||||
want: []CORSHeader{},
|
||||
err: nil,
|
||||
},
|
||||
{
|
||||
name: "single valid header",
|
||||
in: "X-Test",
|
||||
want: []CORSHeader{"X-Test"},
|
||||
err: nil,
|
||||
},
|
||||
{
|
||||
name: "multiple valid headers with spaces",
|
||||
in: "X-Test, Content-Type, Authorization",
|
||||
want: []CORSHeader{"X-Test", "Content-Type", "Authorization"},
|
||||
err: nil,
|
||||
},
|
||||
{
|
||||
name: "header with leading/trailing spaces",
|
||||
in: " X-Test ",
|
||||
want: []CORSHeader{"X-Test"},
|
||||
err: nil,
|
||||
},
|
||||
{
|
||||
name: "contains invalid header",
|
||||
in: "X-Test, Invalid Header, Content-Type",
|
||||
want: nil,
|
||||
err: s3err.GetInvalidCORSRequestHeaderErr(" Invalid Header"),
|
||||
},
|
||||
{
|
||||
name: "only invalid header",
|
||||
in: "Invalid Header",
|
||||
want: nil,
|
||||
err: s3err.GetInvalidCORSRequestHeaderErr("Invalid Header"),
|
||||
},
|
||||
{
|
||||
name: "multiple commas in a row",
|
||||
in: "X-Test,,Content-Type",
|
||||
want: nil,
|
||||
err: s3err.GetInvalidCORSRequestHeaderErr(""),
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got, err := ParseCORSHeaders(tt.in)
|
||||
assert.EqualValues(t, tt.err, err)
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestWildcardMatch(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
pattern string
|
||||
input string
|
||||
want bool
|
||||
}{
|
||||
// Exact match, no wildcards
|
||||
{"exact match", "hello", "hello", true},
|
||||
{"exact mismatch", "hello", "hell", false},
|
||||
// Single '*' matching zero chars
|
||||
{"star matches zero chars", "he*lo", "helo", true},
|
||||
// Single '*' matching multiple chars
|
||||
{"star matches multiple chars", "he*o", "heyyyyyo", true},
|
||||
// '*' at start
|
||||
{"star at start", "*world", "hello world", true},
|
||||
// '*' at end
|
||||
{"star at end", "hello*", "hello there", true},
|
||||
// '*' matches whole string
|
||||
{"only star", "*", "anything", true},
|
||||
{"only star empty", "*", "", true},
|
||||
// Multiple '*'s
|
||||
{"multiple stars", "a*b*c", "axxxbzzzzyc", true},
|
||||
{"multiple stars no match", "a*b*c", "axxxbzzzzy", false},
|
||||
// Backtracking needed
|
||||
{"backtracking required", "a*b*c", "ab123c", true},
|
||||
// No match with star present
|
||||
{"star but mismatch", "he*world", "hey there", false},
|
||||
// Trailing stars in pattern
|
||||
{"trailing stars match", "abc**", "abc", true},
|
||||
{"trailing stars match longer", "abc**", "abccc", true},
|
||||
// Empty pattern cases
|
||||
{"empty pattern and empty input", "", "", true},
|
||||
{"empty pattern non-empty input", "", "a", false},
|
||||
{"only stars pattern with empty input", "***", "", true},
|
||||
// Pattern longer than input
|
||||
{"pattern longer no star", "abcd", "abc", false},
|
||||
// Input longer but no star
|
||||
{"input longer no star", "abc", "abcd", false},
|
||||
// Complex interleaved match
|
||||
{"complex interleaved", "*a*b*cd*", "xxaYYbZZcd123", true},
|
||||
// Star match at the end after mismatch
|
||||
{"mismatch then star match", "ab*xyz", "abzzzxyz", true},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := wildcardMatch(tt.pattern, tt.input)
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -17,14 +17,11 @@ package auth
|
||||
import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net/http"
|
||||
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
var ErrAccessDenied = errors.New("access denied")
|
||||
|
||||
type policyErr string
|
||||
|
||||
func (p policyErr) Error() string {
|
||||
@@ -40,17 +37,14 @@ const (
|
||||
policyErrInvalidFirstChar = policyErr("Policies must be valid JSON and the first byte must be '{'")
|
||||
policyErrEmptyStatement = policyErr("Could not parse the policy: Statement is empty!")
|
||||
policyErrMissingStatmentField = policyErr("Missing required field Statement")
|
||||
policyErrInvalidVersion = policyErr("The policy must contain a valid version string")
|
||||
)
|
||||
|
||||
type BucketPolicy struct {
|
||||
Version PolicyVersion `json:"Version"`
|
||||
Statement []BucketPolicyItem `json:"Statement"`
|
||||
}
|
||||
|
||||
func (bp *BucketPolicy) UnmarshalJSON(data []byte) error {
|
||||
var tmp struct {
|
||||
Version *PolicyVersion
|
||||
Statement *[]BucketPolicyItem `json:"Statement"`
|
||||
}
|
||||
|
||||
@@ -63,22 +57,12 @@ func (bp *BucketPolicy) UnmarshalJSON(data []byte) error {
|
||||
return policyErrMissingStatmentField
|
||||
}
|
||||
|
||||
if tmp.Version == nil {
|
||||
// bucket policy version should defualt to '2008-10-17'
|
||||
bp.Version = PolicyVersion2008
|
||||
} else {
|
||||
bp.Version = *tmp.Version
|
||||
}
|
||||
|
||||
// Assign the parsed value to the actual struct
|
||||
bp.Statement = *tmp.Statement
|
||||
return nil
|
||||
}
|
||||
|
||||
func (bp *BucketPolicy) Validate(bucket string, iam IAMService) error {
|
||||
if !bp.Version.isValid() {
|
||||
return policyErrInvalidVersion
|
||||
}
|
||||
|
||||
for _, statement := range bp.Statement {
|
||||
err := statement.Validate(bucket, iam)
|
||||
if err != nil {
|
||||
@@ -105,36 +89,6 @@ func (bp *BucketPolicy) isAllowed(principal string, action Action, resource stri
|
||||
return isAllowed
|
||||
}
|
||||
|
||||
// IsPublicFor checks if the bucket policy statements contain
|
||||
// an entity granting public access to the given resource and action
|
||||
func (bp *BucketPolicy) isPublicFor(resource string, action Action) bool {
|
||||
var isAllowed bool
|
||||
for _, statement := range bp.Statement {
|
||||
if statement.isPublicFor(resource, action) {
|
||||
switch statement.Effect {
|
||||
case BucketPolicyAccessTypeAllow:
|
||||
isAllowed = true
|
||||
case BucketPolicyAccessTypeDeny:
|
||||
return false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return isAllowed
|
||||
}
|
||||
|
||||
// IsPublic checks if one of bucket policy statments grant
|
||||
// public access to ALL users
|
||||
func (bp *BucketPolicy) IsPublic() bool {
|
||||
for _, statement := range bp.Statement {
|
||||
if statement.isPublic() {
|
||||
return true
|
||||
}
|
||||
}
|
||||
|
||||
return false
|
||||
}
|
||||
|
||||
type BucketPolicyItem struct {
|
||||
Effect BucketPolicyAccessType `json:"Effect"`
|
||||
Principals Principals `json:"Principal"`
|
||||
@@ -180,18 +134,6 @@ func (bpi *BucketPolicyItem) findMatch(principal string, action Action, resource
|
||||
return false
|
||||
}
|
||||
|
||||
// isPublicFor checks if the bucket policy statemant grants public access
|
||||
// for given resource and action
|
||||
func (bpi *BucketPolicyItem) isPublicFor(resource string, action Action) bool {
|
||||
return bpi.Principals.isPublic() && bpi.Actions.FindMatch(action) && bpi.Resources.FindMatch(resource)
|
||||
}
|
||||
|
||||
// isPublic checks if the statement grants public access
|
||||
// to ALL users
|
||||
func (bpi *BucketPolicyItem) isPublic() bool {
|
||||
return bpi.Principals.isPublic()
|
||||
}
|
||||
|
||||
func getMalformedPolicyError(err error) error {
|
||||
return s3err.APIError{
|
||||
Code: "MalformedPolicy",
|
||||
@@ -200,27 +142,17 @@ func getMalformedPolicyError(err error) error {
|
||||
}
|
||||
}
|
||||
|
||||
// ParsePolicyDocument parses raw bytes to 'BucketPolicy'
|
||||
func ParsePolicyDocument(data []byte) (*BucketPolicy, error) {
|
||||
var policy BucketPolicy
|
||||
if err := json.Unmarshal(data, &policy); err != nil {
|
||||
var pe policyErr
|
||||
if errors.As(err, &pe) {
|
||||
return nil, getMalformedPolicyError(err)
|
||||
}
|
||||
return nil, getMalformedPolicyError(policyErrInvalidPolicy)
|
||||
}
|
||||
|
||||
return &policy, nil
|
||||
}
|
||||
|
||||
func ValidatePolicyDocument(policyBin []byte, bucket string, iam IAMService) error {
|
||||
if len(policyBin) == 0 || policyBin[0] != '{' {
|
||||
return getMalformedPolicyError(policyErrInvalidFirstChar)
|
||||
}
|
||||
policy, err := ParsePolicyDocument(policyBin)
|
||||
if err != nil {
|
||||
return err
|
||||
var policy BucketPolicy
|
||||
if err := json.Unmarshal(policyBin, &policy); err != nil {
|
||||
var pe policyErr
|
||||
if errors.As(err, &pe) {
|
||||
return getMalformedPolicyError(err)
|
||||
}
|
||||
return getMalformedPolicyError(policyErrInvalidPolicy)
|
||||
}
|
||||
|
||||
if len(policy.Statement) == 0 {
|
||||
@@ -237,7 +169,7 @@ func ValidatePolicyDocument(policyBin []byte, bucket string, iam IAMService) err
|
||||
func VerifyBucketPolicy(policy []byte, access, bucket, object string, action Action) error {
|
||||
var bucketPolicy BucketPolicy
|
||||
if err := json.Unmarshal(policy, &bucketPolicy); err != nil {
|
||||
return fmt.Errorf("failed to parse the bucket policy: %w", err)
|
||||
return err
|
||||
}
|
||||
|
||||
resource := bucket
|
||||
@@ -251,53 +183,3 @@ func VerifyBucketPolicy(policy []byte, access, bucket, object string, action Act
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Checks if the bucket policy grants public access
|
||||
func VerifyPublicBucketPolicy(policy []byte, bucket, object string, action Action) error {
|
||||
var bucketPolicy BucketPolicy
|
||||
if err := json.Unmarshal(policy, &bucketPolicy); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
resource := bucket
|
||||
if object != "" {
|
||||
resource += "/" + object
|
||||
}
|
||||
|
||||
if !bucketPolicy.isPublicFor(resource, action) {
|
||||
return ErrAccessDenied
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// matchPattern checks if the input string matches the given pattern with wildcard(`*`) and any character(`?`).
|
||||
// - `?` matches exactly one occurrence of any character.
|
||||
// - `*` matches arbitrary many (including zero) occurrences of any character.
|
||||
func matchPattern(pattern, input string) bool {
|
||||
pIdx, sIdx := 0, 0
|
||||
starIdx, matchIdx := -1, 0
|
||||
|
||||
for sIdx < len(input) {
|
||||
if pIdx < len(pattern) && (pattern[pIdx] == '?' || pattern[pIdx] == input[sIdx]) {
|
||||
sIdx++
|
||||
pIdx++
|
||||
} else if pIdx < len(pattern) && pattern[pIdx] == '*' {
|
||||
starIdx = pIdx
|
||||
matchIdx = sIdx
|
||||
pIdx++
|
||||
} else if starIdx != -1 {
|
||||
pIdx = starIdx + 1
|
||||
matchIdx++
|
||||
sIdx = matchIdx
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
for pIdx < len(pattern) && pattern[pIdx] == '*' {
|
||||
pIdx++
|
||||
}
|
||||
|
||||
return pIdx == len(pattern)
|
||||
}
|
||||
|
||||
@@ -22,181 +22,108 @@ import (
|
||||
type Action string
|
||||
|
||||
const (
|
||||
GetBucketAclAction Action = "s3:GetBucketAcl"
|
||||
CreateBucketAction Action = "s3:CreateBucket"
|
||||
PutBucketAclAction Action = "s3:PutBucketAcl"
|
||||
DeleteBucketAction Action = "s3:DeleteBucket"
|
||||
PutBucketVersioningAction Action = "s3:PutBucketVersioning"
|
||||
GetBucketVersioningAction Action = "s3:GetBucketVersioning"
|
||||
PutBucketPolicyAction Action = "s3:PutBucketPolicy"
|
||||
GetBucketPolicyAction Action = "s3:GetBucketPolicy"
|
||||
DeleteBucketPolicyAction Action = "s3:DeleteBucketPolicy"
|
||||
AbortMultipartUploadAction Action = "s3:AbortMultipartUpload"
|
||||
ListMultipartUploadPartsAction Action = "s3:ListMultipartUploadParts"
|
||||
ListBucketMultipartUploadsAction Action = "s3:ListBucketMultipartUploads"
|
||||
PutObjectAction Action = "s3:PutObject"
|
||||
GetObjectAction Action = "s3:GetObject"
|
||||
GetObjectVersionAction Action = "s3:GetObjectVersion"
|
||||
DeleteObjectAction Action = "s3:DeleteObject"
|
||||
DeleteObjectVersionAction Action = "s3:DeleteObjectVersion"
|
||||
GetObjectAclAction Action = "s3:GetObjectAcl"
|
||||
GetObjectAttributesAction Action = "s3:GetObjectAttributes"
|
||||
GetObjectVersionAttributesAction Action = "s3:GetObjectVersionAttributes"
|
||||
PutObjectAclAction Action = "s3:PutObjectAcl"
|
||||
RestoreObjectAction Action = "s3:RestoreObject"
|
||||
GetBucketTaggingAction Action = "s3:GetBucketTagging"
|
||||
PutBucketTaggingAction Action = "s3:PutBucketTagging"
|
||||
GetObjectTaggingAction Action = "s3:GetObjectTagging"
|
||||
GetObjectVersionTaggingAction Action = "s3:GetObjectVersionTagging"
|
||||
PutObjectTaggingAction Action = "s3:PutObjectTagging"
|
||||
PutObjectVersionTaggingAction Action = "s3:PutObjectVersionTagging"
|
||||
DeleteObjectTaggingAction Action = "s3:DeleteObjectTagging"
|
||||
DeleteObjectVersionTaggingAction Action = "s3:DeleteObjectVersionTagging"
|
||||
ListBucketVersionsAction Action = "s3:ListBucketVersions"
|
||||
ListBucketAction Action = "s3:ListBucket"
|
||||
GetBucketObjectLockConfigurationAction Action = "s3:GetBucketObjectLockConfiguration"
|
||||
PutBucketObjectLockConfigurationAction Action = "s3:PutBucketObjectLockConfiguration"
|
||||
GetObjectLegalHoldAction Action = "s3:GetObjectLegalHold"
|
||||
PutObjectLegalHoldAction Action = "s3:PutObjectLegalHold"
|
||||
GetObjectRetentionAction Action = "s3:GetObjectRetention"
|
||||
PutObjectRetentionAction Action = "s3:PutObjectRetention"
|
||||
BypassGovernanceRetentionAction Action = "s3:BypassGovernanceRetention"
|
||||
PutBucketOwnershipControlsAction Action = "s3:PutBucketOwnershipControls"
|
||||
GetBucketOwnershipControlsAction Action = "s3:GetBucketOwnershipControls"
|
||||
PutBucketCorsAction Action = "s3:PutBucketCORS"
|
||||
GetBucketCorsAction Action = "s3:GetBucketCORS"
|
||||
PutAnalyticsConfigurationAction Action = "s3:PutAnalyticsConfiguration"
|
||||
GetAnalyticsConfigurationAction Action = "s3:GetAnalyticsConfiguration"
|
||||
PutEncryptionConfigurationAction Action = "s3:PutEncryptionConfiguration"
|
||||
GetEncryptionConfigurationAction Action = "s3:GetEncryptionConfiguration"
|
||||
PutIntelligentTieringConfigurationAction Action = "s3:PutIntelligentTieringConfiguration"
|
||||
GetIntelligentTieringConfigurationAction Action = "s3:GetIntelligentTieringConfiguration"
|
||||
PutInventoryConfigurationAction Action = "s3:PutInventoryConfiguration"
|
||||
GetInventoryConfigurationAction Action = "s3:GetInventoryConfiguration"
|
||||
PutLifecycleConfigurationAction Action = "s3:PutLifecycleConfiguration"
|
||||
GetLifecycleConfigurationAction Action = "s3:GetLifecycleConfiguration"
|
||||
PutBucketLoggingAction Action = "s3:PutBucketLogging"
|
||||
GetBucketLoggingAction Action = "s3:GetBucketLogging"
|
||||
PutBucketRequestPaymentAction Action = "s3:PutBucketRequestPayment"
|
||||
GetBucketRequestPaymentAction Action = "s3:GetBucketRequestPayment"
|
||||
PutMetricsConfigurationAction Action = "s3:PutMetricsConfiguration"
|
||||
GetMetricsConfigurationAction Action = "s3:GetMetricsConfiguration"
|
||||
PutReplicationConfigurationAction Action = "s3:PutReplicationConfiguration"
|
||||
GetReplicationConfigurationAction Action = "s3:GetReplicationConfiguration"
|
||||
PutBucketPublicAccessBlockAction Action = "s3:PutBucketPublicAccessBlock"
|
||||
GetBucketPublicAccessBlockAction Action = "s3:GetBucketPublicAccessBlock"
|
||||
PutBucketNotificationAction Action = "s3:PutBucketNotification"
|
||||
GetBucketNotificationAction Action = "s3:GetBucketNotification"
|
||||
PutAccelerateConfigurationAction Action = "s3:PutAccelerateConfiguration"
|
||||
GetAccelerateConfigurationAction Action = "s3:GetAccelerateConfiguration"
|
||||
PutBucketWebsiteAction Action = "s3:PutBucketWebsite"
|
||||
GetBucketWebsiteAction Action = "s3:GetBucketWebsite"
|
||||
GetBucketPolicyStatusAction Action = "s3:GetBucketPolicyStatus"
|
||||
GetBucketLocationAction Action = "s3:GetBucketLocation"
|
||||
|
||||
AllActions Action = "s3:*"
|
||||
GetBucketAclAction Action = "s3:GetBucketAcl"
|
||||
CreateBucketAction Action = "s3:CreateBucket"
|
||||
PutBucketAclAction Action = "s3:PutBucketAcl"
|
||||
DeleteBucketAction Action = "s3:DeleteBucket"
|
||||
PutBucketVersioningAction Action = "s3:PutBucketVersioning"
|
||||
GetBucketVersioningAction Action = "s3:GetBucketVersioning"
|
||||
PutBucketPolicyAction Action = "s3:PutBucketPolicy"
|
||||
GetBucketPolicyAction Action = "s3:GetBucketPolicy"
|
||||
DeleteBucketPolicyAction Action = "s3:DeleteBucketPolicy"
|
||||
AbortMultipartUploadAction Action = "s3:AbortMultipartUpload"
|
||||
ListMultipartUploadPartsAction Action = "s3:ListMultipartUploadParts"
|
||||
ListBucketMultipartUploadsAction Action = "s3:ListBucketMultipartUploads"
|
||||
PutObjectAction Action = "s3:PutObject"
|
||||
GetObjectAction Action = "s3:GetObject"
|
||||
GetObjectVersionAction Action = "s3:GetObjectVersion"
|
||||
DeleteObjectAction Action = "s3:DeleteObject"
|
||||
GetObjectAclAction Action = "s3:GetObjectAcl"
|
||||
GetObjectAttributesAction Action = "s3:GetObjectAttributes"
|
||||
PutObjectAclAction Action = "s3:PutObjectAcl"
|
||||
RestoreObjectAction Action = "s3:RestoreObject"
|
||||
GetBucketTaggingAction Action = "s3:GetBucketTagging"
|
||||
PutBucketTaggingAction Action = "s3:PutBucketTagging"
|
||||
GetObjectTaggingAction Action = "s3:GetObjectTagging"
|
||||
PutObjectTaggingAction Action = "s3:PutObjectTagging"
|
||||
DeleteObjectTaggingAction Action = "s3:DeleteObjectTagging"
|
||||
ListBucketVersionsAction Action = "s3:ListBucketVersions"
|
||||
ListBucketAction Action = "s3:ListBucket"
|
||||
GetBucketObjectLockConfigurationAction Action = "s3:GetBucketObjectLockConfiguration"
|
||||
PutBucketObjectLockConfigurationAction Action = "s3:PutBucketObjectLockConfiguration"
|
||||
GetObjectLegalHoldAction Action = "s3:GetObjectLegalHold"
|
||||
PutObjectLegalHoldAction Action = "s3:PutObjectLegalHold"
|
||||
GetObjectRetentionAction Action = "s3:GetObjectRetention"
|
||||
PutObjectRetentionAction Action = "s3:PutObjectRetention"
|
||||
BypassGovernanceRetentionAction Action = "s3:BypassGovernanceRetention"
|
||||
PutBucketOwnershipControlsAction Action = "s3:PutBucketOwnershipControls"
|
||||
GetBucketOwnershipControlsAction Action = "s3:GetBucketOwnershipControls"
|
||||
PutBucketCorsAction Action = "s3:PutBucketCORS"
|
||||
GetBucketCorsAction Action = "s3:GetBucketCORS"
|
||||
AllActions Action = "s3:*"
|
||||
)
|
||||
|
||||
var supportedActionList = map[Action]struct{}{
|
||||
GetBucketAclAction: {},
|
||||
CreateBucketAction: {},
|
||||
PutBucketAclAction: {},
|
||||
DeleteBucketAction: {},
|
||||
PutBucketVersioningAction: {},
|
||||
GetBucketVersioningAction: {},
|
||||
PutBucketPolicyAction: {},
|
||||
GetBucketPolicyAction: {},
|
||||
DeleteBucketPolicyAction: {},
|
||||
AbortMultipartUploadAction: {},
|
||||
ListMultipartUploadPartsAction: {},
|
||||
ListBucketMultipartUploadsAction: {},
|
||||
PutObjectAction: {},
|
||||
GetObjectAction: {},
|
||||
GetObjectVersionAction: {},
|
||||
DeleteObjectAction: {},
|
||||
DeleteObjectVersionAction: {},
|
||||
GetObjectAclAction: {},
|
||||
GetObjectAttributesAction: {},
|
||||
GetObjectVersionAttributesAction: {},
|
||||
PutObjectAclAction: {},
|
||||
RestoreObjectAction: {},
|
||||
GetBucketTaggingAction: {},
|
||||
PutBucketTaggingAction: {},
|
||||
GetObjectTaggingAction: {},
|
||||
GetObjectVersionTaggingAction: {},
|
||||
PutObjectTaggingAction: {},
|
||||
PutObjectVersionTaggingAction: {},
|
||||
DeleteObjectTaggingAction: {},
|
||||
DeleteObjectVersionTaggingAction: {},
|
||||
ListBucketVersionsAction: {},
|
||||
ListBucketAction: {},
|
||||
GetBucketObjectLockConfigurationAction: {},
|
||||
PutBucketObjectLockConfigurationAction: {},
|
||||
GetObjectLegalHoldAction: {},
|
||||
PutObjectLegalHoldAction: {},
|
||||
GetObjectRetentionAction: {},
|
||||
PutObjectRetentionAction: {},
|
||||
BypassGovernanceRetentionAction: {},
|
||||
PutBucketOwnershipControlsAction: {},
|
||||
GetBucketOwnershipControlsAction: {},
|
||||
PutBucketCorsAction: {},
|
||||
GetBucketCorsAction: {},
|
||||
PutAnalyticsConfigurationAction: {},
|
||||
GetAnalyticsConfigurationAction: {},
|
||||
PutEncryptionConfigurationAction: {},
|
||||
GetEncryptionConfigurationAction: {},
|
||||
PutIntelligentTieringConfigurationAction: {},
|
||||
GetIntelligentTieringConfigurationAction: {},
|
||||
PutInventoryConfigurationAction: {},
|
||||
GetInventoryConfigurationAction: {},
|
||||
PutLifecycleConfigurationAction: {},
|
||||
GetLifecycleConfigurationAction: {},
|
||||
PutBucketLoggingAction: {},
|
||||
GetBucketLoggingAction: {},
|
||||
PutBucketRequestPaymentAction: {},
|
||||
GetBucketRequestPaymentAction: {},
|
||||
PutMetricsConfigurationAction: {},
|
||||
GetMetricsConfigurationAction: {},
|
||||
PutReplicationConfigurationAction: {},
|
||||
GetReplicationConfigurationAction: {},
|
||||
PutBucketPublicAccessBlockAction: {},
|
||||
GetBucketPublicAccessBlockAction: {},
|
||||
PutBucketNotificationAction: {},
|
||||
GetBucketNotificationAction: {},
|
||||
PutAccelerateConfigurationAction: {},
|
||||
GetAccelerateConfigurationAction: {},
|
||||
PutBucketWebsiteAction: {},
|
||||
GetBucketWebsiteAction: {},
|
||||
GetBucketPolicyStatusAction: {},
|
||||
GetBucketLocationAction: {},
|
||||
AllActions: {},
|
||||
GetBucketAclAction: {},
|
||||
CreateBucketAction: {},
|
||||
PutBucketAclAction: {},
|
||||
DeleteBucketAction: {},
|
||||
PutBucketVersioningAction: {},
|
||||
GetBucketVersioningAction: {},
|
||||
PutBucketPolicyAction: {},
|
||||
GetBucketPolicyAction: {},
|
||||
DeleteBucketPolicyAction: {},
|
||||
AbortMultipartUploadAction: {},
|
||||
ListMultipartUploadPartsAction: {},
|
||||
ListBucketMultipartUploadsAction: {},
|
||||
PutObjectAction: {},
|
||||
GetObjectAction: {},
|
||||
GetObjectVersionAction: {},
|
||||
DeleteObjectAction: {},
|
||||
GetObjectAclAction: {},
|
||||
GetObjectAttributesAction: {},
|
||||
PutObjectAclAction: {},
|
||||
RestoreObjectAction: {},
|
||||
GetBucketTaggingAction: {},
|
||||
PutBucketTaggingAction: {},
|
||||
GetObjectTaggingAction: {},
|
||||
PutObjectTaggingAction: {},
|
||||
DeleteObjectTaggingAction: {},
|
||||
ListBucketVersionsAction: {},
|
||||
ListBucketAction: {},
|
||||
PutBucketObjectLockConfigurationAction: {},
|
||||
GetObjectLegalHoldAction: {},
|
||||
PutObjectLegalHoldAction: {},
|
||||
GetObjectRetentionAction: {},
|
||||
PutObjectRetentionAction: {},
|
||||
BypassGovernanceRetentionAction: {},
|
||||
PutBucketOwnershipControlsAction: {},
|
||||
GetBucketOwnershipControlsAction: {},
|
||||
PutBucketCorsAction: {},
|
||||
GetBucketCorsAction: {},
|
||||
AllActions: {},
|
||||
}
|
||||
|
||||
var supportedObjectActionList = map[Action]struct{}{
|
||||
AbortMultipartUploadAction: {},
|
||||
ListMultipartUploadPartsAction: {},
|
||||
PutObjectAction: {},
|
||||
GetObjectAction: {},
|
||||
GetObjectVersionAction: {},
|
||||
DeleteObjectAction: {},
|
||||
DeleteObjectVersionAction: {},
|
||||
GetObjectAclAction: {},
|
||||
GetObjectAttributesAction: {},
|
||||
GetObjectVersionAttributesAction: {},
|
||||
PutObjectAclAction: {},
|
||||
RestoreObjectAction: {},
|
||||
GetObjectTaggingAction: {},
|
||||
GetObjectVersionTaggingAction: {},
|
||||
PutObjectTaggingAction: {},
|
||||
PutObjectVersionTaggingAction: {},
|
||||
DeleteObjectTaggingAction: {},
|
||||
DeleteObjectVersionTaggingAction: {},
|
||||
GetObjectLegalHoldAction: {},
|
||||
PutObjectLegalHoldAction: {},
|
||||
GetObjectRetentionAction: {},
|
||||
PutObjectRetentionAction: {},
|
||||
BypassGovernanceRetentionAction: {},
|
||||
AllActions: {},
|
||||
AbortMultipartUploadAction: {},
|
||||
ListMultipartUploadPartsAction: {},
|
||||
PutObjectAction: {},
|
||||
GetObjectAction: {},
|
||||
GetObjectVersionAction: {},
|
||||
DeleteObjectAction: {},
|
||||
GetObjectAclAction: {},
|
||||
GetObjectAttributesAction: {},
|
||||
PutObjectAclAction: {},
|
||||
RestoreObjectAction: {},
|
||||
GetObjectTaggingAction: {},
|
||||
PutObjectTaggingAction: {},
|
||||
DeleteObjectTaggingAction: {},
|
||||
GetObjectLegalHoldAction: {},
|
||||
PutObjectLegalHoldAction: {},
|
||||
GetObjectRetentionAction: {},
|
||||
PutObjectRetentionAction: {},
|
||||
BypassGovernanceRetentionAction: {},
|
||||
AllActions: {},
|
||||
}
|
||||
|
||||
// Validates Action: it should either wildcard match with supported actions list or be in it
|
||||
@@ -209,54 +136,55 @@ func (a Action) IsValid() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// first check for an exact match
|
||||
if _, ok := supportedActionList[a]; ok {
|
||||
return nil
|
||||
}
|
||||
|
||||
// walk through the supported actions and try wildcard match
|
||||
for action := range supportedActionList {
|
||||
if action.Match(a) {
|
||||
return nil
|
||||
if a[len(a)-1] == '*' {
|
||||
pattern := strings.TrimSuffix(string(a), "*")
|
||||
for act := range supportedActionList {
|
||||
if strings.HasPrefix(string(act), pattern) {
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
return policyErrInvalidAction
|
||||
}
|
||||
|
||||
return policyErrInvalidAction
|
||||
_, found := supportedActionList[a]
|
||||
if !found {
|
||||
return policyErrInvalidAction
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func getBoolPtr(bl bool) *bool {
|
||||
return &bl
|
||||
}
|
||||
|
||||
// String converts the action to string
|
||||
func (a Action) String() string {
|
||||
return string(a)
|
||||
}
|
||||
|
||||
// Match wildcard matches the given pattern to the action
|
||||
func (a Action) Match(pattern Action) bool {
|
||||
return matchPattern(pattern.String(), a.String())
|
||||
}
|
||||
|
||||
// Checks if the action is object action
|
||||
// nil points to 's3:*'
|
||||
func (a Action) IsObjectAction() *bool {
|
||||
if a == AllActions {
|
||||
return nil
|
||||
}
|
||||
|
||||
// first find an exact match
|
||||
if _, ok := supportedObjectActionList[a]; ok {
|
||||
return &ok
|
||||
}
|
||||
|
||||
for action := range supportedObjectActionList {
|
||||
if action.Match(a) {
|
||||
return getBoolPtr(true)
|
||||
if a[len(a)-1] == '*' {
|
||||
pattern := strings.TrimSuffix(string(a), "*")
|
||||
for act := range supportedObjectActionList {
|
||||
if strings.HasPrefix(string(act), pattern) {
|
||||
return getBoolPtr(true)
|
||||
}
|
||||
}
|
||||
|
||||
return getBoolPtr(false)
|
||||
}
|
||||
|
||||
return getBoolPtr(false)
|
||||
_, found := supportedObjectActionList[a]
|
||||
return &found
|
||||
}
|
||||
|
||||
func (a Action) WildCardMatch(act Action) bool {
|
||||
if strings.HasSuffix(string(a), "*") {
|
||||
pattern := strings.TrimSuffix(string(a), "*")
|
||||
return strings.HasPrefix(string(act), pattern)
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type Actions map[Action]struct{}
|
||||
@@ -305,7 +233,6 @@ func (a Actions) Add(str string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// FindMatch tries to match the given action to the actions list
|
||||
func (a Actions) FindMatch(action Action) bool {
|
||||
_, ok := a[AllActions]
|
||||
if ok {
|
||||
@@ -317,9 +244,8 @@ func (a Actions) FindMatch(action Action) bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// search for a wildcard match
|
||||
for act := range a {
|
||||
if action.Match(act) {
|
||||
if strings.HasSuffix(string(act), "*") && act.WildCardMatch(action) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,175 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func TestAction_IsValid(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
action Action
|
||||
wantErr bool
|
||||
}{
|
||||
{"valid exact action", GetObjectAction, false},
|
||||
{"valid all actions", AllActions, false},
|
||||
{"invalid prefix", "invalid:Action", true},
|
||||
{"unsupported action 1", "s3:Unsupported", true},
|
||||
{"unsupported action 2", "s3:HeadObject", true},
|
||||
{"valid wildcard match 1", "s3:Get*", false},
|
||||
{"valid wildcard match 2", "s3:*Object*", false},
|
||||
{"valid wildcard match 3", "s3:*Multipart*", false},
|
||||
{"any char match 1", "s3:Get?bject", false},
|
||||
{"any char match 2", "s3:Get??bject", true},
|
||||
{"any char match 3", "s3:???", true},
|
||||
{"mixed match 1", "s3:Get?*", false},
|
||||
{"mixed match 2", "s3:*Object?????", true},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
err := tt.action.IsValid()
|
||||
if tt.wantErr {
|
||||
assert.EqualValues(t, policyErrInvalidAction, err)
|
||||
} else {
|
||||
assert.NoError(t, err)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestAction_String(t *testing.T) {
|
||||
a := Action("s3:TestAction")
|
||||
assert.Equal(t, "s3:TestAction", a.String())
|
||||
}
|
||||
|
||||
func TestAction_Match(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
action Action
|
||||
pattern Action
|
||||
want bool
|
||||
}{
|
||||
{"exact match", "s3:GetObject", "s3:GetObject", true},
|
||||
{"wildcard match", "s3:GetObject", "s3:Get*", true},
|
||||
{"wildcard mismatch", "s3:PutObject", "s3:Get*", false},
|
||||
{"any character match", "s3:Get1", "s3:Get?", true},
|
||||
{"any character mismatch", "s3:Get12", "s3:Get?", false},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := tt.action.Match(tt.pattern)
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestAction_IsObjectAction(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
action Action
|
||||
want *bool
|
||||
}{
|
||||
{"all actions", AllActions, nil},
|
||||
{"object action exact", GetObjectAction, getBoolPtr(true)},
|
||||
{"object action wildcard", "s3:Get*", getBoolPtr(true)},
|
||||
{"non object action", GetBucketAclAction, getBoolPtr(false)},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := tt.action.IsObjectAction()
|
||||
if tt.want == nil {
|
||||
assert.Nil(t, got)
|
||||
} else {
|
||||
assert.NotNil(t, got)
|
||||
assert.Equal(t, *tt.want, *got)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestActions_UnmarshalJSON(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input string
|
||||
wantErr bool
|
||||
}{
|
||||
{"valid slice", `["s3:GetObject","s3:PutObject"]`, false},
|
||||
{"empty slice", `[]`, true},
|
||||
{"invalid action in slice", `["s3:Invalid"]`, true},
|
||||
{"valid string", `"s3:GetObject"`, false},
|
||||
{"empty string", `""`, true},
|
||||
{"invalid string", `"s3:Invalid"`, true},
|
||||
{"invalid json", `{}`, true},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
var a Actions
|
||||
err := json.Unmarshal([]byte(tt.input), &a)
|
||||
if tt.wantErr {
|
||||
assert.Error(t, err)
|
||||
} else {
|
||||
assert.NoError(t, err)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestActions_Add(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
action string
|
||||
wantErr bool
|
||||
}{
|
||||
{"valid add", "s3:GetObject", false},
|
||||
{"invalid add", "s3:InvalidAction", true},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
a := make(Actions)
|
||||
err := a.Add(tt.action)
|
||||
if tt.wantErr {
|
||||
assert.Error(t, err)
|
||||
} else {
|
||||
assert.NoError(t, err)
|
||||
_, ok := a[Action(tt.action)]
|
||||
assert.True(t, ok)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestActions_FindMatch(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
actions Actions
|
||||
check Action
|
||||
want bool
|
||||
}{
|
||||
{"all actions present", Actions{AllActions: {}}, GetObjectAction, true},
|
||||
{"exact match", Actions{GetObjectAction: {}}, GetObjectAction, true},
|
||||
{"wildcard match", Actions{"s3:Get*": {}}, GetObjectAction, true},
|
||||
{"no match", Actions{"s3:Put*": {}}, GetObjectAction, false},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := tt.actions.FindMatch(tt.check)
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -1,57 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func TestBucketPolicyAccessType_Validate(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input BucketPolicyAccessType
|
||||
wantErr bool
|
||||
errMsg string
|
||||
}{
|
||||
{
|
||||
name: "valid allow",
|
||||
input: BucketPolicyAccessTypeAllow,
|
||||
wantErr: false,
|
||||
},
|
||||
{
|
||||
name: "valid deny",
|
||||
input: BucketPolicyAccessTypeDeny,
|
||||
wantErr: false,
|
||||
},
|
||||
{
|
||||
name: "invalid type",
|
||||
input: BucketPolicyAccessType("InvalidValue"),
|
||||
wantErr: true,
|
||||
errMsg: "Invalid effect: InvalidValue",
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
err := tt.input.Validate()
|
||||
if tt.wantErr {
|
||||
assert.EqualError(t, err, tt.errMsg)
|
||||
} else {
|
||||
assert.NoError(t, err)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -121,10 +121,3 @@ func (p Principals) Contains(userAccess string) bool {
|
||||
_, found := p[userAccess]
|
||||
return found
|
||||
}
|
||||
|
||||
// Bucket policy grants public access, if it contains
|
||||
// a wildcard match to all the users
|
||||
func (p Principals) isPublic() bool {
|
||||
_, ok := p["*"]
|
||||
return ok
|
||||
}
|
||||
|
||||
@@ -1,106 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func TestPrincipals_Add(t *testing.T) {
|
||||
p := make(Principals)
|
||||
p.Add("user1")
|
||||
_, ok := p["user1"]
|
||||
assert.True(t, ok)
|
||||
}
|
||||
|
||||
func TestPrincipals_UnmarshalJSON(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input string
|
||||
want Principals
|
||||
wantErr bool
|
||||
}{
|
||||
{"valid slice", `["user1","user2"]`, Principals{"user1": {}, "user2": {}}, false},
|
||||
{"empty slice", `[]`, nil, true},
|
||||
{"valid string", `"user1"`, Principals{"user1": {}}, false},
|
||||
{"empty string", `""`, nil, true},
|
||||
{"valid AWS object", `{"AWS":"user1"}`, Principals{"user1": {}}, false},
|
||||
{"empty AWS object", `{"AWS":""}`, nil, true},
|
||||
{"valid AWS array", `{"AWS":["user1","user2"]}`, Principals{"user1": {}, "user2": {}}, false},
|
||||
{"empty AWS array", `{"AWS":[]}`, nil, true},
|
||||
{"invalid json", `{invalid}`, nil, true},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
var p Principals
|
||||
err := json.Unmarshal([]byte(tt.input), &p)
|
||||
if tt.wantErr {
|
||||
assert.Error(t, err)
|
||||
} else {
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, tt.want, p)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestPrincipals_ToSlice(t *testing.T) {
|
||||
p := Principals{"user1": {}, "user2": {}, "*": {}}
|
||||
got := p.ToSlice()
|
||||
assert.Contains(t, got, "user1")
|
||||
assert.Contains(t, got, "user2")
|
||||
assert.NotContains(t, got, "*")
|
||||
}
|
||||
|
||||
func TestPrincipals_Validate(t *testing.T) {
|
||||
iamSingle := NewIAMServiceSingle(Account{
|
||||
Access: "user1",
|
||||
})
|
||||
tests := []struct {
|
||||
name string
|
||||
principals Principals
|
||||
mockIAM IAMService
|
||||
err error
|
||||
}{
|
||||
{"only wildcard", Principals{"*": {}}, iamSingle, nil},
|
||||
{"wildcard and user", Principals{"*": {}, "user1": {}}, iamSingle, policyErrInvalidPrincipal},
|
||||
{"accounts exist returns err", Principals{"user2": {}, "user3": {}}, iamSingle, policyErrInvalidPrincipal},
|
||||
{"accounts exist non-empty", Principals{"user1": {}}, iamSingle, nil},
|
||||
{"accounts valid", Principals{"user1": {}}, iamSingle, nil},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
err := tt.principals.Validate(tt.mockIAM)
|
||||
assert.EqualValues(t, tt.err, err)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestPrincipals_Contains(t *testing.T) {
|
||||
p := Principals{"user1": {}}
|
||||
assert.True(t, p.Contains("user1"))
|
||||
assert.False(t, p.Contains("user2"))
|
||||
|
||||
p = Principals{"*": {}}
|
||||
assert.True(t, p.Contains("anyuser"))
|
||||
}
|
||||
|
||||
func TestPrincipals_isPublic(t *testing.T) {
|
||||
assert.True(t, Principals{"*": {}}.isPublic())
|
||||
assert.False(t, Principals{"user1": {}}.isPublic())
|
||||
}
|
||||
@@ -110,9 +110,35 @@ func (r Resources) FindMatch(resource string) bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// Match matches the given input resource with the pattern
|
||||
// Match checks if the input string matches the given pattern with wildcards (`*`, `?`).
|
||||
// - `?` matches exactly one occurrence of any character.
|
||||
// - `*` matches arbitrary many (including zero) occurrences of any character.
|
||||
func (r Resources) Match(pattern, input string) bool {
|
||||
return matchPattern(pattern, input)
|
||||
pIdx, sIdx := 0, 0
|
||||
starIdx, matchIdx := -1, 0
|
||||
|
||||
for sIdx < len(input) {
|
||||
if pIdx < len(pattern) && (pattern[pIdx] == '?' || pattern[pIdx] == input[sIdx]) {
|
||||
sIdx++
|
||||
pIdx++
|
||||
} else if pIdx < len(pattern) && pattern[pIdx] == '*' {
|
||||
starIdx = pIdx
|
||||
matchIdx = sIdx
|
||||
pIdx++
|
||||
} else if starIdx != -1 {
|
||||
pIdx = starIdx + 1
|
||||
matchIdx++
|
||||
sIdx = matchIdx
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
for pIdx < len(pattern) && pattern[pIdx] == '*' {
|
||||
pIdx++
|
||||
}
|
||||
|
||||
return pIdx == len(pattern)
|
||||
}
|
||||
|
||||
// Checks the resource to have arn prefix and not starting with /
|
||||
|
||||
@@ -1,32 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
type PolicyVersion string
|
||||
|
||||
const (
|
||||
PolicyVersion2008 PolicyVersion = "2008-10-17"
|
||||
PolicyVersion2012 PolicyVersion = "2012-10-17"
|
||||
)
|
||||
|
||||
// isValid checks if the policy version is valid or not
|
||||
func (pv PolicyVersion) isValid() bool {
|
||||
switch pv {
|
||||
case PolicyVersion2008, PolicyVersion2012:
|
||||
return true
|
||||
default:
|
||||
return false
|
||||
}
|
||||
}
|
||||
@@ -1,54 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package auth
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func TestPolicyVersion_isValid(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string // description of this test case
|
||||
value string
|
||||
want bool
|
||||
}{
|
||||
{"valid 2008", "2008-10-17", true},
|
||||
{"valid 2012", "2012-10-17", true},
|
||||
{"invalid empty", "", false},
|
||||
{"invalid 1", "invalid", false},
|
||||
{"invalid 2", "2010-10-17", false},
|
||||
{"invalid 3", "2006-00-12", false},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
got := PolicyVersion(tt.value).isValid()
|
||||
assert.Equal(t, tt.want, got)
|
||||
})
|
||||
}
|
||||
}
|
||||
123
auth/iam.go
123
auth/iam.go
@@ -18,8 +18,6 @@ import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"time"
|
||||
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
type Role string
|
||||
@@ -45,12 +43,11 @@ func (r Role) IsValid() bool {
|
||||
|
||||
// Account is a gateway IAM account
|
||||
type Account struct {
|
||||
Access string `json:"access"`
|
||||
Secret string `json:"secret"`
|
||||
Role Role `json:"role"`
|
||||
UserID int `json:"userID"`
|
||||
GroupID int `json:"groupID"`
|
||||
ProjectID int `json:"projectID"`
|
||||
Access string `json:"access"`
|
||||
Secret string `json:"secret"`
|
||||
Role Role `json:"role"`
|
||||
UserID int `json:"userID"`
|
||||
GroupID int `json:"groupID"`
|
||||
}
|
||||
|
||||
type ListUserAccountsResult struct {
|
||||
@@ -59,19 +56,9 @@ type ListUserAccountsResult struct {
|
||||
|
||||
// Mutable props, which could be changed when updating an IAM account
|
||||
type MutableProps struct {
|
||||
Secret *string `json:"secret"`
|
||||
Role Role `json:"role"`
|
||||
UserID *int `json:"userID"`
|
||||
GroupID *int `json:"groupID"`
|
||||
ProjectID *int `json:"projectID"`
|
||||
}
|
||||
|
||||
func (m MutableProps) Validate() error {
|
||||
if m.Role != "" && !m.Role.IsValid() {
|
||||
return s3err.GetAPIError(s3err.ErrAdminInvalidUserRole)
|
||||
}
|
||||
|
||||
return nil
|
||||
Secret *string `json:"secret"`
|
||||
UserID *int `json:"userID"`
|
||||
GroupID *int `json:"groupID"`
|
||||
}
|
||||
|
||||
func updateAcc(acc *Account, props MutableProps) {
|
||||
@@ -84,12 +71,6 @@ func updateAcc(acc *Account, props MutableProps) {
|
||||
if props.UserID != nil {
|
||||
acc.UserID = *props.UserID
|
||||
}
|
||||
if props.ProjectID != nil {
|
||||
acc.ProjectID = *props.ProjectID
|
||||
}
|
||||
if props.Role != "" {
|
||||
acc.Role = props.Role
|
||||
}
|
||||
}
|
||||
|
||||
// IAMService is the interface for all IAM service implementations
|
||||
@@ -112,47 +93,43 @@ var (
|
||||
)
|
||||
|
||||
type Opts struct {
|
||||
RootAccount Account
|
||||
Dir string
|
||||
LDAPServerURL string
|
||||
LDAPBindDN string
|
||||
LDAPPassword string
|
||||
LDAPQueryBase string
|
||||
LDAPObjClasses string
|
||||
LDAPAccessAtr string
|
||||
LDAPSecretAtr string
|
||||
LDAPRoleAtr string
|
||||
LDAPUserIdAtr string
|
||||
LDAPGroupIdAtr string
|
||||
LDAPProjectIdAtr string
|
||||
LDAPTLSSkipVerify bool
|
||||
VaultEndpointURL string
|
||||
VaultNamespace string
|
||||
VaultSecretStoragePath string
|
||||
VaultSecretStorageNamespace string
|
||||
VaultAuthMethod string
|
||||
VaultAuthNamespace string
|
||||
VaultMountPath string
|
||||
VaultRootToken string
|
||||
VaultRoleId string
|
||||
VaultRoleSecret string
|
||||
VaultServerCert string
|
||||
VaultClientCert string
|
||||
VaultClientCertKey string
|
||||
S3Access string
|
||||
S3Secret string
|
||||
S3Region string
|
||||
S3Bucket string
|
||||
S3Endpoint string
|
||||
S3DisableSSlVerfiy bool
|
||||
CacheDisable bool
|
||||
CacheTTL int
|
||||
CachePrune int
|
||||
IpaHost string
|
||||
IpaVaultName string
|
||||
IpaUser string
|
||||
IpaPassword string
|
||||
IpaInsecure bool
|
||||
RootAccount Account
|
||||
Dir string
|
||||
LDAPServerURL string
|
||||
LDAPBindDN string
|
||||
LDAPPassword string
|
||||
LDAPQueryBase string
|
||||
LDAPObjClasses string
|
||||
LDAPAccessAtr string
|
||||
LDAPSecretAtr string
|
||||
LDAPRoleAtr string
|
||||
LDAPUserIdAtr string
|
||||
LDAPGroupIdAtr string
|
||||
VaultEndpointURL string
|
||||
VaultSecretStoragePath string
|
||||
VaultMountPath string
|
||||
VaultRootToken string
|
||||
VaultRoleId string
|
||||
VaultRoleSecret string
|
||||
VaultServerCert string
|
||||
VaultClientCert string
|
||||
VaultClientCertKey string
|
||||
S3Access string
|
||||
S3Secret string
|
||||
S3Region string
|
||||
S3Bucket string
|
||||
S3Endpoint string
|
||||
S3DisableSSlVerfiy bool
|
||||
S3Debug bool
|
||||
CacheDisable bool
|
||||
CacheTTL int
|
||||
CachePrune int
|
||||
IpaHost string
|
||||
IpaVaultName string
|
||||
IpaUser string
|
||||
IpaPassword string
|
||||
IpaInsecure bool
|
||||
IpaDebug bool
|
||||
}
|
||||
|
||||
func New(o *Opts) (IAMService, error) {
|
||||
@@ -166,20 +143,20 @@ func New(o *Opts) (IAMService, error) {
|
||||
case o.LDAPServerURL != "":
|
||||
svc, err = NewLDAPService(o.RootAccount, o.LDAPServerURL, o.LDAPBindDN, o.LDAPPassword,
|
||||
o.LDAPQueryBase, o.LDAPAccessAtr, o.LDAPSecretAtr, o.LDAPRoleAtr, o.LDAPUserIdAtr,
|
||||
o.LDAPGroupIdAtr, o.LDAPProjectIdAtr, o.LDAPObjClasses, o.LDAPTLSSkipVerify)
|
||||
o.LDAPGroupIdAtr, o.LDAPObjClasses)
|
||||
fmt.Printf("initializing LDAP IAM with %q\n", o.LDAPServerURL)
|
||||
case o.S3Endpoint != "":
|
||||
svc, err = NewS3(o.RootAccount, o.S3Access, o.S3Secret, o.S3Region, o.S3Bucket,
|
||||
o.S3Endpoint, o.S3DisableSSlVerfiy)
|
||||
o.S3Endpoint, o.S3DisableSSlVerfiy, o.S3Debug)
|
||||
fmt.Printf("initializing S3 IAM with '%v/%v'\n",
|
||||
o.S3Endpoint, o.S3Bucket)
|
||||
case o.VaultEndpointURL != "":
|
||||
svc, err = NewVaultIAMService(o.RootAccount, o.VaultEndpointURL, o.VaultNamespace, o.VaultSecretStoragePath, o.VaultSecretStorageNamespace,
|
||||
o.VaultAuthMethod, o.VaultAuthNamespace, o.VaultMountPath, o.VaultRootToken, o.VaultRoleId, o.VaultRoleSecret,
|
||||
svc, err = NewVaultIAMService(o.RootAccount, o.VaultEndpointURL, o.VaultSecretStoragePath,
|
||||
o.VaultMountPath, o.VaultRootToken, o.VaultRoleId, o.VaultRoleSecret,
|
||||
o.VaultServerCert, o.VaultClientCert, o.VaultClientCertKey)
|
||||
fmt.Printf("initializing Vault IAM with %q\n", o.VaultEndpointURL)
|
||||
case o.IpaHost != "":
|
||||
svc, err = NewIpaIAMService(o.RootAccount, o.IpaHost, o.IpaVaultName, o.IpaUser, o.IpaPassword, o.IpaInsecure)
|
||||
svc, err = NewIpaIAMService(o.RootAccount, o.IpaHost, o.IpaVaultName, o.IpaUser, o.IpaPassword, o.IpaInsecure, o.IpaDebug)
|
||||
fmt.Printf("initializing IPA IAM with %q\n", o.IpaHost)
|
||||
default:
|
||||
// if no iam options selected, default to the single user mode
|
||||
|
||||
@@ -194,12 +194,11 @@ func (s *IAMServiceInternal) ListUserAccounts() ([]Account, error) {
|
||||
var accs []Account
|
||||
for _, k := range keys {
|
||||
accs = append(accs, Account{
|
||||
Access: k,
|
||||
Secret: conf.AccessAccounts[k].Secret,
|
||||
Role: conf.AccessAccounts[k].Role,
|
||||
UserID: conf.AccessAccounts[k].UserID,
|
||||
GroupID: conf.AccessAccounts[k].GroupID,
|
||||
ProjectID: conf.AccessAccounts[k].ProjectID,
|
||||
Access: k,
|
||||
Secret: conf.AccessAccounts[k].Secret,
|
||||
Role: conf.AccessAccounts[k].Role,
|
||||
UserID: conf.AccessAccounts[k].UserID,
|
||||
GroupID: conf.AccessAccounts[k].GroupID,
|
||||
})
|
||||
}
|
||||
|
||||
@@ -291,49 +290,93 @@ func (s *IAMServiceInternal) readIAMData() ([]byte, error) {
|
||||
|
||||
func (s *IAMServiceInternal) storeIAM(update UpdateAcctFunc) error {
|
||||
// We are going to be racing with other running gateways without any
|
||||
// coordination. So the strategy here is to read the current file data,
|
||||
// update the data, write back out to a temp file, then rename the
|
||||
// temp file to the original file. This rename will replace the
|
||||
// original file with the new file. This is atomic and should always
|
||||
// allow for a consistent view of the data. There is a small
|
||||
// window where the file could be read and then updated by
|
||||
// another process. In this case any updates the other process did
|
||||
// will be lost. This is a limitation of the internal IAM service.
|
||||
// This should be rare, and even when it does happen should result
|
||||
// in a valid IAM file, just without the other process's updates.
|
||||
// coordination. So the strategy here is to read the current file data.
|
||||
// If the file doesn't exist, then we assume someone else is currently
|
||||
// updating the file. So we just need to keep retrying. We also need
|
||||
// to make sure the data is consistent within a single update. So racing
|
||||
// writes to a file would possibly leave this in some invalid state.
|
||||
// We can get atomic updates with rename. If we read the data, update
|
||||
// the data, write to a temp file, then rename the tempfile back to the
|
||||
// data file. This should always result in a complete data image.
|
||||
|
||||
iamFname := filepath.Join(s.dir, iamFile)
|
||||
backupFname := filepath.Join(s.dir, iamBackupFile)
|
||||
// There is at least one unsolved failure mode here.
|
||||
// If a gateway removes the data file and then crashes, all other
|
||||
// gateways will retry forever thinking that the original will eventually
|
||||
// write the file.
|
||||
|
||||
b, err := os.ReadFile(iamFname)
|
||||
if err != nil && !errors.Is(err, fs.ErrNotExist) {
|
||||
return fmt.Errorf("read iam file: %w", err)
|
||||
}
|
||||
retries := 0
|
||||
fname := filepath.Join(s.dir, iamFile)
|
||||
|
||||
// save copy of data
|
||||
datacopy := make([]byte, len(b))
|
||||
copy(datacopy, b)
|
||||
for {
|
||||
b, err := os.ReadFile(fname)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
// racing with someone else updating
|
||||
// keep retrying after backoff
|
||||
retries++
|
||||
if retries < maxretry {
|
||||
time.Sleep(backoff)
|
||||
continue
|
||||
}
|
||||
|
||||
// make a backup copy in case something happens
|
||||
err = s.writeUsingTempFile(b, backupFname)
|
||||
if err != nil {
|
||||
return fmt.Errorf("write backup iam file: %w", err)
|
||||
}
|
||||
// we have been unsuccessful trying to read the iam file
|
||||
// so this must be the case where something happened and
|
||||
// the file did not get updated successfully, and probably
|
||||
// isn't going to be. The recovery procedure would be to
|
||||
// copy the backup file into place of the original.
|
||||
return fmt.Errorf("no iam file, needs backup recovery")
|
||||
}
|
||||
if err != nil && !errors.Is(err, fs.ErrNotExist) {
|
||||
return fmt.Errorf("read iam file: %w", err)
|
||||
}
|
||||
|
||||
b, err = update(b)
|
||||
if err != nil {
|
||||
return fmt.Errorf("update iam data: %w", err)
|
||||
}
|
||||
// reset retries on successful read
|
||||
retries = 0
|
||||
|
||||
err = s.writeUsingTempFile(b, iamFname)
|
||||
if err != nil {
|
||||
return fmt.Errorf("write iam file: %w", err)
|
||||
err = os.Remove(fname)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
// racing with someone else updating
|
||||
// keep retrying after backoff
|
||||
time.Sleep(backoff)
|
||||
continue
|
||||
}
|
||||
if err != nil && !errors.Is(err, fs.ErrNotExist) {
|
||||
return fmt.Errorf("remove old iam file: %w", err)
|
||||
}
|
||||
|
||||
// save copy of data
|
||||
datacopy := make([]byte, len(b))
|
||||
copy(datacopy, b)
|
||||
|
||||
// make a backup copy in case we crash before update
|
||||
// this is after remove, so there is a small window something
|
||||
// can go wrong, but the remove should barrier other gateways
|
||||
// from trying to write backup at the same time. Only one
|
||||
// gateway will successfully remove the file.
|
||||
os.WriteFile(filepath.Join(s.dir, iamBackupFile), b, iamMode)
|
||||
|
||||
b, err = update(b)
|
||||
if err != nil {
|
||||
// update failed, try to write old data back out
|
||||
os.WriteFile(fname, datacopy, iamMode)
|
||||
return fmt.Errorf("update iam data: %w", err)
|
||||
}
|
||||
|
||||
err = s.writeTempFile(b)
|
||||
if err != nil {
|
||||
// update failed, try to write old data back out
|
||||
os.WriteFile(fname, datacopy, iamMode)
|
||||
return err
|
||||
}
|
||||
|
||||
break
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s *IAMServiceInternal) writeUsingTempFile(b []byte, fname string) error {
|
||||
func (s *IAMServiceInternal) writeTempFile(b []byte) error {
|
||||
fname := filepath.Join(s.dir, iamFile)
|
||||
|
||||
f, err := os.CreateTemp(s.dir, iamFile)
|
||||
if err != nil {
|
||||
return fmt.Errorf("create temp file: %w", err)
|
||||
@@ -341,7 +384,6 @@ func (s *IAMServiceInternal) writeUsingTempFile(b []byte, fname string) error {
|
||||
defer os.Remove(f.Name())
|
||||
|
||||
_, err = f.Write(b)
|
||||
f.Close()
|
||||
if err != nil {
|
||||
return fmt.Errorf("write temp file: %w", err)
|
||||
}
|
||||
|
||||
133
auth/iam_ipa.go
133
auth/iam_ipa.go
@@ -26,17 +26,12 @@ import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"net"
|
||||
"log"
|
||||
"net/http"
|
||||
"net/http/cookiejar"
|
||||
"net/url"
|
||||
"slices"
|
||||
"strconv"
|
||||
"strings"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
)
|
||||
|
||||
const IpaVersion = "2.254"
|
||||
@@ -50,12 +45,14 @@ type IpaIAMService struct {
|
||||
username string
|
||||
password string
|
||||
kraTransportKey *rsa.PublicKey
|
||||
debug bool
|
||||
rootAcc Account
|
||||
}
|
||||
|
||||
var _ IAMService = &IpaIAMService{}
|
||||
|
||||
func NewIpaIAMService(rootAcc Account, host, vaultName, username, password string, isInsecure bool) (*IpaIAMService, error) {
|
||||
func NewIpaIAMService(rootAcc Account, host, vaultName, username, password string, isInsecure, debug bool) (*IpaIAMService, error) {
|
||||
|
||||
ipa := IpaIAMService{
|
||||
id: 0,
|
||||
version: IpaVersion,
|
||||
@@ -63,6 +60,7 @@ func NewIpaIAMService(rootAcc Account, host, vaultName, username, password strin
|
||||
vaultName: vaultName,
|
||||
username: username,
|
||||
password: password,
|
||||
debug: debug,
|
||||
rootAcc: rootAcc,
|
||||
}
|
||||
jar, err := cookiejar.New(nil)
|
||||
@@ -74,7 +72,6 @@ func NewIpaIAMService(rootAcc Account, host, vaultName, username, password strin
|
||||
mTLSConfig := &tls.Config{InsecureSkipVerify: isInsecure}
|
||||
tr := &http.Transport{
|
||||
TLSClientConfig: mTLSConfig,
|
||||
Proxy: http.ProxyFromEnvironment,
|
||||
}
|
||||
ipa.client = http.Client{Jar: jar, Transport: tr}
|
||||
|
||||
@@ -105,7 +102,13 @@ func NewIpaIAMService(rootAcc Account, host, vaultName, username, password strin
|
||||
|
||||
ipa.kraTransportKey = cert.PublicKey.(*rsa.PublicKey)
|
||||
|
||||
isSupported := slices.Contains(vaultConfig.Wrapping_supported_algorithms, "aes-128-cbc")
|
||||
isSupported := false
|
||||
for _, algo := range vaultConfig.Wrapping_supported_algorithms {
|
||||
if algo == "aes-128-cbc" {
|
||||
isSupported = true
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if !isSupported {
|
||||
return nil,
|
||||
@@ -132,7 +135,6 @@ func (ipa *IpaIAMService) GetUserAccount(access string) (Account, error) {
|
||||
userResult := struct {
|
||||
Gidnumber []string
|
||||
Uidnumber []string
|
||||
PidNumber []string
|
||||
}{}
|
||||
|
||||
err = ipa.rpc(req, &userResult)
|
||||
@@ -140,25 +142,20 @@ func (ipa *IpaIAMService) GetUserAccount(access string) (Account, error) {
|
||||
return Account{}, err
|
||||
}
|
||||
|
||||
uid, err := parseToInt(userResult.Uidnumber, "userID")
|
||||
uid, err := strconv.Atoi(userResult.Uidnumber[0])
|
||||
if err != nil {
|
||||
return Account{}, err
|
||||
return Account{}, fmt.Errorf("ipa uid invalid: %w", err)
|
||||
}
|
||||
gid, err := parseToInt(userResult.Gidnumber, "groupID")
|
||||
gid, err := strconv.Atoi(userResult.Gidnumber[0])
|
||||
if err != nil {
|
||||
return Account{}, err
|
||||
}
|
||||
pId, err := parseToInt(userResult.PidNumber, "projectID")
|
||||
if err != nil {
|
||||
return Account{}, err
|
||||
return Account{}, fmt.Errorf("ipa gid invalid: %w", err)
|
||||
}
|
||||
|
||||
account := Account{
|
||||
Access: access,
|
||||
Role: RoleUser,
|
||||
UserID: uid,
|
||||
GroupID: gid,
|
||||
ProjectID: pId,
|
||||
Access: access,
|
||||
Role: RoleUser,
|
||||
UserID: uid,
|
||||
GroupID: gid,
|
||||
}
|
||||
|
||||
session_key := make([]byte, 16)
|
||||
@@ -229,8 +226,6 @@ func (ipa *IpaIAMService) Shutdown() error {
|
||||
|
||||
// Implementation
|
||||
|
||||
const requestRetries = 3
|
||||
|
||||
func (ipa *IpaIAMService) login() error {
|
||||
form := url.Values{}
|
||||
form.Set("user", ipa.username)
|
||||
@@ -247,33 +242,17 @@ func (ipa *IpaIAMService) login() error {
|
||||
req.Header.Set("referer", fmt.Sprintf("%s/ipa", ipa.host))
|
||||
req.Header.Set("Content-Type", "application/x-www-form-urlencoded")
|
||||
|
||||
var resp *http.Response
|
||||
for i := range requestRetries {
|
||||
resp, err = ipa.client.Do(req)
|
||||
if err == nil {
|
||||
break
|
||||
}
|
||||
// Check for transient network errors
|
||||
if isRetryable(err) {
|
||||
time.Sleep(time.Second * time.Duration(i+1))
|
||||
continue
|
||||
}
|
||||
return fmt.Errorf("login POST to %s failed: %w", req.URL, err)
|
||||
}
|
||||
resp, err := ipa.client.Do(req)
|
||||
if err != nil {
|
||||
return fmt.Errorf("login POST to %s failed after retries: %w",
|
||||
req.URL, err)
|
||||
return err
|
||||
}
|
||||
|
||||
defer resp.Body.Close()
|
||||
|
||||
if resp.StatusCode == 401 {
|
||||
return errors.New("cannot login to FreeIPA: invalid credentials")
|
||||
}
|
||||
|
||||
if resp.StatusCode != 200 {
|
||||
return fmt.Errorf("cannot login to FreeIPA: status code %d",
|
||||
resp.StatusCode)
|
||||
return fmt.Errorf("cannot login to FreeIPA: status code %d", resp.StatusCode)
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -316,34 +295,17 @@ func (ipa *IpaIAMService) rpcInternal(req rpcRequest) (rpcResponse, error) {
|
||||
return rpcResponse{}, err
|
||||
}
|
||||
|
||||
debuglogger.IAMLogf("IPA request: %v", req)
|
||||
ipa.log(fmt.Sprintf("%v", req))
|
||||
httpReq.Header.Set("referer", fmt.Sprintf("%s/ipa", ipa.host))
|
||||
httpReq.Header.Set("Content-Type", "application/json")
|
||||
|
||||
var httpResp *http.Response
|
||||
for i := range requestRetries {
|
||||
httpResp, err = ipa.client.Do(httpReq)
|
||||
if err == nil {
|
||||
break
|
||||
}
|
||||
// Check for transient network errors
|
||||
if isRetryable(err) {
|
||||
time.Sleep(time.Second * time.Duration(i+1))
|
||||
continue
|
||||
}
|
||||
return rpcResponse{}, fmt.Errorf("ipa request to %s failed: %w",
|
||||
httpReq.URL, err)
|
||||
}
|
||||
httpResp, err := ipa.client.Do(httpReq)
|
||||
if err != nil {
|
||||
return rpcResponse{},
|
||||
fmt.Errorf("ipa request to %s failed after retries: %w",
|
||||
httpReq.URL, err)
|
||||
return rpcResponse{}, err
|
||||
}
|
||||
|
||||
defer httpResp.Body.Close()
|
||||
|
||||
bytes, err := io.ReadAll(httpResp.Body)
|
||||
debuglogger.IAMLogf("IPA response (%v): %v", err, string(bytes))
|
||||
ipa.log(string(bytes))
|
||||
if err != nil {
|
||||
return rpcResponse{}, err
|
||||
}
|
||||
@@ -376,30 +338,6 @@ func (ipa *IpaIAMService) rpcInternal(req rpcRequest) (rpcResponse, error) {
|
||||
}, nil
|
||||
}
|
||||
|
||||
func isRetryable(err error) bool {
|
||||
if err == nil {
|
||||
return false
|
||||
}
|
||||
|
||||
if errors.Is(err, io.EOF) {
|
||||
return true
|
||||
}
|
||||
|
||||
if err, ok := err.(net.Error); ok && err.Timeout() {
|
||||
return true
|
||||
}
|
||||
|
||||
if opErr, ok := err.(*net.OpError); ok {
|
||||
if sysErr, ok := opErr.Err.(*syscall.Errno); ok {
|
||||
if *sysErr == syscall.ECONNRESET {
|
||||
return true
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return false
|
||||
}
|
||||
|
||||
func (ipa *IpaIAMService) newRequest(method string, args []string, dict map[string]any) (rpcRequest, error) {
|
||||
|
||||
id := ipa.id
|
||||
@@ -501,19 +439,8 @@ func (b *Base64Encoded) UnmarshalJSON(data []byte) error {
|
||||
return err
|
||||
}
|
||||
|
||||
// parseToInt parses the first argument of input string slice
|
||||
// to an integer. If slice is empty, it defaults to 0
|
||||
func parseToInt(input []string, argName string) (int, error) {
|
||||
if len(input) == 0 {
|
||||
debuglogger.IAMLogf("empty %s slice: defaulting to 0", argName)
|
||||
return 0, nil
|
||||
func (ipa *IpaIAMService) log(msg string) {
|
||||
if ipa.debug {
|
||||
log.Println(msg)
|
||||
}
|
||||
|
||||
id, err := strconv.Atoi(input[0])
|
||||
if err != nil {
|
||||
debuglogger.IAMLogf("failed to parse %s: %v", argName, err)
|
||||
return 0, fmt.Errorf("invalid %s: %w", argName, err)
|
||||
}
|
||||
|
||||
return id, nil
|
||||
}
|
||||
|
||||
217
auth/iam_ldap.go
217
auth/iam_ldap.go
@@ -15,124 +15,54 @@
|
||||
package auth
|
||||
|
||||
import (
|
||||
"crypto/tls"
|
||||
"fmt"
|
||||
"net/url"
|
||||
"strconv"
|
||||
"strings"
|
||||
"sync"
|
||||
|
||||
"github.com/davecgh/go-spew/spew"
|
||||
"github.com/go-ldap/ldap/v3"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
)
|
||||
|
||||
type LdapIAMService struct {
|
||||
conn *ldap.Conn
|
||||
queryBase string
|
||||
objClasses []string
|
||||
accessAtr string
|
||||
secretAtr string
|
||||
roleAtr string
|
||||
groupIdAtr string
|
||||
userIdAtr string
|
||||
projectIdAtr string
|
||||
rootAcc Account
|
||||
url string
|
||||
bindDN string
|
||||
pass string
|
||||
tlsSkipVerify bool
|
||||
mu sync.Mutex
|
||||
conn *ldap.Conn
|
||||
queryBase string
|
||||
objClasses []string
|
||||
accessAtr string
|
||||
secretAtr string
|
||||
roleAtr string
|
||||
groupIdAtr string
|
||||
userIdAtr string
|
||||
rootAcc Account
|
||||
}
|
||||
|
||||
var _ IAMService = &LdapIAMService{}
|
||||
|
||||
func NewLDAPService(rootAcc Account, ldapURL, bindDN, pass, queryBase, accAtr, secAtr, roleAtr, userIdAtr, groupIdAtr, projectIdAtr, objClasses string, tlsSkipVerify bool) (IAMService, error) {
|
||||
if ldapURL == "" || bindDN == "" || pass == "" || queryBase == "" || accAtr == "" ||
|
||||
secAtr == "" || roleAtr == "" || userIdAtr == "" || groupIdAtr == "" || projectIdAtr == "" || objClasses == "" {
|
||||
func NewLDAPService(rootAcc Account, url, bindDN, pass, queryBase, accAtr, secAtr, roleAtr, userIdAtr, groupIdAtr, objClasses string) (IAMService, error) {
|
||||
if url == "" || bindDN == "" || pass == "" || queryBase == "" || accAtr == "" ||
|
||||
secAtr == "" || roleAtr == "" || userIdAtr == "" || groupIdAtr == "" || objClasses == "" {
|
||||
return nil, fmt.Errorf("required parameters list not fully provided")
|
||||
}
|
||||
|
||||
conn, err := dialLDAP(ldapURL, tlsSkipVerify)
|
||||
conn, err := ldap.DialURL(url)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to connect to LDAP server: %w", err)
|
||||
}
|
||||
|
||||
err = conn.Bind(bindDN, pass)
|
||||
if err != nil {
|
||||
conn.Close()
|
||||
return nil, fmt.Errorf("failed to bind to LDAP server %w", err)
|
||||
}
|
||||
return &LdapIAMService{
|
||||
conn: conn,
|
||||
queryBase: queryBase,
|
||||
objClasses: strings.Split(objClasses, ","),
|
||||
accessAtr: accAtr,
|
||||
secretAtr: secAtr,
|
||||
roleAtr: roleAtr,
|
||||
userIdAtr: userIdAtr,
|
||||
groupIdAtr: groupIdAtr,
|
||||
projectIdAtr: projectIdAtr,
|
||||
rootAcc: rootAcc,
|
||||
url: ldapURL,
|
||||
bindDN: bindDN,
|
||||
pass: pass,
|
||||
tlsSkipVerify: tlsSkipVerify,
|
||||
conn: conn,
|
||||
queryBase: queryBase,
|
||||
objClasses: strings.Split(objClasses, ","),
|
||||
accessAtr: accAtr,
|
||||
secretAtr: secAtr,
|
||||
roleAtr: roleAtr,
|
||||
userIdAtr: userIdAtr,
|
||||
groupIdAtr: groupIdAtr,
|
||||
rootAcc: rootAcc,
|
||||
}, nil
|
||||
}
|
||||
|
||||
// dialLDAP establishes an LDAP connection with optional TLS configuration
|
||||
func dialLDAP(ldapURL string, tlsSkipVerify bool) (*ldap.Conn, error) {
|
||||
u, err := url.Parse(ldapURL)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("invalid LDAP URL: %w", err)
|
||||
}
|
||||
|
||||
// For ldaps:// URLs, use DialURL with custom TLS config if needed
|
||||
if u.Scheme == "ldaps" && tlsSkipVerify {
|
||||
tlsConfig := &tls.Config{
|
||||
InsecureSkipVerify: tlsSkipVerify,
|
||||
}
|
||||
return ldap.DialURL(ldapURL, ldap.DialWithTLSConfig(tlsConfig))
|
||||
}
|
||||
|
||||
// For ldap:// or when TLS verification is enabled, use standard DialURL
|
||||
return ldap.DialURL(ldapURL)
|
||||
}
|
||||
|
||||
func (ld *LdapIAMService) reconnect() error {
|
||||
ld.conn.Close()
|
||||
|
||||
conn, err := dialLDAP(ld.url, ld.tlsSkipVerify)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to reconnect to LDAP server: %w", err)
|
||||
}
|
||||
|
||||
err = conn.Bind(ld.bindDN, ld.pass)
|
||||
if err != nil {
|
||||
conn.Close()
|
||||
return fmt.Errorf("failed to bind to LDAP server on reconnect: %w", err)
|
||||
}
|
||||
ld.conn = conn
|
||||
return nil
|
||||
}
|
||||
|
||||
func (ld *LdapIAMService) execute(f func(*ldap.Conn) error) error {
|
||||
ld.mu.Lock()
|
||||
defer ld.mu.Unlock()
|
||||
|
||||
err := f(ld.conn)
|
||||
if err != nil {
|
||||
if e, ok := err.(*ldap.Error); ok && e.ResultCode == ldap.ErrorNetwork {
|
||||
if reconnErr := ld.reconnect(); reconnErr != nil {
|
||||
return reconnErr
|
||||
}
|
||||
return f(ld.conn)
|
||||
}
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func (ld *LdapIAMService) CreateAccount(account Account) error {
|
||||
if ld.rootAcc.Access == account.Access {
|
||||
return ErrUserExists
|
||||
@@ -144,11 +74,8 @@ func (ld *LdapIAMService) CreateAccount(account Account) error {
|
||||
userEntry.Attribute(ld.roleAtr, []string{string(account.Role)})
|
||||
userEntry.Attribute(ld.groupIdAtr, []string{fmt.Sprint(account.GroupID)})
|
||||
userEntry.Attribute(ld.userIdAtr, []string{fmt.Sprint(account.UserID)})
|
||||
userEntry.Attribute(ld.projectIdAtr, []string{fmt.Sprint(account.ProjectID)})
|
||||
|
||||
err := ld.execute(func(c *ldap.Conn) error {
|
||||
return c.Add(userEntry)
|
||||
})
|
||||
err := ld.conn.Add(userEntry)
|
||||
if err != nil {
|
||||
return fmt.Errorf("error adding an entry: %w", err)
|
||||
}
|
||||
@@ -156,22 +83,10 @@ func (ld *LdapIAMService) CreateAccount(account Account) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (ld *LdapIAMService) buildSearchFilter(access string) string {
|
||||
var searchFilter strings.Builder
|
||||
for _, el := range ld.objClasses {
|
||||
searchFilter.WriteString(fmt.Sprintf("(objectClass=%v)", el))
|
||||
}
|
||||
if access != "" {
|
||||
searchFilter.WriteString(fmt.Sprintf("(%v=%v)", ld.accessAtr, access))
|
||||
}
|
||||
return fmt.Sprintf("(&%v)", searchFilter.String())
|
||||
}
|
||||
|
||||
func (ld *LdapIAMService) GetUserAccount(access string) (Account, error) {
|
||||
if access == ld.rootAcc.Access {
|
||||
return ld.rootAcc, nil
|
||||
}
|
||||
var result *ldap.SearchResult
|
||||
searchRequest := ldap.NewSearchRequest(
|
||||
ld.queryBase,
|
||||
ldap.ScopeWholeSubtree,
|
||||
@@ -179,27 +94,12 @@ func (ld *LdapIAMService) GetUserAccount(access string) (Account, error) {
|
||||
0,
|
||||
0,
|
||||
false,
|
||||
ld.buildSearchFilter(access),
|
||||
[]string{ld.accessAtr, ld.secretAtr, ld.roleAtr, ld.userIdAtr, ld.groupIdAtr, ld.projectIdAtr},
|
||||
fmt.Sprintf("(%v=%v)", ld.accessAtr, access),
|
||||
[]string{ld.accessAtr, ld.secretAtr, ld.roleAtr, ld.userIdAtr, ld.groupIdAtr},
|
||||
nil,
|
||||
)
|
||||
|
||||
if debuglogger.IsIAMDebugEnabled() {
|
||||
debuglogger.IAMLogf("LDAP Search Request")
|
||||
debuglogger.IAMLogf(spew.Sdump(searchRequest))
|
||||
}
|
||||
|
||||
err := ld.execute(func(c *ldap.Conn) error {
|
||||
var err error
|
||||
result, err = c.Search(searchRequest)
|
||||
return err
|
||||
})
|
||||
|
||||
if debuglogger.IsIAMDebugEnabled() {
|
||||
debuglogger.IAMLogf("LDAP Search Result")
|
||||
debuglogger.IAMLogf(spew.Sdump(result))
|
||||
}
|
||||
|
||||
result, err := ld.conn.Search(searchRequest)
|
||||
if err != nil {
|
||||
return Account{}, err
|
||||
}
|
||||
@@ -219,19 +119,12 @@ func (ld *LdapIAMService) GetUserAccount(access string) (Account, error) {
|
||||
return Account{}, fmt.Errorf("invalid entry value for user-id %q: %w",
|
||||
entry.GetAttributeValue(ld.userIdAtr), err)
|
||||
}
|
||||
projectID, err := strconv.Atoi(entry.GetAttributeValue(ld.projectIdAtr))
|
||||
if err != nil {
|
||||
return Account{}, fmt.Errorf("invalid entry value for project-id %q: %w",
|
||||
entry.GetAttributeValue(ld.projectIdAtr), err)
|
||||
}
|
||||
|
||||
return Account{
|
||||
Access: entry.GetAttributeValue(ld.accessAtr),
|
||||
Secret: entry.GetAttributeValue(ld.secretAtr),
|
||||
Role: Role(entry.GetAttributeValue(ld.roleAtr)),
|
||||
GroupID: groupId,
|
||||
UserID: userId,
|
||||
ProjectID: projectID,
|
||||
Access: entry.GetAttributeValue(ld.accessAtr),
|
||||
Secret: entry.GetAttributeValue(ld.secretAtr),
|
||||
Role: Role(entry.GetAttributeValue(ld.roleAtr)),
|
||||
GroupID: groupId,
|
||||
UserID: userId,
|
||||
}, nil
|
||||
}
|
||||
|
||||
@@ -246,16 +139,8 @@ func (ld *LdapIAMService) UpdateUserAccount(access string, props MutableProps) e
|
||||
if props.UserID != nil {
|
||||
req.Replace(ld.userIdAtr, []string{fmt.Sprint(*props.UserID)})
|
||||
}
|
||||
if props.ProjectID != nil {
|
||||
req.Replace(ld.projectIdAtr, []string{fmt.Sprint(*props.ProjectID)})
|
||||
}
|
||||
if props.Role != "" {
|
||||
req.Replace(ld.roleAtr, []string{string(props.Role)})
|
||||
}
|
||||
|
||||
err := ld.execute(func(c *ldap.Conn) error {
|
||||
return c.Modify(req)
|
||||
})
|
||||
err := ld.conn.Modify(req)
|
||||
//TODO: Handle non existing user case
|
||||
if err != nil {
|
||||
return err
|
||||
@@ -266,9 +151,7 @@ func (ld *LdapIAMService) UpdateUserAccount(access string, props MutableProps) e
|
||||
func (ld *LdapIAMService) DeleteUserAccount(access string) error {
|
||||
delReq := ldap.NewDelRequest(fmt.Sprintf("%v=%v, %v", ld.accessAtr, access, ld.queryBase), nil)
|
||||
|
||||
err := ld.execute(func(c *ldap.Conn) error {
|
||||
return c.Del(delReq)
|
||||
})
|
||||
err := ld.conn.Del(delReq)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -277,7 +160,10 @@ func (ld *LdapIAMService) DeleteUserAccount(access string) error {
|
||||
}
|
||||
|
||||
func (ld *LdapIAMService) ListUserAccounts() ([]Account, error) {
|
||||
var resp *ldap.SearchResult
|
||||
searchFilter := ""
|
||||
for _, el := range ld.objClasses {
|
||||
searchFilter += fmt.Sprintf("(objectClass=%v)", el)
|
||||
}
|
||||
searchRequest := ldap.NewSearchRequest(
|
||||
ld.queryBase,
|
||||
ldap.ScopeWholeSubtree,
|
||||
@@ -285,16 +171,12 @@ func (ld *LdapIAMService) ListUserAccounts() ([]Account, error) {
|
||||
0,
|
||||
0,
|
||||
false,
|
||||
ld.buildSearchFilter(""),
|
||||
[]string{ld.accessAtr, ld.secretAtr, ld.roleAtr, ld.groupIdAtr, ld.projectIdAtr, ld.userIdAtr},
|
||||
fmt.Sprintf("(&%v)", searchFilter),
|
||||
[]string{ld.accessAtr, ld.secretAtr, ld.roleAtr, ld.groupIdAtr, ld.userIdAtr},
|
||||
nil,
|
||||
)
|
||||
|
||||
err := ld.execute(func(c *ldap.Conn) error {
|
||||
var err error
|
||||
resp, err = c.Search(searchRequest)
|
||||
return err
|
||||
})
|
||||
resp, err := ld.conn.Search(searchRequest)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -311,19 +193,12 @@ func (ld *LdapIAMService) ListUserAccounts() ([]Account, error) {
|
||||
return nil, fmt.Errorf("invalid entry value for user-id %q: %w",
|
||||
el.GetAttributeValue(ld.userIdAtr), err)
|
||||
}
|
||||
projectID, err := strconv.Atoi(el.GetAttributeValue(ld.projectIdAtr))
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("invalid entry value for project-id %q: %w",
|
||||
el.GetAttributeValue(ld.groupIdAtr), err)
|
||||
}
|
||||
|
||||
result = append(result, Account{
|
||||
Access: el.GetAttributeValue(ld.accessAtr),
|
||||
Secret: el.GetAttributeValue(ld.secretAtr),
|
||||
Role: Role(el.GetAttributeValue(ld.roleAtr)),
|
||||
GroupID: groupId,
|
||||
ProjectID: projectID,
|
||||
UserID: userId,
|
||||
Access: el.GetAttributeValue(ld.accessAtr),
|
||||
Secret: el.GetAttributeValue(ld.secretAtr),
|
||||
Role: Role(el.GetAttributeValue(ld.roleAtr)),
|
||||
GroupID: groupId,
|
||||
UserID: userId,
|
||||
})
|
||||
}
|
||||
|
||||
@@ -332,7 +207,5 @@ func (ld *LdapIAMService) ListUserAccounts() ([]Account, error) {
|
||||
|
||||
// Shutdown graceful termination of service
|
||||
func (ld *LdapIAMService) Shutdown() error {
|
||||
ld.mu.Lock()
|
||||
defer ld.mu.Unlock()
|
||||
return ld.conn.Close()
|
||||
}
|
||||
|
||||
@@ -1,56 +0,0 @@
|
||||
package auth
|
||||
|
||||
import "testing"
|
||||
|
||||
func TestLdapIAMService_BuildSearchFilter(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
objClasses []string
|
||||
accessAtr string
|
||||
access string
|
||||
expected string
|
||||
}{
|
||||
{
|
||||
name: "single object class with access",
|
||||
objClasses: []string{"inetOrgPerson"},
|
||||
accessAtr: "uid",
|
||||
access: "testuser",
|
||||
expected: "(&(objectClass=inetOrgPerson)(uid=testuser))",
|
||||
},
|
||||
{
|
||||
name: "single object class without access",
|
||||
objClasses: []string{"inetOrgPerson"},
|
||||
accessAtr: "uid",
|
||||
access: "",
|
||||
expected: "(&(objectClass=inetOrgPerson))",
|
||||
},
|
||||
{
|
||||
name: "multiple object classes with access",
|
||||
objClasses: []string{"inetOrgPerson", "organizationalPerson"},
|
||||
accessAtr: "cn",
|
||||
access: "john.doe",
|
||||
expected: "(&(objectClass=inetOrgPerson)(objectClass=organizationalPerson)(cn=john.doe))",
|
||||
},
|
||||
{
|
||||
name: "multiple object classes without access",
|
||||
objClasses: []string{"inetOrgPerson", "organizationalPerson", "person"},
|
||||
accessAtr: "cn",
|
||||
access: "",
|
||||
expected: "(&(objectClass=inetOrgPerson)(objectClass=organizationalPerson)(objectClass=person))",
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
ld := &LdapIAMService{
|
||||
objClasses: tt.objClasses,
|
||||
accessAtr: tt.accessAtr,
|
||||
}
|
||||
|
||||
result := ld.buildSearchFilter(tt.access)
|
||||
if result != tt.expected {
|
||||
t.Errorf("BuildSearchFilter() = %v, want %v", result, tt.expected)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -33,7 +33,6 @@ import (
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/aws/smithy-go"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
)
|
||||
|
||||
// IAMServiceS3 stores user accounts in an S3 object
|
||||
@@ -57,13 +56,14 @@ type IAMServiceS3 struct {
|
||||
bucket string
|
||||
endpoint string
|
||||
sslSkipVerify bool
|
||||
debug bool
|
||||
rootAcc Account
|
||||
client *s3.Client
|
||||
}
|
||||
|
||||
var _ IAMService = &IAMServiceS3{}
|
||||
|
||||
func NewS3(rootAcc Account, access, secret, region, bucket, endpoint string, sslSkipVerify bool) (*IAMServiceS3, error) {
|
||||
func NewS3(rootAcc Account, access, secret, region, bucket, endpoint string, sslSkipVerify, debug bool) (*IAMServiceS3, error) {
|
||||
if access == "" {
|
||||
return nil, fmt.Errorf("must provide s3 IAM service access key")
|
||||
}
|
||||
@@ -87,6 +87,7 @@ func NewS3(rootAcc Account, access, secret, region, bucket, endpoint string, ssl
|
||||
bucket: bucket,
|
||||
endpoint: endpoint,
|
||||
sslSkipVerify: sslSkipVerify,
|
||||
debug: debug,
|
||||
rootAcc: rootAcc,
|
||||
}
|
||||
|
||||
@@ -205,12 +206,11 @@ func (s *IAMServiceS3) ListUserAccounts() ([]Account, error) {
|
||||
var accs []Account
|
||||
for _, k := range keys {
|
||||
accs = append(accs, Account{
|
||||
Access: k,
|
||||
Secret: conf.AccessAccounts[k].Secret,
|
||||
Role: conf.AccessAccounts[k].Role,
|
||||
UserID: conf.AccessAccounts[k].UserID,
|
||||
GroupID: conf.AccessAccounts[k].GroupID,
|
||||
ProjectID: conf.AccessAccounts[k].ProjectID,
|
||||
Access: k,
|
||||
Secret: conf.AccessAccounts[k].Secret,
|
||||
Role: conf.AccessAccounts[k].Role,
|
||||
UserID: conf.AccessAccounts[k].UserID,
|
||||
GroupID: conf.AccessAccounts[k].GroupID,
|
||||
})
|
||||
}
|
||||
|
||||
@@ -235,7 +235,7 @@ func (s *IAMServiceS3) getConfig() (aws.Config, error) {
|
||||
config.WithHTTPClient(client),
|
||||
}
|
||||
|
||||
if debuglogger.IsIAMDebugEnabled() {
|
||||
if s.debug {
|
||||
opts = append(opts,
|
||||
config.WithClientLogMode(aws.LogSigning|aws.LogRetries|aws.LogRequest|aws.LogResponse|aws.LogRequestEventMessage|aws.LogResponseEventMessage))
|
||||
}
|
||||
|
||||
@@ -19,7 +19,6 @@ import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net/http"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
@@ -27,50 +26,21 @@ import (
|
||||
"github.com/hashicorp/vault-client-go/schema"
|
||||
)
|
||||
|
||||
const requestTimeout = 10 * time.Second
|
||||
|
||||
type VaultIAMService struct {
|
||||
client *vault.Client
|
||||
authReqOpts []vault.RequestOption
|
||||
kvReqOpts []vault.RequestOption
|
||||
reqOpts []vault.RequestOption
|
||||
secretStoragePath string
|
||||
rootAcc Account
|
||||
creds schema.AppRoleLoginRequest
|
||||
}
|
||||
|
||||
type VaultIAMNamespace struct {
|
||||
Auth string
|
||||
SecretStorage string
|
||||
}
|
||||
|
||||
// Resolve empty specific namespaces to the fallback.
|
||||
// Empty result means root namespace.
|
||||
func resolveVaultNamespaces(authNamespace, secretStorageNamespace, fallback string) VaultIAMNamespace {
|
||||
ns := VaultIAMNamespace{
|
||||
Auth: authNamespace,
|
||||
SecretStorage: secretStorageNamespace,
|
||||
}
|
||||
|
||||
if ns.Auth == "" {
|
||||
ns.Auth = fallback
|
||||
}
|
||||
if ns.SecretStorage == "" {
|
||||
ns.SecretStorage = fallback
|
||||
}
|
||||
|
||||
return ns
|
||||
}
|
||||
|
||||
var _ IAMService = &VaultIAMService{}
|
||||
|
||||
func NewVaultIAMService(rootAcc Account, endpoint, namespace, secretStoragePath, secretStorageNamespace,
|
||||
authMethod, authNamespace, mountPath, rootToken, roleID, roleSecret, serverCert,
|
||||
clientCert, clientCertKey string) (IAMService, error) {
|
||||
func NewVaultIAMService(rootAcc Account, endpoint, secretStoragePath, mountPath, rootToken, roleID, roleSecret, serverCert, clientCert, clientCertKey string) (IAMService, error) {
|
||||
opts := []vault.ClientOption{
|
||||
vault.WithAddress(endpoint),
|
||||
vault.WithRequestTimeout(requestTimeout),
|
||||
// set request timeout to 10 secs
|
||||
vault.WithRequestTimeout(10 * time.Second),
|
||||
}
|
||||
|
||||
if serverCert != "" {
|
||||
tls := vault.TLSConfiguration{}
|
||||
|
||||
@@ -92,43 +62,10 @@ func NewVaultIAMService(rootAcc Account, endpoint, namespace, secretStoragePath,
|
||||
return nil, fmt.Errorf("init vault client: %w", err)
|
||||
}
|
||||
|
||||
authReqOpts := []vault.RequestOption{}
|
||||
// if auth method path is not specified, it defaults to "approle"
|
||||
if authMethod != "" {
|
||||
authReqOpts = append(authReqOpts, vault.WithMountPath(authMethod))
|
||||
}
|
||||
|
||||
kvReqOpts := []vault.RequestOption{}
|
||||
// if mount path is not specified, it defaults to "kv-v2"
|
||||
reqOpts := []vault.RequestOption{}
|
||||
// if mount path is not specified, it defaults to "approle"
|
||||
if mountPath != "" {
|
||||
kvReqOpts = append(kvReqOpts, vault.WithMountPath(mountPath))
|
||||
}
|
||||
|
||||
// Resolve namespaces using optional generic fallback "namespace"
|
||||
ns := resolveVaultNamespaces(authNamespace, secretStorageNamespace, namespace)
|
||||
|
||||
// Guard: AppRole tokens are namespace scoped. If using AppRole and namespaces differ, error early.
|
||||
// Root token can span namespaces because each request carries X-Vault-Namespace.
|
||||
if rootToken == "" && ns.Auth != "" && ns.SecretStorage != "" && ns.Auth != ns.SecretStorage {
|
||||
return nil, fmt.Errorf(
|
||||
"approle tokens are namespace scoped. auth namespace %q and secret storage namespace %q differ. "+
|
||||
"use the same namespace or authenticate with a root token",
|
||||
ns.Auth, ns.SecretStorage,
|
||||
)
|
||||
}
|
||||
|
||||
// Apply namespaces to the correct request option sets.
|
||||
// For root token we do not need an auth namespace since we are not logging in via auth.
|
||||
if rootToken == "" && ns.Auth != "" {
|
||||
authReqOpts = append(authReqOpts, vault.WithNamespace(ns.Auth))
|
||||
}
|
||||
if ns.SecretStorage != "" {
|
||||
kvReqOpts = append(kvReqOpts, vault.WithNamespace(ns.SecretStorage))
|
||||
}
|
||||
|
||||
creds := schema.AppRoleLoginRequest{
|
||||
RoleId: roleID,
|
||||
SecretId: roleSecret,
|
||||
reqOpts = append(reqOpts, vault.WithMountPath(mountPath))
|
||||
}
|
||||
|
||||
// Authentication
|
||||
@@ -143,8 +80,12 @@ func NewVaultIAMService(rootAcc Account, endpoint, namespace, secretStoragePath,
|
||||
return nil, fmt.Errorf("role id and role secret must both be specified")
|
||||
}
|
||||
|
||||
resp, err := client.Auth.AppRoleLogin(context.Background(),
|
||||
creds, authReqOpts...)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
|
||||
resp, err := client.Auth.AppRoleLogin(ctx, schema.AppRoleLoginRequest{
|
||||
RoleId: roleID,
|
||||
SecretId: roleSecret,
|
||||
}, reqOpts...)
|
||||
cancel()
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("approle authentication failure: %w", err)
|
||||
}
|
||||
@@ -158,81 +99,33 @@ func NewVaultIAMService(rootAcc Account, endpoint, namespace, secretStoragePath,
|
||||
|
||||
return &VaultIAMService{
|
||||
client: client,
|
||||
authReqOpts: authReqOpts,
|
||||
kvReqOpts: kvReqOpts,
|
||||
reqOpts: reqOpts,
|
||||
secretStoragePath: secretStoragePath,
|
||||
rootAcc: rootAcc,
|
||||
creds: creds,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func (vt *VaultIAMService) reAuthIfNeeded(err error) error {
|
||||
if err == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Vault returns 403 for expired/revoked tokens
|
||||
// pass all other errors back unchanged
|
||||
if !vault.IsErrorStatus(err, http.StatusForbidden) {
|
||||
return err
|
||||
}
|
||||
|
||||
resp, authErr := vt.client.Auth.AppRoleLogin(context.Background(),
|
||||
vt.creds, vt.authReqOpts...)
|
||||
if authErr != nil {
|
||||
return fmt.Errorf("vault re-authentication failure: %w", authErr)
|
||||
}
|
||||
if err := vt.client.SetToken(resp.Auth.ClientToken); err != nil {
|
||||
return fmt.Errorf("vault re-authentication set token failure: %w", err)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (vt *VaultIAMService) CreateAccount(account Account) error {
|
||||
if vt.rootAcc.Access == account.Access {
|
||||
return ErrUserExists
|
||||
}
|
||||
_, err := vt.client.Secrets.KvV2Write(context.Background(),
|
||||
vt.secretStoragePath+"/"+account.Access, schema.KvV2WriteRequest{
|
||||
Data: map[string]any{
|
||||
account.Access: account,
|
||||
},
|
||||
Options: map[string]any{
|
||||
"cas": 0,
|
||||
},
|
||||
}, vt.kvReqOpts...)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
|
||||
_, err := vt.client.Secrets.KvV2Write(ctx, vt.secretStoragePath+"/"+account.Access, schema.KvV2WriteRequest{
|
||||
Data: map[string]any{
|
||||
account.Access: account,
|
||||
},
|
||||
Options: map[string]interface{}{
|
||||
"cas": 0,
|
||||
},
|
||||
}, vt.reqOpts...)
|
||||
cancel()
|
||||
if err != nil {
|
||||
if strings.Contains(err.Error(), "check-and-set") {
|
||||
return ErrUserExists
|
||||
}
|
||||
|
||||
reauthErr := vt.reAuthIfNeeded(err)
|
||||
if reauthErr != nil {
|
||||
return reauthErr
|
||||
}
|
||||
// retry once after re-auth
|
||||
_, err = vt.client.Secrets.KvV2Write(context.Background(),
|
||||
vt.secretStoragePath+"/"+account.Access, schema.KvV2WriteRequest{
|
||||
Data: map[string]any{
|
||||
account.Access: account,
|
||||
},
|
||||
Options: map[string]any{
|
||||
"cas": 0,
|
||||
},
|
||||
}, vt.kvReqOpts...)
|
||||
if err != nil {
|
||||
if strings.Contains(err.Error(), "check-and-set") {
|
||||
return ErrUserExists
|
||||
}
|
||||
if vault.IsErrorStatus(err, http.StatusForbidden) {
|
||||
return fmt.Errorf("vault 403 permission denied on path %q. check KV mount path and policy. original: %w",
|
||||
vt.secretStoragePath+"/"+account.Access, err)
|
||||
}
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -240,84 +133,66 @@ func (vt *VaultIAMService) GetUserAccount(access string) (Account, error) {
|
||||
if vt.rootAcc.Access == access {
|
||||
return vt.rootAcc, nil
|
||||
}
|
||||
resp, err := vt.client.Secrets.KvV2Read(context.Background(),
|
||||
vt.secretStoragePath+"/"+access, vt.kvReqOpts...)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
|
||||
resp, err := vt.client.Secrets.KvV2Read(ctx, vt.secretStoragePath+"/"+access, vt.reqOpts...)
|
||||
cancel()
|
||||
if err != nil {
|
||||
reauthErr := vt.reAuthIfNeeded(err)
|
||||
if reauthErr != nil {
|
||||
return Account{}, reauthErr
|
||||
}
|
||||
// retry once after re-auth
|
||||
resp, err = vt.client.Secrets.KvV2Read(context.Background(),
|
||||
vt.secretStoragePath+"/"+access, vt.kvReqOpts...)
|
||||
if err != nil {
|
||||
return Account{}, err
|
||||
}
|
||||
return Account{}, err
|
||||
}
|
||||
|
||||
acc, err := parseVaultUserAccount(resp.Data.Data, access)
|
||||
if err != nil {
|
||||
return Account{}, err
|
||||
}
|
||||
|
||||
return acc, nil
|
||||
}
|
||||
|
||||
func (vt *VaultIAMService) UpdateUserAccount(access string, props MutableProps) error {
|
||||
//TODO: We need something like a transaction here ?
|
||||
acc, err := vt.GetUserAccount(access)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
updateAcc(&acc, props)
|
||||
|
||||
err = vt.DeleteUserAccount(access)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
err = vt.CreateAccount(acc)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (vt *VaultIAMService) DeleteUserAccount(access string) error {
|
||||
_, err := vt.client.Secrets.KvV2DeleteMetadataAndAllVersions(context.Background(),
|
||||
vt.secretStoragePath+"/"+access, vt.kvReqOpts...)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
|
||||
_, err := vt.client.Secrets.KvV2DeleteMetadataAndAllVersions(ctx, vt.secretStoragePath+"/"+access, vt.reqOpts...)
|
||||
cancel()
|
||||
if err != nil {
|
||||
reauthErr := vt.reAuthIfNeeded(err)
|
||||
if reauthErr != nil {
|
||||
return reauthErr
|
||||
}
|
||||
// retry once after re-auth
|
||||
_, err = vt.client.Secrets.KvV2DeleteMetadataAndAllVersions(context.Background(),
|
||||
vt.secretStoragePath+"/"+access, vt.kvReqOpts...)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (vt *VaultIAMService) ListUserAccounts() ([]Account, error) {
|
||||
resp, err := vt.client.Secrets.KvV2List(context.Background(),
|
||||
vt.secretStoragePath, vt.kvReqOpts...)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
|
||||
resp, err := vt.client.Secrets.KvV2List(ctx, vt.secretStoragePath, vt.reqOpts...)
|
||||
cancel()
|
||||
if err != nil {
|
||||
reauthErr := vt.reAuthIfNeeded(err)
|
||||
if reauthErr != nil {
|
||||
if vault.IsErrorStatus(err, http.StatusNotFound) {
|
||||
return []Account{}, nil
|
||||
}
|
||||
return nil, reauthErr
|
||||
}
|
||||
// retry once after re-auth
|
||||
resp, err = vt.client.Secrets.KvV2List(context.Background(),
|
||||
vt.secretStoragePath, vt.kvReqOpts...)
|
||||
if err != nil {
|
||||
if vault.IsErrorStatus(err, http.StatusNotFound) {
|
||||
return []Account{}, nil
|
||||
}
|
||||
return nil, err
|
||||
if vault.IsErrorStatus(err, 404) {
|
||||
return []Account{}, nil
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
|
||||
accs := []Account{}
|
||||
|
||||
for _, acss := range resp.Data.Keys {
|
||||
acc, err := vt.GetUserAccount(acss)
|
||||
if err != nil {
|
||||
@@ -325,6 +200,7 @@ func (vt *VaultIAMService) ListUserAccounts() ([]Account, error) {
|
||||
}
|
||||
accs = append(accs, acc)
|
||||
}
|
||||
|
||||
return accs, nil
|
||||
}
|
||||
|
||||
@@ -335,8 +211,8 @@ func (vt *VaultIAMService) Shutdown() error {
|
||||
|
||||
var errInvalidUser error = errors.New("invalid user account entry in secrets engine")
|
||||
|
||||
func parseVaultUserAccount(data map[string]any, access string) (acc Account, err error) {
|
||||
usrAcc, ok := data[access].(map[string]any)
|
||||
func parseVaultUserAccount(data map[string]interface{}, access string) (acc Account, err error) {
|
||||
usrAcc, ok := data[access].(map[string]interface{})
|
||||
if !ok {
|
||||
return acc, errInvalidUser
|
||||
}
|
||||
@@ -369,21 +245,12 @@ func parseVaultUserAccount(data map[string]any, access string) (acc Account, err
|
||||
if err != nil {
|
||||
return acc, errInvalidUser
|
||||
}
|
||||
projectIdJson, ok := usrAcc["projectID"].(json.Number)
|
||||
if !ok {
|
||||
return acc, errInvalidUser
|
||||
}
|
||||
projectID, err := projectIdJson.Int64()
|
||||
if err != nil {
|
||||
return acc, errInvalidUser
|
||||
}
|
||||
|
||||
return Account{
|
||||
Access: acss,
|
||||
Secret: secret,
|
||||
Role: Role(role),
|
||||
UserID: int(userId),
|
||||
GroupID: int(groupId),
|
||||
ProjectID: int(projectID),
|
||||
Access: acss,
|
||||
Secret: secret,
|
||||
Role: Role(role),
|
||||
UserID: int(userId),
|
||||
GroupID: int(groupId),
|
||||
}, nil
|
||||
}
|
||||
|
||||
@@ -24,7 +24,6 @@ import (
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
@@ -41,7 +40,7 @@ func ParseBucketLockConfigurationInput(input []byte) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
if lockConfig.ObjectLockEnabled != types.ObjectLockEnabledEnabled {
|
||||
if lockConfig.ObjectLockEnabled != "" && lockConfig.ObjectLockEnabled != types.ObjectLockEnabledEnabled {
|
||||
return nil, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
@@ -93,101 +92,28 @@ func ParseBucketLockConfigurationOutput(input []byte) (*types.ObjectLockConfigur
|
||||
return result, nil
|
||||
}
|
||||
|
||||
func ParseObjectLockRetentionInput(input []byte) (*s3response.PutObjectRetentionInput, error) {
|
||||
func ParseObjectLockRetentionInput(input []byte) ([]byte, error) {
|
||||
var retention s3response.PutObjectRetentionInput
|
||||
if err := xml.Unmarshal(input, &retention); err != nil {
|
||||
debuglogger.Logf("invalid object lock retention request body: %v", err)
|
||||
return nil, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
if retention.RetainUntilDate.Before(time.Now()) {
|
||||
debuglogger.Logf("object lock retain until date must be in the future")
|
||||
return nil, s3err.GetAPIError(s3err.ErrPastObjectLockRetainDate)
|
||||
}
|
||||
switch retention.Mode {
|
||||
case types.ObjectLockRetentionModeCompliance:
|
||||
case types.ObjectLockRetentionModeGovernance:
|
||||
default:
|
||||
debuglogger.Logf("invalid object lock retention mode: %s", retention.Mode)
|
||||
return nil, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
return &retention, nil
|
||||
}
|
||||
|
||||
func ParseObjectLockRetentionInputToJSON(input *s3response.PutObjectRetentionInput) ([]byte, error) {
|
||||
data, err := json.Marshal(input)
|
||||
if err != nil {
|
||||
debuglogger.Logf("parse object lock retention to JSON: %v", err)
|
||||
return nil, fmt.Errorf("parse object lock retention: %w", err)
|
||||
}
|
||||
|
||||
return data, nil
|
||||
}
|
||||
|
||||
// IsObjectLockRetentionPutAllowed checks if the object lock retention PUT request
|
||||
// is allowed against the current state of the object lock
|
||||
func IsObjectLockRetentionPutAllowed(ctx context.Context, be backend.Backend, bucket, object, versionId, userAccess string, input *s3response.PutObjectRetentionInput, bypass bool) error {
|
||||
ret, err := be.GetObjectRetention(ctx, bucket, object, versionId)
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrNoSuchObjectLockConfiguration)) {
|
||||
// if object lock configuration is not set
|
||||
// allow the retention modification without any checks
|
||||
return nil
|
||||
}
|
||||
if err != nil {
|
||||
debuglogger.Logf("failed to get object retention: %v", err)
|
||||
return err
|
||||
}
|
||||
|
||||
retention, err := ParseObjectLockRetentionOutput(ret)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if retention.Mode == input.Mode {
|
||||
// if retention mode is the same
|
||||
// the operation is allowed
|
||||
return nil
|
||||
}
|
||||
|
||||
if retention.Mode == types.ObjectLockRetentionModeCompliance {
|
||||
// COMPLIANCE mode is by definition not allowed to modify
|
||||
debuglogger.Logf("object lock retention change request from 'COMPLIANCE' to 'GOVERNANCE' is not allowed")
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
|
||||
if !bypass {
|
||||
// if x-amz-bypass-governance-retention is not provided
|
||||
// return error: object is locked
|
||||
debuglogger.Logf("object lock retention mode change is not allowed and bypass governence is not forced")
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
|
||||
// the last case left, when user tries to chenge
|
||||
// from 'GOVERNANCE' to 'COMPLIANCE' with
|
||||
// 'x-amz-bypass-governance-retention' header
|
||||
// first we need to check if user has 's3:BypassGovernanceRetention'
|
||||
policy, err := be.GetBucketPolicy(ctx, bucket)
|
||||
if err != nil {
|
||||
// if it fails to get the policy, return object is locked
|
||||
debuglogger.Logf("failed to get the bucket policy: %v", err)
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
err = VerifyBucketPolicy(policy, userAccess, bucket, object, BypassGovernanceRetentionAction)
|
||||
if err != nil {
|
||||
// if user doesn't have "s3:BypassGovernanceRetention" permission
|
||||
// return object is locked
|
||||
debuglogger.Logf("the user is missing 's3:BypassGovernanceRetention' permission")
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
|
||||
return nil
|
||||
return json.Marshal(retention)
|
||||
}
|
||||
|
||||
func ParseObjectLockRetentionOutput(input []byte) (*types.ObjectLockRetention, error) {
|
||||
var retention types.ObjectLockRetention
|
||||
if err := json.Unmarshal(input, &retention); err != nil {
|
||||
debuglogger.Logf("parse object lock retention output: %v", err)
|
||||
return nil, fmt.Errorf("parse object lock retention: %w", err)
|
||||
}
|
||||
|
||||
@@ -210,16 +136,7 @@ func ParseObjectLegalHoldOutput(status *bool) *s3response.GetObjectLegalHoldResu
|
||||
}
|
||||
}
|
||||
|
||||
func CheckObjectAccess(ctx context.Context, bucket, userAccess string, objects []types.ObjectIdentifier, bypass, isBucketPublic bool, be backend.Backend, isOverwrite bool) error {
|
||||
if isOverwrite {
|
||||
// if bucket versioning is enabled, any overwrite request
|
||||
// should be enabled, as it leads to a new object version
|
||||
// creation
|
||||
res, err := be.GetBucketVersioning(ctx, bucket)
|
||||
if err == nil && res.Status != nil && *res.Status == types.BucketVersioningStatusEnabled {
|
||||
return nil
|
||||
}
|
||||
}
|
||||
func CheckObjectAccess(ctx context.Context, bucket, userAccess string, objects []types.ObjectIdentifier, bypass bool, be backend.Backend) error {
|
||||
data, err := be.GetObjectLockConfiguration(ctx, bucket)
|
||||
if err != nil {
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrObjectLockConfigurationNotFound)) {
|
||||
@@ -254,12 +171,6 @@ func CheckObjectAccess(ctx context.Context, bucket, userAccess string, objects [
|
||||
}
|
||||
}
|
||||
|
||||
var versioningEnabled bool
|
||||
vers, err := be.GetBucketVersioning(ctx, bucket)
|
||||
if err == nil && vers.Status != nil {
|
||||
versioningEnabled = *vers.Status == types.BucketVersioningStatusEnabled
|
||||
}
|
||||
|
||||
for _, obj := range objects {
|
||||
var key, versionId string
|
||||
if obj.Key != nil {
|
||||
@@ -268,21 +179,11 @@ func CheckObjectAccess(ctx context.Context, bucket, userAccess string, objects [
|
||||
if obj.VersionId != nil {
|
||||
versionId = *obj.VersionId
|
||||
}
|
||||
// if bucket versioning is enabled and versionId isn't provided
|
||||
// no lock check is needed, as it leads to a new delete marker creation
|
||||
if versioningEnabled && versionId == "" {
|
||||
continue
|
||||
}
|
||||
checkRetention := true
|
||||
retentionData, err := be.GetObjectRetention(ctx, bucket, key, versionId)
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrNoSuchKey)) {
|
||||
continue
|
||||
}
|
||||
// the object is a delete marker, if a `MethodNotAllowed` error is returned
|
||||
// no object lock check is needed
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrMethodNotAllowed)) {
|
||||
continue
|
||||
}
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrNoSuchObjectLockConfiguration)) {
|
||||
checkRetention = false
|
||||
}
|
||||
@@ -297,35 +198,27 @@ func CheckObjectAccess(ctx context.Context, bucket, userAccess string, objects [
|
||||
}
|
||||
|
||||
if retention.Mode != "" && retention.RetainUntilDate != nil {
|
||||
if retention.RetainUntilDate.Before(time.Now()) {
|
||||
// if the object retention is expired, the object
|
||||
// is allowed for write operations(delete, modify)
|
||||
return nil
|
||||
}
|
||||
|
||||
switch retention.Mode {
|
||||
case types.ObjectLockRetentionModeGovernance:
|
||||
if !bypass {
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
} else {
|
||||
policy, err := be.GetBucketPolicy(ctx, bucket)
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrNoSuchBucketPolicy)) {
|
||||
if retention.RetainUntilDate.After(time.Now()) {
|
||||
switch retention.Mode {
|
||||
case types.ObjectLockRetentionModeGovernance:
|
||||
if !bypass {
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if isBucketPublic {
|
||||
err = VerifyPublicBucketPolicy(policy, bucket, key, BypassGovernanceRetentionAction)
|
||||
} else {
|
||||
policy, err := be.GetBucketPolicy(ctx, bucket)
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrNoSuchBucketPolicy)) {
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
err = VerifyBucketPolicy(policy, userAccess, bucket, key, BypassGovernanceRetentionAction)
|
||||
if err != nil {
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
}
|
||||
if err != nil {
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
case types.ObjectLockRetentionModeCompliance:
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
case types.ObjectLockRetentionModeCompliance:
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -361,11 +254,7 @@ func CheckObjectAccess(ctx context.Context, bucket, userAccess string, objects [
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if isBucketPublic {
|
||||
err = VerifyPublicBucketPolicy(policy, bucket, key, BypassGovernanceRetentionAction)
|
||||
} else {
|
||||
err = VerifyBucketPolicy(policy, userAccess, bucket, key, BypassGovernanceRetentionAction)
|
||||
}
|
||||
err = VerifyBucketPolicy(policy, userAccess, bucket, key, BypassGovernanceRetentionAction)
|
||||
if err != nil {
|
||||
return s3err.GetAPIError(s3err.ErrObjectLocked)
|
||||
}
|
||||
|
||||
@@ -8,8 +8,7 @@ var IgnoredHeaders = Rules{
|
||||
// some clients use user-agent in signed headers
|
||||
// "User-Agent": struct{}{},
|
||||
"X-Amzn-Trace-Id": struct{}{},
|
||||
// Expect might appear in signed headers
|
||||
// "Expect": struct{}{},
|
||||
"Expect": struct{}{},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
@@ -41,7 +41,7 @@ func TestIgnoredHeaders(t *testing.T) {
|
||||
}{
|
||||
"expect": {
|
||||
Header: "Expect",
|
||||
ExpectIgnored: false,
|
||||
ExpectIgnored: true,
|
||||
},
|
||||
"authorization": {
|
||||
Header: "Authorization",
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -40,7 +40,7 @@ func azErrToS3err(azErr *azcore.ResponseError) s3err.APIError {
|
||||
case "BlobNotFound":
|
||||
return s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
case "TagsTooLarge":
|
||||
return s3err.GetAPIError(s3err.ErrInvalidTagValue)
|
||||
return s3err.GetAPIError(s3err.ErrInvalidTag)
|
||||
case "Requested Range Not Satisfiable":
|
||||
return s3err.GetAPIError(s3err.ErrInvalidRange)
|
||||
}
|
||||
|
||||
@@ -46,13 +46,13 @@ type Backend interface {
|
||||
PutBucketOwnershipControls(_ context.Context, bucket string, ownership types.ObjectOwnership) error
|
||||
GetBucketOwnershipControls(_ context.Context, bucket string) (types.ObjectOwnership, error)
|
||||
DeleteBucketOwnershipControls(_ context.Context, bucket string) error
|
||||
PutBucketCors(_ context.Context, bucket string, cors []byte) error
|
||||
PutBucketCors(context.Context, []byte) error
|
||||
GetBucketCors(_ context.Context, bucket string) ([]byte, error)
|
||||
DeleteBucketCors(_ context.Context, bucket string) error
|
||||
|
||||
// multipart operations
|
||||
CreateMultipartUpload(context.Context, s3response.CreateMultipartUploadInput) (s3response.InitiateMultipartUploadResult, error)
|
||||
CompleteMultipartUpload(context.Context, *s3.CompleteMultipartUploadInput) (_ s3response.CompleteMultipartUploadResult, versionid string, _ error)
|
||||
CompleteMultipartUpload(context.Context, *s3.CompleteMultipartUploadInput) (*s3.CompleteMultipartUploadOutput, error)
|
||||
AbortMultipartUpload(context.Context, *s3.AbortMultipartUploadInput) error
|
||||
ListMultipartUploads(context.Context, *s3.ListMultipartUploadsInput) (s3response.ListMultipartUploadsResult, error)
|
||||
ListParts(context.Context, *s3.ListPartsInput) (s3response.ListPartsResult, error)
|
||||
@@ -65,7 +65,7 @@ type Backend interface {
|
||||
GetObject(context.Context, *s3.GetObjectInput) (*s3.GetObjectOutput, error)
|
||||
GetObjectAcl(context.Context, *s3.GetObjectAclInput) (*s3.GetObjectAclOutput, error)
|
||||
GetObjectAttributes(context.Context, *s3.GetObjectAttributesInput) (s3response.GetObjectAttributesResponse, error)
|
||||
CopyObject(context.Context, s3response.CopyObjectInput) (s3response.CopyObjectOutput, error)
|
||||
CopyObject(context.Context, s3response.CopyObjectInput) (*s3.CopyObjectOutput, error)
|
||||
ListObjects(context.Context, *s3.ListObjectsInput) (s3response.ListObjectsResult, error)
|
||||
ListObjectsV2(context.Context, *s3.ListObjectsV2Input) (s3response.ListObjectsV2Result, error)
|
||||
DeleteObject(context.Context, *s3.DeleteObjectInput) (*s3.DeleteObjectOutput, error)
|
||||
@@ -83,23 +83,27 @@ type Backend interface {
|
||||
DeleteBucketTagging(_ context.Context, bucket string) error
|
||||
|
||||
// object tagging operations
|
||||
GetObjectTagging(_ context.Context, bucket, object, versionId string) (map[string]string, error)
|
||||
PutObjectTagging(_ context.Context, bucket, object, versionId string, tags map[string]string) error
|
||||
DeleteObjectTagging(_ context.Context, bucket, object, versionId string) error
|
||||
GetObjectTagging(_ context.Context, bucket, object string) (map[string]string, error)
|
||||
PutObjectTagging(_ context.Context, bucket, object string, tags map[string]string) error
|
||||
DeleteObjectTagging(_ context.Context, bucket, object string) error
|
||||
|
||||
// object lock operations
|
||||
PutObjectLockConfiguration(_ context.Context, bucket string, config []byte) error
|
||||
GetObjectLockConfiguration(_ context.Context, bucket string) ([]byte, error)
|
||||
PutObjectRetention(_ context.Context, bucket, object, versionId string, retention []byte) error
|
||||
PutObjectRetention(_ context.Context, bucket, object, versionId string, bypass bool, retention []byte) error
|
||||
GetObjectRetention(_ context.Context, bucket, object, versionId string) ([]byte, error)
|
||||
PutObjectLegalHold(_ context.Context, bucket, object, versionId string, status bool) error
|
||||
GetObjectLegalHold(_ context.Context, bucket, object, versionId string) (*bool, error)
|
||||
|
||||
// non AWS actions
|
||||
ChangeBucketOwner(_ context.Context, bucket, owner string) error
|
||||
ChangeBucketOwner(_ context.Context, bucket string, acl []byte) error
|
||||
ListBucketsAndOwners(context.Context) ([]s3response.Bucket, error)
|
||||
}
|
||||
|
||||
// InterfaceVersion tracks changes to the Backend interface for plugins.
|
||||
// Increment this when the Backend interface changes.
|
||||
const InterfaceVersion = 1
|
||||
|
||||
type BackendUnsupported struct{}
|
||||
|
||||
var _ Backend = &BackendUnsupported{}
|
||||
@@ -153,7 +157,7 @@ func (BackendUnsupported) GetBucketOwnershipControls(_ context.Context, bucket s
|
||||
func (BackendUnsupported) DeleteBucketOwnershipControls(_ context.Context, bucket string) error {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) PutBucketCors(context.Context, string, []byte) error {
|
||||
func (BackendUnsupported) PutBucketCors(context.Context, []byte) error {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) GetBucketCors(_ context.Context, bucket string) ([]byte, error) {
|
||||
@@ -166,8 +170,8 @@ func (BackendUnsupported) DeleteBucketCors(_ context.Context, bucket string) err
|
||||
func (BackendUnsupported) CreateMultipartUpload(context.Context, s3response.CreateMultipartUploadInput) (s3response.InitiateMultipartUploadResult, error) {
|
||||
return s3response.InitiateMultipartUploadResult{}, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) CompleteMultipartUpload(context.Context, *s3.CompleteMultipartUploadInput) (s3response.CompleteMultipartUploadResult, string, error) {
|
||||
return s3response.CompleteMultipartUploadResult{}, "", s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
func (BackendUnsupported) CompleteMultipartUpload(context.Context, *s3.CompleteMultipartUploadInput) (*s3.CompleteMultipartUploadOutput, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) AbortMultipartUpload(context.Context, *s3.AbortMultipartUploadInput) error {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
@@ -200,8 +204,8 @@ func (BackendUnsupported) GetObjectAcl(context.Context, *s3.GetObjectAclInput) (
|
||||
func (BackendUnsupported) GetObjectAttributes(context.Context, *s3.GetObjectAttributesInput) (s3response.GetObjectAttributesResponse, error) {
|
||||
return s3response.GetObjectAttributesResponse{}, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) CopyObject(context.Context, s3response.CopyObjectInput) (s3response.CopyObjectOutput, error) {
|
||||
return s3response.CopyObjectOutput{}, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
func (BackendUnsupported) CopyObject(context.Context, s3response.CopyObjectInput) (*s3.CopyObjectOutput, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) ListObjects(context.Context, *s3.ListObjectsInput) (s3response.ListObjectsResult, error) {
|
||||
return s3response.ListObjectsResult{}, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
@@ -251,13 +255,13 @@ func (BackendUnsupported) DeleteBucketTagging(_ context.Context, bucket string)
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
|
||||
func (BackendUnsupported) GetObjectTagging(_ context.Context, bucket, object, versionId string) (map[string]string, error) {
|
||||
func (BackendUnsupported) GetObjectTagging(_ context.Context, bucket, object string) (map[string]string, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) PutObjectTagging(_ context.Context, bucket, object, versionId string, tags map[string]string) error {
|
||||
func (BackendUnsupported) PutObjectTagging(_ context.Context, bucket, object string, tags map[string]string) error {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) DeleteObjectTagging(_ context.Context, bucket, object, versionId string) error {
|
||||
func (BackendUnsupported) DeleteObjectTagging(_ context.Context, bucket, object string) error {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
|
||||
@@ -267,7 +271,7 @@ func (BackendUnsupported) PutObjectLockConfiguration(_ context.Context, bucket s
|
||||
func (BackendUnsupported) GetObjectLockConfiguration(_ context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) PutObjectRetention(_ context.Context, bucket, object, versionId string, retention []byte) error {
|
||||
func (BackendUnsupported) PutObjectRetention(_ context.Context, bucket, object, versionId string, bypass bool, retention []byte) error {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) GetObjectRetention(_ context.Context, bucket, object, versionId string) ([]byte, error) {
|
||||
@@ -280,7 +284,7 @@ func (BackendUnsupported) GetObjectLegalHold(_ context.Context, bucket, object,
|
||||
return nil, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
|
||||
func (BackendUnsupported) ChangeBucketOwner(_ context.Context, bucket, owner string) error {
|
||||
func (BackendUnsupported) ChangeBucketOwner(_ context.Context, bucket string, acl []byte) error {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
func (BackendUnsupported) ListBucketsAndOwners(context.Context) ([]s3response.Bucket, error) {
|
||||
|
||||
@@ -17,18 +17,11 @@ package backend
|
||||
import (
|
||||
"crypto/md5"
|
||||
"encoding/hex"
|
||||
"errors"
|
||||
"fmt"
|
||||
"hash"
|
||||
"io"
|
||||
"io/fs"
|
||||
"math"
|
||||
"net/url"
|
||||
"os"
|
||||
"regexp"
|
||||
"strconv"
|
||||
"strings"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
@@ -88,90 +81,58 @@ func TrimEtag(etag *string) *string {
|
||||
var (
|
||||
errInvalidRange = s3err.GetAPIError(s3err.ErrInvalidRange)
|
||||
errInvalidCopySourceRange = s3err.GetAPIError(s3err.ErrInvalidCopySourceRange)
|
||||
errPreconditionFailed = s3err.GetAPIError(s3err.ErrPreconditionFailed)
|
||||
errNotModified = s3err.GetAPIError(s3err.ErrNotModified)
|
||||
)
|
||||
|
||||
// ParseObjectRange parses input range header and returns startoffset, length, isValid
|
||||
// ParseGetObjectRange parses input range header and returns startoffset, length, isValid
|
||||
// and error. If no endoffset specified, then length is set to the object size
|
||||
// for invalid inputs, it returns no error, but isValid=false
|
||||
// `InvalidRange` error is returnd, only if startoffset is greater than the object size
|
||||
func ParseObjectRange(size int64, acceptRange string) (int64, int64, bool, error) {
|
||||
// Return full object (invalid range, no error) if header empty
|
||||
func ParseGetObjectRange(size int64, acceptRange string) (int64, int64, bool, error) {
|
||||
if acceptRange == "" {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
|
||||
rangeKv := strings.Split(acceptRange, "=")
|
||||
|
||||
if len(rangeKv) != 2 {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
if rangeKv[0] != "bytes" { // unsupported unit -> ignore
|
||||
|
||||
if rangeKv[0] != "bytes" {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
|
||||
bRange := strings.Split(rangeKv[1], "-")
|
||||
if len(bRange) != 2 { // malformed / multi-range
|
||||
if len(bRange) != 2 {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
|
||||
// Parse start; empty start indicates a suffix-byte-range-spec (e.g. bytes=-100)
|
||||
startOffset, err := strconv.ParseInt(bRange[0], 10, strconv.IntSize)
|
||||
if startOffset > int64(math.MaxInt) || startOffset < int64(math.MinInt) {
|
||||
return 0, size, false, errInvalidRange
|
||||
}
|
||||
if err != nil && bRange[0] != "" { // invalid numeric start (non-empty) -> ignore range
|
||||
startOffset, err := strconv.ParseInt(bRange[0], 10, 64)
|
||||
if err != nil {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
|
||||
// If end part missing (e.g. bytes=100-)
|
||||
if bRange[1] == "" {
|
||||
if bRange[0] == "" { // bytes=- (meaningless) -> ignore
|
||||
return 0, size, false, nil
|
||||
}
|
||||
// start beyond or at size is unsatisfiable -> error (RequestedRangeNotSatisfiable)
|
||||
if startOffset >= size {
|
||||
return 0, 0, false, errInvalidRange
|
||||
}
|
||||
// bytes=100- => from start to end
|
||||
return startOffset, size - startOffset, true, nil
|
||||
}
|
||||
|
||||
endOffset, err := strconv.ParseInt(bRange[1], 10, strconv.IntSize)
|
||||
if endOffset > int64(math.MaxInt) {
|
||||
return 0, size, false, errInvalidRange
|
||||
}
|
||||
if err != nil { // invalid numeric end -> ignore range
|
||||
return 0, size, false, nil
|
||||
}
|
||||
|
||||
// Suffix range handling (bRange[0] == "")
|
||||
if bRange[0] == "" {
|
||||
// Disallow -0 (always unsatisfiable)
|
||||
if endOffset == 0 {
|
||||
return 0, 0, false, errInvalidRange
|
||||
}
|
||||
// For zero-sized objects any positive suffix is treated as invalid (ignored, no error)
|
||||
if size == 0 {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
// Clamp to object size (request more bytes than exist -> entire object)
|
||||
endOffset = min(endOffset, size)
|
||||
return size - endOffset, endOffset, true, nil
|
||||
}
|
||||
|
||||
// Normal range (start-end)
|
||||
if startOffset > endOffset { // start > end -> ignore
|
||||
return 0, size, false, nil
|
||||
}
|
||||
// Start beyond or at end of object -> error
|
||||
if startOffset >= size {
|
||||
return 0, 0, false, errInvalidRange
|
||||
}
|
||||
// Adjust end beyond object size (trim)
|
||||
if endOffset >= size {
|
||||
endOffset = size - 1
|
||||
|
||||
if bRange[1] == "" {
|
||||
return startOffset, size - startOffset, true, nil
|
||||
}
|
||||
|
||||
endOffset, err := strconv.ParseInt(bRange[1], 10, 64)
|
||||
if err != nil {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
|
||||
if endOffset < startOffset {
|
||||
return 0, size, false, nil
|
||||
}
|
||||
|
||||
if endOffset >= size {
|
||||
return startOffset, size - startOffset, true, nil
|
||||
}
|
||||
|
||||
return startOffset, endOffset - startOffset + 1, true, nil
|
||||
}
|
||||
|
||||
@@ -244,134 +205,34 @@ func ParseCopySource(copySourceHeader string) (string, string, string, error) {
|
||||
|
||||
srcBucket, srcObject, ok := strings.Cut(copySource, "/")
|
||||
if !ok {
|
||||
return "", "", "", s3err.GetAPIError(s3err.ErrInvalidCopySourceBucket)
|
||||
return "", "", "", s3err.GetAPIError(s3err.ErrInvalidCopySource)
|
||||
}
|
||||
|
||||
return srcBucket, srcObject, versionId, nil
|
||||
}
|
||||
|
||||
// ParseObjectTags parses the url encoded input string into
|
||||
// map[string]string with unescaped key/value pair
|
||||
func ParseObjectTags(tagging string) (map[string]string, error) {
|
||||
if tagging == "" {
|
||||
// map[string]string key-value tag set
|
||||
func ParseObjectTags(t string) (map[string]string, error) {
|
||||
if t == "" {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
tagSet := make(map[string]string)
|
||||
tagging := make(map[string]string)
|
||||
|
||||
for tagging != "" {
|
||||
var tag string
|
||||
tag, tagging, _ = strings.Cut(tagging, "&")
|
||||
// if 'tag' before the first appearance of '&' is empty continue
|
||||
if tag == "" {
|
||||
continue
|
||||
tagParts := strings.Split(t, "&")
|
||||
for _, prt := range tagParts {
|
||||
p := strings.Split(prt, "=")
|
||||
if len(p) != 2 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTag)
|
||||
}
|
||||
|
||||
key, value, found := strings.Cut(tag, "=")
|
||||
// if key is empty, but "=" is present, return invalid url ecnoding err
|
||||
if found && key == "" {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidURLEncodedTagging)
|
||||
if len(p[0]) > 128 || len(p[1]) > 256 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTag)
|
||||
}
|
||||
|
||||
// return invalid tag key, if the key is longer than 128
|
||||
if len(key) > 128 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagKey)
|
||||
}
|
||||
|
||||
// return invalid tag value, if tag value is longer than 256
|
||||
if len(value) > 256 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagValue)
|
||||
}
|
||||
|
||||
// query unescape tag key
|
||||
key, err := url.QueryUnescape(key)
|
||||
if err != nil {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidURLEncodedTagging)
|
||||
}
|
||||
|
||||
// query unescape tag value
|
||||
value, err = url.QueryUnescape(value)
|
||||
if err != nil {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidURLEncodedTagging)
|
||||
}
|
||||
|
||||
// check tag key to be valid
|
||||
if !isValidTagComponent(key) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagKey)
|
||||
}
|
||||
|
||||
// check tag value to be valid
|
||||
if !isValidTagComponent(value) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagValue)
|
||||
}
|
||||
|
||||
// duplicate keys are not allowed: return invalid url encoding err
|
||||
_, ok := tagSet[key]
|
||||
if ok {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidURLEncodedTagging)
|
||||
}
|
||||
|
||||
tagSet[key] = value
|
||||
tagging[p[0]] = p[1]
|
||||
}
|
||||
|
||||
return tagSet, nil
|
||||
}
|
||||
|
||||
// ParseCreateBucketTags parses and validates the bucket
|
||||
// tagging from CreateBucket input
|
||||
func ParseCreateBucketTags(tagging []types.Tag) (map[string]string, error) {
|
||||
if len(tagging) == 0 {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
tagset := make(map[string]string, len(tagging))
|
||||
|
||||
if len(tagging) > 50 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrBucketTaggingLimited)
|
||||
}
|
||||
|
||||
for _, tag := range tagging {
|
||||
// validate tag key length
|
||||
key := GetStringFromPtr(tag.Key)
|
||||
if len(key) == 0 || len(key) > 128 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagKey)
|
||||
}
|
||||
|
||||
// validate tag key string chars
|
||||
if !isValidTagComponent(key) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagKey)
|
||||
}
|
||||
|
||||
// validate tag value length
|
||||
value := GetStringFromPtr(tag.Value)
|
||||
if len(value) > 256 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagValue)
|
||||
}
|
||||
|
||||
// validate tag value string chars
|
||||
if !isValidTagComponent(value) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidTagValue)
|
||||
}
|
||||
|
||||
// make sure there are no duplicate keys
|
||||
_, ok := tagset[key]
|
||||
if ok {
|
||||
return nil, s3err.GetAPIError(s3err.ErrDuplicateTagKey)
|
||||
}
|
||||
|
||||
tagset[key] = value
|
||||
}
|
||||
|
||||
return tagset, nil
|
||||
}
|
||||
|
||||
// tag component (key/value) name rule regexp
|
||||
// https://docs.aws.amazon.com/AmazonS3/latest/API/API_control_Tag.html
|
||||
var validTagComponent = regexp.MustCompile(`^([\p{L}\p{Z}\p{N}_.:/=+\-@]*)$`)
|
||||
|
||||
// isValidTagComponent validates the tag component(key/value) name
|
||||
func isValidTagComponent(str string) bool {
|
||||
return validTagComponent.Match([]byte(str))
|
||||
return tagging, nil
|
||||
}
|
||||
|
||||
func GetMultipartMD5(parts []types.CompletedPart) string {
|
||||
@@ -408,262 +269,3 @@ func (f *FileSectionReadCloser) Read(p []byte) (int, error) {
|
||||
func (f *FileSectionReadCloser) Close() error {
|
||||
return f.F.Close()
|
||||
}
|
||||
|
||||
// MoveFile moves a file from source to destination.
|
||||
func MoveFile(source, destination string, perm os.FileMode) error {
|
||||
// We use Rename as the atomic operation for object puts. The upload is
|
||||
// written to a temp file to not conflict with any other simultaneous
|
||||
// uploads. The final operation is to move the temp file into place for
|
||||
// the object. This ensures the object semantics of last upload completed
|
||||
// wins and is not some combination of writes from simultaneous uploads.
|
||||
err := os.Rename(source, destination)
|
||||
if err == nil || !errors.Is(err, syscall.EXDEV) {
|
||||
return err
|
||||
}
|
||||
|
||||
// Rename can fail if the source and destination are not on the same
|
||||
// filesystem. The fallback is to copy the file and then remove the source.
|
||||
// We need to be careful that the desination does not exist before copying
|
||||
// to prevent any other simultaneous writes to the file.
|
||||
sourceFile, err := os.Open(source)
|
||||
if err != nil {
|
||||
return fmt.Errorf("open source: %w", err)
|
||||
}
|
||||
defer sourceFile.Close()
|
||||
|
||||
var destFile *os.File
|
||||
for {
|
||||
destFile, err = os.OpenFile(destination, os.O_CREATE|os.O_EXCL|os.O_WRONLY, perm)
|
||||
if err != nil {
|
||||
if errors.Is(err, fs.ErrExist) {
|
||||
if removeErr := os.Remove(destination); removeErr != nil {
|
||||
return fmt.Errorf("remove existing destination: %w", removeErr)
|
||||
}
|
||||
continue
|
||||
}
|
||||
return fmt.Errorf("create destination: %w", err)
|
||||
}
|
||||
break
|
||||
}
|
||||
defer destFile.Close()
|
||||
|
||||
_, err = io.Copy(destFile, sourceFile)
|
||||
if err != nil {
|
||||
return fmt.Errorf("copy data: %w", err)
|
||||
}
|
||||
|
||||
err = os.Remove(source)
|
||||
if err != nil {
|
||||
return fmt.Errorf("remove source: %w", err)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// GenerateEtag generates a new quoted etag from the provided hash.Hash
|
||||
func GenerateEtag(h hash.Hash) string {
|
||||
dataSum := h.Sum(nil)
|
||||
return fmt.Sprintf("\"%s\"", hex.EncodeToString(dataSum[:]))
|
||||
}
|
||||
|
||||
// AreEtagsSame compares 2 etags by ignoring quotes
|
||||
func AreEtagsSame(e1, e2 string) bool {
|
||||
return strings.Trim(e1, `"`) == strings.Trim(e2, `"`)
|
||||
}
|
||||
|
||||
func getBoolPtr(b bool) *bool {
|
||||
return &b
|
||||
}
|
||||
|
||||
type PreConditions struct {
|
||||
IfMatch *string
|
||||
IfNoneMatch *string
|
||||
IfModSince *time.Time
|
||||
IfUnmodeSince *time.Time
|
||||
}
|
||||
|
||||
// EvaluatePreconditions takes the object ETag, the last modified time and
|
||||
// evaluates the read preconditions:
|
||||
// - if-match,
|
||||
// - if-none-match
|
||||
// - if-modified-since
|
||||
// - if-unmodified-since
|
||||
// if-match and if-none-match are ETag comparisions
|
||||
// if-modified-since and if-unmodified-since are last modifed time comparisons
|
||||
func EvaluatePreconditions(etag string, modTime time.Time, preconditions PreConditions) error {
|
||||
if preconditions.IfMatch == nil && preconditions.IfNoneMatch == nil && preconditions.IfModSince == nil && preconditions.IfUnmodeSince == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
etag = strings.Trim(etag, `"`)
|
||||
|
||||
// convert all conditions to *bool to evaluate the conditions
|
||||
var ifMatch, ifNoneMatch, ifModSince, ifUnmodeSince *bool
|
||||
if preconditions.IfMatch != nil {
|
||||
ifMatch = getBoolPtr(*preconditions.IfMatch == etag)
|
||||
}
|
||||
if preconditions.IfNoneMatch != nil {
|
||||
ifNoneMatch = getBoolPtr(*preconditions.IfNoneMatch != etag)
|
||||
}
|
||||
if preconditions.IfModSince != nil {
|
||||
ifModSince = getBoolPtr(preconditions.IfModSince.UTC().Before(modTime.UTC()))
|
||||
}
|
||||
if preconditions.IfUnmodeSince != nil {
|
||||
ifUnmodeSince = getBoolPtr(preconditions.IfUnmodeSince.UTC().After(modTime.UTC()))
|
||||
}
|
||||
|
||||
if ifMatch != nil {
|
||||
// if `if-match` doesn't matches, return PreconditionFailed
|
||||
if !*ifMatch {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
// if-match matches
|
||||
if *ifMatch {
|
||||
if ifNoneMatch != nil {
|
||||
// if `if-none-match` doesn't match return NotModified
|
||||
if !*ifNoneMatch {
|
||||
return errNotModified
|
||||
}
|
||||
|
||||
// if both `if-match` and `if-none-match` match, return no error
|
||||
return nil
|
||||
}
|
||||
|
||||
// if `if-match` matches but `if-modified-since` is false return NotModified
|
||||
if ifModSince != nil && !*ifModSince {
|
||||
return errNotModified
|
||||
}
|
||||
|
||||
// ignore `if-unmodified-since` as `if-match` is true
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
if ifNoneMatch != nil {
|
||||
if *ifNoneMatch {
|
||||
// if `if-none-match` is true, but `if-unmodified-since` is false
|
||||
// return PreconditionFailed
|
||||
if ifUnmodeSince != nil && !*ifUnmodeSince {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
// ignore `if-modified-since` as `if-none-match` is true
|
||||
return nil
|
||||
} else {
|
||||
// if `if-none-match` is false and `if-unmodified-since` is false
|
||||
// return PreconditionFailed
|
||||
if ifUnmodeSince != nil && !*ifUnmodeSince {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
// in all other cases when `if-none-match` is false return NotModified
|
||||
return errNotModified
|
||||
}
|
||||
}
|
||||
|
||||
if ifModSince != nil && !*ifModSince {
|
||||
// if both `if-modified-since` and `if-unmodified-since` are false
|
||||
// return PreconditionFailed
|
||||
if ifUnmodeSince != nil && !*ifUnmodeSince {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
// if only `if-modified-since` is false, return NotModified
|
||||
return errNotModified
|
||||
}
|
||||
|
||||
// if `if-unmodified-since` is false return PreconditionFailed
|
||||
if ifUnmodeSince != nil && !*ifUnmodeSince {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// EvaluateMatchPreconditions evaluates if-match and if-none-match preconditions
|
||||
func EvaluateMatchPreconditions(etag string, ifMatch, ifNoneMatch *string) error {
|
||||
etag = strings.Trim(etag, `"`)
|
||||
if ifMatch != nil && *ifMatch != etag {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
if ifNoneMatch != nil && *ifNoneMatch == etag {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// EvaluateObjectPutPreconditions evaluates if-match and if-none-match preconditions
|
||||
// for object PUT(PutObject, CompleteMultipartUpload) actions
|
||||
func EvaluateObjectPutPreconditions(etag string, ifMatch, ifNoneMatch *string, objExists bool) error {
|
||||
if ifMatch == nil && ifNoneMatch == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
if ifNoneMatch != nil && *ifNoneMatch != "*" {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
|
||||
if ifNoneMatch != nil && ifMatch != nil {
|
||||
return s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
|
||||
if ifNoneMatch != nil && objExists {
|
||||
return s3err.GetAPIError(s3err.ErrPreconditionFailed)
|
||||
}
|
||||
|
||||
if ifMatch != nil && !objExists {
|
||||
return s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
}
|
||||
|
||||
etag = strings.Trim(etag, `"`)
|
||||
|
||||
if ifMatch != nil && *ifMatch != etag {
|
||||
return s3err.GetAPIError(s3err.ErrPreconditionFailed)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
type ObjectDeletePreconditions struct {
|
||||
IfMatch *string
|
||||
IfMatchLastModTime *time.Time
|
||||
IfMatchSize *int64
|
||||
}
|
||||
|
||||
// EvaluateObjectDeletePreconditions evaluates preconditions for DeleteObject
|
||||
func EvaluateObjectDeletePreconditions(etag string, modTime time.Time, size int64, preconditions ObjectDeletePreconditions) error {
|
||||
ifMatch := preconditions.IfMatch
|
||||
if ifMatch != nil && *ifMatch != etag {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
ifMatchTime := preconditions.IfMatchLastModTime
|
||||
if ifMatchTime != nil && ifMatchTime.Unix() != modTime.Unix() {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
ifMatchSize := preconditions.IfMatchSize
|
||||
if ifMatchSize != nil && *ifMatchSize != size {
|
||||
return errPreconditionFailed
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// IsValidDirectoryName returns true if the string is a valid name
|
||||
// for a directory
|
||||
func IsValidDirectoryName(name string) bool {
|
||||
// directories may not contain a path separator
|
||||
if strings.ContainsRune(name, '/') {
|
||||
return false
|
||||
}
|
||||
|
||||
// directories may not contain null character
|
||||
if strings.ContainsRune(name, 0) {
|
||||
return false
|
||||
}
|
||||
|
||||
return true
|
||||
}
|
||||
|
||||
@@ -17,7 +17,6 @@ package meta
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
)
|
||||
@@ -99,8 +98,6 @@ func (s SideCar) DeleteAttribute(bucket, object, attribute string) error {
|
||||
return fmt.Errorf("failed to remove attribute: %v", err)
|
||||
}
|
||||
|
||||
s.cleanupEmptyDirs(metadir, bucket, object)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -138,60 +135,5 @@ func (s SideCar) DeleteAttributes(bucket, object string) error {
|
||||
if err != nil && !errors.Is(err, os.ErrNotExist) {
|
||||
return fmt.Errorf("failed to remove attributes: %v", err)
|
||||
}
|
||||
s.cleanupEmptyDirs(metadir, bucket, object)
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s SideCar) cleanupEmptyDirs(metadir, bucket, object string) {
|
||||
removeIfEmpty(metadir)
|
||||
if bucket == "" {
|
||||
return
|
||||
}
|
||||
bucketDir := filepath.Join(s.dir, bucket)
|
||||
if object != "" {
|
||||
removeEmptyParents(filepath.Dir(metadir), bucketDir)
|
||||
}
|
||||
removeIfEmpty(bucketDir)
|
||||
}
|
||||
|
||||
func removeIfEmpty(dir string) {
|
||||
empty, err := isDirEmpty(dir)
|
||||
if err != nil || !empty {
|
||||
return
|
||||
}
|
||||
_ = os.Remove(dir)
|
||||
}
|
||||
|
||||
func removeEmptyParents(dir, stopDir string) {
|
||||
for {
|
||||
if dir == stopDir || dir == "." || dir == string(filepath.Separator) {
|
||||
return
|
||||
}
|
||||
empty, err := isDirEmpty(dir)
|
||||
if err != nil || !empty {
|
||||
return
|
||||
}
|
||||
err = os.Remove(dir)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
dir = filepath.Dir(dir)
|
||||
}
|
||||
}
|
||||
|
||||
func isDirEmpty(dir string) (bool, error) {
|
||||
f, err := os.Open(dir)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
defer f.Close()
|
||||
|
||||
ents, err := f.Readdirnames(1)
|
||||
if err == io.EOF {
|
||||
return true, nil
|
||||
}
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
return len(ents) == 0, nil
|
||||
}
|
||||
|
||||
@@ -26,6 +26,10 @@ import (
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
const (
|
||||
xattrPrefix = "user."
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrNoSuchKey is returned when the key does not exist.
|
||||
ErrNoSuchKey = errors.New("no such key")
|
||||
|
||||
@@ -1,19 +0,0 @@
|
||||
// Copyright 2026 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
//go:build freebsd
|
||||
|
||||
package meta
|
||||
|
||||
const xattrPrefix = ""
|
||||
@@ -1,19 +0,0 @@
|
||||
// Copyright 2026 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
//go:build !freebsd
|
||||
|
||||
package meta
|
||||
|
||||
const xattrPrefix = "user."
|
||||
@@ -1,205 +0,0 @@
|
||||
// Copyright 2026 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package backend
|
||||
|
||||
import (
|
||||
"strings"
|
||||
|
||||
"github.com/google/uuid"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
// ListMultipartUploads initializes a multipart upload lister and calls Run()
|
||||
func ListMultipartUploads(uploads []s3response.Upload, prefix, delimiter, keyMarker, uploadIdMarker string, maxUploads int) (*ListMultipartUploadsPage, error) {
|
||||
lister := &MultipartUploadLister{
|
||||
Uploads: uploads,
|
||||
Prefix: prefix,
|
||||
Delimiter: delimiter,
|
||||
KeyMarker: keyMarker,
|
||||
UploadIDMarker: uploadIdMarker,
|
||||
MaxUploads: maxUploads,
|
||||
}
|
||||
|
||||
return lister.Run()
|
||||
}
|
||||
|
||||
// MultipartUploadLister emits a ListMultipartUploads-compatible page from an
|
||||
// already-sorted, already prefix- and key-marker-filtered upload list.
|
||||
//
|
||||
// Assumptions about input Uploads:
|
||||
// - Sorted by (Key asc, Initiated asc)
|
||||
// - Filtered by Prefix
|
||||
// - Filtered to start strictly after key-marker when key-marker was provided.
|
||||
type MultipartUploadLister struct {
|
||||
Uploads []s3response.Upload
|
||||
Prefix string
|
||||
Delimiter string
|
||||
MaxUploads int
|
||||
KeyMarker string
|
||||
UploadIDMarker string
|
||||
}
|
||||
|
||||
// ListMultipartUploadsPage is the lister output
|
||||
type ListMultipartUploadsPage struct {
|
||||
Uploads []s3response.Upload
|
||||
CommonPrefixes []s3response.CommonPrefix
|
||||
IsTruncated bool
|
||||
NextKeyMarker string
|
||||
NextUploadIDMarker string
|
||||
}
|
||||
|
||||
// Run validates marker constraints, then performs a single-pass list that:
|
||||
// - collapses uploads into CommonPrefixes when delimiter is set
|
||||
// - enforces MaxUploads over (Uploads + CommonPrefixes)
|
||||
// - computes truncation and next markers
|
||||
func (l *MultipartUploadLister) Run() (*ListMultipartUploadsPage, error) {
|
||||
out := &ListMultipartUploadsPage{}
|
||||
|
||||
var startIndex int
|
||||
|
||||
// if upload-id-marker is provided without a corresponding key-marker, ignore it.
|
||||
uploadIDMarker := l.UploadIDMarker
|
||||
if l.KeyMarker == "" {
|
||||
uploadIDMarker = ""
|
||||
}
|
||||
|
||||
if uploadIDMarker != "" {
|
||||
// any invalid uuid is considered as an invalid uploadIdMarker
|
||||
_, err := uuid.Parse(uploadIDMarker)
|
||||
if err != nil {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidUploadIdMarker)
|
||||
}
|
||||
startIndex = l.findUploadIdMarkerIndex(uploadIDMarker)
|
||||
if startIndex == -1 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidUploadIdMarker)
|
||||
}
|
||||
if startIndex >= len(l.Uploads) {
|
||||
return out, nil
|
||||
}
|
||||
}
|
||||
|
||||
// Common prefix uniqueness tracking.
|
||||
seenCP := make(map[string]struct{})
|
||||
|
||||
emitted := 0
|
||||
var lastKey string
|
||||
|
||||
// emitUpload appends a new upload to out.Uplodas
|
||||
emitUpload := func(up s3response.Upload) bool {
|
||||
out.Uploads = append(out.Uploads, up)
|
||||
emitted++
|
||||
lastKey = up.Key
|
||||
return emitted == l.MaxUploads
|
||||
}
|
||||
// emitCp appends a new common prefix to out.CommonPrefixes
|
||||
emitCP := func(cpref string) bool {
|
||||
out.CommonPrefixes = append(out.CommonPrefixes, s3response.CommonPrefix{Prefix: cpref})
|
||||
emitted++
|
||||
lastKey = cpref
|
||||
return emitted == l.MaxUploads
|
||||
}
|
||||
|
||||
for i, up := range l.Uploads[startIndex:] {
|
||||
if l.Delimiter != "" {
|
||||
// delimiter check
|
||||
suffix := strings.TrimPrefix(up.Key, l.Prefix)
|
||||
before, _, found := strings.Cut(suffix, l.Delimiter)
|
||||
if found {
|
||||
cpref := l.Prefix + before + l.Delimiter
|
||||
if _, ok := seenCP[cpref]; !ok {
|
||||
seenCP[cpref] = struct{}{}
|
||||
if emitCP(cpref) {
|
||||
out.IsTruncated = l.hasMoreAfter(i+1, seenCP)
|
||||
if out.IsTruncated {
|
||||
out.NextKeyMarker = lastKey
|
||||
out.NextUploadIDMarker = up.UploadID
|
||||
}
|
||||
return out, nil
|
||||
}
|
||||
}
|
||||
continue
|
||||
}
|
||||
}
|
||||
|
||||
if emitUpload(up) {
|
||||
out.IsTruncated = l.hasMoreAfter(i+1, seenCP)
|
||||
if out.IsTruncated {
|
||||
out.NextKeyMarker = lastKey
|
||||
out.NextUploadIDMarker = up.UploadID
|
||||
}
|
||||
return out, nil
|
||||
}
|
||||
}
|
||||
|
||||
return out, nil
|
||||
}
|
||||
|
||||
// findUploadIdMarkerIndex finds the index of given uploadId marker in uploads
|
||||
// uploadIDMarker must match an upload-id among uploads with the first key after KeyMarker.
|
||||
// Since caller filtered to Key > KeyMarker and the list is sorted by key/time,
|
||||
// the first key after KeyMarker is Uploads[0].Key (if any).
|
||||
// -1 is returned if no uploadId is found
|
||||
func (l *MultipartUploadLister) findUploadIdMarkerIndex(uploadIDMarker string) int {
|
||||
if len(l.Uploads) == 0 {
|
||||
// key-marker provided but nothing after it => upload-id-marker can never be valid.
|
||||
return -1
|
||||
}
|
||||
firstKey := l.Uploads[0].Key
|
||||
|
||||
// it must match an upload-id under firstKey only.
|
||||
// If firstKey has multiple uploads, any of those IDs is valid.
|
||||
for i, up := range l.Uploads {
|
||||
if up.Key != firstKey {
|
||||
// sorted by key, so we're past firstKey group
|
||||
break
|
||||
}
|
||||
if up.UploadID == uploadIDMarker {
|
||||
// the listing should start from the next index
|
||||
// to skip the uploadId marker
|
||||
return i + 1
|
||||
}
|
||||
}
|
||||
return -1
|
||||
}
|
||||
|
||||
// hasMoreAfter checks if there exists at least one more effective item after idx,
|
||||
// considering delimiter collapse and already-emitted common prefixes.
|
||||
func (l *MultipartUploadLister) hasMoreAfter(idx int, seenCP map[string]struct{}) bool {
|
||||
if idx >= len(l.Uploads) {
|
||||
return false
|
||||
}
|
||||
if l.Delimiter == "" {
|
||||
// any remaining upload would be emitted
|
||||
return true
|
||||
}
|
||||
|
||||
for i := idx; i < len(l.Uploads); i++ {
|
||||
up := l.Uploads[i]
|
||||
suffix := strings.TrimPrefix(up.Key, l.Prefix)
|
||||
before, _, found := strings.Cut(suffix, l.Delimiter)
|
||||
if !found {
|
||||
// would emit an upload
|
||||
return true
|
||||
}
|
||||
cpref := l.Prefix + before + l.Delimiter
|
||||
if _, ok := seenCP[cpref]; ok {
|
||||
continue
|
||||
}
|
||||
// would emit a new common prefix
|
||||
return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
516
backend/plugin/plugin.go
Normal file
516
backend/plugin/plugin.go
Normal file
@@ -0,0 +1,516 @@
|
||||
// Copyright 2025 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package vgwplugin
|
||||
|
||||
import (
|
||||
"bufio"
|
||||
"context"
|
||||
"fmt"
|
||||
"plugin"
|
||||
"reflect"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
// The plugin backend is used to dynamically load a Go plugin at runtime.
|
||||
// It loads the plugin and calls the InitPlugin function to initialize it.
|
||||
// A config string option is passed to init the plugin, it is expected that the
|
||||
// plugin will handle its own configuration and initialization from this.
|
||||
// If the plugin cannot be loaded or initialized, it returns an error.
|
||||
// The InitPlugin function should be defined in the plugin and should have
|
||||
// the signature func(configfile string) (version int, err error).
|
||||
// The plugin should also implement the backend.Backend interface functions.
|
||||
// However, the plugin does not need to implement all functions of the
|
||||
// backend.Backend interface. It can implement only the functions it needs.
|
||||
// Any non-implemented functions will return an error indicating that
|
||||
// the function is not implemented.
|
||||
// The plugin file should be compiled with the same Go version as the
|
||||
// application using it. The plugin file should be built with the
|
||||
// -buildmode=plugin flag.
|
||||
// Example: go build -buildmode=plugin -o myplugin.so myplugin.go
|
||||
// See the following for caveats and details:
|
||||
// https://pkg.go.dev/plugin#hdr-Warnings
|
||||
|
||||
// PluginBackend implements the backend.Backend interface using Go plugins.
|
||||
type PluginBackend struct {
|
||||
p *plugin.Plugin
|
||||
}
|
||||
|
||||
// NewPluginBackend creates a new PluginBackend. The path parameter should
|
||||
// point to the compiled plugin file (e.g., .so file).
|
||||
func NewPluginBackend(path, config string) (*PluginBackend, error) {
|
||||
p, err := plugin.Open(path)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to open plugin: %w", err)
|
||||
}
|
||||
|
||||
initSymbol, err := p.Lookup("InitPlugin")
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to lookup InitPlugin symbol: %w", err)
|
||||
}
|
||||
|
||||
initFunc, ok := initSymbol.(func(string) (int, error))
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("InitPlugin symbol is not a func() (int, error)")
|
||||
}
|
||||
|
||||
version, err := initFunc(config)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("InitPlugin failed: %w", err)
|
||||
}
|
||||
|
||||
if version != backend.InterfaceVersion {
|
||||
return nil, fmt.Errorf("plugin interface version mismatch: gateway %v, plugin %v",
|
||||
backend.InterfaceVersion, version)
|
||||
}
|
||||
|
||||
return &PluginBackend{p: p}, nil
|
||||
}
|
||||
|
||||
func (p *PluginBackend) callPluginFunc(name string, args []any) ([]reflect.Value, error) {
|
||||
symbol, err := p.p.Lookup(name)
|
||||
if err != nil {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNotImplemented)
|
||||
}
|
||||
|
||||
symbolValue := reflect.ValueOf(symbol)
|
||||
if symbolValue.Kind() != reflect.Func {
|
||||
return nil, fmt.Errorf("symbol %s is not a function", name)
|
||||
}
|
||||
|
||||
numIn := symbolValue.Type().NumIn()
|
||||
if len(args) != numIn {
|
||||
return nil, fmt.Errorf("incorrect number of arguments for function %s, expected %d, got %d", name, numIn, len(args))
|
||||
}
|
||||
|
||||
in := make([]reflect.Value, len(args))
|
||||
for i := range args {
|
||||
in[i] = reflect.ValueOf(args[i])
|
||||
}
|
||||
|
||||
return symbolValue.Call(in), nil
|
||||
}
|
||||
|
||||
func (p *PluginBackend) String() string { return "Plugin Gateway" }
|
||||
func (p *PluginBackend) Shutdown() {}
|
||||
|
||||
func (p *PluginBackend) ListBuckets(ctx context.Context, input s3response.ListBucketsInput) (s3response.ListAllMyBucketsResult, error) {
|
||||
results, err := p.callPluginFunc("ListBuckets", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.ListAllMyBucketsResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.ListAllMyBucketsResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) HeadBucket(ctx context.Context, input *s3.HeadBucketInput) (*s3.HeadBucketOutput, error) {
|
||||
results, err := p.callPluginFunc("HeadBucket", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.HeadBucketOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetBucketAcl(ctx context.Context, input *s3.GetBucketAclInput) ([]byte, error) {
|
||||
results, err := p.callPluginFunc("GetBucketAcl", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().([]byte), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) CreateBucket(ctx context.Context, input *s3.CreateBucketInput, defaultACL []byte) error {
|
||||
_, err := p.callPluginFunc("CreateBucket", []any{ctx, input, defaultACL})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutBucketAcl(ctx context.Context, bucket string, data []byte) error {
|
||||
_, err := p.callPluginFunc("PutBucketAcl", []any{ctx, bucket, data})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteBucket(ctx context.Context, bucket string) error {
|
||||
_, err := p.callPluginFunc("DeleteBucket", []any{ctx, bucket})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutBucketVersioning(ctx context.Context, bucket string, status types.BucketVersioningStatus) error {
|
||||
_, err := p.callPluginFunc("PutBucketVersioning", []any{ctx, bucket, status})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetBucketVersioning(ctx context.Context, bucket string) (s3response.GetBucketVersioningOutput, error) {
|
||||
results, err := p.callPluginFunc("GetBucketVersioning", []any{ctx, bucket})
|
||||
if err != nil {
|
||||
return s3response.GetBucketVersioningOutput{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.GetBucketVersioningOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutBucketPolicy(ctx context.Context, bucket string, policy []byte) error {
|
||||
_, err := p.callPluginFunc("PutBucketPolicy", []any{ctx, bucket, policy})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetBucketPolicy(ctx context.Context, bucket string) ([]byte, error) {
|
||||
results, err := p.callPluginFunc("GetBucketPolicy", []any{ctx, bucket})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().([]byte), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteBucketPolicy(ctx context.Context, bucket string) error {
|
||||
_, err := p.callPluginFunc("DeleteBucketPolicy", []any{ctx, bucket})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutBucketOwnershipControls(ctx context.Context, bucket string, ownership types.ObjectOwnership) error {
|
||||
_, err := p.callPluginFunc("PutBucketOwnershipControls", []any{ctx, bucket, ownership})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetBucketOwnershipControls(ctx context.Context, bucket string) (types.ObjectOwnership, error) {
|
||||
results, err := p.callPluginFunc("GetBucketOwnershipControls", []any{ctx, bucket})
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
|
||||
return results[0].Interface().(types.ObjectOwnership), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteBucketOwnershipControls(ctx context.Context, bucket string) error {
|
||||
_, err := p.callPluginFunc("DeleteBucketOwnershipControls", []any{ctx, bucket})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutBucketCors(ctx context.Context, data []byte) error {
|
||||
_, err := p.callPluginFunc("PutBucketCors", []any{ctx, data})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetBucketCors(ctx context.Context, bucket string) ([]byte, error) {
|
||||
results, err := p.callPluginFunc("GetBucketCors", []any{ctx, bucket})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().([]byte), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteBucketCors(ctx context.Context, bucket string) error {
|
||||
_, err := p.callPluginFunc("DeleteBucketCors", []any{ctx, bucket})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) CreateMultipartUpload(ctx context.Context, input s3response.CreateMultipartUploadInput) (s3response.InitiateMultipartUploadResult, error) {
|
||||
results, err := p.callPluginFunc("CreateMultipartUpload", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.InitiateMultipartUploadResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.InitiateMultipartUploadResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) CompleteMultipartUpload(ctx context.Context, input *s3.CompleteMultipartUploadInput) (*s3.CompleteMultipartUploadOutput, error) {
|
||||
results, err := p.callPluginFunc("CompleteMultipartUpload", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.CompleteMultipartUploadOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) AbortMultipartUpload(ctx context.Context, input *s3.AbortMultipartUploadInput) error {
|
||||
_, err := p.callPluginFunc("AbortMultipartUpload", []any{ctx, input})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) ListMultipartUploads(ctx context.Context, input *s3.ListMultipartUploadsInput) (s3response.ListMultipartUploadsResult, error) {
|
||||
results, err := p.callPluginFunc("ListMultipartUploads", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.ListMultipartUploadsResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.ListMultipartUploadsResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) ListParts(ctx context.Context, input *s3.ListPartsInput) (s3response.ListPartsResult, error) {
|
||||
results, err := p.callPluginFunc("ListParts", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.ListPartsResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.ListPartsResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) UploadPart(ctx context.Context, input *s3.UploadPartInput) (*s3.UploadPartOutput, error) {
|
||||
results, err := p.callPluginFunc("UploadPart", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.UploadPartOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) UploadPartCopy(ctx context.Context, input *s3.UploadPartCopyInput) (s3response.CopyPartResult, error) {
|
||||
results, err := p.callPluginFunc("UploadPartCopy", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.CopyPartResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.CopyPartResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutObject(ctx context.Context, input s3response.PutObjectInput) (s3response.PutObjectOutput, error) {
|
||||
results, err := p.callPluginFunc("PutObject", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.PutObjectOutput{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.PutObjectOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) HeadObject(ctx context.Context, input *s3.HeadObjectInput) (*s3.HeadObjectOutput, error) {
|
||||
results, err := p.callPluginFunc("HeadObject", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.HeadObjectOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetObject(ctx context.Context, input *s3.GetObjectInput) (*s3.GetObjectOutput, error) {
|
||||
results, err := p.callPluginFunc("GetObject", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.GetObjectOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetObjectAcl(ctx context.Context, input *s3.GetObjectAclInput) (*s3.GetObjectAclOutput, error) {
|
||||
results, err := p.callPluginFunc("GetObjectAcl", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.GetObjectAclOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetObjectAttributes(ctx context.Context, input *s3.GetObjectAttributesInput) (s3response.GetObjectAttributesResponse, error) {
|
||||
results, err := p.callPluginFunc("GetObjectAttributes", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.GetObjectAttributesResponse{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.GetObjectAttributesResponse), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) CopyObject(ctx context.Context, input s3response.CopyObjectInput) (*s3.CopyObjectOutput, error) {
|
||||
results, err := p.callPluginFunc("CopyObject", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.CopyObjectOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) ListObjects(ctx context.Context, input *s3.ListObjectsInput) (s3response.ListObjectsResult, error) {
|
||||
results, err := p.callPluginFunc("ListObjects", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.ListObjectsResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.ListObjectsResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) ListObjectsV2(ctx context.Context, input *s3.ListObjectsV2Input) (s3response.ListObjectsV2Result, error) {
|
||||
results, err := p.callPluginFunc("ListObjectsV2", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.ListObjectsV2Result{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.ListObjectsV2Result), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteObject(ctx context.Context, input *s3.DeleteObjectInput) (*s3.DeleteObjectOutput, error) {
|
||||
results, err := p.callPluginFunc("DeleteObject", []any{ctx, input})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(*s3.DeleteObjectOutput), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteObjects(ctx context.Context, input *s3.DeleteObjectsInput) (s3response.DeleteResult, error) {
|
||||
results, err := p.callPluginFunc("DeleteObjects", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.DeleteResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.DeleteResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutObjectAcl(ctx context.Context, input *s3.PutObjectAclInput) error {
|
||||
_, err := p.callPluginFunc("PutObjectAcl", []any{ctx, input})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) ListObjectVersions(ctx context.Context, input *s3.ListObjectVersionsInput) (s3response.ListVersionsResult, error) {
|
||||
results, err := p.callPluginFunc("ListObjectVersions", []any{ctx, input})
|
||||
if err != nil {
|
||||
return s3response.ListVersionsResult{}, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(s3response.ListVersionsResult), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) RestoreObject(ctx context.Context, input *s3.RestoreObjectInput) error {
|
||||
_, err := p.callPluginFunc("RestoreObject", []any{ctx, input})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) SelectObjectContent(ctx context.Context, input *s3.SelectObjectContentInput) func(w *bufio.Writer) {
|
||||
results, err := p.callPluginFunc("SelectObjectContent", []any{ctx, input})
|
||||
if err != nil {
|
||||
return func(w *bufio.Writer) {}
|
||||
}
|
||||
|
||||
return results[0].Interface().(func(w *bufio.Writer))
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetBucketTagging(ctx context.Context, bucket string) (map[string]string, error) {
|
||||
results, err := p.callPluginFunc("GetBucketTagging", []any{ctx, bucket})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(map[string]string), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutBucketTagging(ctx context.Context, bucket string, tags map[string]string) error {
|
||||
_, err := p.callPluginFunc("PutBucketTagging", []any{ctx, bucket, tags})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteBucketTagging(ctx context.Context, bucket string) error {
|
||||
_, err := p.callPluginFunc("DeleteBucketTagging", []any{ctx, bucket})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetObjectTagging(ctx context.Context, bucket, object string) (map[string]string, error) {
|
||||
results, err := p.callPluginFunc("GetObjectTagging", []any{ctx, bucket, object})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().(map[string]string), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutObjectTagging(ctx context.Context, bucket, object string, tags map[string]string) error {
|
||||
_, err := p.callPluginFunc("PutObjectTagging", []any{ctx, bucket, object, tags})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) DeleteObjectTagging(ctx context.Context, bucket, object string) error {
|
||||
_, err := p.callPluginFunc("DeleteObjectTagging", []any{ctx, bucket, object})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutObjectLockConfiguration(ctx context.Context, bucket string, config []byte) error {
|
||||
_, err := p.callPluginFunc("PutObjectLockConfiguration", []any{ctx, bucket, config})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetObjectLockConfiguration(ctx context.Context, bucket string) ([]byte, error) {
|
||||
results, err := p.callPluginFunc("GetObjectLockConfiguration", []any{ctx, bucket})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().([]byte), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutObjectRetention(ctx context.Context, bucket, object, versionId string, bypass bool, retention []byte) error {
|
||||
_, err := p.callPluginFunc("PutObjectRetention", []any{ctx, bucket, object, versionId, bypass, retention})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetObjectRetention(ctx context.Context, bucket, object, versionId string) ([]byte, error) {
|
||||
results, err := p.callPluginFunc("GetObjectRetention", []any{ctx, bucket, object, versionId})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().([]byte), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) PutObjectLegalHold(ctx context.Context, bucket, object, versionId string, status bool) error {
|
||||
_, err := p.callPluginFunc("PutObjectLegalHold", []any{ctx, bucket, object, versionId, status})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) GetObjectLegalHold(ctx context.Context, bucket, object, versionId string) (*bool, error) {
|
||||
results, err := p.callPluginFunc("GetObjectLegalHold", []any{ctx, bucket, object, versionId})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
val := results[0].Interface()
|
||||
|
||||
if val == nil {
|
||||
return nil, convertError(results[1])
|
||||
}
|
||||
|
||||
return val.(*bool), convertError(results[1])
|
||||
}
|
||||
|
||||
func (p *PluginBackend) ChangeBucketOwner(ctx context.Context, bucket string, acl []byte) error {
|
||||
_, err := p.callPluginFunc("ChangeBucketOwner", []any{ctx, bucket, acl})
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *PluginBackend) ListBucketsAndOwners(ctx context.Context) ([]s3response.Bucket, error) {
|
||||
results, err := p.callPluginFunc("ListBucketsAndOwners", []any{ctx})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return results[0].Interface().([]s3response.Bucket), convertError(results[1])
|
||||
}
|
||||
|
||||
func convertError(result reflect.Value) error {
|
||||
if result.IsNil() {
|
||||
return nil
|
||||
}
|
||||
|
||||
err, ok := result.Interface().(error)
|
||||
if !ok {
|
||||
return fmt.Errorf("expected error, got %T", result.Interface())
|
||||
}
|
||||
|
||||
return err
|
||||
}
|
||||
|
||||
var _ backend.Backend = &PluginBackend{}
|
||||
@@ -1,46 +0,0 @@
|
||||
// Copyright 2026 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
//go:build windows
|
||||
|
||||
package posix
|
||||
|
||||
import (
|
||||
"os"
|
||||
"path/filepath"
|
||||
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func handleParentDirError(name string) error {
|
||||
dir := filepath.Dir(name)
|
||||
|
||||
// Walk up the directory hierarchy
|
||||
for dir != "." && dir != "/" {
|
||||
d, statErr := os.Stat(dir)
|
||||
if statErr == nil {
|
||||
// Path component exists
|
||||
if !d.IsDir() {
|
||||
// Found a file in the ancestor path
|
||||
return s3err.GetAPIError(s3err.ErrObjectParentIsFile)
|
||||
}
|
||||
// Found a valid directory ancestor, parent truly doesn't exist
|
||||
break
|
||||
}
|
||||
// Continue checking parent directories
|
||||
dir = filepath.Dir(dir)
|
||||
}
|
||||
// Parent doesn't exist or is a directory, treat as ENOENT
|
||||
return nil
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -26,7 +26,6 @@ import (
|
||||
"path/filepath"
|
||||
"strconv"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/backend"
|
||||
@@ -53,13 +52,9 @@ var (
|
||||
defaultFilePerm uint32 = 0644
|
||||
)
|
||||
|
||||
func (p *Posix) openTmpFile(dir, bucket, obj string, size int64, acct auth.Account, dofalloc bool, forceNoTmpFile bool) (*tmpfile, error) {
|
||||
func (p *Posix) openTmpFile(dir, bucket, obj string, size int64, acct auth.Account, dofalloc bool) (*tmpfile, error) {
|
||||
uid, gid, doChown := p.getChownIDs(acct)
|
||||
|
||||
if forceNoTmpFile {
|
||||
return p.openMkTemp(dir, bucket, obj, size, dofalloc, uid, gid, doChown)
|
||||
}
|
||||
|
||||
// O_TMPFILE allows for a file handle to an unnamed file in the filesystem.
|
||||
// This can help reduce contention within the namespace (parent directories),
|
||||
// etc. And will auto cleanup the inode on close if we never link this
|
||||
@@ -73,7 +68,37 @@ func (p *Posix) openTmpFile(dir, bucket, obj string, size int64, acct auth.Accou
|
||||
}
|
||||
|
||||
// O_TMPFILE not supported, try fallback
|
||||
return p.openMkTemp(dir, bucket, obj, size, dofalloc, uid, gid, doChown)
|
||||
err = backend.MkdirAll(dir, uid, gid, doChown, p.newDirPerm)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("make temp dir: %w", err)
|
||||
}
|
||||
f, err := os.CreateTemp(dir,
|
||||
fmt.Sprintf("%x.", sha256.Sum256([]byte(obj))))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
tmp := &tmpfile{
|
||||
f: f,
|
||||
bucket: bucket,
|
||||
objname: obj,
|
||||
size: size,
|
||||
needsChown: doChown,
|
||||
uid: uid,
|
||||
gid: gid,
|
||||
}
|
||||
// falloc is best effort, its fine if this fails
|
||||
if size > 0 && dofalloc {
|
||||
tmp.falloc()
|
||||
}
|
||||
|
||||
if doChown {
|
||||
err := f.Chown(uid, gid)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("set temp file ownership: %w", err)
|
||||
}
|
||||
}
|
||||
|
||||
return tmp, nil
|
||||
}
|
||||
|
||||
// for O_TMPFILE, filename is /proc/self/fd/<fd> to be used
|
||||
@@ -107,46 +132,6 @@ func (p *Posix) openTmpFile(dir, bucket, obj string, size int64, acct auth.Accou
|
||||
return tmp, nil
|
||||
}
|
||||
|
||||
func (p *Posix) openMkTemp(dir, bucket, obj string, size int64, dofalloc bool, uid, gid int, doChown bool) (*tmpfile, error) {
|
||||
err := backend.MkdirAll(dir, uid, gid, doChown, p.newDirPerm)
|
||||
if err != nil {
|
||||
if errors.Is(err, syscall.EROFS) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrMethodNotAllowed)
|
||||
}
|
||||
return nil, fmt.Errorf("make temp dir: %w", err)
|
||||
}
|
||||
f, err := os.CreateTemp(dir,
|
||||
fmt.Sprintf("%x.", sha256.Sum256([]byte(obj))))
|
||||
if err != nil {
|
||||
if errors.Is(err, syscall.EROFS) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrMethodNotAllowed)
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
tmp := &tmpfile{
|
||||
f: f,
|
||||
bucket: bucket,
|
||||
objname: obj,
|
||||
size: size,
|
||||
needsChown: doChown,
|
||||
uid: uid,
|
||||
gid: gid,
|
||||
}
|
||||
// falloc is best effort, its fine if this fails
|
||||
if size > 0 && dofalloc {
|
||||
tmp.falloc()
|
||||
}
|
||||
|
||||
if doChown {
|
||||
err := f.Chown(uid, gid)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("set temp file ownership: %w", err)
|
||||
}
|
||||
}
|
||||
|
||||
return tmp, nil
|
||||
}
|
||||
|
||||
func (tmp *tmpfile) falloc() error {
|
||||
err := syscall.Fallocate(int(tmp.f.Fd()), 0, 0, tmp.size)
|
||||
if err != nil {
|
||||
@@ -166,10 +151,14 @@ func (tmp *tmpfile) link() error {
|
||||
// of last upload completed wins and is not some combination of writes
|
||||
// from simultaneous uploads.
|
||||
objPath := filepath.Join(tmp.bucket, tmp.objname)
|
||||
err := os.Remove(objPath)
|
||||
if err != nil && !errors.Is(err, fs.ErrNotExist) {
|
||||
return fmt.Errorf("remove stale path: %w", err)
|
||||
}
|
||||
|
||||
dir := filepath.Dir(objPath)
|
||||
|
||||
err := backend.MkdirAll(dir, tmp.uid, tmp.gid, tmp.needsChown, tmp.newDirPerm)
|
||||
err = backend.MkdirAll(dir, tmp.uid, tmp.gid, tmp.needsChown, tmp.newDirPerm)
|
||||
if err != nil {
|
||||
return fmt.Errorf("make parent dir: %w", err)
|
||||
}
|
||||
@@ -191,33 +180,21 @@ func (tmp *tmpfile) link() error {
|
||||
}
|
||||
defer dirf.Close()
|
||||
|
||||
err = unix.Linkat(int(procdir.Fd()), filepath.Base(tmp.f.Name()),
|
||||
int(dirf.Fd()), filepath.Base(objPath), unix.AT_SYMLINK_FOLLOW)
|
||||
if errors.Is(err, syscall.EEXIST) {
|
||||
// Linkat cannot overwrite files; we will allocate a temporary file, Linkat to it and then Renameat it
|
||||
// to avoid potential race condition
|
||||
retries := 1
|
||||
for {
|
||||
tmpName := fmt.Sprintf(".%s.sgwtmp.%d", filepath.Base(objPath), time.Now().UnixNano())
|
||||
err := unix.Linkat(int(procdir.Fd()), filepath.Base(tmp.f.Name()),
|
||||
int(dirf.Fd()), tmpName, unix.AT_SYMLINK_FOLLOW)
|
||||
if errors.Is(err, syscall.EEXIST) && retries < 3 {
|
||||
retries += 1
|
||||
continue
|
||||
for {
|
||||
err = unix.Linkat(int(procdir.Fd()), filepath.Base(tmp.f.Name()),
|
||||
int(dirf.Fd()), filepath.Base(objPath), unix.AT_SYMLINK_FOLLOW)
|
||||
if errors.Is(err, syscall.EEXIST) {
|
||||
err := os.Remove(objPath)
|
||||
if err != nil && !errors.Is(err, fs.ErrNotExist) {
|
||||
return fmt.Errorf("remove stale path: %w", err)
|
||||
}
|
||||
if err != nil {
|
||||
return fmt.Errorf("cannot find free temporary file: %w", err)
|
||||
}
|
||||
|
||||
err = unix.Renameat(int(dirf.Fd()), tmpName, int(dirf.Fd()), filepath.Base(objPath))
|
||||
if err != nil {
|
||||
return fmt.Errorf("overwriting renameat failed: %w", err)
|
||||
}
|
||||
break
|
||||
continue
|
||||
}
|
||||
} else if err != nil {
|
||||
return fmt.Errorf("link tmpfile (fd %q as %q): %w",
|
||||
filepath.Base(tmp.f.Name()), objPath, err)
|
||||
if err != nil {
|
||||
return fmt.Errorf("link tmpfile (fd %q as %q): %w",
|
||||
filepath.Base(tmp.f.Name()), objPath, err)
|
||||
}
|
||||
break
|
||||
}
|
||||
|
||||
err = tmp.f.Close()
|
||||
@@ -245,9 +222,7 @@ func (tmp *tmpfile) fallbackLink() error {
|
||||
objPath := filepath.Join(tmp.bucket, tmp.objname)
|
||||
err = os.Rename(tempname, objPath)
|
||||
if err != nil {
|
||||
// rename only works for files within the same filesystem
|
||||
// if this fails fallback to copy
|
||||
return backend.MoveFile(tempname, objPath, fs.FileMode(defaultFilePerm))
|
||||
return fmt.Errorf("rename tmpfile: %w", err)
|
||||
}
|
||||
|
||||
return nil
|
||||
|
||||
@@ -38,7 +38,7 @@ type tmpfile struct {
|
||||
size int64
|
||||
}
|
||||
|
||||
func (p *Posix) openTmpFile(dir, bucket, obj string, size int64, acct auth.Account, _ bool, _ bool) (*tmpfile, error) {
|
||||
func (p *Posix) openTmpFile(dir, bucket, obj string, size int64, acct auth.Account, _ bool) (*tmpfile, error) {
|
||||
uid, gid, doChown := p.getChownIDs(acct)
|
||||
|
||||
// Create a temp file for upload while in progress (see link comments below).
|
||||
@@ -80,17 +80,31 @@ func (tmp *tmpfile) link() error {
|
||||
// this will no longer exist
|
||||
defer os.Remove(tempname)
|
||||
|
||||
// We use Rename as the atomic operation for object puts. The upload is
|
||||
// written to a temp file to not conflict with any other simultaneous
|
||||
// uploads. The final operation is to move the temp file into place for
|
||||
// the object. This ensures the object semantics of last upload completed
|
||||
// wins and is not some combination of writes from simultaneous uploads.
|
||||
objPath := filepath.Join(tmp.bucket, tmp.objname)
|
||||
err := os.Remove(objPath)
|
||||
if err != nil && !errors.Is(err, fs.ErrNotExist) {
|
||||
return fmt.Errorf("remove stale path: %w", err)
|
||||
}
|
||||
|
||||
// reset default file mode because CreateTemp uses 0600
|
||||
tmp.f.Chmod(defaultFilePerm)
|
||||
|
||||
err := tmp.f.Close()
|
||||
err = tmp.f.Close()
|
||||
if err != nil {
|
||||
return fmt.Errorf("close tmpfile: %w", err)
|
||||
}
|
||||
|
||||
return backend.MoveFile(tempname, objPath, defaultFilePerm)
|
||||
err = os.Rename(tempname, objPath)
|
||||
if err != nil {
|
||||
return fmt.Errorf("rename tmpfile: %w", err)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (tmp *tmpfile) Write(b []byte) (int, error) {
|
||||
|
||||
@@ -36,11 +36,6 @@ func (s *S3Proxy) getClientWithCtx(ctx context.Context) (*s3.Client, error) {
|
||||
if s.endpoint != "" {
|
||||
return s3.NewFromConfig(cfg, func(o *s3.Options) {
|
||||
o.BaseEndpoint = &s.endpoint
|
||||
o.UsePathStyle = s.usePathStyle
|
||||
// The http body stream is not seekable, so most operations cannot
|
||||
// be retried. The error returned to the original client may be
|
||||
// retried by the client.
|
||||
o.Retryer = aws.NopRetryer{}
|
||||
}), nil
|
||||
}
|
||||
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
@@ -17,70 +17,30 @@
|
||||
package scoutfs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io/fs"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"strconv"
|
||||
"strings"
|
||||
"syscall"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/pkg/xattr"
|
||||
"golang.org/x/sys/unix"
|
||||
|
||||
"github.com/versity/scoutfs-go"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/backend/meta"
|
||||
"github.com/versity/versitygw/backend/posix"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
type ScoutFS struct {
|
||||
*posix.Posix
|
||||
rootfd *os.File
|
||||
rootdir string
|
||||
|
||||
// glaciermode enables the following behavior:
|
||||
// GET object: if file offline, return invalid object state
|
||||
// HEAD object: if file offline, set obj storage class to GLACIER
|
||||
// if file offline and staging, x-amz-restore: ongoing-request="true"
|
||||
// if file offline and not staging, x-amz-restore: ongoing-request="false"
|
||||
// if file online, x-amz-restore: ongoing-request="false", expiry-date="Fri, 2 Dec 2050 00:00:00 GMT"
|
||||
// note: this expiry-date is not used but provided for client glacier compatibility
|
||||
// ListObjects: if file offline, set obj storage class to GLACIER
|
||||
// RestoreObject: add batch stage request to file
|
||||
glaciermode bool
|
||||
|
||||
// disableNoArchive is used to disable setting scoutam noarchive flag
|
||||
// on multipart parts. This is enabled by default to prevent archive
|
||||
// copies of temporary multipart parts.
|
||||
disableNoArchive bool
|
||||
|
||||
// enable posix level bucket name validations, not needed if the
|
||||
// frontend handlers are already validating bucket names
|
||||
validateBucketName bool
|
||||
|
||||
// projectIDEnabled enables setting projectid of new buckets and objects
|
||||
// to the account project id when non-0
|
||||
projectIDEnabled bool
|
||||
}
|
||||
|
||||
func New(rootdir string, opts ScoutfsOpts) (*ScoutFS, error) {
|
||||
metastore := meta.XattrMeta{}
|
||||
|
||||
p, err := posix.New(rootdir, metastore, posix.PosixOpts{
|
||||
ChownUID: opts.ChownUID,
|
||||
ChownGID: opts.ChownGID,
|
||||
BucketLinks: opts.BucketLinks,
|
||||
NewDirPerm: opts.NewDirPerm,
|
||||
VersioningDir: opts.VersioningDir,
|
||||
ValidateBucketNames: opts.ValidateBucketNames,
|
||||
ChownUID: opts.ChownUID,
|
||||
ChownGID: opts.ChownGID,
|
||||
BucketLinks: opts.BucketLinks,
|
||||
NewDirPerm: opts.NewDirPerm,
|
||||
})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
@@ -91,491 +51,155 @@ func New(rootdir string, opts ScoutfsOpts) (*ScoutFS, error) {
|
||||
return nil, fmt.Errorf("open %v: %w", rootdir, err)
|
||||
}
|
||||
|
||||
setProjectID := opts.SetProjectID
|
||||
if opts.SetProjectID {
|
||||
setProjectID = fGetFormatVersion(f).AtLeast(versionScoutFsV2)
|
||||
if !setProjectID {
|
||||
fmt.Println("WARNING:")
|
||||
fmt.Println("Disabling ProjectIDs for unsupported FS format version")
|
||||
fmt.Println("See documentation for format version upgrades")
|
||||
}
|
||||
}
|
||||
|
||||
return &ScoutFS{
|
||||
Posix: p,
|
||||
rootfd: f,
|
||||
rootdir: rootdir,
|
||||
meta: metastore,
|
||||
chownuid: opts.ChownUID,
|
||||
chowngid: opts.ChownGID,
|
||||
glaciermode: opts.GlacierMode,
|
||||
newDirPerm: opts.NewDirPerm,
|
||||
disableNoArchive: opts.DisableNoArchive,
|
||||
projectIDEnabled: setProjectID,
|
||||
}, nil
|
||||
}
|
||||
|
||||
const (
|
||||
stageComplete = "ongoing-request=\"false\", expiry-date=\"Fri, 2 Dec 2050 00:00:00 GMT\""
|
||||
stageInProgress = "true"
|
||||
stageNotInProgress = "false"
|
||||
)
|
||||
const procfddir = "/proc/self/fd"
|
||||
|
||||
const (
|
||||
// ScoutFS special xattr types
|
||||
systemPrefix = "scoutfs.hide."
|
||||
flagskey = systemPrefix + "sam_flags"
|
||||
)
|
||||
|
||||
const (
|
||||
// ScoutAM Flags
|
||||
|
||||
// Staging - file requested stage
|
||||
Staging uint64 = 1 << iota
|
||||
// StageFail - all copies failed to stage
|
||||
StageFail
|
||||
// NoArchive - no archive copies of file should be made
|
||||
NoArchive
|
||||
// ExtCacheRequested means file policy requests Ext Cache
|
||||
ExtCacheRequested
|
||||
// ExtCacheDone means this file ext cache copy has been
|
||||
// created already (and possibly pruned, so may not exist)
|
||||
ExtCacheDone
|
||||
)
|
||||
|
||||
func (s *ScoutFS) Shutdown() {
|
||||
s.Posix.Shutdown()
|
||||
s.rootfd.Close()
|
||||
type tmpfile struct {
|
||||
f *os.File
|
||||
bucket string
|
||||
objname string
|
||||
size int64
|
||||
needsChown bool
|
||||
uid int
|
||||
gid int
|
||||
newDirPerm fs.FileMode
|
||||
}
|
||||
|
||||
func (*ScoutFS) String() string {
|
||||
return "ScoutFS Gateway"
|
||||
}
|
||||
var (
|
||||
defaultFilePerm uint32 = 0644
|
||||
)
|
||||
|
||||
func (s *ScoutFS) CreateBucket(ctx context.Context, input *s3.CreateBucketInput, acl []byte) error {
|
||||
err := s.Posix.CreateBucket(ctx, input, acl)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
func (s *ScoutFS) openTmpFile(dir, bucket, obj string, size int64, acct auth.Account) (*tmpfile, error) {
|
||||
uid, gid, doChown := s.getChownIDs(acct)
|
||||
|
||||
if s.projectIDEnabled {
|
||||
acct, ok := ctx.Value("account").(auth.Account)
|
||||
if !ok {
|
||||
acct = auth.Account{}
|
||||
}
|
||||
|
||||
if !isValidProjectID(acct.ProjectID) {
|
||||
// early return to avoid the open if we dont have a valid
|
||||
// project id
|
||||
return nil
|
||||
}
|
||||
|
||||
f, err := os.Open(*input.Bucket)
|
||||
if err != nil {
|
||||
debuglogger.InternalError(fmt.Errorf("create bucket %q set project id - open: %v",
|
||||
*input.Bucket, err))
|
||||
return nil
|
||||
}
|
||||
|
||||
err = s.setProjectID(f, acct.ProjectID)
|
||||
f.Close()
|
||||
if err != nil {
|
||||
debuglogger.InternalError(fmt.Errorf("create bucket %q set project id: %v",
|
||||
*input.Bucket, err))
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s *ScoutFS) HeadObject(ctx context.Context, input *s3.HeadObjectInput) (*s3.HeadObjectOutput, error) {
|
||||
res, err := s.Posix.HeadObject(ctx, input)
|
||||
// O_TMPFILE allows for a file handle to an unnamed file in the filesystem.
|
||||
// This can help reduce contention within the namespace (parent directories),
|
||||
// etc. And will auto cleanup the inode on close if we never link this
|
||||
// file descriptor into the namespace.
|
||||
fd, err := unix.Open(dir, unix.O_RDWR|unix.O_TMPFILE|unix.O_CLOEXEC, defaultFilePerm)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if s.glaciermode {
|
||||
objPath := filepath.Join(*input.Bucket, *input.Key)
|
||||
// for O_TMPFILE, filename is /proc/self/fd/<fd> to be used
|
||||
// later to link file into namespace
|
||||
f := os.NewFile(uintptr(fd), filepath.Join(procfddir, strconv.Itoa(fd)))
|
||||
|
||||
stclass := types.StorageClassStandard
|
||||
requestOngoing := ""
|
||||
tmp := &tmpfile{
|
||||
f: f,
|
||||
bucket: bucket,
|
||||
objname: obj,
|
||||
size: size,
|
||||
needsChown: doChown,
|
||||
uid: uid,
|
||||
gid: gid,
|
||||
newDirPerm: s.newDirPerm,
|
||||
}
|
||||
|
||||
requestOngoing = stageComplete
|
||||
|
||||
// Check if there are any offline exents associated with this file.
|
||||
// If so, we will set storage class to glacier.
|
||||
st, err := scoutfs.StatMore(objPath)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
}
|
||||
if doChown {
|
||||
err := f.Chown(uid, gid)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("stat more: %w", err)
|
||||
return nil, fmt.Errorf("set temp file ownership: %w", err)
|
||||
}
|
||||
if st.Offline_blocks != 0 {
|
||||
stclass = types.StorageClassGlacier
|
||||
requestOngoing = stageNotInProgress
|
||||
|
||||
ok, err := isStaging(objPath)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
}
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("check stage status: %w", err)
|
||||
}
|
||||
if ok {
|
||||
requestOngoing = stageInProgress
|
||||
}
|
||||
}
|
||||
|
||||
res.Restore = &requestOngoing
|
||||
res.StorageClass = stclass
|
||||
}
|
||||
|
||||
return res, nil
|
||||
return tmp, nil
|
||||
}
|
||||
|
||||
func (s *ScoutFS) PutObject(ctx context.Context, po s3response.PutObjectInput) (s3response.PutObjectOutput, error) {
|
||||
acct, ok := ctx.Value("account").(auth.Account)
|
||||
if !ok {
|
||||
acct = auth.Account{}
|
||||
func (tmp *tmpfile) link() error {
|
||||
// We use Linkat/Rename as the atomic operation for object puts. The
|
||||
// upload is written to a temp (or unnamed/O_TMPFILE) file to not conflict
|
||||
// with any other simultaneous uploads. The final operation is to move the
|
||||
// temp file into place for the object. This ensures the object semantics
|
||||
// of last upload completed wins and is not some combination of writes
|
||||
// from simultaneous uploads.
|
||||
objPath := filepath.Join(tmp.bucket, tmp.objname)
|
||||
err := os.Remove(objPath)
|
||||
if err != nil && !errors.Is(err, fs.ErrNotExist) {
|
||||
return fmt.Errorf("remove stale path: %w", err)
|
||||
}
|
||||
|
||||
return s.Posix.PutObjectWithPostFunc(ctx, po, func(f *os.File) error {
|
||||
err := s.setProjectID(f, acct.ProjectID)
|
||||
if err != nil {
|
||||
debuglogger.InternalError(fmt.Errorf("put object %v/%v set project id: %v",
|
||||
filepath.Join(*po.Bucket, *po.Key), acct.ProjectID, err))
|
||||
}
|
||||
dir := filepath.Dir(objPath)
|
||||
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
func (s *ScoutFS) UploadPart(ctx context.Context, input *s3.UploadPartInput) (*s3.UploadPartOutput, error) {
|
||||
acct, ok := ctx.Value("account").(auth.Account)
|
||||
if !ok {
|
||||
acct = auth.Account{}
|
||||
}
|
||||
|
||||
return s.Posix.UploadPartWithPostFunc(ctx, input,
|
||||
func(f *os.File) error {
|
||||
if !s.disableNoArchive {
|
||||
err := setNoArchive(f)
|
||||
if err != nil {
|
||||
return fmt.Errorf("set noarchive: %w", err)
|
||||
}
|
||||
}
|
||||
|
||||
err := s.setProjectID(f, acct.ProjectID)
|
||||
if err != nil {
|
||||
return fmt.Errorf("set project id %v: %w", acct.ProjectID, err)
|
||||
}
|
||||
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
// CompleteMultipartUpload scoutfs complete upload uses scoutfs move blocks
|
||||
// ioctl to not have to read and copy the part data to the final object. This
|
||||
// saves a read and write cycle for all mutlipart uploads.
|
||||
func (s *ScoutFS) CompleteMultipartUpload(ctx context.Context, input *s3.CompleteMultipartUploadInput) (s3response.CompleteMultipartUploadResult, string, error) {
|
||||
acct, ok := ctx.Value("account").(auth.Account)
|
||||
if !ok {
|
||||
acct = auth.Account{}
|
||||
}
|
||||
|
||||
return s.Posix.CompleteMultipartUploadWithCopy(ctx, input,
|
||||
func(from *os.File, to *os.File) error {
|
||||
// May fail if the files are not 4K aligned; check for alignment
|
||||
ffi, err := from.Stat()
|
||||
if err != nil {
|
||||
return fmt.Errorf("complete-mpu stat from: %w", err)
|
||||
}
|
||||
tfi, err := to.Stat()
|
||||
if err != nil {
|
||||
return fmt.Errorf("complete-mpu stat to: %w", err)
|
||||
}
|
||||
if ffi.Size()%4096 != 0 || tfi.Size()%4096 != 0 {
|
||||
return os.ErrInvalid
|
||||
}
|
||||
|
||||
err = s.setProjectID(to, acct.ProjectID)
|
||||
if err != nil {
|
||||
debuglogger.InternalError(fmt.Errorf("complete-mpu %q/%q set project id %v: %v",
|
||||
*input.Bucket, *input.Key, acct.ProjectID, err))
|
||||
}
|
||||
|
||||
err = scoutfs.MoveData(from, to)
|
||||
if err != nil {
|
||||
return fmt.Errorf("complete-mpu movedata: %w", err)
|
||||
}
|
||||
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
func (s *ScoutFS) isBucketValid(bucket string) bool {
|
||||
if !s.validateBucketName {
|
||||
return true
|
||||
}
|
||||
|
||||
return backend.IsValidDirectoryName(bucket)
|
||||
}
|
||||
|
||||
func (s *ScoutFS) GetObject(ctx context.Context, input *s3.GetObjectInput) (*s3.GetObjectOutput, error) {
|
||||
bucket := *input.Bucket
|
||||
object := *input.Key
|
||||
|
||||
if !s.isBucketValid(bucket) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidBucketName)
|
||||
}
|
||||
|
||||
_, err := os.Stat(bucket)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNoSuchBucket)
|
||||
}
|
||||
err = backend.MkdirAll(dir, tmp.uid, tmp.gid, tmp.needsChown, tmp.newDirPerm)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("stat bucket: %w", err)
|
||||
return fmt.Errorf("make parent dir: %w", err)
|
||||
}
|
||||
|
||||
objPath := filepath.Join(bucket, object)
|
||||
|
||||
fi, err := os.Stat(objPath)
|
||||
if errors.Is(err, fs.ErrNotExist) || errors.Is(err, syscall.ENOTDIR) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
}
|
||||
if errors.Is(err, syscall.ENAMETOOLONG) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrKeyTooLong)
|
||||
}
|
||||
procdir, err := os.Open(procfddir)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("stat object: %w", err)
|
||||
return fmt.Errorf("open proc dir: %w", err)
|
||||
}
|
||||
defer procdir.Close()
|
||||
|
||||
if strings.HasSuffix(object, "/") && !fi.IsDir() {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
}
|
||||
|
||||
if s.glaciermode {
|
||||
// Check if there are any offline exents associated with this file.
|
||||
// If so, we will return the InvalidObjectState error.
|
||||
st, err := scoutfs.StatMore(objPath)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
}
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("stat more: %w", err)
|
||||
}
|
||||
if st.Offline_blocks != 0 {
|
||||
return nil, s3err.GetAPIError(s3err.ErrInvalidObjectState)
|
||||
}
|
||||
}
|
||||
|
||||
return s.Posix.GetObject(ctx, input)
|
||||
}
|
||||
|
||||
func (s *ScoutFS) ListObjects(ctx context.Context, input *s3.ListObjectsInput) (s3response.ListObjectsResult, error) {
|
||||
if s.glaciermode {
|
||||
return s.Posix.ListObjectsParametrized(ctx, input, s.glacierFileToObj)
|
||||
} else {
|
||||
return s.Posix.ListObjects(ctx, input)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *ScoutFS) ListObjectsV2(ctx context.Context, input *s3.ListObjectsV2Input) (s3response.ListObjectsV2Result, error) {
|
||||
if s.glaciermode {
|
||||
return s.Posix.ListObjectsV2Parametrized(ctx, input, s.glacierFileToObj)
|
||||
} else {
|
||||
return s.Posix.ListObjectsV2(ctx, input)
|
||||
}
|
||||
}
|
||||
|
||||
// FileToObj function for ListObject calls that adds a Glacier storage class if the file is offline
|
||||
func (s *ScoutFS) glacierFileToObj(bucket string, fetchOwner bool) backend.GetObjFunc {
|
||||
posixFileToObj := s.Posix.FileToObj(bucket, fetchOwner)
|
||||
|
||||
return func(path string, d fs.DirEntry) (s3response.Object, error) {
|
||||
res, err := posixFileToObj(path, d)
|
||||
if err != nil || d.IsDir() {
|
||||
return res, err
|
||||
}
|
||||
objPath := filepath.Join(bucket, path)
|
||||
// Check if there are any offline exents associated with this file.
|
||||
// If so, we will return the Glacier storage class
|
||||
st, err := scoutfs.StatMore(objPath)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
return s3response.Object{}, backend.ErrSkipObj
|
||||
}
|
||||
if err != nil {
|
||||
return s3response.Object{}, fmt.Errorf("stat more: %w", err)
|
||||
}
|
||||
if st.Offline_blocks != 0 {
|
||||
res.StorageClass = types.ObjectStorageClassGlacier
|
||||
}
|
||||
return res, nil
|
||||
}
|
||||
}
|
||||
|
||||
// RestoreObject will set stage request on file if offline and do nothing if
|
||||
// file is online
|
||||
func (s *ScoutFS) RestoreObject(_ context.Context, input *s3.RestoreObjectInput) error {
|
||||
bucket := *input.Bucket
|
||||
object := *input.Key
|
||||
|
||||
if !s.isBucketValid(bucket) {
|
||||
return s3err.GetAPIError(s3err.ErrInvalidBucketName)
|
||||
}
|
||||
|
||||
_, err := os.Stat(bucket)
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
return s3err.GetAPIError(s3err.ErrNoSuchBucket)
|
||||
}
|
||||
dirf, err := os.Open(dir)
|
||||
if err != nil {
|
||||
return fmt.Errorf("stat bucket: %w", err)
|
||||
return fmt.Errorf("open parent dir: %w", err)
|
||||
}
|
||||
defer dirf.Close()
|
||||
|
||||
err = unix.Linkat(int(procdir.Fd()), filepath.Base(tmp.f.Name()),
|
||||
int(dirf.Fd()), filepath.Base(objPath), unix.AT_SYMLINK_FOLLOW)
|
||||
if err != nil {
|
||||
return fmt.Errorf("link tmpfile: %w", err)
|
||||
}
|
||||
|
||||
err = setStaging(filepath.Join(bucket, object))
|
||||
if errors.Is(err, fs.ErrNotExist) {
|
||||
return s3err.GetAPIError(s3err.ErrNoSuchKey)
|
||||
}
|
||||
err = tmp.f.Close()
|
||||
if err != nil {
|
||||
return fmt.Errorf("stage object: %w", err)
|
||||
return fmt.Errorf("close tmpfile: %w", err)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func isStaging(objname string) (bool, error) {
|
||||
b, err := xattr.Get(objname, flagskey)
|
||||
if err != nil && !isNoAttr(err) {
|
||||
return false, err
|
||||
func (tmp *tmpfile) Write(b []byte) (int, error) {
|
||||
if int64(len(b)) > tmp.size {
|
||||
return 0, fmt.Errorf("write exceeds content length %v", tmp.size)
|
||||
}
|
||||
|
||||
var flags uint64
|
||||
if !isNoAttr(err) {
|
||||
err = json.Unmarshal(b, &flags)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
}
|
||||
|
||||
return flags&Staging == Staging, nil
|
||||
n, err := tmp.f.Write(b)
|
||||
tmp.size -= int64(n)
|
||||
return n, err
|
||||
}
|
||||
|
||||
func setFlag(objname string, flag uint64) error {
|
||||
f, err := os.Open(objname)
|
||||
func (tmp *tmpfile) cleanup() {
|
||||
tmp.f.Close()
|
||||
}
|
||||
|
||||
func (tmp *tmpfile) File() *os.File {
|
||||
return tmp.f
|
||||
}
|
||||
|
||||
func moveData(from *os.File, to *os.File) error {
|
||||
return scoutfs.MoveData(from, to)
|
||||
}
|
||||
|
||||
func statMore(path string) (stat, error) {
|
||||
st, err := scoutfs.StatMore(path)
|
||||
if err != nil {
|
||||
return err
|
||||
return stat{}, err
|
||||
}
|
||||
defer f.Close()
|
||||
var s stat
|
||||
|
||||
return fsetFlag(f, flag)
|
||||
}
|
||||
|
||||
func fsetFlag(f *os.File, flag uint64) error {
|
||||
b, err := xattr.FGet(f, flagskey)
|
||||
if err != nil && !isNoAttr(err) {
|
||||
return err
|
||||
}
|
||||
|
||||
var oldflags uint64
|
||||
if !isNoAttr(err) {
|
||||
err = json.Unmarshal(b, &oldflags)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
newflags := oldflags | flag
|
||||
|
||||
if newflags == oldflags {
|
||||
// no flags change, just return
|
||||
return nil
|
||||
}
|
||||
|
||||
b, err = json.Marshal(&newflags)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return xattr.FSet(f, flagskey, b)
|
||||
}
|
||||
|
||||
func setStaging(objname string) error {
|
||||
return setFlag(objname, Staging)
|
||||
}
|
||||
|
||||
func setNoArchive(f *os.File) error {
|
||||
return fsetFlag(f, NoArchive)
|
||||
}
|
||||
|
||||
func isNoAttr(err error) bool {
|
||||
xerr, ok := err.(*xattr.Error)
|
||||
if ok && xerr.Err == xattr.ENOATTR {
|
||||
return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (s *ScoutFS) setProjectID(f *os.File, proj int) error {
|
||||
if s.projectIDEnabled && isValidProjectID(proj) {
|
||||
err := scoutfs.SetProjectID(f, uint64(proj))
|
||||
if err != nil {
|
||||
return fmt.Errorf("set project id: %w", err)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func isValidProjectID(proj int) bool {
|
||||
return proj > 0
|
||||
}
|
||||
|
||||
const (
|
||||
sysscoutfs = "/sys/fs/scoutfs/"
|
||||
formatversion = "format_version"
|
||||
)
|
||||
|
||||
// GetFormatVersion returns ScoutFS version reported by sysfs
|
||||
func fGetFormatVersion(f *os.File) scoutFsVersion {
|
||||
fsid, err := scoutfs.GetIDs(f)
|
||||
if err != nil {
|
||||
return versionScoutFsNotScoutFS
|
||||
}
|
||||
|
||||
path := filepath.Join(sysscoutfs, fsid.ShortID, formatversion)
|
||||
buf, err := os.ReadFile(path)
|
||||
if err != nil {
|
||||
return versionScoutFsUnknown
|
||||
}
|
||||
|
||||
str := strings.TrimSpace(string(buf))
|
||||
vers, err := strconv.Atoi(str)
|
||||
if err != nil {
|
||||
return versionScoutFsUnknown
|
||||
}
|
||||
|
||||
return scoutFsVersion(vers)
|
||||
}
|
||||
|
||||
const (
|
||||
// versionScoutFsUnknown is unknown version
|
||||
versionScoutFsUnknown scoutFsVersion = iota
|
||||
// versionScoutFsV1 is version 1
|
||||
versionScoutFsV1
|
||||
// versionScoutFsV2 is version 2
|
||||
versionScoutFsV2
|
||||
// versionScoutFsMin is minimum scoutfs version
|
||||
versionScoutFsMin = versionScoutFsV1
|
||||
// versionScoutFsMax is maximum scoutfs version
|
||||
versionScoutFsMax = versionScoutFsV2
|
||||
// versionScoutFsNotScoutFS means the target FS is not scoutfs
|
||||
versionScoutFsNotScoutFS = versionScoutFsMax + 1
|
||||
)
|
||||
|
||||
// scoutFsVersion version
|
||||
type scoutFsVersion int
|
||||
|
||||
// AtLeast returns true if version is valid and at least b
|
||||
func (a scoutFsVersion) AtLeast(b scoutFsVersion) bool {
|
||||
return a.IsValid() && a >= b
|
||||
}
|
||||
|
||||
func (a scoutFsVersion) IsValid() bool {
|
||||
return a >= versionScoutFsMin && a <= versionScoutFsMax
|
||||
s.Meta_seq = st.Meta_seq
|
||||
s.Data_seq = st.Data_seq
|
||||
s.Data_version = st.Data_version
|
||||
s.Online_blocks = st.Online_blocks
|
||||
s.Offline_blocks = st.Offline_blocks
|
||||
s.Crtime_sec = st.Crtime_sec
|
||||
s.Crtime_nsec = st.Crtime_nsec
|
||||
|
||||
return s, nil
|
||||
}
|
||||
|
||||
@@ -17,15 +17,51 @@
|
||||
package scoutfs
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"os"
|
||||
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/auth"
|
||||
)
|
||||
|
||||
type ScoutFS struct {
|
||||
backend.BackendUnsupported
|
||||
}
|
||||
|
||||
func New(rootdir string, opts ScoutfsOpts) (*ScoutFS, error) {
|
||||
return nil, fmt.Errorf("scoutfs only available on linux")
|
||||
}
|
||||
|
||||
type tmpfile struct{}
|
||||
|
||||
var (
|
||||
errNotSupported = errors.New("not supported")
|
||||
)
|
||||
|
||||
func (s *ScoutFS) openTmpFile(_, _, _ string, _ int64, _ auth.Account) (*tmpfile, error) {
|
||||
// make these look used for static check
|
||||
_ = s.chownuid
|
||||
_ = s.chowngid
|
||||
_ = s.euid
|
||||
_ = s.egid
|
||||
return nil, errNotSupported
|
||||
}
|
||||
|
||||
func (tmp *tmpfile) link() error {
|
||||
return errNotSupported
|
||||
}
|
||||
|
||||
func (tmp *tmpfile) Write(b []byte) (int, error) {
|
||||
return 0, errNotSupported
|
||||
}
|
||||
|
||||
func (tmp *tmpfile) cleanup() {
|
||||
}
|
||||
|
||||
func (tmp *tmpfile) File() *os.File {
|
||||
return nil
|
||||
}
|
||||
|
||||
func moveData(_, _ *os.File) error {
|
||||
return errNotSupported
|
||||
}
|
||||
|
||||
func statMore(_ string) (stat, error) {
|
||||
return stat{}, errNotSupported
|
||||
}
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
// Copyright 2026 Versity Software
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
@@ -12,14 +12,14 @@
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
//go:build !windows
|
||||
package scoutfs
|
||||
|
||||
package posix
|
||||
|
||||
import (
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func handleParentDirError(_ string) error {
|
||||
return s3err.GetAPIError(s3err.ErrObjectParentIsFile)
|
||||
type stat struct {
|
||||
Meta_seq uint64
|
||||
Data_seq uint64
|
||||
Data_version uint64
|
||||
Online_blocks uint64
|
||||
Offline_blocks uint64
|
||||
Crtime_sec uint64
|
||||
Crtime_nsec uint32
|
||||
}
|
||||
1296
backend/walk.go
1296
backend/walk.go
File diff suppressed because it is too large
Load Diff
@@ -112,22 +112,6 @@ func TestWalk(t *testing.T) {
|
||||
}},
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "max objs",
|
||||
delimiter: "/",
|
||||
prefix: "photos/2006/February/",
|
||||
maxObjs: 2,
|
||||
expected: backend.WalkResults{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("photos/2006/February/sample2.jpg"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("photos/2006/February/sample3.jpg"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
@@ -242,7 +226,7 @@ func TestWalk(t *testing.T) {
|
||||
tt.fsys, tc.prefix, tc.delimiter, tc.marker, tc.maxObjs,
|
||||
tt.getobj, []string{})
|
||||
if err != nil {
|
||||
t.Errorf("%v: walk: %v", tc.name, err)
|
||||
t.Errorf("tc.name: walk: %v", err)
|
||||
}
|
||||
|
||||
compareResults(tc.name, res, tc.expected, t)
|
||||
@@ -392,702 +376,3 @@ func TestWalkStop(t *testing.T) {
|
||||
t.Fatalf("unexpected error: %v", err)
|
||||
}
|
||||
}
|
||||
|
||||
// TestOrderWalk tests the lexicographic ordering of the object names
|
||||
// for the case where readdir sort order of a directory is different
|
||||
// than the lexicographic ordering of the full paths. The below has
|
||||
// a readdir sort order for dir1/:
|
||||
// a, a.b
|
||||
// but if you consider the character that comes after a is "/", then
|
||||
// the "." should come before "/" in the lexicographic ordering:
|
||||
// a.b/, a/
|
||||
func TestOrderWalk(t *testing.T) {
|
||||
tests := []walkTest{
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"dir1/a/file1": {},
|
||||
"dir1/a/file2": {},
|
||||
"dir1/a/file3": {},
|
||||
"dir1/a.b/file1": {},
|
||||
"dir1/a.b/file2": {},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []testcase{
|
||||
{
|
||||
name: "order test",
|
||||
maxObjs: 1000,
|
||||
prefix: "dir1/",
|
||||
expected: backend.WalkResults{
|
||||
Objects: []s3response.Object{
|
||||
{Key: backend.GetPtrFromString("dir1/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a.b/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a.b/file1")},
|
||||
{Key: backend.GetPtrFromString("dir1/a.b/file2")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file1")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file2")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file3")},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"dir|1/a/file1": {},
|
||||
"dir|1/a/file2": {},
|
||||
"dir|1/a/file3": {},
|
||||
"dir|1/a.b/file1": {},
|
||||
"dir|1/a.b/file2": {},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []testcase{
|
||||
{
|
||||
name: "order test delim",
|
||||
maxObjs: 1000,
|
||||
delimiter: "|",
|
||||
prefix: "dir|",
|
||||
expected: backend.WalkResults{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir|1/a.b/file1"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir|1/a.b/file2"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir|1/a/file1"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir|1/a/file2"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir|1/a/file3"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"a": &fstest.MapFile{Mode: fs.ModeDir},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []testcase{
|
||||
{
|
||||
name: "single dir obj",
|
||||
maxObjs: 1000,
|
||||
delimiter: "/",
|
||||
prefix: "a",
|
||||
expected: backend.WalkResults{
|
||||
CommonPrefixes: []types.CommonPrefix{
|
||||
{
|
||||
Prefix: backend.GetPtrFromString("a/"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "single dir obj",
|
||||
maxObjs: 1000,
|
||||
delimiter: "/",
|
||||
prefix: "a/",
|
||||
expected: backend.WalkResults{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("a/"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
for _, tc := range tt.cases {
|
||||
res, err := backend.Walk(context.Background(),
|
||||
tt.fsys, tc.prefix, tc.delimiter, tc.marker, tc.maxObjs,
|
||||
tt.getobj, []string{})
|
||||
if err != nil {
|
||||
t.Errorf("%v: walk: %v", tc.name, err)
|
||||
}
|
||||
|
||||
compareResultsOrdered(tc.name, res, tc.expected, t)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
type markerTest struct {
|
||||
fsys fs.FS
|
||||
getobj backend.GetObjFunc
|
||||
cases []markertestcase
|
||||
}
|
||||
|
||||
type markertestcase struct {
|
||||
name string
|
||||
prefix string
|
||||
delimiter string
|
||||
marker string
|
||||
maxObjs int32
|
||||
expected []backend.WalkResults
|
||||
}
|
||||
|
||||
func TestMarker(t *testing.T) {
|
||||
tests := []markerTest{
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"dir/sample2.jpg": {},
|
||||
"dir/sample3.jpg": {},
|
||||
"dir/sample4.jpg": {},
|
||||
"dir/sample5.jpg": {},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []markertestcase{
|
||||
{
|
||||
name: "multi page marker",
|
||||
delimiter: "/",
|
||||
prefix: "dir/",
|
||||
maxObjs: 2,
|
||||
expected: []backend.WalkResults{
|
||||
{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir/sample2.jpg"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir/sample3.jpg"),
|
||||
},
|
||||
},
|
||||
Truncated: true,
|
||||
},
|
||||
{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir/sample4.jpg"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir/sample5.jpg"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"dir1/subdir/file.txt": {},
|
||||
"dir1/subdir.ext": {},
|
||||
"dir1/subdir1.ext": {},
|
||||
"dir1/subdir2.ext": {},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []markertestcase{
|
||||
{
|
||||
name: "integration test case 1",
|
||||
maxObjs: 2,
|
||||
delimiter: "/",
|
||||
prefix: "dir1/",
|
||||
expected: []backend.WalkResults{
|
||||
{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir1/subdir.ext"),
|
||||
},
|
||||
},
|
||||
CommonPrefixes: []types.CommonPrefix{
|
||||
{
|
||||
Prefix: backend.GetPtrFromString("dir1/subdir/"),
|
||||
},
|
||||
},
|
||||
Truncated: true,
|
||||
},
|
||||
{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir1/subdir1.ext"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("dir1/subdir2.ext"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"asdf": {},
|
||||
"boo/bar": {},
|
||||
"boo/baz/xyzzy": {},
|
||||
"cquux/thud": {},
|
||||
"cquux/bla": {},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []markertestcase{
|
||||
{
|
||||
name: "integration test case2",
|
||||
maxObjs: 1,
|
||||
delimiter: "/",
|
||||
marker: "boo/",
|
||||
expected: []backend.WalkResults{
|
||||
{
|
||||
Objects: []s3response.Object{},
|
||||
CommonPrefixes: []types.CommonPrefix{
|
||||
{
|
||||
Prefix: backend.GetPtrFromString("cquux/"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"bar": {},
|
||||
"baz": {},
|
||||
"foo": {},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []markertestcase{
|
||||
{
|
||||
name: "exact limit count",
|
||||
maxObjs: 3,
|
||||
expected: []backend.WalkResults{
|
||||
{
|
||||
Objects: []s3response.Object{
|
||||
{
|
||||
Key: backend.GetPtrFromString("bar"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("baz"),
|
||||
},
|
||||
{
|
||||
Key: backend.GetPtrFromString("foo"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
fsys: fstest.MapFS{
|
||||
"d1/f1": {},
|
||||
"d2/f2": {},
|
||||
"d3/f3": {},
|
||||
"d4/f4": {},
|
||||
},
|
||||
getobj: getObj,
|
||||
cases: []markertestcase{
|
||||
{
|
||||
name: "limited common prefix",
|
||||
maxObjs: 3,
|
||||
delimiter: "/",
|
||||
expected: []backend.WalkResults{
|
||||
{
|
||||
CommonPrefixes: []types.CommonPrefix{
|
||||
{
|
||||
Prefix: backend.GetPtrFromString("d1/"),
|
||||
},
|
||||
{
|
||||
Prefix: backend.GetPtrFromString("d2/"),
|
||||
},
|
||||
{
|
||||
Prefix: backend.GetPtrFromString("d3/"),
|
||||
},
|
||||
},
|
||||
Truncated: true,
|
||||
},
|
||||
{
|
||||
CommonPrefixes: []types.CommonPrefix{
|
||||
{
|
||||
Prefix: backend.GetPtrFromString("d4/"),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
for _, tc := range tt.cases {
|
||||
marker := tc.marker
|
||||
for i, page := range tc.expected {
|
||||
res, err := backend.Walk(context.Background(),
|
||||
tt.fsys, tc.prefix, tc.delimiter, marker, tc.maxObjs,
|
||||
tt.getobj, []string{})
|
||||
if err != nil {
|
||||
t.Errorf("%v: walk: %v", tc.name, err)
|
||||
}
|
||||
marker = res.NextMarker
|
||||
|
||||
compareResultsOrdered(tc.name, res, page, t)
|
||||
|
||||
if res.Truncated != page.Truncated {
|
||||
t.Errorf("%v page %v expected truncated %v, got %v",
|
||||
tc.name, i, page.Truncated, res.Truncated)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func compareResultsOrdered(name string, got, wanted backend.WalkResults, t *testing.T) {
|
||||
if !compareObjectsOrdered(got.Objects, wanted.Objects) {
|
||||
t.Errorf("%v: unexpected object, got %v wanted %v",
|
||||
name,
|
||||
printObjects(got.Objects),
|
||||
printObjects(wanted.Objects))
|
||||
}
|
||||
if !comparePrefixesOrdered(got.CommonPrefixes, wanted.CommonPrefixes) {
|
||||
t.Errorf("%v: unexpected prefix, got %v wanted %v",
|
||||
name,
|
||||
printCommonPrefixes(got.CommonPrefixes),
|
||||
printCommonPrefixes(wanted.CommonPrefixes))
|
||||
}
|
||||
}
|
||||
|
||||
func compareObjectsOrdered(a, b []s3response.Object) bool {
|
||||
if len(a) == 0 && len(b) == 0 {
|
||||
return true
|
||||
}
|
||||
if len(a) != len(b) {
|
||||
return false
|
||||
}
|
||||
|
||||
for i, obj := range a {
|
||||
if *obj.Key != *b[i].Key {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
||||
|
||||
func comparePrefixesOrdered(a, b []types.CommonPrefix) bool {
|
||||
if len(a) == 0 && len(b) == 0 {
|
||||
return true
|
||||
}
|
||||
if len(a) != len(b) {
|
||||
return false
|
||||
}
|
||||
|
||||
for i, cp := range a {
|
||||
if *cp.Prefix != *b[i].Prefix {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
||||
|
||||
// ---- Versioning Tests ----
|
||||
|
||||
// getVersionsTestFunc is a simple GetVersionsFunc implementation for tests that
|
||||
// returns a single latest version for each file or directory encountered.
|
||||
// Directories are reported with a trailing delimiter in the key to match the
|
||||
// behavior of the non-versioned Walk tests where directory objects are listed.
|
||||
func getVersionsTestFunc(path, versionIdMarker string, pastVersionIdMarker *bool, availableObjCount int, d fs.DirEntry) (*backend.ObjVersionFuncResult, error) {
|
||||
// If we have no available slots left, signal truncation (should be rare in these tests)
|
||||
if availableObjCount <= 0 {
|
||||
return &backend.ObjVersionFuncResult{Truncated: true, NextVersionIdMarker: ""}, nil
|
||||
}
|
||||
|
||||
key := path
|
||||
if d.IsDir() {
|
||||
key = key + "/"
|
||||
}
|
||||
ver := "v1"
|
||||
latest := true
|
||||
ov := s3response.ObjectVersion{Key: &key, VersionId: &ver, IsLatest: &latest}
|
||||
return &backend.ObjVersionFuncResult{ObjectVersions: []s3response.ObjectVersion{ov}}, nil
|
||||
}
|
||||
|
||||
// TestWalkVersions mirrors TestWalk but exercises WalkVersions and validates
|
||||
// common prefixes and object versions for typical delimiter/prefix scenarios.
|
||||
func TestWalkVersions(t *testing.T) {
|
||||
fsys := fstest.MapFS{
|
||||
"dir1/a/file1": {},
|
||||
"dir1/a/file2": {},
|
||||
"dir1/b/file3": {},
|
||||
"rootfile": {},
|
||||
}
|
||||
|
||||
// Without a delimiter, every directory and file becomes an object version
|
||||
// via the test GetVersionsFunc (directories have trailing '/').
|
||||
expected := backend.WalkVersioningResults{
|
||||
ObjectVersions: []s3response.ObjectVersion{
|
||||
{Key: backend.GetPtrFromString("dir1/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file1")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file2")},
|
||||
{Key: backend.GetPtrFromString("dir1/b/")},
|
||||
{Key: backend.GetPtrFromString("dir1/b/file3")},
|
||||
{Key: backend.GetPtrFromString("rootfile")},
|
||||
},
|
||||
}
|
||||
|
||||
res, err := backend.WalkVersions(context.Background(), fsys, "", "", "", "", 1000, getVersionsTestFunc, []string{})
|
||||
if err != nil {
|
||||
t.Fatalf("walk versions: %v", err)
|
||||
}
|
||||
compareVersionResultsOrdered("simple versions no delimiter", res, expected, t)
|
||||
}
|
||||
|
||||
// TestOrderWalkVersions mirrors TestOrderWalk, exercising ordering semantics for
|
||||
// version listings (lexicographic ordering of directory and file version keys).
|
||||
func TestOrderWalkVersions(t *testing.T) {
|
||||
fsys := fstest.MapFS{
|
||||
"dir1/a/file1": {},
|
||||
"dir1/a/file2": {},
|
||||
"dir1/a/file3": {},
|
||||
"dir1/a.b/file1": {},
|
||||
"dir1/a.b/file2": {},
|
||||
}
|
||||
|
||||
// Expect lexicographic ordering similar to non-version walk when no delimiter.
|
||||
expected := backend.WalkVersioningResults{
|
||||
ObjectVersions: []s3response.ObjectVersion{
|
||||
{Key: backend.GetPtrFromString("dir1/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a.b/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a.b/file1")},
|
||||
{Key: backend.GetPtrFromString("dir1/a.b/file2")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file1")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file2")},
|
||||
{Key: backend.GetPtrFromString("dir1/a/file3")},
|
||||
},
|
||||
}
|
||||
|
||||
res, err := backend.WalkVersions(context.Background(), fsys, "dir1/", "", "", "", 1000, getVersionsTestFunc, []string{})
|
||||
if err != nil {
|
||||
t.Fatalf("order walk versions: %v", err)
|
||||
}
|
||||
compareVersionResultsOrdered("order versions no delimiter", res, expected, t)
|
||||
}
|
||||
|
||||
// compareVersionResults compares unordered sets of common prefixes and object versions
|
||||
// compareVersionResultsOrdered compares ordered slices
|
||||
func compareVersionResultsOrdered(name string, got, wanted backend.WalkVersioningResults, t *testing.T) {
|
||||
if !compareObjectVersionsOrdered(got.ObjectVersions, wanted.ObjectVersions) {
|
||||
t.Errorf("%v: unexpected object versions, got %v wanted %v", name, printVersionObjects(got.ObjectVersions), printVersionObjects(wanted.ObjectVersions))
|
||||
}
|
||||
if !comparePrefixesOrdered(got.CommonPrefixes, wanted.CommonPrefixes) {
|
||||
t.Errorf("%v: unexpected prefix, got %v wanted %v", name, printCommonPrefixes(got.CommonPrefixes), printCommonPrefixes(wanted.CommonPrefixes))
|
||||
}
|
||||
}
|
||||
|
||||
func compareObjectVersionsOrdered(a, b []s3response.ObjectVersion) bool {
|
||||
if len(a) == 0 && len(b) == 0 {
|
||||
return true
|
||||
}
|
||||
if len(a) != len(b) {
|
||||
return false
|
||||
}
|
||||
for i, ov := range a {
|
||||
if ov.Key == nil || b[i].Key == nil {
|
||||
return false
|
||||
}
|
||||
if *ov.Key != *b[i].Key {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
||||
|
||||
func printVersionObjects(list []s3response.ObjectVersion) string {
|
||||
res := "["
|
||||
for _, ov := range list {
|
||||
var key string
|
||||
if ov.Key == nil {
|
||||
key = "<nil>"
|
||||
} else {
|
||||
key = *ov.Key
|
||||
}
|
||||
if res == "[" {
|
||||
res = res + key
|
||||
} else {
|
||||
res = res + ", " + key
|
||||
}
|
||||
}
|
||||
return res + "]"
|
||||
}
|
||||
|
||||
// multiVersionGetVersionsFunc is a more sophisticated test function that simulates
|
||||
// multiple versions per object, similar to the integration test behavior.
|
||||
// It creates multiple versions for each file with deterministic version IDs.
|
||||
func createMultiVersionFunc(files map[string]int) backend.GetVersionsFunc {
|
||||
// Pre-generate all versions for deterministic testing
|
||||
versionedFiles := make(map[string][]s3response.ObjectVersion)
|
||||
|
||||
for path, versionCount := range files {
|
||||
versions := make([]s3response.ObjectVersion, versionCount)
|
||||
for i := range versionCount {
|
||||
versionId := fmt.Sprintf("v%d", i+1)
|
||||
isLatest := i == versionCount-1 // Last version is latest
|
||||
key := path
|
||||
|
||||
versions[i] = s3response.ObjectVersion{
|
||||
Key: &key,
|
||||
VersionId: &versionId,
|
||||
IsLatest: &isLatest,
|
||||
}
|
||||
}
|
||||
// Reverse slice so latest comes first (reverse chronological order)
|
||||
for i, j := 0, len(versions)-1; i < j; i, j = i+1, j-1 {
|
||||
versions[i], versions[j] = versions[j], versions[i]
|
||||
}
|
||||
versionedFiles[path] = versions
|
||||
}
|
||||
|
||||
return func(path, versionIdMarker string, pastVersionIdMarker *bool, availableObjCount int, d fs.DirEntry) (*backend.ObjVersionFuncResult, error) {
|
||||
if availableObjCount <= 0 {
|
||||
return &backend.ObjVersionFuncResult{Truncated: true}, nil
|
||||
}
|
||||
|
||||
// Handle directories - just return a single directory version
|
||||
if d.IsDir() {
|
||||
key := path + "/"
|
||||
ver := "v1"
|
||||
latest := true
|
||||
ov := s3response.ObjectVersion{Key: &key, VersionId: &ver, IsLatest: &latest}
|
||||
return &backend.ObjVersionFuncResult{ObjectVersions: []s3response.ObjectVersion{ov}}, nil
|
||||
}
|
||||
|
||||
// Get versions for this file
|
||||
versions, exists := versionedFiles[path]
|
||||
if !exists {
|
||||
// No versions for this file, skip it
|
||||
return &backend.ObjVersionFuncResult{}, backend.ErrSkipObj
|
||||
}
|
||||
|
||||
// Handle version ID marker pagination
|
||||
startIdx := 0
|
||||
if versionIdMarker != "" && !*pastVersionIdMarker {
|
||||
// Find the starting position after the marker
|
||||
for i, version := range versions {
|
||||
if *version.VersionId == versionIdMarker {
|
||||
startIdx = i + 1
|
||||
*pastVersionIdMarker = true
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Return available versions up to the limit
|
||||
endIdx := min(startIdx+availableObjCount, len(versions))
|
||||
|
||||
result := &backend.ObjVersionFuncResult{
|
||||
ObjectVersions: versions[startIdx:endIdx],
|
||||
}
|
||||
|
||||
// Check if we need to truncate
|
||||
if endIdx < len(versions) {
|
||||
result.Truncated = true
|
||||
result.NextVersionIdMarker = *versions[endIdx-1].VersionId
|
||||
}
|
||||
|
||||
return result, nil
|
||||
}
|
||||
}
|
||||
|
||||
// TestWalkVersionsTruncated tests the pagination behavior of WalkVersions
|
||||
// when there are multiple versions per object and the result is truncated.
|
||||
// This mirrors the integration test ListObjectVersions_multiple_object_versions_truncated.
|
||||
func TestWalkVersionsTruncated(t *testing.T) {
|
||||
// Create filesystem with the same files as integration test
|
||||
fsys := fstest.MapFS{
|
||||
"foo": {},
|
||||
"bar": {},
|
||||
"baz": {},
|
||||
}
|
||||
|
||||
// Define version counts per file (matching integration test)
|
||||
versionCounts := map[string]int{
|
||||
"foo": 4, // 4 versions
|
||||
"bar": 3, // 3 versions
|
||||
"baz": 5, // 5 versions
|
||||
}
|
||||
|
||||
getVersionsFunc := createMultiVersionFunc(versionCounts)
|
||||
|
||||
// Test first page with limit of 5 (should be truncated)
|
||||
maxKeys := 5
|
||||
res1, err := backend.WalkVersions(context.Background(), fsys, "", "", "", "", maxKeys, getVersionsFunc, []string{})
|
||||
if err != nil {
|
||||
t.Fatalf("walk versions first page: %v", err)
|
||||
}
|
||||
|
||||
// Verify first page results
|
||||
if !res1.Truncated {
|
||||
t.Error("expected first page to be truncated")
|
||||
}
|
||||
|
||||
if len(res1.ObjectVersions) != maxKeys {
|
||||
t.Errorf("expected %d versions in first page, got %d", maxKeys, len(res1.ObjectVersions))
|
||||
}
|
||||
|
||||
// Expected order: bar (3 versions), baz (2 versions) - lexicographic order
|
||||
expectedFirstPage := []string{"bar", "bar", "bar", "baz", "baz"}
|
||||
if len(res1.ObjectVersions) != len(expectedFirstPage) {
|
||||
t.Fatalf("first page length mismatch: expected %d, got %d", len(expectedFirstPage), len(res1.ObjectVersions))
|
||||
}
|
||||
|
||||
for i, expected := range expectedFirstPage {
|
||||
if res1.ObjectVersions[i].Key == nil || *res1.ObjectVersions[i].Key != expected {
|
||||
t.Errorf("first page[%d]: expected key %s, got %v", i, expected, res1.ObjectVersions[i].Key)
|
||||
}
|
||||
}
|
||||
|
||||
// Verify next markers are set
|
||||
if res1.NextMarker == "" {
|
||||
t.Error("expected NextMarker to be set on truncated result")
|
||||
}
|
||||
if res1.NextVersionIdMarker == "" {
|
||||
t.Error("expected NextVersionIdMarker to be set on truncated result")
|
||||
}
|
||||
|
||||
// Test second page using markers
|
||||
res2, err := backend.WalkVersions(context.Background(), fsys, "", "", res1.NextMarker, res1.NextVersionIdMarker, maxKeys, getVersionsFunc, []string{})
|
||||
if err != nil {
|
||||
t.Fatalf("walk versions second page: %v", err)
|
||||
}
|
||||
|
||||
t.Logf("Second page: ObjectVersions=%d, Truncated=%v, NextMarker=%s, NextVersionIdMarker=%s",
|
||||
len(res2.ObjectVersions), res2.Truncated, res2.NextMarker, res2.NextVersionIdMarker)
|
||||
|
||||
for i, ov := range res2.ObjectVersions {
|
||||
t.Logf(" [%d] Key=%s, VersionId=%s", i, *ov.Key, *ov.VersionId)
|
||||
}
|
||||
|
||||
// Verify second page results
|
||||
// With maxKeys=5, we should have 3 pages total: 5 + 5 + 2 = 12
|
||||
|
||||
// Test third page if needed
|
||||
var res3 backend.WalkVersioningResults
|
||||
if res2.Truncated {
|
||||
res3, err = backend.WalkVersions(context.Background(), fsys, "", "", res2.NextMarker, res2.NextVersionIdMarker, maxKeys, getVersionsFunc, []string{})
|
||||
if err != nil {
|
||||
t.Fatalf("walk versions third page: %v", err)
|
||||
}
|
||||
|
||||
t.Logf("Third page: ObjectVersions=%d, Truncated=%v, NextMarker=%s, NextVersionIdMarker=%s",
|
||||
len(res3.ObjectVersions), res3.Truncated, res3.NextMarker, res3.NextVersionIdMarker)
|
||||
|
||||
for i, ov := range res3.ObjectVersions {
|
||||
t.Logf(" [%d] Key=%s, VersionId=%s", i, *ov.Key, *ov.VersionId)
|
||||
}
|
||||
}
|
||||
|
||||
// Verify total count across all pages
|
||||
totalVersions := len(res1.ObjectVersions) + len(res2.ObjectVersions) + len(res3.ObjectVersions)
|
||||
expectedTotal := versionCounts["foo"] + versionCounts["bar"] + versionCounts["baz"]
|
||||
if totalVersions != expectedTotal {
|
||||
t.Errorf("total versions mismatch: expected %d, got %d", expectedTotal, totalVersions)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -19,20 +19,16 @@ import (
|
||||
"crypto/sha256"
|
||||
"crypto/tls"
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"encoding/xml"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"net/http"
|
||||
"os"
|
||||
"strings"
|
||||
"text/tabwriter"
|
||||
"time"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/aws"
|
||||
v4 "github.com/aws/aws-sdk-go-v2/aws/signer/v4"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/aws/smithy-go"
|
||||
"github.com/urfave/cli/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
@@ -86,11 +82,6 @@ func adminCommand() *cli.Command {
|
||||
Usage: "groupID for the new user",
|
||||
Aliases: []string{"gi"},
|
||||
},
|
||||
&cli.IntFlag{
|
||||
Name: "project-id",
|
||||
Usage: "projectID for the new user",
|
||||
Aliases: []string{"pi"},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
@@ -109,11 +100,6 @@ func adminCommand() *cli.Command {
|
||||
Usage: "secret access key for the new user",
|
||||
Aliases: []string{"s"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "role",
|
||||
Usage: "the new user role",
|
||||
Aliases: []string{"r"},
|
||||
},
|
||||
&cli.IntFlag{
|
||||
Name: "user-id",
|
||||
Usage: "userID for the new user",
|
||||
@@ -124,11 +110,6 @@ func adminCommand() *cli.Command {
|
||||
Usage: "groupID for the new user",
|
||||
Aliases: []string{"gi"},
|
||||
},
|
||||
&cli.IntFlag{
|
||||
Name: "project-id",
|
||||
Usage: "projectID for the new user",
|
||||
Aliases: []string{"pi"},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
@@ -173,66 +154,6 @@ func adminCommand() *cli.Command {
|
||||
Usage: "Lists all the gateway buckets and owners.",
|
||||
Action: listBuckets,
|
||||
},
|
||||
{
|
||||
Name: "create-bucket",
|
||||
Usage: "Create a new bucket with owner",
|
||||
Action: createBucket,
|
||||
Flags: []cli.Flag{
|
||||
&cli.StringFlag{
|
||||
Name: "owner",
|
||||
Usage: "access key id of the bucket owner",
|
||||
Required: true,
|
||||
Aliases: []string{"o"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "bucket",
|
||||
Usage: "bucket name",
|
||||
Required: true,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "acl",
|
||||
Usage: "canned ACL to apply to the bucket",
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "grant-full-control",
|
||||
Usage: "Allows grantee the read, write, read ACP, and write ACP permissions on the bucket.",
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "grant-read",
|
||||
Usage: "Allows grantee to list the objects in the bucket.",
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "grant-read-acp",
|
||||
Usage: "Allows grantee to read the bucket ACL.",
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "grant-write",
|
||||
Usage: `Allows grantee to create new objects in the bucket.
|
||||
For the bucket and object owners of existing objects, also allows deletions and overwrites of those objects.`,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "grant-write-acp",
|
||||
Usage: "Allows grantee to write the ACL for the applicable bucket.",
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "create-bucket-configuration",
|
||||
Usage: "bucket configuration (LocationConstraint, Tags)",
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "object-lock-enabled-for-bucket",
|
||||
Usage: "enable object lock for the bucket",
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "no-object-lock-enabled-for-bucket",
|
||||
Usage: "disable object lock for the bucket",
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "object-ownership",
|
||||
Usage: "bucket object ownership setting",
|
||||
Value: "",
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
Flags: []cli.Flag{
|
||||
// TODO: create a configuration file for this
|
||||
@@ -241,6 +162,7 @@ func adminCommand() *cli.Command {
|
||||
Usage: "admin access key id",
|
||||
EnvVars: []string{"ADMIN_ACCESS_KEY_ID", "ADMIN_ACCESS_KEY"},
|
||||
Aliases: []string{"a"},
|
||||
Required: true,
|
||||
Destination: &adminAccess,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
@@ -248,6 +170,7 @@ func adminCommand() *cli.Command {
|
||||
Usage: "admin secret access key",
|
||||
EnvVars: []string{"ADMIN_SECRET_ACCESS_KEY", "ADMIN_SECRET_KEY"},
|
||||
Aliases: []string{"s"},
|
||||
Required: true,
|
||||
Destination: &adminSecret,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
@@ -277,32 +200,6 @@ func adminCommand() *cli.Command {
|
||||
}
|
||||
}
|
||||
|
||||
// getAdminCreds returns the effective admin access key ID and secret key.
|
||||
// If admin-specific credentials are not provided, it falls back to the
|
||||
// root user credentials. Both resulting values must be non-empty;
|
||||
// otherwise, an error is returned.
|
||||
func getAdminCreds() (string, string, error) {
|
||||
access := adminAccess
|
||||
secret := adminSecret
|
||||
|
||||
// Fallbacks to root user credentials
|
||||
if access == "" {
|
||||
access = rootUserAccess
|
||||
}
|
||||
if secret == "" {
|
||||
secret = rootUserSecret
|
||||
}
|
||||
|
||||
if access == "" {
|
||||
return "", "", errors.New("subcommand admin access key id is not set")
|
||||
}
|
||||
if secret == "" {
|
||||
return "", "", errors.New("subcommand admin secret access key is not set")
|
||||
}
|
||||
|
||||
return access, secret, nil
|
||||
}
|
||||
|
||||
func initHTTPClient() *http.Client {
|
||||
tr := &http.Transport{
|
||||
TLSClientConfig: &tls.Config{InsecureSkipVerify: allowInsecure},
|
||||
@@ -311,12 +208,8 @@ func initHTTPClient() *http.Client {
|
||||
}
|
||||
|
||||
func createUser(ctx *cli.Context) error {
|
||||
adminAccess, adminSecret, err := getAdminCreds()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
access, secret, role := ctx.String("access"), ctx.String("secret"), ctx.String("role")
|
||||
userID, groupID, projectID := ctx.Int("user-id"), ctx.Int("group-id"), ctx.Int("project-id")
|
||||
userID, groupID := ctx.Int("user-id"), ctx.Int("group-id")
|
||||
if access == "" || secret == "" {
|
||||
return fmt.Errorf("invalid input parameters for the new user access/secret keys")
|
||||
}
|
||||
@@ -325,12 +218,11 @@ func createUser(ctx *cli.Context) error {
|
||||
}
|
||||
|
||||
acc := auth.Account{
|
||||
Access: access,
|
||||
Secret: secret,
|
||||
Role: auth.Role(role),
|
||||
UserID: userID,
|
||||
GroupID: groupID,
|
||||
ProjectID: projectID,
|
||||
Access: access,
|
||||
Secret: secret,
|
||||
Role: auth.Role(role),
|
||||
UserID: userID,
|
||||
GroupID: groupID,
|
||||
}
|
||||
|
||||
accxml, err := xml.Marshal(acc)
|
||||
@@ -376,10 +268,6 @@ func createUser(ctx *cli.Context) error {
|
||||
}
|
||||
|
||||
func deleteUser(ctx *cli.Context) error {
|
||||
adminAccess, adminSecret, err := getAdminCreds()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
access := ctx.String("access")
|
||||
if access == "" {
|
||||
return fmt.Errorf("invalid input parameter for the user access key")
|
||||
@@ -423,26 +311,8 @@ func deleteUser(ctx *cli.Context) error {
|
||||
}
|
||||
|
||||
func updateUser(ctx *cli.Context) error {
|
||||
adminAccess, adminSecret, err := getAdminCreds()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
access, secret, userId, groupId, projectID, role :=
|
||||
ctx.String("access"),
|
||||
ctx.String("secret"),
|
||||
ctx.Int("user-id"),
|
||||
ctx.Int("group-id"),
|
||||
ctx.Int("projectID"),
|
||||
auth.Role(ctx.String("role"))
|
||||
|
||||
access, secret, userId, groupId := ctx.String("access"), ctx.String("secret"), ctx.Int("user-id"), ctx.Int("group-id")
|
||||
props := auth.MutableProps{}
|
||||
if ctx.IsSet("role") {
|
||||
if !role.IsValid() {
|
||||
return fmt.Errorf("invalid user role: %v", role)
|
||||
}
|
||||
props.Role = role
|
||||
}
|
||||
if ctx.IsSet("secret") {
|
||||
props.Secret = &secret
|
||||
}
|
||||
@@ -452,9 +322,6 @@ func updateUser(ctx *cli.Context) error {
|
||||
if ctx.IsSet("group-id") {
|
||||
props.GroupID = &groupId
|
||||
}
|
||||
if ctx.IsSet("project-id") {
|
||||
props.ProjectID = &projectID
|
||||
}
|
||||
|
||||
propsxml, err := xml.Marshal(props)
|
||||
if err != nil {
|
||||
@@ -499,11 +366,6 @@ func updateUser(ctx *cli.Context) error {
|
||||
}
|
||||
|
||||
func listUsers(ctx *cli.Context) error {
|
||||
adminAccess, adminSecret, err := getAdminCreds()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
req, err := http.NewRequest(http.MethodPatch, fmt.Sprintf("%v/list-users", adminEndpoint), nil)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to send the request: %w", err)
|
||||
@@ -548,251 +410,6 @@ func listUsers(ctx *cli.Context) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
type createBucketInput struct {
|
||||
LocationConstraint *string
|
||||
Tags []types.Tag
|
||||
}
|
||||
|
||||
// parseCreateBucketPayload parses the
|
||||
func parseCreateBucketPayload(input string) ([]byte, error) {
|
||||
input = strings.TrimSpace(input)
|
||||
if input == "" {
|
||||
return []byte{}, nil
|
||||
}
|
||||
|
||||
// try to parse as json, if the input starts with '{'
|
||||
if input[0] == '{' {
|
||||
var raw createBucketInput
|
||||
err := json.Unmarshal([]byte(input), &raw)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("invalid JSON input: %w", err)
|
||||
}
|
||||
|
||||
return xml.Marshal(s3response.CreateBucketConfiguration{
|
||||
LocationConstraint: raw.LocationConstraint,
|
||||
TagSet: raw.Tags,
|
||||
})
|
||||
}
|
||||
|
||||
var config s3response.CreateBucketConfiguration
|
||||
|
||||
// parse as string - shorthand syntax
|
||||
inputParts, err := splitTopLevel(input)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, part := range inputParts {
|
||||
part = strings.TrimSpace(part)
|
||||
if strings.HasPrefix(part, "LocationConstraint=") {
|
||||
locConstraint := strings.TrimPrefix(part, "LocationConstraint=")
|
||||
config.LocationConstraint = &locConstraint
|
||||
} else if strings.HasPrefix(part, "Tags=") {
|
||||
tags, err := parseTagging(strings.TrimPrefix(part, "Tags="))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
config.TagSet = tags
|
||||
} else {
|
||||
return nil, fmt.Errorf("invalid component: %v", part)
|
||||
}
|
||||
}
|
||||
|
||||
return xml.Marshal(config)
|
||||
}
|
||||
|
||||
var errInvalidTagsSyntax = errors.New("invalid tags syntax")
|
||||
|
||||
// splitTopLevel splits a shorthand configuration string into top-level components.
|
||||
// The function splits only on commas that are not nested inside '{}' or '[]'.
|
||||
func splitTopLevel(s string) ([]string, error) {
|
||||
var parts []string
|
||||
start := 0
|
||||
depth := 0
|
||||
|
||||
for i, r := range s {
|
||||
switch r {
|
||||
case '{', '[':
|
||||
depth++
|
||||
case '}', ']':
|
||||
depth--
|
||||
case ',':
|
||||
if depth == 0 {
|
||||
parts = append(parts, s[start:i])
|
||||
start = i + 1
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if depth != 0 {
|
||||
return nil, errors.New("invalid string format")
|
||||
}
|
||||
|
||||
// add last segment
|
||||
if start < len(s) {
|
||||
parts = append(parts, s[start:])
|
||||
}
|
||||
|
||||
return parts, nil
|
||||
}
|
||||
|
||||
// parseTagging parses a tag set expressed in shorthand syntax into AWS CLI tags.
|
||||
// Expected format:
|
||||
//
|
||||
// [{Key=string,Value=string},{Key=string,Value=string}]
|
||||
//
|
||||
// The function validates bracket structure, splits tag objects at the top level,
|
||||
// and delegates individual tag parsing to parseTag. It returns an error if the
|
||||
// syntax is invalid or if any tag entry cannot be parsed.
|
||||
func parseTagging(input string) ([]types.Tag, error) {
|
||||
if len(input) < 2 {
|
||||
return nil, errInvalidTagsSyntax
|
||||
}
|
||||
|
||||
if input[0] != '[' || input[len(input)-1] != ']' {
|
||||
return nil, errInvalidTagsSyntax
|
||||
}
|
||||
// strip []
|
||||
input = input[1 : len(input)-1]
|
||||
|
||||
tagComponents, err := splitTopLevel(input)
|
||||
if err != nil {
|
||||
return nil, errInvalidTagsSyntax
|
||||
}
|
||||
result := make([]types.Tag, 0, len(tagComponents))
|
||||
for _, tagComponent := range tagComponents {
|
||||
tagComponent = strings.TrimSpace(tagComponent)
|
||||
tag, err := parseTag(tagComponent)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
result = append(result, tag)
|
||||
}
|
||||
|
||||
return result, nil
|
||||
}
|
||||
|
||||
// parseTag parses a single tag definition in shorthand form.
|
||||
// Expected format:
|
||||
//
|
||||
// {Key=string,Value=string}
|
||||
func parseTag(input string) (types.Tag, error) {
|
||||
input = strings.TrimSpace(input)
|
||||
|
||||
if len(input) < 2 {
|
||||
return types.Tag{}, errInvalidTagsSyntax
|
||||
}
|
||||
|
||||
if input[0] != '{' || input[len(input)-1] != '}' {
|
||||
return types.Tag{}, errInvalidTagsSyntax
|
||||
}
|
||||
|
||||
// strip {}
|
||||
input = input[1 : len(input)-1]
|
||||
|
||||
components := strings.Split(input, ",")
|
||||
if len(components) != 2 {
|
||||
return types.Tag{}, errInvalidTagsSyntax
|
||||
}
|
||||
|
||||
var key, value string
|
||||
|
||||
for _, c := range components {
|
||||
c = strings.TrimSpace(c)
|
||||
|
||||
switch {
|
||||
case strings.HasPrefix(c, "Key="):
|
||||
key = strings.TrimPrefix(c, "Key=")
|
||||
case strings.HasPrefix(c, "Value="):
|
||||
value = strings.TrimPrefix(c, "Value=")
|
||||
default:
|
||||
return types.Tag{}, errInvalidTagsSyntax
|
||||
}
|
||||
}
|
||||
|
||||
if key == "" {
|
||||
return types.Tag{}, errInvalidTagsSyntax
|
||||
}
|
||||
|
||||
return types.Tag{
|
||||
Key: &key,
|
||||
Value: &value,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func createBucket(ctx *cli.Context) error {
|
||||
adminAccess, adminSecret, err := getAdminCreds()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
bucket, owner := ctx.String("bucket"), ctx.String("owner")
|
||||
|
||||
payload, err := parseCreateBucketPayload(ctx.String("create-bucket-configuration"))
|
||||
if err != nil {
|
||||
return fmt.Errorf("invalid create bucket configuration: %w", err)
|
||||
}
|
||||
|
||||
hashedPayload := sha256.Sum256(payload)
|
||||
hexPayload := hex.EncodeToString(hashedPayload[:])
|
||||
|
||||
headers := map[string]string{
|
||||
"x-amz-content-sha256": hexPayload,
|
||||
"x-vgw-owner": owner,
|
||||
"x-amz-acl": ctx.String("acl"),
|
||||
"x-amz-grant-full-control": ctx.String("grant-full-control"),
|
||||
"x-amz-grant-read": ctx.String("grant-read"),
|
||||
"x-amz-grant-read-acp": ctx.String("grant-read-acp"),
|
||||
"x-amz-grant-write": ctx.String("grant-write"),
|
||||
"x-amz-grant-write-acp": ctx.String("grant-write-acp"),
|
||||
"x-amz-object-ownership": ctx.String("object-ownership"),
|
||||
}
|
||||
|
||||
if ctx.Bool("object-lock-enabled-for-bucket") {
|
||||
headers["x-amz-bucket-object-lock-enabled"] = "true"
|
||||
}
|
||||
if ctx.Bool("no-object-lock-enabled-for-bucket") {
|
||||
headers["x-amz-bucket-object-lock-enabled"] = "false"
|
||||
}
|
||||
|
||||
req, err := http.NewRequestWithContext(ctx.Context, http.MethodPatch, fmt.Sprintf("%s/%s/create", adminEndpoint, bucket), bytes.NewReader(payload))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
for key, value := range headers {
|
||||
if value != "" {
|
||||
req.Header.Set(key, value)
|
||||
}
|
||||
}
|
||||
|
||||
signer := v4.NewSigner()
|
||||
err = signer.SignHTTP(req.Context(), aws.Credentials{AccessKeyID: adminAccess, SecretAccessKey: adminSecret}, req, hexPayload, "s3", adminRegion, time.Now())
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to sign the request: %w", err)
|
||||
}
|
||||
|
||||
client := initHTTPClient()
|
||||
|
||||
resp, err := client.Do(req)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to send the request: %w", err)
|
||||
}
|
||||
defer resp.Body.Close()
|
||||
|
||||
body, err := io.ReadAll(resp.Body)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if resp.StatusCode >= 400 {
|
||||
return parseApiError(body)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
const (
|
||||
// account table formatting
|
||||
minwidth int = 2 // minimal cell width including any padding
|
||||
@@ -805,21 +422,16 @@ const (
|
||||
func printAcctTable(accs []auth.Account) {
|
||||
w := new(tabwriter.Writer)
|
||||
w.Init(os.Stdout, minwidth, tabwidth, padding, padchar, flags)
|
||||
fmt.Fprintln(w, "Account\tRole\tUserID\tGroupID\tProjectID")
|
||||
fmt.Fprintln(w, "-------\t----\t------\t-------\t---------")
|
||||
fmt.Fprintln(w, "Account\tRole\tUserID\tGroupID")
|
||||
fmt.Fprintln(w, "-------\t----\t------\t-------")
|
||||
for _, acc := range accs {
|
||||
fmt.Fprintf(w, "%v\t%v\t%v\t%v\t%v\n", acc.Access, acc.Role, acc.UserID, acc.GroupID, acc.ProjectID)
|
||||
fmt.Fprintf(w, "%v\t%v\t%v\t%v\n", acc.Access, acc.Role, acc.UserID, acc.GroupID)
|
||||
}
|
||||
fmt.Fprintln(w)
|
||||
w.Flush()
|
||||
}
|
||||
|
||||
func changeBucketOwner(ctx *cli.Context) error {
|
||||
adminAccess, adminSecret, err := getAdminCreds()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
bucket, owner := ctx.String("bucket"), ctx.String("owner")
|
||||
req, err := http.NewRequest(http.MethodPatch, fmt.Sprintf("%v/change-bucket-owner/?bucket=%v&owner=%v", adminEndpoint, bucket, owner), nil)
|
||||
if err != nil {
|
||||
@@ -871,11 +483,6 @@ func printBuckets(buckets []s3response.Bucket) {
|
||||
}
|
||||
|
||||
func listBuckets(ctx *cli.Context) error {
|
||||
adminAccess, adminSecret, err := getAdminCreds()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
req, err := http.NewRequest(http.MethodPatch, fmt.Sprintf("%v/list-buckets", adminEndpoint), nil)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to send the request: %w", err)
|
||||
|
||||
@@ -16,84 +16,67 @@ package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"crypto/tls"
|
||||
"fmt"
|
||||
"log"
|
||||
"net"
|
||||
"net/http"
|
||||
_ "net/http/pprof"
|
||||
"os"
|
||||
"strconv"
|
||||
"strings"
|
||||
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/urfave/cli/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/metrics"
|
||||
"github.com/versity/versitygw/s3api"
|
||||
"github.com/versity/versitygw/s3api/middlewares"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3event"
|
||||
"github.com/versity/versitygw/s3log"
|
||||
"github.com/versity/versitygw/webui"
|
||||
)
|
||||
|
||||
var (
|
||||
port, admPort string
|
||||
rootUserAccess string
|
||||
rootUserSecret string
|
||||
region string
|
||||
corsAllowOrigin string
|
||||
admCertFile, admKeyFile string
|
||||
certFile, keyFile string
|
||||
kafkaURL, kafkaTopic, kafkaKey string
|
||||
natsURL, natsTopic string
|
||||
rabbitmqURL, rabbitmqExchange string
|
||||
rabbitmqRoutingKey string
|
||||
eventWebhookURL string
|
||||
eventConfigFilePath string
|
||||
logWebhookURL, accessLog string
|
||||
adminLogFile string
|
||||
healthPath string
|
||||
virtualDomain string
|
||||
debug bool
|
||||
keepAlive bool
|
||||
pprof string
|
||||
quiet bool
|
||||
readonly bool
|
||||
disableStrictBucketNames bool
|
||||
iamDir string
|
||||
ldapURL, ldapBindDN, ldapPassword string
|
||||
ldapQueryBase, ldapObjClasses string
|
||||
ldapAccessAtr, ldapSecAtr, ldapRoleAtr string
|
||||
ldapUserIdAtr, ldapGroupIdAtr string
|
||||
ldapProjectIdAtr string
|
||||
ldapTLSSkipVerify bool
|
||||
vaultEndpointURL, vaultNamespace string
|
||||
vaultSecretStoragePath string
|
||||
vaultSecretStorageNamespace string
|
||||
vaultAuthMethod, vaultAuthNamespace string
|
||||
vaultMountPath string
|
||||
vaultRootToken, vaultRoleId string
|
||||
vaultRoleSecret, vaultServerCert string
|
||||
vaultClientCert, vaultClientCertKey string
|
||||
s3IamAccess, s3IamSecret string
|
||||
s3IamRegion, s3IamBucket string
|
||||
s3IamEndpoint string
|
||||
s3IamSslNoVerify bool
|
||||
iamCacheDisable bool
|
||||
iamCacheTTL int
|
||||
iamCachePrune int
|
||||
metricsService string
|
||||
statsdServers string
|
||||
dogstatsServers string
|
||||
ipaHost, ipaVaultName string
|
||||
ipaUser, ipaPassword string
|
||||
ipaInsecure bool
|
||||
iamDebug bool
|
||||
webuiAddr string
|
||||
webuiCertFile, webuiKeyFile string
|
||||
webuiNoTLS bool
|
||||
port, admPort string
|
||||
rootUserAccess string
|
||||
rootUserSecret string
|
||||
region string
|
||||
admCertFile, admKeyFile string
|
||||
certFile, keyFile string
|
||||
kafkaURL, kafkaTopic, kafkaKey string
|
||||
natsURL, natsTopic string
|
||||
eventWebhookURL string
|
||||
eventConfigFilePath string
|
||||
logWebhookURL, accessLog string
|
||||
adminLogFile string
|
||||
healthPath string
|
||||
debug bool
|
||||
pprof string
|
||||
quiet bool
|
||||
readonly bool
|
||||
iamDir string
|
||||
ldapURL, ldapBindDN, ldapPassword string
|
||||
ldapQueryBase, ldapObjClasses string
|
||||
ldapAccessAtr, ldapSecAtr, ldapRoleAtr string
|
||||
ldapUserIdAtr, ldapGroupIdAtr string
|
||||
vaultEndpointURL, vaultSecretStoragePath string
|
||||
vaultMountPath, vaultRootToken string
|
||||
vaultRoleId, vaultRoleSecret string
|
||||
vaultServerCert, vaultClientCert string
|
||||
vaultClientCertKey string
|
||||
s3IamAccess, s3IamSecret string
|
||||
s3IamRegion, s3IamBucket string
|
||||
s3IamEndpoint string
|
||||
s3IamSslNoVerify, s3IamDebug bool
|
||||
iamCacheDisable bool
|
||||
iamCacheTTL int
|
||||
iamCachePrune int
|
||||
metricsService string
|
||||
statsdServers string
|
||||
dogstatsServers string
|
||||
ipaHost, ipaVaultName string
|
||||
ipaUser, ipaPassword string
|
||||
ipaInsecure, ipaDebug bool
|
||||
)
|
||||
|
||||
var (
|
||||
@@ -171,30 +154,6 @@ func initFlags() []cli.Flag {
|
||||
Destination: &port,
|
||||
Aliases: []string{"p"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "webui",
|
||||
Usage: "enable WebUI server on the specified listen address (e.g. ':7071', '127.0.0.1:7071', 'localhost:7071'; disabled when omitted)",
|
||||
EnvVars: []string{"VGW_WEBUI_PORT"},
|
||||
Destination: &webuiAddr,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "webui-cert",
|
||||
Usage: "TLS cert file for WebUI (defaults to --cert value when WebUI is enabled)",
|
||||
EnvVars: []string{"VGW_WEBUI_CERT"},
|
||||
Destination: &webuiCertFile,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "webui-key",
|
||||
Usage: "TLS key file for WebUI (defaults to --key value when WebUI is enabled)",
|
||||
EnvVars: []string{"VGW_WEBUI_KEY"},
|
||||
Destination: &webuiKeyFile,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "webui-no-tls",
|
||||
Usage: "disable TLS for WebUI even if TLS is configured for the gateway",
|
||||
EnvVars: []string{"VGW_WEBUI_NO_TLS"},
|
||||
Destination: &webuiNoTLS,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "access",
|
||||
Usage: "root user access key",
|
||||
@@ -217,12 +176,6 @@ func initFlags() []cli.Flag {
|
||||
Destination: ®ion,
|
||||
Aliases: []string{"r"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "cors-allow-origin",
|
||||
Usage: "default CORS Access-Control-Allow-Origin value (applied when no bucket CORS configuration exists, and for admin APIs)",
|
||||
EnvVars: []string{"VGW_CORS_ALLOW_ORIGIN"},
|
||||
Destination: &corsAllowOrigin,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "cert",
|
||||
Usage: "TLS cert file",
|
||||
@@ -267,12 +220,6 @@ func initFlags() []cli.Flag {
|
||||
EnvVars: []string{"VGW_PPROF"},
|
||||
Destination: &pprof,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "keep-alive",
|
||||
Usage: "enable keep-alive connections (for finnicky clients)",
|
||||
EnvVars: []string{"VGW_KEEP_ALIVE"},
|
||||
Destination: &keepAlive,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "quiet",
|
||||
Usage: "silence stdout request logging output",
|
||||
@@ -280,13 +227,6 @@ func initFlags() []cli.Flag {
|
||||
Destination: &quiet,
|
||||
Aliases: []string{"q"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "virtual-domain",
|
||||
Usage: "enables the virtual host style bucket addressing with the specified arg as the base domain",
|
||||
EnvVars: []string{"VGW_VIRTUAL_DOMAIN"},
|
||||
Destination: &virtualDomain,
|
||||
Aliases: []string{"vd"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "access-log",
|
||||
Usage: "enable server access logging to specified file",
|
||||
@@ -340,27 +280,6 @@ func initFlags() []cli.Flag {
|
||||
Destination: &natsTopic,
|
||||
Aliases: []string{"ent"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "event-rabbitmq-url",
|
||||
Usage: "rabbitmq server url to send the bucket notifications (amqp or amqps scheme)",
|
||||
EnvVars: []string{"VGW_EVENT_RABBITMQ_URL"},
|
||||
Destination: &rabbitmqURL,
|
||||
Aliases: []string{"eru"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "event-rabbitmq-exchange",
|
||||
Usage: "rabbitmq exchange to publish bucket notifications to (blank for default)",
|
||||
EnvVars: []string{"VGW_EVENT_RABBITMQ_EXCHANGE"},
|
||||
Destination: &rabbitmqExchange,
|
||||
Aliases: []string{"ere"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "event-rabbitmq-routing-key",
|
||||
Usage: "rabbitmq routing key when publishing bucket notifications (defaults to bucket name when blank)",
|
||||
EnvVars: []string{"VGW_EVENT_RABBITMQ_ROUTING_KEY"},
|
||||
Destination: &rabbitmqRoutingKey,
|
||||
Aliases: []string{"errk"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "event-webhook-url",
|
||||
Usage: "webhook url to send bucket notifications",
|
||||
@@ -441,54 +360,18 @@ func initFlags() []cli.Flag {
|
||||
EnvVars: []string{"VGW_IAM_LDAP_GROUP_ID_ATR"},
|
||||
Destination: &ldapGroupIdAtr,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-ldap-project-id-atr",
|
||||
Usage: "ldap server user project id attribute name",
|
||||
EnvVars: []string{"VGW_IAM_LDAP_PROJECT_ID_ATR"},
|
||||
Destination: &ldapProjectIdAtr,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "iam-ldap-tls-skip-verify",
|
||||
Usage: "disable TLS certificate verification for LDAP connections (insecure, for self-signed certificates)",
|
||||
EnvVars: []string{"VGW_IAM_LDAP_TLS_SKIP_VERIFY"},
|
||||
Destination: &ldapTLSSkipVerify,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-vault-endpoint-url",
|
||||
Usage: "vault server url",
|
||||
EnvVars: []string{"VGW_IAM_VAULT_ENDPOINT_URL"},
|
||||
Destination: &vaultEndpointURL,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-vault-namespace",
|
||||
Usage: "vault server namespace",
|
||||
EnvVars: []string{"VGW_IAM_VAULT_NAMESPACE"},
|
||||
Destination: &vaultNamespace,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-vault-secret-storage-path",
|
||||
Usage: "vault server secret storage path",
|
||||
EnvVars: []string{"VGW_IAM_VAULT_SECRET_STORAGE_PATH"},
|
||||
Destination: &vaultSecretStoragePath,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-vault-secret-storage-namespace",
|
||||
Usage: "vault server secret storage namespace",
|
||||
EnvVars: []string{"VGW_IAM_VAULT_SECRET_STORAGE_NAMESPACE"},
|
||||
Destination: &vaultSecretStorageNamespace,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-vault-auth-method",
|
||||
Usage: "vault server auth method",
|
||||
EnvVars: []string{"VGW_IAM_VAULT_AUTH_METHOD"},
|
||||
Destination: &vaultAuthMethod,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-vault-auth-namespace",
|
||||
Usage: "vault server auth namespace",
|
||||
EnvVars: []string{"VGW_IAM_VAULT_AUTH_NAMESPACE"},
|
||||
Destination: &vaultAuthNamespace,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "iam-vault-mount-path",
|
||||
Usage: "vault server mount path",
|
||||
@@ -568,6 +451,12 @@ func initFlags() []cli.Flag {
|
||||
EnvVars: []string{"VGW_S3_IAM_NO_VERIFY"},
|
||||
Destination: &s3IamSslNoVerify,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "s3-iam-debug",
|
||||
Usage: "s3 IAM debug output",
|
||||
EnvVars: []string{"VGW_S3_IAM_DEBUG"},
|
||||
Destination: &s3IamDebug,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "iam-cache-disable",
|
||||
Usage: "disable local iam cache",
|
||||
@@ -588,13 +477,6 @@ func initFlags() []cli.Flag {
|
||||
Value: 3600,
|
||||
Destination: &iamCachePrune,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "iam-debug",
|
||||
Usage: "enable IAM debug output",
|
||||
Value: false,
|
||||
EnvVars: []string{"VGW_IAM_DEBUG"},
|
||||
Destination: &iamDebug,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "health",
|
||||
Usage: `health check endpoint path. Health endpoint will be configured on GET http method: GET <health>
|
||||
@@ -608,12 +490,6 @@ func initFlags() []cli.Flag {
|
||||
EnvVars: []string{"VGW_READ_ONLY"},
|
||||
Destination: &readonly,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "disable-strict-bucket-names",
|
||||
Usage: "allow relaxed bucket naming (disables strict validation checks)",
|
||||
EnvVars: []string{"VGW_DISABLE_STRICT_BUCKET_NAMES"},
|
||||
Destination: &disableStrictBucketNames,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "metrics-service-name",
|
||||
Usage: "service name tag for metrics, hostname if blank",
|
||||
@@ -649,22 +525,28 @@ func initFlags() []cli.Flag {
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "ipa-user",
|
||||
Usage: "Username used to connect to FreeIPA (requires permissions to read user vault contents)",
|
||||
Usage: "Username used to connect to FreeIPA. Needs permissions to read user vault contents",
|
||||
EnvVars: []string{"VGW_IPA_USER"},
|
||||
Destination: &ipaUser,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "ipa-password",
|
||||
Usage: "Password of the user used to connect to FreeIPA",
|
||||
Usage: "Password of the user used to connect to FreeIPA.",
|
||||
EnvVars: []string{"VGW_IPA_PASSWORD"},
|
||||
Destination: &ipaPassword,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "ipa-insecure",
|
||||
Usage: "Disable verify TLS certificate of FreeIPA server",
|
||||
Usage: "Verify TLS certificate of FreeIPA server. Default is 'true'.",
|
||||
EnvVars: []string{"VGW_IPA_INSECURE"},
|
||||
Destination: &ipaInsecure,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "ipa-debug",
|
||||
Usage: "FreeIPA IAM debug output",
|
||||
EnvVars: []string{"VGW_IPA_DEBUG"},
|
||||
Destination: &ipaDebug,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
@@ -673,44 +555,6 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
return fmt.Errorf("root user access and secret key must be provided")
|
||||
}
|
||||
|
||||
webuiAddr = strings.TrimSpace(webuiAddr)
|
||||
if webuiAddr != "" && isAllDigits(webuiAddr) {
|
||||
webuiAddr = ":" + webuiAddr
|
||||
}
|
||||
|
||||
// WebUI runs in a browser and typically talks to the gateway/admin APIs cross-origin
|
||||
// (different port). If no bucket CORS configuration exists, those API responses need
|
||||
// a default Access-Control-Allow-Origin to be usable from the WebUI.
|
||||
if webuiAddr != "" && strings.TrimSpace(corsAllowOrigin) == "" {
|
||||
// A single Access-Control-Allow-Origin value cannot cover multiple specific
|
||||
// origins. Default to '*' for usability and print a warning so operators can
|
||||
// lock it down explicitly.
|
||||
corsAllowOrigin = "*"
|
||||
webuiScheme := "http"
|
||||
if !webuiNoTLS && (strings.TrimSpace(webuiCertFile) != "" || strings.TrimSpace(certFile) != "") {
|
||||
webuiScheme = "https"
|
||||
}
|
||||
|
||||
// Suggest a more secure explicit origin based on the actual WebUI listening interfaces.
|
||||
// (Browsers require an exact origin match; this is typically one chosen hostname/IP.)
|
||||
var suggestion string
|
||||
ips, ipsErr := getMatchingIPs(webuiAddr)
|
||||
_, webPrt, prtErr := net.SplitHostPort(webuiAddr)
|
||||
if ipsErr == nil && prtErr == nil && len(ips) > 0 {
|
||||
origins := make([]string, 0, len(ips))
|
||||
for _, ip := range ips {
|
||||
origins = append(origins, fmt.Sprintf("%s://%s:%s", webuiScheme, ip, webPrt))
|
||||
}
|
||||
suggestion = fmt.Sprintf("consider setting it to one of: %s (or your public hostname)", strings.Join(origins, ", "))
|
||||
} else {
|
||||
suggestion = fmt.Sprintf("consider setting it to %s://<host>:<port>", webuiScheme)
|
||||
}
|
||||
|
||||
fmt.Fprintf(os.Stderr, "WARNING: --webui is enabled but --cors-allow-origin is not set; defaulting to '*'; %s\n", suggestion)
|
||||
}
|
||||
|
||||
utils.SetBucketNameValidationStrict(!disableStrictBucketNames)
|
||||
|
||||
if pprof != "" {
|
||||
// listen on specified port for pprof debug
|
||||
// point browser to http://<ip:port>/debug/pprof/
|
||||
@@ -719,10 +563,16 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
}()
|
||||
}
|
||||
|
||||
app := fiber.New(fiber.Config{
|
||||
AppName: "versitygw",
|
||||
ServerHeader: "VERSITYGW",
|
||||
StreamRequestBody: true,
|
||||
DisableKeepalive: true,
|
||||
Network: fiber.NetworkTCP,
|
||||
DisableStartupMessage: true,
|
||||
})
|
||||
|
||||
var opts []s3api.Option
|
||||
if corsAllowOrigin != "" {
|
||||
opts = append(opts, s3api.WithCORSAllowOrigin(corsAllowOrigin))
|
||||
}
|
||||
|
||||
if certFile != "" || keyFile != "" {
|
||||
if certFile == "" {
|
||||
@@ -732,12 +582,14 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
return fmt.Errorf("TLS cert specified without key file")
|
||||
}
|
||||
|
||||
cs := utils.NewCertStorage()
|
||||
err := cs.SetCertificate(certFile, keyFile)
|
||||
cert, err := tls.LoadX509KeyPair(certFile, keyFile)
|
||||
if err != nil {
|
||||
return fmt.Errorf("tls: load certs: %v", err)
|
||||
}
|
||||
opts = append(opts, s3api.WithTLS(cs))
|
||||
opts = append(opts, s3api.WithTLS(cert))
|
||||
}
|
||||
if debug {
|
||||
opts = append(opts, s3api.WithDebug())
|
||||
}
|
||||
if admPort == "" {
|
||||
opts = append(opts, s3api.WithAdminServer())
|
||||
@@ -751,17 +603,29 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
if readonly {
|
||||
opts = append(opts, s3api.WithReadOnly())
|
||||
}
|
||||
if virtualDomain != "" {
|
||||
opts = append(opts, s3api.WithHostStyle(virtualDomain))
|
||||
}
|
||||
if keepAlive {
|
||||
opts = append(opts, s3api.WithKeepAlive())
|
||||
}
|
||||
if debug {
|
||||
debuglogger.SetDebugEnabled()
|
||||
}
|
||||
if iamDebug {
|
||||
debuglogger.SetIAMDebugEnabled()
|
||||
|
||||
admApp := fiber.New(fiber.Config{
|
||||
AppName: "versitygw",
|
||||
ServerHeader: "VERSITYGW",
|
||||
Network: fiber.NetworkTCP,
|
||||
DisableStartupMessage: true,
|
||||
})
|
||||
|
||||
var admOpts []s3api.AdminOpt
|
||||
|
||||
if admCertFile != "" || admKeyFile != "" {
|
||||
if admCertFile == "" {
|
||||
return fmt.Errorf("TLS key specified without cert file")
|
||||
}
|
||||
if admKeyFile == "" {
|
||||
return fmt.Errorf("TLS cert specified without key file")
|
||||
}
|
||||
|
||||
cert, err := tls.LoadX509KeyPair(admCertFile, admKeyFile)
|
||||
if err != nil {
|
||||
return fmt.Errorf("tls: load certs: %v", err)
|
||||
}
|
||||
admOpts = append(admOpts, s3api.WithAdminSrvTLS(cert))
|
||||
}
|
||||
|
||||
iam, err := auth.New(&auth.Opts{
|
||||
@@ -770,46 +634,42 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
Secret: rootUserSecret,
|
||||
Role: auth.RoleAdmin,
|
||||
},
|
||||
Dir: iamDir,
|
||||
LDAPServerURL: ldapURL,
|
||||
LDAPBindDN: ldapBindDN,
|
||||
LDAPPassword: ldapPassword,
|
||||
LDAPQueryBase: ldapQueryBase,
|
||||
LDAPObjClasses: ldapObjClasses,
|
||||
LDAPAccessAtr: ldapAccessAtr,
|
||||
LDAPSecretAtr: ldapSecAtr,
|
||||
LDAPRoleAtr: ldapRoleAtr,
|
||||
LDAPUserIdAtr: ldapUserIdAtr,
|
||||
LDAPGroupIdAtr: ldapGroupIdAtr,
|
||||
LDAPProjectIdAtr: ldapProjectIdAtr,
|
||||
LDAPTLSSkipVerify: ldapTLSSkipVerify,
|
||||
VaultEndpointURL: vaultEndpointURL,
|
||||
VaultNamespace: vaultNamespace,
|
||||
VaultSecretStoragePath: vaultSecretStoragePath,
|
||||
VaultSecretStorageNamespace: vaultSecretStorageNamespace,
|
||||
VaultAuthMethod: vaultAuthMethod,
|
||||
VaultAuthNamespace: vaultAuthNamespace,
|
||||
VaultMountPath: vaultMountPath,
|
||||
VaultRootToken: vaultRootToken,
|
||||
VaultRoleId: vaultRoleId,
|
||||
VaultRoleSecret: vaultRoleSecret,
|
||||
VaultServerCert: vaultServerCert,
|
||||
VaultClientCert: vaultClientCert,
|
||||
VaultClientCertKey: vaultClientCertKey,
|
||||
S3Access: s3IamAccess,
|
||||
S3Secret: s3IamSecret,
|
||||
S3Region: s3IamRegion,
|
||||
S3Bucket: s3IamBucket,
|
||||
S3Endpoint: s3IamEndpoint,
|
||||
S3DisableSSlVerfiy: s3IamSslNoVerify,
|
||||
CacheDisable: iamCacheDisable,
|
||||
CacheTTL: iamCacheTTL,
|
||||
CachePrune: iamCachePrune,
|
||||
IpaHost: ipaHost,
|
||||
IpaVaultName: ipaVaultName,
|
||||
IpaUser: ipaUser,
|
||||
IpaPassword: ipaPassword,
|
||||
IpaInsecure: ipaInsecure,
|
||||
Dir: iamDir,
|
||||
LDAPServerURL: ldapURL,
|
||||
LDAPBindDN: ldapBindDN,
|
||||
LDAPPassword: ldapPassword,
|
||||
LDAPQueryBase: ldapQueryBase,
|
||||
LDAPObjClasses: ldapObjClasses,
|
||||
LDAPAccessAtr: ldapAccessAtr,
|
||||
LDAPSecretAtr: ldapSecAtr,
|
||||
LDAPRoleAtr: ldapRoleAtr,
|
||||
LDAPUserIdAtr: ldapUserIdAtr,
|
||||
LDAPGroupIdAtr: ldapGroupIdAtr,
|
||||
VaultEndpointURL: vaultEndpointURL,
|
||||
VaultSecretStoragePath: vaultSecretStoragePath,
|
||||
VaultMountPath: vaultMountPath,
|
||||
VaultRootToken: vaultRootToken,
|
||||
VaultRoleId: vaultRoleId,
|
||||
VaultRoleSecret: vaultRoleSecret,
|
||||
VaultServerCert: vaultServerCert,
|
||||
VaultClientCert: vaultClientCert,
|
||||
VaultClientCertKey: vaultClientCertKey,
|
||||
S3Access: s3IamAccess,
|
||||
S3Secret: s3IamSecret,
|
||||
S3Region: s3IamRegion,
|
||||
S3Bucket: s3IamBucket,
|
||||
S3Endpoint: s3IamEndpoint,
|
||||
S3DisableSSlVerfiy: s3IamSslNoVerify,
|
||||
S3Debug: s3IamDebug,
|
||||
CacheDisable: iamCacheDisable,
|
||||
CacheTTL: iamCacheTTL,
|
||||
CachePrune: iamCachePrune,
|
||||
IpaHost: ipaHost,
|
||||
IpaVaultName: ipaVaultName,
|
||||
IpaUser: ipaUser,
|
||||
IpaPassword: ipaPassword,
|
||||
IpaInsecure: ipaInsecure,
|
||||
IpaDebug: ipaDebug,
|
||||
})
|
||||
if err != nil {
|
||||
return fmt.Errorf("setup iam: %w", err)
|
||||
@@ -839,9 +699,6 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
KafkaTopicKey: kafkaKey,
|
||||
NatsURL: natsURL,
|
||||
NatsTopic: natsTopic,
|
||||
RabbitmqURL: rabbitmqURL,
|
||||
RabbitmqExchange: rabbitmqExchange,
|
||||
RabbitmqRoutingKey: rabbitmqRoutingKey,
|
||||
WebhookURL: eventWebhookURL,
|
||||
FilterConfigFilePath: eventConfigFilePath,
|
||||
})
|
||||
@@ -849,7 +706,7 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
return fmt.Errorf("init bucket event notifications: %w", err)
|
||||
}
|
||||
|
||||
srv, err := s3api.New(be, middlewares.RootUserConfig{
|
||||
srv, err := s3api.New(app, be, middlewares.RootUserConfig{
|
||||
Access: rootUserAccess,
|
||||
Secret: rootUserSecret,
|
||||
}, port, region, iam, loggers.S3Logger, loggers.AdminLogger, evSender, metricsManager, opts...)
|
||||
@@ -857,135 +714,17 @@ func runGateway(ctx context.Context, be backend.Backend) error {
|
||||
return fmt.Errorf("init gateway: %v", err)
|
||||
}
|
||||
|
||||
var admSrv *s3api.S3AdminServer
|
||||
|
||||
if admPort != "" {
|
||||
var opts []s3api.AdminOpt
|
||||
if corsAllowOrigin != "" {
|
||||
opts = append(opts, s3api.WithAdminCORSAllowOrigin(corsAllowOrigin))
|
||||
}
|
||||
|
||||
if admCertFile != "" || admKeyFile != "" {
|
||||
if admCertFile == "" {
|
||||
return fmt.Errorf("TLS key specified without cert file")
|
||||
}
|
||||
if admKeyFile == "" {
|
||||
return fmt.Errorf("TLS cert specified without key file")
|
||||
}
|
||||
|
||||
cs := utils.NewCertStorage()
|
||||
err = cs.SetCertificate(admCertFile, admKeyFile)
|
||||
if err != nil {
|
||||
return fmt.Errorf("tls: load certs: %v", err)
|
||||
}
|
||||
opts = append(opts, s3api.WithAdminSrvTLS(cs))
|
||||
}
|
||||
if quiet {
|
||||
opts = append(opts, s3api.WithAdminQuiet())
|
||||
}
|
||||
if debug {
|
||||
opts = append(opts, s3api.WithAdminDebug())
|
||||
}
|
||||
|
||||
admSrv = s3api.NewAdminServer(be, middlewares.RootUserConfig{Access: rootUserAccess, Secret: rootUserSecret}, admPort, region, iam, loggers.AdminLogger, srv.Router.Ctrl, opts...)
|
||||
}
|
||||
|
||||
var webSrv *webui.Server
|
||||
webuiSSLEnabled := false
|
||||
webTLSCert := ""
|
||||
webTLSKey := ""
|
||||
if webuiAddr != "" {
|
||||
_, webPrt, err := net.SplitHostPort(webuiAddr)
|
||||
if err != nil {
|
||||
return fmt.Errorf("webui listen address must be in the form ':port' or 'host:port': %w", err)
|
||||
}
|
||||
webPortNum, err := strconv.Atoi(webPrt)
|
||||
if err != nil {
|
||||
return fmt.Errorf("webui port must be a number: %w", err)
|
||||
}
|
||||
if webPortNum < 0 || webPortNum > 65535 {
|
||||
return fmt.Errorf("webui port must be between 0 and 65535")
|
||||
}
|
||||
|
||||
var webOpts []webui.Option
|
||||
if !webuiNoTLS {
|
||||
// WebUI can either use explicitly provided TLS files or reuse the
|
||||
// gateway's TLS files by default.
|
||||
webTLSCert = webuiCertFile
|
||||
webTLSKey = webuiKeyFile
|
||||
if webTLSCert == "" && webTLSKey == "" {
|
||||
webTLSCert = certFile
|
||||
webTLSKey = keyFile
|
||||
}
|
||||
if webTLSCert != "" || webTLSKey != "" {
|
||||
if webTLSCert == "" {
|
||||
return fmt.Errorf("webui TLS key specified without cert file")
|
||||
}
|
||||
if webTLSKey == "" {
|
||||
return fmt.Errorf("webui TLS cert specified without key file")
|
||||
}
|
||||
webuiSSLEnabled = true
|
||||
|
||||
cs := utils.NewCertStorage()
|
||||
err := cs.SetCertificate(webTLSCert, webTLSKey)
|
||||
if err != nil {
|
||||
return fmt.Errorf("tls: load certs: %v", err)
|
||||
}
|
||||
|
||||
webOpts = append(webOpts, webui.WithTLS(cs))
|
||||
}
|
||||
}
|
||||
|
||||
sslEnabled := certFile != ""
|
||||
admSSLEnabled := sslEnabled
|
||||
if admPort != "" {
|
||||
admSSLEnabled = admCertFile != ""
|
||||
}
|
||||
|
||||
gateways, err := buildServiceURLs(port, sslEnabled)
|
||||
if err != nil {
|
||||
return fmt.Errorf("webui: build gateway URLs: %w", err)
|
||||
}
|
||||
|
||||
adminGateways := gateways
|
||||
if admPort != "" {
|
||||
adminGateways, err = buildServiceURLs(admPort, admSSLEnabled)
|
||||
if err != nil {
|
||||
return fmt.Errorf("webui: build admin gateway URLs: %w", err)
|
||||
}
|
||||
}
|
||||
|
||||
if quiet {
|
||||
webOpts = append(webOpts, webui.WithQuiet())
|
||||
}
|
||||
|
||||
webSrv = webui.NewServer(&webui.ServerConfig{
|
||||
ListenAddr: webuiAddr,
|
||||
Gateways: gateways,
|
||||
AdminGateways: adminGateways,
|
||||
Region: region,
|
||||
}, webOpts...)
|
||||
}
|
||||
admSrv := s3api.NewAdminServer(admApp, be, middlewares.RootUserConfig{Access: rootUserAccess, Secret: rootUserSecret}, admPort, region, iam, loggers.AdminLogger, admOpts...)
|
||||
|
||||
if !quiet {
|
||||
printBanner(port, admPort, certFile != "", admCertFile != "", webuiAddr, webuiSSLEnabled)
|
||||
printBanner(port, admPort, certFile != "", admCertFile != "")
|
||||
}
|
||||
|
||||
servers := 1
|
||||
if admPort != "" {
|
||||
servers++
|
||||
}
|
||||
if webSrv != nil {
|
||||
servers++
|
||||
}
|
||||
c := make(chan error, servers)
|
||||
c := make(chan error, 2)
|
||||
go func() { c <- srv.Serve() }()
|
||||
if admPort != "" {
|
||||
go func() { c <- admSrv.Serve() }()
|
||||
}
|
||||
if webSrv != nil {
|
||||
go func() { c <- webSrv.Serve() }()
|
||||
}
|
||||
|
||||
// for/select blocks until shutdown
|
||||
Loop:
|
||||
@@ -1010,71 +749,35 @@ Loop:
|
||||
break Loop
|
||||
}
|
||||
}
|
||||
if certFile != "" && keyFile != "" {
|
||||
err = srv.CertStorage.SetCertificate(certFile, keyFile)
|
||||
if err != nil {
|
||||
debuglogger.InternalError(fmt.Errorf("srv cert reload failed: %w", err))
|
||||
} else {
|
||||
fmt.Printf("srv cert reloaded (cert: %s, key: %s)\n", certFile, keyFile)
|
||||
}
|
||||
}
|
||||
if admPort != "" && admCertFile != "" && admKeyFile != "" {
|
||||
err = admSrv.CertStorage.SetCertificate(admCertFile, admKeyFile)
|
||||
if err != nil {
|
||||
debuglogger.InternalError(fmt.Errorf("admSrv cert reload failed: %w", err))
|
||||
} else {
|
||||
fmt.Printf("admSrv cert reloaded (cert: %s, key: %s)\n", admCertFile, admKeyFile)
|
||||
}
|
||||
}
|
||||
if webSrv != nil && webTLSCert != "" && webTLSKey != "" {
|
||||
err := webSrv.CertStorage.SetCertificate(webTLSCert, webTLSKey)
|
||||
if err != nil {
|
||||
debuglogger.InternalError(fmt.Errorf("webSrv cert reload failed: %w", err))
|
||||
} else {
|
||||
fmt.Printf("webSrv cert reloaded (cert: %s, key: %s)\n", webTLSCert, webTLSKey)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
saveErr := err
|
||||
|
||||
// first shut down the s3api and admin servers
|
||||
// as they have dependecy from other modules
|
||||
err = srv.ShutDown()
|
||||
if err != nil {
|
||||
fmt.Fprintf(os.Stderr, "shutdown api server: %v\n", err)
|
||||
}
|
||||
|
||||
if admSrv != nil {
|
||||
err := admSrv.Shutdown()
|
||||
if err != nil {
|
||||
fmt.Fprintf(os.Stderr, "shutdown admin server: %v\n", err)
|
||||
}
|
||||
}
|
||||
|
||||
if webSrv != nil {
|
||||
err := webSrv.Shutdown()
|
||||
if err != nil {
|
||||
fmt.Fprintf(os.Stderr, "shutdown webui server: %v\n", err)
|
||||
}
|
||||
}
|
||||
|
||||
be.Shutdown()
|
||||
|
||||
err = iam.Shutdown()
|
||||
if err != nil {
|
||||
if saveErr == nil {
|
||||
saveErr = err
|
||||
}
|
||||
fmt.Fprintf(os.Stderr, "shutdown iam: %v\n", err)
|
||||
}
|
||||
|
||||
if loggers.S3Logger != nil {
|
||||
err := loggers.S3Logger.Shutdown()
|
||||
if err != nil {
|
||||
if saveErr == nil {
|
||||
saveErr = err
|
||||
}
|
||||
fmt.Fprintf(os.Stderr, "shutdown s3 logger: %v\n", err)
|
||||
}
|
||||
}
|
||||
if loggers.AdminLogger != nil {
|
||||
err := loggers.AdminLogger.Shutdown()
|
||||
if err != nil {
|
||||
if saveErr == nil {
|
||||
saveErr = err
|
||||
}
|
||||
fmt.Fprintf(os.Stderr, "shutdown admin logger: %v\n", err)
|
||||
}
|
||||
}
|
||||
@@ -1082,6 +785,9 @@ Loop:
|
||||
if evSender != nil {
|
||||
err := evSender.Close()
|
||||
if err != nil {
|
||||
if saveErr == nil {
|
||||
saveErr = err
|
||||
}
|
||||
fmt.Fprintf(os.Stderr, "close event sender: %v\n", err)
|
||||
}
|
||||
}
|
||||
@@ -1093,7 +799,7 @@ Loop:
|
||||
return saveErr
|
||||
}
|
||||
|
||||
func printBanner(port, admPort string, ssl, admSsl bool, webuiAddr string, webuiSsl bool) {
|
||||
func printBanner(port, admPort string, ssl, admSsl bool) {
|
||||
interfaces, err := getMatchingIPs(port)
|
||||
if err != nil {
|
||||
fmt.Fprintf(os.Stderr, "Failed to match local IP addresses: %v\n", err)
|
||||
@@ -1175,30 +881,6 @@ func printBanner(port, admPort string, ssl, admSsl bool, webuiAddr string, webui
|
||||
}
|
||||
}
|
||||
|
||||
if strings.TrimSpace(webuiAddr) != "" {
|
||||
webInterfaces, err := getMatchingIPs(webuiAddr)
|
||||
if err != nil {
|
||||
fmt.Fprintf(os.Stderr, "Failed to match webui port local IP addresses: %v\n", err)
|
||||
return
|
||||
}
|
||||
_, webPrt, err := net.SplitHostPort(webuiAddr)
|
||||
if err != nil {
|
||||
fmt.Fprintf(os.Stderr, "Failed to parse webui port: %v\n", err)
|
||||
return
|
||||
}
|
||||
lines = append(lines,
|
||||
centerText(""),
|
||||
leftText("WebUI listening on:"),
|
||||
)
|
||||
for _, ip := range webInterfaces {
|
||||
url := fmt.Sprintf("http://%s:%s", ip, webPrt)
|
||||
if webuiSsl {
|
||||
url = fmt.Sprintf("https://%s:%s", ip, webPrt)
|
||||
}
|
||||
lines = append(lines, leftText(" "+url))
|
||||
}
|
||||
}
|
||||
|
||||
// Print the top border
|
||||
fmt.Println("┌" + strings.Repeat("─", columnWidth-2) + "┐")
|
||||
|
||||
@@ -1274,46 +956,13 @@ func getMatchingIPs(spec string) ([]string, error) {
|
||||
return result, nil
|
||||
}
|
||||
|
||||
func buildServiceURLs(spec string, ssl bool) ([]string, error) {
|
||||
interfaces, err := getMatchingIPs(spec)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
_, prt, err := net.SplitHostPort(spec)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("parse address/port: %w", err)
|
||||
}
|
||||
if len(interfaces) == 0 {
|
||||
interfaces = []string{"localhost"}
|
||||
}
|
||||
|
||||
scheme := "http"
|
||||
if ssl {
|
||||
scheme = "https"
|
||||
}
|
||||
urls := make([]string, 0, len(interfaces))
|
||||
for _, ip := range interfaces {
|
||||
urls = append(urls, fmt.Sprintf("%s://%s:%s", scheme, ip, prt))
|
||||
}
|
||||
return urls, nil
|
||||
}
|
||||
|
||||
func isAllDigits(s string) bool {
|
||||
if s == "" {
|
||||
return false
|
||||
}
|
||||
for _, r := range s {
|
||||
if r < '0' || r > '9' {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
||||
|
||||
const columnWidth = 70
|
||||
|
||||
func centerText(text string) string {
|
||||
padding := max((columnWidth-2-len(text))/2, 0)
|
||||
padding := (columnWidth - 2 - len(text)) / 2
|
||||
if padding < 0 {
|
||||
padding = 0
|
||||
}
|
||||
return strings.Repeat(" ", padding) + text
|
||||
}
|
||||
|
||||
|
||||
@@ -15,61 +15,50 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"plugin"
|
||||
|
||||
"github.com/urfave/cli/v2"
|
||||
"github.com/versity/versitygw/plugins"
|
||||
vgwplugin "github.com/versity/versitygw/backend/plugin"
|
||||
)
|
||||
|
||||
var (
|
||||
pluginPath string
|
||||
pluginConfig string
|
||||
)
|
||||
|
||||
func pluginCommand() *cli.Command {
|
||||
return &cli.Command{
|
||||
Name: "plugin",
|
||||
Usage: "load a backend from a plugin",
|
||||
Description: "Runs a s3 gateway and redirects the requests to the backend defined in the plugin",
|
||||
Action: runPluginBackend,
|
||||
Usage: "plugin storage backend",
|
||||
Description: `This tells the gateway to load the backend from a dynamic runtime plugin.`,
|
||||
Action: runPlugin,
|
||||
Flags: []cli.Flag{
|
||||
&cli.StringFlag{
|
||||
Name: "config",
|
||||
Usage: "location of the plugin config file",
|
||||
Aliases: []string{"c"},
|
||||
EnvVars: []string{"VGW_PLUGIN_CONFIG"},
|
||||
Name: "file",
|
||||
Usage: "path to plugin shared object file",
|
||||
Value: "",
|
||||
Required: true,
|
||||
EnvVars: []string{"VGW_PLUGIN_FILE"},
|
||||
Destination: &pluginPath,
|
||||
Aliases: []string{"f"},
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "config",
|
||||
Usage: "configuration option for the plugin",
|
||||
Value: "",
|
||||
Required: true,
|
||||
EnvVars: []string{"VGW_PLUGIN_CONFIG"},
|
||||
Destination: &pluginConfig,
|
||||
Aliases: []string{"c"},
|
||||
},
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func runPluginBackend(ctx *cli.Context) error {
|
||||
if ctx.NArg() == 0 {
|
||||
return fmt.Errorf("no plugin file provided to be loaded")
|
||||
}
|
||||
|
||||
pluginPath := ctx.Args().Get(0)
|
||||
config := ctx.String("config")
|
||||
|
||||
p, err := plugin.Open(pluginPath)
|
||||
func runPlugin(ctx *cli.Context) error {
|
||||
be, err := vgwplugin.NewPluginBackend(pluginPath, pluginConfig)
|
||||
if err != nil {
|
||||
return err
|
||||
return fmt.Errorf("init plugin backend: %w", err)
|
||||
}
|
||||
|
||||
backendSymbol, err := p.Lookup("Backend")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
backendPluginPtr, ok := backendSymbol.(*plugins.BackendPlugin)
|
||||
if !ok {
|
||||
return errors.New("plugin is not of type *plugins.BackendPlugin")
|
||||
}
|
||||
|
||||
if backendPluginPtr == nil {
|
||||
return errors.New("variable Backend is nil")
|
||||
}
|
||||
|
||||
be, err := (*backendPluginPtr).New(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return runGateway(ctx.Context, be)
|
||||
}
|
||||
|
||||
@@ -31,7 +31,6 @@ var (
|
||||
dirPerms uint
|
||||
sidecar string
|
||||
nometa bool
|
||||
forceNoTmpFile bool
|
||||
)
|
||||
|
||||
func posixCommand() *cli.Command {
|
||||
@@ -94,12 +93,6 @@ will be translated into the file /mnt/fs/gwroot/mybucket/a/b/c/myobject`,
|
||||
EnvVars: []string{"VGW_META_NONE"},
|
||||
Destination: &nometa,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "disableotmp",
|
||||
Usage: "disable O_TMPFILE support for new objects",
|
||||
EnvVars: []string{"VGW_DISABLE_OTMP"},
|
||||
Destination: &forceNoTmpFile,
|
||||
},
|
||||
},
|
||||
}
|
||||
}
|
||||
@@ -120,13 +113,11 @@ func runPosix(ctx *cli.Context) error {
|
||||
}
|
||||
|
||||
opts := posix.PosixOpts{
|
||||
ChownUID: chownuid,
|
||||
ChownGID: chowngid,
|
||||
BucketLinks: bucketlinks,
|
||||
VersioningDir: versioningDir,
|
||||
NewDirPerm: fs.FileMode(dirPerms),
|
||||
ForceNoTmpFile: forceNoTmpFile,
|
||||
ValidateBucketNames: disableStrictBucketNames,
|
||||
ChownUID: chownuid,
|
||||
ChownGID: chowngid,
|
||||
BucketLinks: bucketlinks,
|
||||
VersioningDir: versioningDir,
|
||||
NewDirPerm: fs.FileMode(dirPerms),
|
||||
}
|
||||
|
||||
var ms meta.MetadataStorer
|
||||
|
||||
@@ -26,10 +26,8 @@ var (
|
||||
s3proxySecret string
|
||||
s3proxyEndpoint string
|
||||
s3proxyRegion string
|
||||
s3proxyMetaBucket string
|
||||
s3proxyDisableChecksum bool
|
||||
s3proxySslSkipVerify bool
|
||||
s3proxyUsePathStyle bool
|
||||
s3proxyDebug bool
|
||||
)
|
||||
|
||||
@@ -73,12 +71,6 @@ to an s3 storage backend service.`,
|
||||
EnvVars: []string{"VGW_S3_REGION"},
|
||||
Destination: &s3proxyRegion,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "meta-bucket",
|
||||
Usage: "s3 service meta bucket to store buckets acl/policy",
|
||||
EnvVars: []string{"VGW_S3_META_BUCKET"},
|
||||
Destination: &s3proxyMetaBucket,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "disable-checksum",
|
||||
Usage: "disable gateway to server object checksums",
|
||||
@@ -93,13 +85,6 @@ to an s3 storage backend service.`,
|
||||
Value: false,
|
||||
Destination: &s3proxySslSkipVerify,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "use-path-style",
|
||||
Usage: "use path style addressing for s3 proxy",
|
||||
EnvVars: []string{"VGW_S3_USE_PATH_STYLE"},
|
||||
Value: false,
|
||||
Destination: &s3proxyUsePathStyle,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "debug",
|
||||
Usage: "output extra debug tracing",
|
||||
@@ -112,8 +97,8 @@ to an s3 storage backend service.`,
|
||||
}
|
||||
|
||||
func runS3(ctx *cli.Context) error {
|
||||
be, err := s3proxy.New(ctx.Context, s3proxyAccess, s3proxySecret, s3proxyEndpoint, s3proxyRegion,
|
||||
s3proxyMetaBucket, s3proxyDisableChecksum, s3proxySslSkipVerify, s3proxyUsePathStyle, s3proxyDebug)
|
||||
be, err := s3proxy.New(s3proxyAccess, s3proxySecret, s3proxyEndpoint, s3proxyRegion,
|
||||
s3proxyDisableChecksum, s3proxySslSkipVerify, s3proxyDebug)
|
||||
if err != nil {
|
||||
return fmt.Errorf("init s3 backend: %w", err)
|
||||
}
|
||||
|
||||
@@ -26,7 +26,6 @@ import (
|
||||
var (
|
||||
glacier bool
|
||||
disableNoArchive bool
|
||||
setProjectID bool
|
||||
)
|
||||
|
||||
func scoutfsCommand() *cli.Command {
|
||||
@@ -67,24 +66,12 @@ move interfaces as well as support for tiered filesystems.`,
|
||||
EnvVars: []string{"VGW_CHOWN_GID"},
|
||||
Destination: &chowngid,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "projectid",
|
||||
Usage: "set project id on newly created buckets, files, and directories to client account ProjectID",
|
||||
EnvVars: []string{"VGW_SET_PROJECT_ID"},
|
||||
Destination: &setProjectID,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "bucketlinks",
|
||||
Usage: "allow symlinked directories at bucket level to be treated as buckets",
|
||||
EnvVars: []string{"VGW_BUCKET_LINKS"},
|
||||
Destination: &bucketlinks,
|
||||
},
|
||||
&cli.StringFlag{
|
||||
Name: "versioning-dir",
|
||||
Usage: "the directory path to enable bucket versioning",
|
||||
EnvVars: []string{"VGW_VERSIONING_DIR"},
|
||||
Destination: &versioningDir,
|
||||
},
|
||||
&cli.UintFlag{
|
||||
Name: "dir-perms",
|
||||
Usage: "default directory permissions for new directories",
|
||||
@@ -119,9 +106,6 @@ func runScoutfs(ctx *cli.Context) error {
|
||||
opts.BucketLinks = bucketlinks
|
||||
opts.NewDirPerm = fs.FileMode(dirPerms)
|
||||
opts.DisableNoArchive = disableNoArchive
|
||||
opts.VersioningDir = versioningDir
|
||||
opts.ValidateBucketNames = disableStrictBucketNames
|
||||
opts.SetProjectID = setProjectID
|
||||
|
||||
be, err := scoutfs.New(ctx.Args().Get(0), opts)
|
||||
if err != nil {
|
||||
|
||||
@@ -34,12 +34,11 @@ var (
|
||||
totalReqs int
|
||||
upload bool
|
||||
download bool
|
||||
hostStyle bool
|
||||
pathStyle bool
|
||||
checksumDisable bool
|
||||
versioningEnabled bool
|
||||
azureTests bool
|
||||
tlsStatus bool
|
||||
parallel bool
|
||||
)
|
||||
|
||||
func testCommand() *cli.Command {
|
||||
@@ -75,12 +74,6 @@ func initTestFlags() []cli.Flag {
|
||||
Destination: &endpoint,
|
||||
Aliases: []string{"e"},
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "host-style",
|
||||
Usage: "Use host-style bucket addressing",
|
||||
Value: false,
|
||||
Destination: &hostStyle,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "debug",
|
||||
Usage: "enable debug mode",
|
||||
@@ -116,12 +109,6 @@ func initTestCommands() []*cli.Command {
|
||||
Destination: &azureTests,
|
||||
Aliases: []string{"azure"},
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "parallel",
|
||||
Usage: "executes the tests concurrently",
|
||||
Destination: ¶llel,
|
||||
Aliases: []string{"p"},
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
@@ -137,11 +124,6 @@ func initTestCommands() []*cli.Command {
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
Name: "scoutfs",
|
||||
Usage: "Tests scoutfs full flow",
|
||||
Action: getAction(integration.TestScoutfs),
|
||||
},
|
||||
{
|
||||
Name: "iam",
|
||||
Usage: "Tests iam service",
|
||||
@@ -204,6 +186,12 @@ func initTestCommands() []*cli.Command {
|
||||
Value: 1,
|
||||
Destination: &concurrency,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "pathStyle",
|
||||
Usage: "Use Pathstyle bucket addressing",
|
||||
Value: false,
|
||||
Destination: &pathStyle,
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "checksumDis",
|
||||
Usage: "Disable server checksum",
|
||||
@@ -235,8 +223,8 @@ func initTestCommands() []*cli.Command {
|
||||
if debug {
|
||||
opts = append(opts, integration.WithDebug())
|
||||
}
|
||||
if hostStyle {
|
||||
opts = append(opts, integration.WithHostStyle())
|
||||
if pathStyle {
|
||||
opts = append(opts, integration.WithPathStyle())
|
||||
}
|
||||
if checksumDisable {
|
||||
opts = append(opts, integration.WithDisableChecksum())
|
||||
@@ -299,9 +287,6 @@ func initTestCommands() []*cli.Command {
|
||||
if checksumDisable {
|
||||
opts = append(opts, integration.WithDisableChecksum())
|
||||
}
|
||||
if hostStyle {
|
||||
opts = append(opts, integration.WithHostStyle())
|
||||
}
|
||||
|
||||
s3conf := integration.NewS3Conf(opts...)
|
||||
|
||||
@@ -311,9 +296,9 @@ func initTestCommands() []*cli.Command {
|
||||
}, extractIntTests()...)
|
||||
}
|
||||
|
||||
type testFunc func(*integration.TestState)
|
||||
type testFunc func(*integration.S3Conf)
|
||||
|
||||
func getAction(tf testFunc) func(ctx *cli.Context) error {
|
||||
func getAction(tf testFunc) func(*cli.Context) error {
|
||||
return func(ctx *cli.Context) error {
|
||||
opts := []integration.Option{
|
||||
integration.WithAccess(awsID),
|
||||
@@ -331,19 +316,14 @@ func getAction(tf testFunc) func(ctx *cli.Context) error {
|
||||
if azureTests {
|
||||
opts = append(opts, integration.WithAzureMode())
|
||||
}
|
||||
if hostStyle {
|
||||
opts = append(opts, integration.WithHostStyle())
|
||||
}
|
||||
|
||||
s := integration.NewS3Conf(opts...)
|
||||
ts := integration.NewTestState(ctx.Context, s, parallel)
|
||||
tf(ts)
|
||||
ts.Wait()
|
||||
tf(s)
|
||||
|
||||
fmt.Println()
|
||||
fmt.Println("RAN:", integration.RunCount.Load(), "PASS:", integration.PassCount.Load(), "FAIL:", integration.FailCount.Load())
|
||||
if integration.FailCount.Load() > 0 {
|
||||
return fmt.Errorf("test failed with %v errors", integration.FailCount.Load())
|
||||
fmt.Println("RAN:", integration.RunCount, "PASS:", integration.PassCount, "FAIL:", integration.FailCount)
|
||||
if integration.FailCount > 0 {
|
||||
return fmt.Errorf("test failed with %v errors", integration.FailCount)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@@ -371,12 +351,6 @@ func extractIntTests() (commands []*cli.Command) {
|
||||
if versioningEnabled {
|
||||
opts = append(opts, integration.WithVersioningEnabled())
|
||||
}
|
||||
if hostStyle {
|
||||
opts = append(opts, integration.WithHostStyle())
|
||||
}
|
||||
if azureTests {
|
||||
opts = append(opts, integration.WithAzureMode())
|
||||
}
|
||||
|
||||
s := integration.NewS3Conf(opts...)
|
||||
err := testFunc(s)
|
||||
@@ -389,12 +363,6 @@ func extractIntTests() (commands []*cli.Command) {
|
||||
Destination: &versioningEnabled,
|
||||
Aliases: []string{"vs"},
|
||||
},
|
||||
&cli.BoolFlag{
|
||||
Name: "azure-test-mode",
|
||||
Usage: "Skips tests that are not supported by Azure",
|
||||
Destination: &azureTests,
|
||||
Aliases: []string{"azure"},
|
||||
},
|
||||
},
|
||||
})
|
||||
}
|
||||
|
||||
@@ -1,275 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package debuglogger
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"log"
|
||||
"net/http"
|
||||
"os"
|
||||
"strings"
|
||||
"sync/atomic"
|
||||
|
||||
"github.com/gofiber/fiber/v2"
|
||||
)
|
||||
|
||||
type Color string
|
||||
type prefix string
|
||||
|
||||
const (
|
||||
green Color = "\033[32m"
|
||||
yellow Color = "\033[33m"
|
||||
blue Color = "\033[34m"
|
||||
red Color = "\033[31m"
|
||||
Purple Color = "\033[0;35m"
|
||||
|
||||
prefixPanic prefix = "[PANIC]: "
|
||||
prefixInernalError prefix = "[INTERNAL ERROR]: "
|
||||
prefixInfo prefix = "[INFO]: "
|
||||
prefixDebug prefix = "[DEBUG]: "
|
||||
|
||||
reset = "\033[0m"
|
||||
borderChar = "─"
|
||||
boxWidth = 120
|
||||
)
|
||||
|
||||
// Panic prints the panics out in the console
|
||||
func Panic(er error) {
|
||||
printError(prefixPanic, er)
|
||||
}
|
||||
|
||||
// InternalError prints the internal error out in the console
|
||||
func InternalError(er error) {
|
||||
printError(prefixInernalError, er)
|
||||
}
|
||||
|
||||
func printError(prefix prefix, er error) {
|
||||
fmt.Fprintf(os.Stderr, string(red)+string(prefix)+"%v"+reset+"\n", er)
|
||||
}
|
||||
|
||||
// Logs http request details: headers, body, params, query args
|
||||
func LogFiberRequestDetails(ctx *fiber.Ctx) {
|
||||
// Log the full request url
|
||||
fullURL := ctx.Protocol() + "://" + ctx.Hostname() + ctx.OriginalURL()
|
||||
fmt.Printf("%s[URL]: %s%s\n", green, fullURL, reset)
|
||||
|
||||
// log request headers
|
||||
wrapInBox(green, "REQUEST HEADERS", boxWidth, func() {
|
||||
for key, value := range ctx.Request().Header.All() {
|
||||
printWrappedLine(yellow, string(key), string(value))
|
||||
}
|
||||
})
|
||||
// skip request body log for PutObject and UploadPart
|
||||
skipBodyLog := isLargeDataAction(ctx)
|
||||
if !skipBodyLog {
|
||||
body := ctx.Request().Body()
|
||||
if len(body) != 0 {
|
||||
printBoxTitleLine(blue, "REQUEST BODY", boxWidth, false)
|
||||
fmt.Printf("%s%s%s\n", blue, body, reset)
|
||||
printHorizontalBorder(blue, boxWidth, false)
|
||||
}
|
||||
}
|
||||
|
||||
if ctx.Request().URI().QueryArgs().Len() != 0 {
|
||||
for key, value := range ctx.Request().URI().QueryArgs().All() {
|
||||
log.Printf("%s: %s", key, value)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Logs http response details: body, headers
|
||||
func LogFiberResponseDetails(ctx *fiber.Ctx) {
|
||||
wrapInBox(green, "RESPONSE HEADERS", boxWidth, func() {
|
||||
for key, value := range ctx.Response().Header.All() {
|
||||
printWrappedLine(yellow, string(key), string(value))
|
||||
}
|
||||
})
|
||||
|
||||
_, ok := ctx.Locals("skip-res-body-log").(bool)
|
||||
if !ok {
|
||||
body := ctx.Response().Body()
|
||||
if len(body) != 0 {
|
||||
PrintInsideHorizontalBorders(blue, "RESPONSE BODY", string(body), boxWidth)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
var debugEnabled atomic.Bool
|
||||
|
||||
// SetDebugEnabled sets the debug mode
|
||||
func SetDebugEnabled() {
|
||||
debugEnabled.Store(true)
|
||||
}
|
||||
|
||||
// IsDebugEnabled returns true if debugging is enabled
|
||||
func IsDebugEnabled() bool {
|
||||
return debugEnabled.Load()
|
||||
}
|
||||
|
||||
// Logf is the same as 'fmt.Printf' with debug prefix,
|
||||
// a color added and '\n' at the end
|
||||
func Logf(format string, v ...any) {
|
||||
if !debugEnabled.Load() {
|
||||
return
|
||||
}
|
||||
|
||||
fmt.Printf(string(yellow)+string(prefixDebug)+format+reset+"\n", v...)
|
||||
}
|
||||
|
||||
// Infof prints out green info block with [INFO]: prefix
|
||||
func Infof(format string, v ...any) {
|
||||
if !debugEnabled.Load() {
|
||||
return
|
||||
}
|
||||
|
||||
fmt.Printf(string(green)+string(prefixInfo)+format+reset+"\n", v...)
|
||||
}
|
||||
|
||||
var debugIAMEnabled atomic.Bool
|
||||
|
||||
// SetIAMDebugEnabled sets the IAM debug mode
|
||||
func SetIAMDebugEnabled() {
|
||||
debugIAMEnabled.Store(true)
|
||||
}
|
||||
|
||||
// IsDebugEnabled returns true if debugging enabled
|
||||
func IsIAMDebugEnabled() bool {
|
||||
return debugEnabled.Load()
|
||||
}
|
||||
|
||||
// IAMLogf is the same as 'fmt.Printf' with debug prefix,
|
||||
// a color added and '\n' at the end
|
||||
func IAMLogf(format string, v ...any) {
|
||||
if !debugIAMEnabled.Load() {
|
||||
return
|
||||
}
|
||||
|
||||
fmt.Printf(string(yellow)+string(prefixDebug)+format+reset+"\n", v...)
|
||||
}
|
||||
|
||||
// PrintInsideHorizontalBorders prints the text inside horizontal
|
||||
// border and title in the center of upper border
|
||||
func PrintInsideHorizontalBorders(color Color, title, text string, width int) {
|
||||
if !debugEnabled.Load() {
|
||||
return
|
||||
}
|
||||
printBoxTitleLine(color, title, width, false)
|
||||
fmt.Printf("%s%s%s\n", color, text, reset)
|
||||
printHorizontalBorder(color, width, false)
|
||||
}
|
||||
|
||||
// Prints out box title either with closing characters or not: "┌", "┐"
|
||||
// e.g ┌────────────────[ RESPONSE HEADERS ]────────────────┐
|
||||
func printBoxTitleLine(color Color, title string, length int, closing bool) {
|
||||
leftCorner, rightCorner := "┌", "┐"
|
||||
|
||||
if !closing {
|
||||
leftCorner, rightCorner = borderChar, borderChar
|
||||
}
|
||||
|
||||
// Calculate how many border characters are needed
|
||||
titleFormatted := fmt.Sprintf("[ %s ]", title)
|
||||
borderSpace := length - len(titleFormatted) - 2 // 2 for corners
|
||||
leftLen := borderSpace / 2
|
||||
rightLen := borderSpace - leftLen
|
||||
|
||||
// Build the line
|
||||
line := leftCorner +
|
||||
strings.Repeat(borderChar, leftLen) +
|
||||
titleFormatted +
|
||||
strings.Repeat(borderChar, rightLen) +
|
||||
rightCorner
|
||||
|
||||
fmt.Println(string(color) + line + reset)
|
||||
}
|
||||
|
||||
// Prints out a horizontal line either with closing characters or not: "└", "┘"
|
||||
func printHorizontalBorder(color Color, length int, closing bool) {
|
||||
leftCorner, rightCorner := "└", "┘"
|
||||
if !closing {
|
||||
leftCorner, rightCorner = borderChar, borderChar
|
||||
}
|
||||
|
||||
line := leftCorner + strings.Repeat(borderChar, length-2) + rightCorner + reset
|
||||
fmt.Println(string(color) + line)
|
||||
}
|
||||
|
||||
// wrapInBox wraps the output of a function call (fn) inside a styled box with a title.
|
||||
func wrapInBox(color Color, title string, length int, fn func()) {
|
||||
printBoxTitleLine(color, title, length, true)
|
||||
fn()
|
||||
printHorizontalBorder(color, length, true)
|
||||
}
|
||||
|
||||
// returns the provided string length
|
||||
// defaulting to 13 for exceeding lengths
|
||||
func getLen(str string) int {
|
||||
if len(str) < 13 {
|
||||
return 13
|
||||
}
|
||||
|
||||
return len(str)
|
||||
}
|
||||
|
||||
// prints a formatted key-value pair within a box layout,
|
||||
// wrapping the value text if it exceeds the allowed width.
|
||||
func printWrappedLine(keyColor Color, key, value string) {
|
||||
prefix := fmt.Sprintf("%s│%s %s%-13s%s : ", green, reset, keyColor, key, reset)
|
||||
prefixLen := len(prefix) - len(green) - len(reset) - len(keyColor) - len(reset)
|
||||
// the actual prefix size without colors
|
||||
actualPrefixLen := getLen(key) + 5
|
||||
|
||||
lineWidth := boxWidth - prefixLen
|
||||
valueLines := wrapText(value, lineWidth)
|
||||
|
||||
for i, line := range valueLines {
|
||||
if i == 0 {
|
||||
if len(line) < lineWidth {
|
||||
line += strings.Repeat(" ", lineWidth-len(line))
|
||||
}
|
||||
fmt.Printf("%s%s%s %s│%s\n", prefix, reset, line, green, reset)
|
||||
} else {
|
||||
line = strings.Repeat(" ", actualPrefixLen-2) + line
|
||||
if len(line) < boxWidth-4 {
|
||||
line += strings.Repeat(" ", boxWidth-len(line)-4)
|
||||
}
|
||||
fmt.Printf("%s│ %s%s %s│%s\n", green, reset, line, green, reset)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// wrapText splits the input text into lines of at most `width` characters each.
|
||||
func wrapText(text string, width int) []string {
|
||||
var lines []string
|
||||
for len(text) > width {
|
||||
lines = append(lines, text[:width])
|
||||
text = text[width:]
|
||||
}
|
||||
if text != "" {
|
||||
lines = append(lines, text)
|
||||
}
|
||||
return lines
|
||||
}
|
||||
|
||||
// TODO: remove this and use utils.IsBidDataAction after refactoring
|
||||
// and creating 'internal' package
|
||||
func isLargeDataAction(ctx *fiber.Ctx) bool {
|
||||
if ctx.Method() == http.MethodPut && len(strings.Split(ctx.Path(), "/")) >= 3 {
|
||||
if !ctx.Request().URI().QueryArgs().Has("tagging") && ctx.Get("X-Amz-Copy-Source") == "" && !ctx.Request().URI().QueryArgs().Has("acl") {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
@@ -1,51 +0,0 @@
|
||||
#!/bin/sh
|
||||
set -e
|
||||
|
||||
BIN="${VGW_BINARY:-/usr/local/bin/versitygw}"
|
||||
|
||||
if [ ! -x "$BIN" ]; then
|
||||
echo "Entrypoint error: versitygw binary not found at $BIN" >&2
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# If arguments were provided, run them directly for backward compatibility.
|
||||
if [ "$#" -gt 0 ]; then
|
||||
exec "$BIN" "$@"
|
||||
fi
|
||||
|
||||
backend="${VGW_BACKEND:-}"
|
||||
if [ -z "$backend" ]; then
|
||||
cat >&2 <<'EOF'
|
||||
No command arguments were provided and VGW_BACKEND is unset.
|
||||
Set VGW_BACKEND to one of: posix, scoutfs, s3, azure, plugin
|
||||
or pass explicit arguments to the container to run the versitygw command directly.
|
||||
EOF
|
||||
exit 1
|
||||
fi
|
||||
|
||||
case "$backend" in
|
||||
posix|scoutfs|s3|azure|plugin)
|
||||
;;
|
||||
*)
|
||||
echo "VGW_BACKEND invalid backend (was '$backend')." >&2
|
||||
exit 1
|
||||
;;
|
||||
esac
|
||||
|
||||
set -- "$backend"
|
||||
|
||||
if [ -n "${VGW_BACKEND_ARG:-}" ]; then
|
||||
set -- "$@" "$VGW_BACKEND_ARG"
|
||||
fi
|
||||
|
||||
if [ -n "${VGW_BACKEND_ARGS:-}" ]; then
|
||||
# shellcheck disable=SC2086
|
||||
set -- "$@" ${VGW_BACKEND_ARGS}
|
||||
fi
|
||||
|
||||
if [ -n "${VGW_ARGS:-}" ]; then
|
||||
# shellcheck disable=SC2086
|
||||
set -- "$@" ${VGW_ARGS}
|
||||
fi
|
||||
|
||||
exec "$BIN" "$@"
|
||||
@@ -23,8 +23,7 @@
|
||||
# VersityGW Required Options #
|
||||
##############################
|
||||
|
||||
# VGW_BACKEND must be defined, and must be one of: posix, scoutfs, s3, azure,
|
||||
# or plugin
|
||||
# VGW_BACKEND must be defined, and must be one of: posix, scoutfs, or s3
|
||||
# This defines the backend that the VGW will use for data access.
|
||||
VGW_BACKEND=posix
|
||||
|
||||
@@ -100,32 +99,6 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
# endpoint is unauthenticated, and returns a 200 status for GET.
|
||||
#VGW_HEALTH=
|
||||
|
||||
# Enable VGW_READ_ONLY to only allow read operations to the S3 server. No write
|
||||
# operations will be allowed.
|
||||
#VGW_READ_ONLY=false
|
||||
|
||||
# The VGW_VIRTUAL_DOMAIN option enables the virtual host style bucket
|
||||
# addressing. The path style addressing is the default, and remains enabled
|
||||
# even when virtual host style is enabled. The VGW_VIRTUAL_DOMAIN option
|
||||
# specifies the domain name that will be used for the virtual host style
|
||||
# addressing. For virtual addressing, access to a bucket is in the request
|
||||
# form:
|
||||
# https://<bucket>.<VGW_VIRTUAL_DOMAIN>/
|
||||
# for example: https://mybucket.example.com/ where
|
||||
# VGW_VIRTUAL_DOMAIN=example.com
|
||||
# and all subdomains of VGW_VIRTUAL_DOMAIN should be reserved for buckets.
|
||||
# This means that virtual host addressing will generally require a DNS
|
||||
# entry for each bucket that needs to be accessed.
|
||||
# The default path style request is of the form:
|
||||
# https://<VGW_ENDPOINT>/<bucket>
|
||||
#VGW_VIRTUAL_DOMAIN=
|
||||
|
||||
# By default, versitygw will enforce similar bucket naming rules as described
|
||||
# in https://docs.aws.amazon.com/AmazonS3/latest/userguide/bucketnamingrules.html
|
||||
# Set to true to allow legacy or non-DNS-compliant bucket names by skipping
|
||||
# strict validation checks.
|
||||
#VGW_DISABLE_STRICT_BUCKET_NAMES=false
|
||||
|
||||
###############
|
||||
# Access Logs #
|
||||
###############
|
||||
@@ -176,19 +149,6 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
#VGW_EVENT_NATS_URL=
|
||||
#VGW_EVENT_NATS_TOPIC=
|
||||
|
||||
# Bucket events can be sent to a RabbitMQ messaging service. When
|
||||
# VGW_EVENT_RABBITMQ_URL is specified, events will be published to the specified
|
||||
# exchange (VGW_EVENT_RABBITMQ_EXCHANGE) using the routing key
|
||||
# (VGW_EVENT_RABBITMQ_ROUTING_KEY). If exchange is blank the default exchange is
|
||||
# used. If routing key is blank, it will be left empty (the server can bind a
|
||||
# queue with an empty binding key or you can set an explicit key).
|
||||
# Example URL formats:
|
||||
# amqp://user:pass@rabbitmq:5672/
|
||||
# amqps://user:pass@rabbitmq:5671/vhost
|
||||
#VGW_EVENT_RABBITMQ_URL=
|
||||
#VGW_EVENT_RABBITMQ_EXCHANGE=
|
||||
#VGW_EVENT_RABBITMQ_ROUTING_KEY=
|
||||
|
||||
# Bucket events can be sent to a webhook. When VGW_EVENT_WEBHOOK_URL is
|
||||
# specified, all configured bucket events will be sent to the webhook.
|
||||
#VGW_EVENT_WEBHOOK_URL=
|
||||
@@ -201,42 +161,6 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
# to generate a default rules file "event_config.json" in the current directory.
|
||||
#VGW_EVENT_FILTER=
|
||||
|
||||
###########
|
||||
# Web GUI #
|
||||
###########
|
||||
|
||||
# The VGW_WEBUI_PORT option enables the Web GUI server on the specified
|
||||
# listening address. The Web GUI provides a browser-based interface for managing
|
||||
# users, buckets and objects. The format can be either ':port' to listen on all
|
||||
# interfaces (e.g., ':7071') or 'host:port' to listen on a specific interface
|
||||
# (e.g., '127.0.0.1:7071' or 'localhost:7071'). When omitted, the Web GUI is
|
||||
# disabled.
|
||||
#VGW_WEBUI_PORT=
|
||||
|
||||
# The VGW_WEBUI_CERT and VGW_WEBUI_KEY options specify the TLS certificate and
|
||||
# private key for the Web GUI server. If these are not specified and TLS is
|
||||
# configured for the gateway (VGW_CERT and VGW_KEY), the Web GUI will use the
|
||||
# same certificates as the gateway. If neither are specified, the Web GUI will
|
||||
# run without TLS (HTTP only). These options allow the Web GUI to use different
|
||||
# certificates than the main S3 gateway.
|
||||
#VGW_WEBUI_CERT=
|
||||
#VGW_WEBUI_KEY=
|
||||
|
||||
# The VGW_WEBUI_NO_TLS option disables TLS for the Web GUI even if TLS
|
||||
# certificates are configured for the gateway. Set to true to force the Web GUI
|
||||
# to use HTTP instead of HTTPS. This can be useful when running the Web GUI
|
||||
# behind a reverse proxy that handles TLS termination.
|
||||
#VGW_WEBUI_NO_TLS=false
|
||||
|
||||
# The VGW_CORS_ALLOW_ORIGIN option sets the default CORS (Cross-Origin Resource
|
||||
# Sharing) Access-Control-Allow-Origin header value. This header is applied to
|
||||
# responses when no bucket-specific CORS configuration exists, and for all admin
|
||||
# API responses. When the Web GUI is enabled and this option is not set, it
|
||||
# defaults to '*' (allow all origins) for usability. For production environments,
|
||||
# it is recommended to set this to a specific origin (e.g.,
|
||||
# 'https://webui.example.com') to improve security.
|
||||
#VGW_CORS_ALLOW_ORIGIN=
|
||||
|
||||
#######################
|
||||
# Debug / Diagnostics #
|
||||
#######################
|
||||
@@ -315,29 +239,6 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
#VGW_IAM_LDAP_ROLE_ATR=
|
||||
#VGW_IAM_LDAP_USER_ID_ATR=
|
||||
#VGW_IAM_LDAP_GROUP_ID_ATR=
|
||||
# Disable TLS certificate verification for LDAP connections (insecure, allows
|
||||
# self-signed certificates). This should only be used in testing environments
|
||||
# or when using self-signed certificates. The default is false (verification
|
||||
# enabled).
|
||||
#VGW_IAM_LDAP_TLS_SKIP_VERIFY=false
|
||||
|
||||
# The FreeIPA options will enable the FreeIPA IAM service with accounts stored
|
||||
# in an external FreeIPA service. Currently the FreeIPA IAM service only
|
||||
# supports account retrieval. Creating and modifying accounts must be done
|
||||
# outside of the versitygw service.
|
||||
# FreeIPA server url e.g. https://ipa.example.test
|
||||
#VGW_IPA_HOST=
|
||||
# A name of the user vault containing their secret
|
||||
#VGW_IPA_VAULT_NAME=
|
||||
# Username used to connect to FreeIPA (requires permissions to read user vault
|
||||
# contents)
|
||||
#VGW_IPA_USER=
|
||||
# Password of the user used to connect to FreeIPA
|
||||
#VGW_IPA_PASSWORD=
|
||||
# Disable verify TLS certificate of FreeIPA server
|
||||
#VGW_IPA_INSECURE=false
|
||||
# FreeIPA IAM debug output
|
||||
#VGW_IPA_DEBUG=false
|
||||
|
||||
###############
|
||||
# IAM caching #
|
||||
@@ -416,40 +317,6 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
# as any parent directories automatically created with object uploads.
|
||||
#VGW_DIR_PERMS=0755
|
||||
|
||||
# To enable object versions, the VGW_VERSIONING_DIR option must be set to the
|
||||
# directory that will be used to store the object versions. The version
|
||||
# directory must NOT be a subdirectory of the VGW_BACKEND_ARG directory.
|
||||
#VGW_VERSIONING_DIR=
|
||||
|
||||
# The gateway uses xattrs to store metadata for objects by default. For systems
|
||||
# that do not support xattrs, the VGW_META_SIDECAR option can be set to a
|
||||
# directory that will be used to store the metadata for objects. This is
|
||||
# currently experimental, and may have issues for some edge cases.
|
||||
#VGW_META_SIDECAR=
|
||||
|
||||
# The VGW_META_NONE option will disable the metadata functionality for the
|
||||
# gateway. This will cause the gateway to not store any metadata for objects
|
||||
# or buckets. This include bucket ACLs and Policy. This may be useful for
|
||||
# read only access to pre-existing data where the gateway should not modify
|
||||
# the data. It is recommened to enable VGW_READ_ONLY (Global Options) along
|
||||
# with this.
|
||||
#VGW_META_NONE=false
|
||||
|
||||
# The gateway will use O_TMPFILE for writing objects while uploading and
|
||||
# link the file to the final object name when the upload is complete if the
|
||||
# filesystem supports O_TMPFILE. This creates an atomic object creation
|
||||
# that is not visible to other clients or racing uploads until the upload
|
||||
# is complete. This will not work if there is a different filesystem mounted
|
||||
# below the bucket level than where the bucket resides. The VGW_DISABLE_OTMP
|
||||
# option can be set to true to disable this functionality and force the fallback
|
||||
# mode when O_TMPFILE is not available. This fallback will create a temporary
|
||||
# file in the bucket directory and rename it to the final object name when
|
||||
# the upload is complete if the final location is in the same filesystem, or
|
||||
# copy the file to the final location if the final location is in a different
|
||||
# filesystem. This fallback mode is still atomic, but may be less efficient
|
||||
# than O_TMPFILE when the data needs to be copied into the final location.
|
||||
#VGW_DISABLE_OTMP=false
|
||||
|
||||
###########
|
||||
# scoutfs #
|
||||
###########
|
||||
@@ -481,11 +348,6 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
#VGW_CHOWN_UID=false
|
||||
#VGW_CHOWN_GID=false
|
||||
|
||||
# The VGW_SET_PROJECT_ID option will enable setting account defined ProjectID
|
||||
# for newly created buckets, files, and directories if the account ProjectID
|
||||
# is greater than 0 and the filesystem format version supports project IDs.
|
||||
#VGW_SET_PROJECT_ID=false
|
||||
|
||||
# The VGW_BUCKET_LINKS option will enable the gateway to treat symbolic links
|
||||
# to directories at the top level gateway directory as buckets.
|
||||
#VGW_BUCKET_LINKS=false
|
||||
@@ -496,14 +358,6 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
# as any parent directories automatically created with object uploads.
|
||||
#VGW_DIR_PERMS=0755
|
||||
|
||||
# To enable object versions, the VGW_VERSIONING_DIR option must be set to the
|
||||
# directory that will be used to store the object versions. The version
|
||||
# directory must NOT be a subdirectory of the VGW_BACKEND_ARG directory.
|
||||
# There may be implications for archive policy updates to include version
|
||||
# directory as well. It is recommended to discuss archive implications of
|
||||
# versioning with Versity support before enabling on an archiving filesystem.
|
||||
#VGW_VERSIONING_DIR=
|
||||
|
||||
# The default behavior of the gateway is to automatically set the noarchive
|
||||
# flag on the multipart upload parts while the multipart upload is in progress.
|
||||
# This is to prevent the parts from being archived since they are temporary
|
||||
@@ -533,48 +387,3 @@ ROOT_SECRET_ACCESS_KEY=
|
||||
#VGW_S3_DISABLE_CHECKSUM=false
|
||||
#VGW_S3_SSL_SKIP_VERIFY=false
|
||||
#VGW_S3_DEBUG=false
|
||||
|
||||
########
|
||||
# azure #
|
||||
########
|
||||
|
||||
# The azure backend allows the gateway to store objects in Azure Blob Storage.
|
||||
# Buckets created through the gateway map to blob containers within the
|
||||
# configured storage account. This backend is useful when existing workflows
|
||||
# expect an S3-compatible interface while data resides in Azure.
|
||||
|
||||
# When the azure backend is selected, configure credentials with one of the
|
||||
# following approaches:
|
||||
# - Shared key: Define AZ_ACCOUNT_NAME with the storage account name and
|
||||
# AZ_ACCESS_KEY with the corresponding account key.
|
||||
# - SAS token: Set AZ_SAS_TOKEN to an account or container scoped SAS token.
|
||||
# Provide AZ_ENDPOINT if the token does not implicitly define the endpoint.
|
||||
# - Default Azure credentials: Leave AZ_ACCOUNT_NAME and AZ_ACCESS_KEY blank
|
||||
# and configure the standard Azure identity environment variables supported
|
||||
# by the DefaultAzureCredential chain (e.g. AZURE_CLIENT_ID, AZURE_TENANT_ID,
|
||||
# AZURE_CLIENT_SECRET, managed identity, etc.).
|
||||
# Use AZ_ENDPOINT to override the service URL (for example when targeting
|
||||
# Azurite or a sovereign cloud). If unset, it defaults to
|
||||
# https://<account>.blob.core.windows.net/ when an account name is provided.
|
||||
#AZ_ACCOUNT_NAME=
|
||||
#AZ_ACCESS_KEY=
|
||||
#AZ_SAS_TOKEN=
|
||||
#AZ_ENDPOINT=
|
||||
|
||||
##########
|
||||
# plugin #
|
||||
##########
|
||||
|
||||
# The plugin backend loads a Go plugin shared object that exposes a variable
|
||||
# named "Backend" of type *plugins.BackendPlugin. The gateway uses the
|
||||
# exported constructor to create the backend implementation at runtime.
|
||||
|
||||
# Set VGW_BACKEND_ARG to the absolute path of the compiled plugin (.so) file.
|
||||
# The path must be readable by the gateway service account and remain stable
|
||||
# across restarts.
|
||||
#VGW_BACKEND_ARG=/usr/lib/versitygw/plugins/example.so
|
||||
|
||||
# Provide the plugin-specific configuration file path via VGW_PLUGIN_CONFIG.
|
||||
# The gateway automatically forwards this value to the plugin backend when it
|
||||
# starts up.
|
||||
#VGW_PLUGIN_CONFIG=/etc/versitygw.d/example-plugin.conf
|
||||
|
||||
@@ -17,7 +17,7 @@ Group=root
|
||||
|
||||
EnvironmentFile=/etc/versitygw.d/%i.conf
|
||||
|
||||
ExecStart=/bin/bash -c 'if [[ ! ("${VGW_BACKEND}" == "posix" || "${VGW_BACKEND}" == "scoutfs" || "${VGW_BACKEND}" == "s3" || "${VGW_BACKEND}" == "azure" || "${VGW_BACKEND}" == "plugin") ]]; then echo "VGW_BACKEND environment variable ${VGW_BACKEND} not set to valid backend type"; exit 1; fi && exec /usr/bin/versitygw "$VGW_BACKEND" "$VGW_BACKEND_ARG"'
|
||||
ExecStart=/bin/bash -c 'if [[ ! ("${VGW_BACKEND}" == "posix" || "${VGW_BACKEND}" == "scoutfs" || "${VGW_BACKEND}" == "s3") ]]; then echo "VGW_BACKEND environment variable not set to one of posix, scoutfs, or s3"; exit 1; fi && exec /usr/bin/versitygw "$VGW_BACKEND" "$VGW_BACKEND_ARG"'
|
||||
|
||||
# Let systemd restart this service always
|
||||
Restart=always
|
||||
|
||||
113
go.mod
113
go.mod
@@ -1,91 +1,82 @@
|
||||
module github.com/versity/versitygw
|
||||
|
||||
go 1.24.0
|
||||
go 1.23.0
|
||||
|
||||
toolchain go1.24.1
|
||||
|
||||
require (
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azcore v1.21.0
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.13.1
|
||||
github.com/Azure/azure-sdk-for-go/sdk/storage/azblob v1.6.4
|
||||
github.com/DataDog/datadog-go/v5 v5.8.2
|
||||
github.com/aws/aws-sdk-go-v2 v1.41.1
|
||||
github.com/aws/aws-sdk-go-v2/service/s3 v1.95.1
|
||||
github.com/aws/smithy-go v1.24.0
|
||||
github.com/davecgh/go-spew v1.1.1
|
||||
github.com/go-ldap/ldap/v3 v3.4.12
|
||||
github.com/gofiber/fiber/v2 v2.52.10
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azcore v1.18.0
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.8.2
|
||||
github.com/Azure/azure-sdk-for-go/sdk/storage/azblob v1.6.0
|
||||
github.com/DataDog/datadog-go/v5 v5.6.0
|
||||
github.com/aws/aws-sdk-go-v2 v1.36.3
|
||||
github.com/aws/aws-sdk-go-v2/service/s3 v1.79.1
|
||||
github.com/aws/smithy-go v1.22.3
|
||||
github.com/go-ldap/ldap/v3 v3.4.10
|
||||
github.com/gofiber/fiber/v2 v2.52.6
|
||||
github.com/google/go-cmp v0.7.0
|
||||
github.com/google/uuid v1.6.0
|
||||
github.com/hashicorp/vault-client-go v0.4.3
|
||||
github.com/minio/crc64nvme v1.1.1
|
||||
github.com/nats-io/nats.go v1.48.0
|
||||
github.com/oklog/ulid/v2 v2.1.1
|
||||
github.com/pkg/xattr v0.4.12
|
||||
github.com/rabbitmq/amqp091-go v1.10.0
|
||||
github.com/segmentio/kafka-go v0.4.50
|
||||
github.com/nats-io/nats.go v1.41.0
|
||||
github.com/oklog/ulid/v2 v2.1.0
|
||||
github.com/pkg/xattr v0.4.10
|
||||
github.com/segmentio/kafka-go v0.4.47
|
||||
github.com/smira/go-statsd v1.3.4
|
||||
github.com/stretchr/testify v1.11.1
|
||||
github.com/urfave/cli/v2 v2.27.7
|
||||
github.com/valyala/fasthttp v1.69.0
|
||||
github.com/versity/scoutfs-go v0.0.0-20240625221833-95fd765b760b
|
||||
golang.org/x/sync v0.19.0
|
||||
golang.org/x/sys v0.40.0
|
||||
github.com/urfave/cli/v2 v2.27.6
|
||||
github.com/valyala/fasthttp v1.60.0
|
||||
github.com/versity/scoutfs-go v0.0.0-20240325223134-38eb2f5f7d44
|
||||
golang.org/x/sync v0.13.0
|
||||
golang.org/x/sys v0.32.0
|
||||
)
|
||||
|
||||
require (
|
||||
github.com/Azure/azure-sdk-for-go/sdk/internal v1.11.2 // indirect
|
||||
github.com/Azure/go-ntlmssp v0.1.0 // indirect
|
||||
github.com/AzureAD/microsoft-authentication-library-for-go v1.6.0 // indirect
|
||||
github.com/Azure/azure-sdk-for-go/sdk/internal v1.11.0 // indirect
|
||||
github.com/Azure/go-ntlmssp v0.0.0-20221128193559-754e69321358 // indirect
|
||||
github.com/AzureAD/microsoft-authentication-library-for-go v1.4.2 // indirect
|
||||
github.com/Microsoft/go-winio v0.6.2 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.18.17 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/internal/ini v1.8.4 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/signin v1.0.5 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/sso v1.30.9 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/ssooidc v1.35.13 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/sts v1.41.6 // indirect
|
||||
github.com/clipperhouse/stringish v0.1.1 // indirect
|
||||
github.com/clipperhouse/uax29/v2 v2.4.0 // indirect
|
||||
github.com/go-asn1-ber/asn1-ber v1.5.8-0.20250403174932-29230038a667 // indirect
|
||||
github.com/golang-jwt/jwt/v5 v5.3.0 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.30 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/internal/ini v1.8.3 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/sso v1.25.3 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/ssooidc v1.30.1 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/sts v1.33.18 // indirect
|
||||
github.com/go-asn1-ber/asn1-ber v1.5.7 // indirect
|
||||
github.com/golang-jwt/jwt/v5 v5.2.2 // indirect
|
||||
github.com/hashicorp/go-cleanhttp v0.5.2 // indirect
|
||||
github.com/hashicorp/go-retryablehttp v0.7.8 // indirect
|
||||
github.com/hashicorp/go-retryablehttp v0.7.7 // indirect
|
||||
github.com/hashicorp/go-rootcerts v1.0.2 // indirect
|
||||
github.com/hashicorp/go-secure-stdlib/strutil v0.1.2 // indirect
|
||||
github.com/klauspost/cpuid/v2 v2.3.0 // indirect
|
||||
github.com/kylelemons/godebug v1.1.0 // indirect
|
||||
github.com/mitchellh/go-homedir v1.1.0 // indirect
|
||||
github.com/nats-io/nkeys v0.4.12 // indirect
|
||||
github.com/nats-io/nkeys v0.4.10 // indirect
|
||||
github.com/nats-io/nuid v1.0.1 // indirect
|
||||
github.com/pierrec/lz4/v4 v4.1.25 // indirect
|
||||
github.com/pierrec/lz4/v4 v4.1.22 // indirect
|
||||
github.com/pkg/browser v0.0.0-20240102092130-5ac0b6a4141c // indirect
|
||||
github.com/pmezard/go-difflib v1.0.0 // indirect
|
||||
github.com/ryanuber/go-glob v1.0.0 // indirect
|
||||
golang.org/x/crypto v0.47.0 // indirect
|
||||
golang.org/x/net v0.49.0 // indirect
|
||||
golang.org/x/text v0.33.0 // indirect
|
||||
golang.org/x/time v0.14.0 // indirect
|
||||
gopkg.in/yaml.v3 v3.0.1 // indirect
|
||||
golang.org/x/crypto v0.37.0 // indirect
|
||||
golang.org/x/net v0.38.0 // indirect
|
||||
golang.org/x/text v0.24.0 // indirect
|
||||
golang.org/x/time v0.11.0 // indirect
|
||||
)
|
||||
|
||||
require (
|
||||
github.com/andybalholm/brotli v1.2.0 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.7.4 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/config v1.32.7
|
||||
github.com/aws/aws-sdk-go-v2/credentials v1.19.7
|
||||
github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.21.0
|
||||
github.com/aws/aws-sdk-go-v2/internal/configsources v1.4.17 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.7.17 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/internal/v4a v1.4.17 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.13.4 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.9.8 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.13.17 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.19.17 // indirect
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.7 // indirect
|
||||
github.com/klauspost/compress v1.18.3 // indirect
|
||||
github.com/andybalholm/brotli v1.1.1 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.10 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/config v1.29.13
|
||||
github.com/aws/aws-sdk-go-v2/credentials v1.17.66
|
||||
github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.17.71
|
||||
github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.34 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.34 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.34 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.12.3 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.7.0 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.12.15 // indirect
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.18.15 // indirect
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.6 // indirect
|
||||
github.com/klauspost/compress v1.18.0 // indirect
|
||||
github.com/mattn/go-colorable v0.1.14 // indirect
|
||||
github.com/mattn/go-isatty v0.0.20 // indirect
|
||||
github.com/mattn/go-runewidth v0.0.19 // indirect
|
||||
github.com/mattn/go-runewidth v0.0.16 // indirect
|
||||
github.com/rivo/uniseg v0.4.7 // indirect
|
||||
github.com/russross/blackfriday/v2 v2.1.0 // indirect
|
||||
github.com/valyala/bytebufferpool v1.0.0 // indirect
|
||||
github.com/xrash/smetrics v0.0.0-20240521201337-686a1a2994c1 // indirect
|
||||
|
||||
319
go.sum
319
go.sum
@@ -1,104 +1,106 @@
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azcore v1.21.0 h1:fou+2+WFTib47nS+nz/ozhEBnvU96bKHy6LjRsY4E28=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azcore v1.21.0/go.mod h1:t76Ruy8AHvUAC8GfMWJMa0ElSbuIcO03NLpynfbgsPA=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.13.1 h1:Hk5QBxZQC1jb2Fwj6mpzme37xbCDdNTxU7O9eb5+LB4=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.13.1/go.mod h1:IYus9qsFobWIc2YVwe/WPjcnyCkPKtnHAqUYeebc8z0=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azcore v1.18.0 h1:Gt0j3wceWMwPmiazCa8MzMA0MfhmPIz0Qp0FJ6qcM0U=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azcore v1.18.0/go.mod h1:Ot/6aikWnKWi4l9QB7qVSwa8iMphQNqkWALMoNT3rzM=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.8.2 h1:F0gBpfdPLGsw+nsgk6aqqkZS1jiixa5WwFe3fk/T3Ys=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.8.2/go.mod h1:SqINnQ9lVVdRlyC8cd1lCI0SdX4n2paeABd2K8ggfnE=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity/cache v0.3.2 h1:yz1bePFlP5Vws5+8ez6T3HWXPmwOK7Yvq8QxDBD3SKY=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/azidentity/cache v0.3.2/go.mod h1:Pa9ZNPuoNu/GztvBSKk9J1cDJW6vk/n0zLtV4mgd8N8=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/internal v1.11.2 h1:9iefClla7iYpfYWdzPCRDozdmndjTm8DXdpCzPajMgA=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/internal v1.11.2/go.mod h1:XtLgD3ZD34DAaVIIAyG3objl5DynM3CQ/vMcbBNJZGI=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/resourcemanager/storage/armstorage v1.8.1 h1:/Zt+cDPnpC3OVDm/JKLOs7M2DKmLRIIp3XIx9pHHiig=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/resourcemanager/storage/armstorage v1.8.1/go.mod h1:Ng3urmn6dYe8gnbCMoHHVl5APYz2txho3koEkV2o2HA=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/storage/azblob v1.6.4 h1:jWQK1GI+LeGGUKBADtcH2rRqPxYB1Ljwms5gFA2LqrM=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/storage/azblob v1.6.4/go.mod h1:8mwH4klAm9DUgR2EEHyEEAQlRDvLPyg5fQry3y+cDew=
|
||||
github.com/Azure/go-ntlmssp v0.1.0 h1:DjFo6YtWzNqNvQdrwEyr/e4nhU3vRiwenz5QX7sFz+A=
|
||||
github.com/Azure/go-ntlmssp v0.1.0/go.mod h1:NYqdhxd/8aAct/s4qSYZEerdPuH1liG2/X9DiVTbhpk=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/internal v1.11.0 h1:Bg8m3nq/X1DeePkAbCfb6ml6F3F0IunEhE8TMh+lY48=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/internal v1.11.0/go.mod h1:j2chePtV91HrC22tGoRX3sGY42uF13WzmmV80/OdVAA=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/resourcemanager/storage/armstorage v1.6.0 h1:PiSrjRPpkQNjrM8H0WwKMnZUdu1RGMtd/LdGKUrOo+c=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/resourcemanager/storage/armstorage v1.6.0/go.mod h1:oDrbWx4ewMylP7xHivfgixbfGBT6APAwsSoHRKotnIc=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/storage/azblob v1.6.0 h1:UXT0o77lXQrikd1kgwIPQOUect7EoR/+sbP4wQKdzxM=
|
||||
github.com/Azure/azure-sdk-for-go/sdk/storage/azblob v1.6.0/go.mod h1:cTvi54pg19DoT07ekoeMgE/taAwNtCShVeZqA+Iv2xI=
|
||||
github.com/Azure/go-ntlmssp v0.0.0-20221128193559-754e69321358 h1:mFRzDkZVAjdal+s7s0MwaRv9igoPqLRdzOLzw/8Xvq8=
|
||||
github.com/Azure/go-ntlmssp v0.0.0-20221128193559-754e69321358/go.mod h1:chxPXzSsl7ZWRAuOIE23GDNzjWuZquvFlgA8xmpunjU=
|
||||
github.com/AzureAD/microsoft-authentication-extensions-for-go/cache v0.1.1 h1:WJTmL004Abzc5wDB5VtZG2PJk5ndYDgVacGqfirKxjM=
|
||||
github.com/AzureAD/microsoft-authentication-extensions-for-go/cache v0.1.1/go.mod h1:tCcJZ0uHAmvjsVYzEFivsRTN00oz5BEsRgQHu5JZ9WE=
|
||||
github.com/AzureAD/microsoft-authentication-library-for-go v1.6.0 h1:XRzhVemXdgvJqCH0sFfrBUTnUJSBrBf7++ypk+twtRs=
|
||||
github.com/AzureAD/microsoft-authentication-library-for-go v1.6.0/go.mod h1:HKpQxkWaGLJ+D/5H8QRpyQXA1eKjxkFlOMwck5+33Jk=
|
||||
github.com/DataDog/datadog-go/v5 v5.8.2 h1:9IEfH1Mw9AjWwhAMqCAkhbxjuJeMxm2ARX2VdgL+ols=
|
||||
github.com/DataDog/datadog-go/v5 v5.8.2/go.mod h1:K9kcYBlxkcPP8tvvjZZKs/m1edNAUFzBbdpTUKfCsuw=
|
||||
github.com/AzureAD/microsoft-authentication-library-for-go v1.4.2 h1:oygO0locgZJe7PpYPXT5A29ZkwJaPqcva7BVeemZOZs=
|
||||
github.com/AzureAD/microsoft-authentication-library-for-go v1.4.2/go.mod h1:wP83P5OoQ5p6ip3ScPr0BAq0BvuPAvacpEuSzyouqAI=
|
||||
github.com/DataDog/datadog-go/v5 v5.6.0 h1:2oCLxjF/4htd55piM75baflj/KoE6VYS7alEUqFvRDw=
|
||||
github.com/DataDog/datadog-go/v5 v5.6.0/go.mod h1:K9kcYBlxkcPP8tvvjZZKs/m1edNAUFzBbdpTUKfCsuw=
|
||||
github.com/Microsoft/go-winio v0.5.0/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84=
|
||||
github.com/Microsoft/go-winio v0.6.2 h1:F2VQgta7ecxGYO8k3ZZz3RS8fVIXVxONVUPlNERoyfY=
|
||||
github.com/Microsoft/go-winio v0.6.2/go.mod h1:yd8OoFMLzJbo9gZq8j5qaps8bJ9aShtEA8Ipt1oGCvU=
|
||||
github.com/alexbrainman/sspi v0.0.0-20250919150558-7d374ff0d59e h1:4dAU9FXIyQktpoUAgOJK3OTFc/xug0PCXYCqU0FgDKI=
|
||||
github.com/alexbrainman/sspi v0.0.0-20250919150558-7d374ff0d59e/go.mod h1:cEWa1LVoE5KvSD9ONXsZrj0z6KqySlCCNKHlLzbqAt4=
|
||||
github.com/andybalholm/brotli v1.2.0 h1:ukwgCxwYrmACq68yiUqwIWnGY0cTPox/M94sVwToPjQ=
|
||||
github.com/andybalholm/brotli v1.2.0/go.mod h1:rzTDkvFWvIrjDXZHkuS16NPggd91W3kUSvPlQ1pLaKY=
|
||||
github.com/aws/aws-sdk-go-v2 v1.41.1 h1:ABlyEARCDLN034NhxlRUSZr4l71mh+T5KAeGh6cerhU=
|
||||
github.com/aws/aws-sdk-go-v2 v1.41.1/go.mod h1:MayyLB8y+buD9hZqkCW3kX1AKq07Y5pXxtgB+rRFhz0=
|
||||
github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.7.4 h1:489krEF9xIGkOaaX3CE/Be2uWjiXrkCH6gUX+bZA/BU=
|
||||
github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.7.4/go.mod h1:IOAPF6oT9KCsceNTvvYMNHy0+kMF8akOjeDvPENWxp4=
|
||||
github.com/aws/aws-sdk-go-v2/config v1.32.7 h1:vxUyWGUwmkQ2g19n7JY/9YL8MfAIl7bTesIUykECXmY=
|
||||
github.com/aws/aws-sdk-go-v2/config v1.32.7/go.mod h1:2/Qm5vKUU/r7Y+zUk/Ptt2MDAEKAfUtKc1+3U1Mo3oY=
|
||||
github.com/aws/aws-sdk-go-v2/credentials v1.19.7 h1:tHK47VqqtJxOymRrNtUXN5SP/zUTvZKeLx4tH6PGQc8=
|
||||
github.com/aws/aws-sdk-go-v2/credentials v1.19.7/go.mod h1:qOZk8sPDrxhf+4Wf4oT2urYJrYt3RejHSzgAquYeppw=
|
||||
github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.18.17 h1:I0GyV8wiYrP8XpA70g1HBcQO1JlQxCMTW9npl5UbDHY=
|
||||
github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.18.17/go.mod h1:tyw7BOl5bBe/oqvoIeECFJjMdzXoa/dfVz3QQ5lgHGA=
|
||||
github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.21.0 h1:pQZGI0qQXeCHZHMeWzhwPu+4jkWrdrIb2dgpG4OKmco=
|
||||
github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.21.0/go.mod h1:XGq5kImVqQT4HUNbbG+0Y8O74URsPNH7CGPg1s1HW5E=
|
||||
github.com/aws/aws-sdk-go-v2/internal/configsources v1.4.17 h1:xOLELNKGp2vsiteLsvLPwxC+mYmO6OZ8PYgiuPJzF8U=
|
||||
github.com/aws/aws-sdk-go-v2/internal/configsources v1.4.17/go.mod h1:5M5CI3D12dNOtH3/mk6minaRwI2/37ifCURZISxA/IQ=
|
||||
github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.7.17 h1:WWLqlh79iO48yLkj1v3ISRNiv+3KdQoZ6JWyfcsyQik=
|
||||
github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.7.17/go.mod h1:EhG22vHRrvF8oXSTYStZhJc1aUgKtnJe+aOiFEV90cM=
|
||||
github.com/aws/aws-sdk-go-v2/internal/ini v1.8.4 h1:WKuaxf++XKWlHWu9ECbMlha8WOEGm0OUEZqm4K/Gcfk=
|
||||
github.com/aws/aws-sdk-go-v2/internal/ini v1.8.4/go.mod h1:ZWy7j6v1vWGmPReu0iSGvRiise4YI5SkR3OHKTZ6Wuc=
|
||||
github.com/aws/aws-sdk-go-v2/internal/v4a v1.4.17 h1:JqcdRG//czea7Ppjb+g/n4o8i/R50aTBHkA7vu0lK+k=
|
||||
github.com/aws/aws-sdk-go-v2/internal/v4a v1.4.17/go.mod h1:CO+WeGmIdj/MlPel2KwID9Gt7CNq4M65HUfBW97liM0=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.13.4 h1:0ryTNEdJbzUCEWkVXEXoqlXV72J5keC1GvILMOuD00E=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.13.4/go.mod h1:HQ4qwNZh32C3CBeO6iJLQlgtMzqeG17ziAA/3KDJFow=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.9.8 h1:Z5EiPIzXKewUQK0QTMkutjiaPVeVYXX7KIqhXu/0fXs=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.9.8/go.mod h1:FsTpJtvC4U1fyDXk7c71XoDv3HlRm8V3NiYLeYLh5YE=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.13.17 h1:RuNSMoozM8oXlgLG/n6WLaFGoea7/CddrCfIiSA+xdY=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.13.17/go.mod h1:F2xxQ9TZz5gDWsclCtPQscGpP0VUOc8RqgFM3vDENmU=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.19.17 h1:bGeHBsGZx0Dvu/eJC0Lh9adJa3M1xREcndxLNZlve2U=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.19.17/go.mod h1:dcW24lbU0CzHusTE8LLHhRLI42ejmINN8Lcr22bwh/g=
|
||||
github.com/aws/aws-sdk-go-v2/service/s3 v1.95.1 h1:C2dUPSnEpy4voWFIq3JNd8gN0Y5vYGDo44eUE58a/p8=
|
||||
github.com/aws/aws-sdk-go-v2/service/s3 v1.95.1/go.mod h1:5jggDlZ2CLQhwJBiZJb4vfk4f0GxWdEDruWKEJ1xOdo=
|
||||
github.com/aws/aws-sdk-go-v2/service/signin v1.0.5 h1:VrhDvQib/i0lxvr3zqlUwLwJP4fpmpyD9wYG1vfSu+Y=
|
||||
github.com/aws/aws-sdk-go-v2/service/signin v1.0.5/go.mod h1:k029+U8SY30/3/ras4G/Fnv/b88N4mAfliNn08Dem4M=
|
||||
github.com/aws/aws-sdk-go-v2/service/sso v1.30.9 h1:v6EiMvhEYBoHABfbGB4alOYmCIrcgyPPiBE1wZAEbqk=
|
||||
github.com/aws/aws-sdk-go-v2/service/sso v1.30.9/go.mod h1:yifAsgBxgJWn3ggx70A3urX2AN49Y5sJTD1UQFlfqBw=
|
||||
github.com/aws/aws-sdk-go-v2/service/ssooidc v1.35.13 h1:gd84Omyu9JLriJVCbGApcLzVR3XtmC4ZDPcAI6Ftvds=
|
||||
github.com/aws/aws-sdk-go-v2/service/ssooidc v1.35.13/go.mod h1:sTGThjphYE4Ohw8vJiRStAcu3rbjtXRsdNB0TvZ5wwo=
|
||||
github.com/aws/aws-sdk-go-v2/service/sts v1.41.6 h1:5fFjR/ToSOzB2OQ/XqWpZBmNvmP/pJ1jOWYlFDJTjRQ=
|
||||
github.com/aws/aws-sdk-go-v2/service/sts v1.41.6/go.mod h1:qgFDZQSD/Kys7nJnVqYlWKnh0SSdMjAi0uSwON4wgYQ=
|
||||
github.com/aws/smithy-go v1.24.0 h1:LpilSUItNPFr1eY85RYgTIg5eIEPtvFbskaFcmmIUnk=
|
||||
github.com/aws/smithy-go v1.24.0/go.mod h1:LEj2LM3rBRQJxPZTB4KuzZkaZYnZPnvgIhb4pu07mx0=
|
||||
github.com/clipperhouse/stringish v0.1.1 h1:+NSqMOr3GR6k1FdRhhnXrLfztGzuG+VuFDfatpWHKCs=
|
||||
github.com/clipperhouse/stringish v0.1.1/go.mod h1:v/WhFtE1q0ovMta2+m+UbpZ+2/HEXNWYXQgCt4hdOzA=
|
||||
github.com/clipperhouse/uax29/v2 v2.4.0 h1:RXqE/l5EiAbA4u97giimKNlmpvkmz+GrBVTelsoXy9g=
|
||||
github.com/clipperhouse/uax29/v2 v2.4.0/go.mod h1:Wn1g7MK6OoeDT0vL+Q0SQLDz/KpfsVRgg6W7ihQeh4g=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.7 h1:zbFlGlXEAKlwXpmvle3d8Oe3YnkKIK4xSRTd3sHPnBo=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.7/go.mod h1:oOW0eioCTA6cOiMLiUPZOpcVxMig6NIQQ7OS05n1F4g=
|
||||
github.com/alexbrainman/sspi v0.0.0-20231016080023-1a75b4708caa h1:LHTHcTQiSGT7VVbI0o4wBRNQIgn917usHWOd6VAffYI=
|
||||
github.com/alexbrainman/sspi v0.0.0-20231016080023-1a75b4708caa/go.mod h1:cEWa1LVoE5KvSD9ONXsZrj0z6KqySlCCNKHlLzbqAt4=
|
||||
github.com/andybalholm/brotli v1.1.1 h1:PR2pgnyFznKEugtsUo0xLdDop5SKXd5Qf5ysW+7XdTA=
|
||||
github.com/andybalholm/brotli v1.1.1/go.mod h1:05ib4cKhjx3OQYUY22hTVd34Bc8upXjOLL2rKwwZBoA=
|
||||
github.com/aws/aws-sdk-go-v2 v1.36.3 h1:mJoei2CxPutQVxaATCzDUjcZEjVRdpsiiXi2o38yqWM=
|
||||
github.com/aws/aws-sdk-go-v2 v1.36.3/go.mod h1:LLXuLpgzEbD766Z5ECcRmi8AzSwfZItDtmABVkRLGzg=
|
||||
github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.10 h1:zAybnyUQXIZ5mok5Jqwlf58/TFE7uvd3IAsa1aF9cXs=
|
||||
github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.10/go.mod h1:qqvMj6gHLR/EXWZw4ZbqlPbQUyenf4h82UQUlKc+l14=
|
||||
github.com/aws/aws-sdk-go-v2/config v1.29.13 h1:RgdPqWoE8nPpIekpVpDJsBckbqT4Liiaq9f35pbTh1Y=
|
||||
github.com/aws/aws-sdk-go-v2/config v1.29.13/go.mod h1:NI28qs/IOUIRhsR7GQ/JdexoqRN9tDxkIrYZq0SOF44=
|
||||
github.com/aws/aws-sdk-go-v2/credentials v1.17.66 h1:aKpEKaTy6n4CEJeYI1MNj97oSDLi4xro3UzQfwf5RWE=
|
||||
github.com/aws/aws-sdk-go-v2/credentials v1.17.66/go.mod h1:xQ5SusDmHb/fy55wU0QqTy0yNfLqxzec59YcsRZB+rI=
|
||||
github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.30 h1:x793wxmUWVDhshP8WW2mlnXuFrO4cOd3HLBroh1paFw=
|
||||
github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.30/go.mod h1:Jpne2tDnYiFascUEs2AWHJL9Yp7A5ZVy3TNyxaAjD6M=
|
||||
github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.17.71 h1:s43gLuY+zGmtpx+KybfFP4IckopmTfDOPdlf/L++N5I=
|
||||
github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.17.71/go.mod h1:KH6wWmY3O3c/jVAjHk0MGzVAFDxkOSt42Eoe4ZO4ge0=
|
||||
github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.34 h1:ZK5jHhnrioRkUNOc+hOgQKlUL5JeC3S6JgLxtQ+Rm0Q=
|
||||
github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.34/go.mod h1:p4VfIceZokChbA9FzMbRGz5OV+lekcVtHlPKEO0gSZY=
|
||||
github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.34 h1:SZwFm17ZUNNg5Np0ioo/gq8Mn6u9w19Mri8DnJ15Jf0=
|
||||
github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.34/go.mod h1:dFZsC0BLo346mvKQLWmoJxT+Sjp+qcVR1tRVHQGOH9Q=
|
||||
github.com/aws/aws-sdk-go-v2/internal/ini v1.8.3 h1:bIqFDwgGXXN1Kpp99pDOdKMTTb5d2KyU5X/BZxjOkRo=
|
||||
github.com/aws/aws-sdk-go-v2/internal/ini v1.8.3/go.mod h1:H5O/EsxDWyU+LP/V8i5sm8cxoZgc2fdNR9bxlOFrQTo=
|
||||
github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.34 h1:ZNTqv4nIdE/DiBfUUfXcLZ/Spcuz+RjeziUtNJackkM=
|
||||
github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.34/go.mod h1:zf7Vcd1ViW7cPqYWEHLHJkS50X0JS2IKz9Cgaj6ugrs=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.12.3 h1:eAh2A4b5IzM/lum78bZ590jy36+d/aFLgKF/4Vd1xPE=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.12.3/go.mod h1:0yKJC/kb8sAnmlYa6Zs3QVYqaC8ug2AbnNChv5Ox3uA=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.7.0 h1:lguz0bmOoGzozP9XfRJR1QIayEYo+2vP/No3OfLF0pU=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.7.0/go.mod h1:iu6FSzgt+M2/x3Dk8zhycdIcHjEFb36IS8HVUVFoMg0=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.12.15 h1:dM9/92u2F1JbDaGooxTq18wmmFzbJRfXfVfy96/1CXM=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.12.15/go.mod h1:SwFBy2vjtA0vZbjjaFtfN045boopadnoVPhu4Fv66vY=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.18.15 h1:moLQUoVq91LiqT1nbvzDukyqAlCv89ZmwaHw/ZFlFZg=
|
||||
github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.18.15/go.mod h1:ZH34PJUc8ApjBIfgQCFvkWcUDBtl/WTD+uiYHjd8igA=
|
||||
github.com/aws/aws-sdk-go-v2/service/s3 v1.79.1 h1:2Ku1xwAohSSXHR1tpAnyVDSQSxoDMA+/NZBytW+f4qg=
|
||||
github.com/aws/aws-sdk-go-v2/service/s3 v1.79.1/go.mod h1:U5SNqwhXB3Xe6F47kXvWihPl/ilGaEDe8HD/50Z9wxc=
|
||||
github.com/aws/aws-sdk-go-v2/service/sso v1.25.3 h1:1Gw+9ajCV1jogloEv1RRnvfRFia2cL6c9cuKV2Ps+G8=
|
||||
github.com/aws/aws-sdk-go-v2/service/sso v1.25.3/go.mod h1:qs4a9T5EMLl/Cajiw2TcbNt2UNo/Hqlyp+GiuG4CFDI=
|
||||
github.com/aws/aws-sdk-go-v2/service/ssooidc v1.30.1 h1:hXmVKytPfTy5axZ+fYbR5d0cFmC3JvwLm5kM83luako=
|
||||
github.com/aws/aws-sdk-go-v2/service/ssooidc v1.30.1/go.mod h1:MlYRNmYu/fGPoxBQVvBYr9nyr948aY/WLUvwBMBJubs=
|
||||
github.com/aws/aws-sdk-go-v2/service/sts v1.33.18 h1:xz7WvTMfSStb9Y8NpCT82FXLNC3QasqBfuAFHY4Pk5g=
|
||||
github.com/aws/aws-sdk-go-v2/service/sts v1.33.18/go.mod h1:cQnB8CUnxbMU82JvlqjKR2HBOm3fe9pWorWBza6MBJ4=
|
||||
github.com/aws/smithy-go v1.22.3 h1:Z//5NuZCSW6R4PhQ93hShNbyBbn8BWCmCVCt+Q8Io5k=
|
||||
github.com/aws/smithy-go v1.22.3/go.mod h1:t1ufH5HMublsJYulve2RKmHDC15xu1f26kHCp/HgceI=
|
||||
github.com/cespare/xxhash/v2 v2.3.0 h1:UL815xU9SqsFlibzuggzjXhog7bL6oX9BbNZnL2UFvs=
|
||||
github.com/cespare/xxhash/v2 v2.3.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.6 h1:XJtiaUW6dEEqVuZiMTn1ldk455QWwEIsMIJlo5vtkx0=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.6/go.mod h1:oOW0eioCTA6cOiMLiUPZOpcVxMig6NIQQ7OS05n1F4g=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/dgryski/go-rendezvous v0.0.0-20200823014737-9f7001d12a5f h1:lO4WD4F/rVNCu3HqELle0jiPLLBs70cWOduZpkS1E78=
|
||||
github.com/dgryski/go-rendezvous v0.0.0-20200823014737-9f7001d12a5f/go.mod h1:cuUVRXasLTGF7a8hSLbxyZXjz+1KgoB3wDUb6vlszIc=
|
||||
github.com/fatih/color v1.16.0 h1:zmkK9Ngbjj+K0yRhTVONQh1p/HknKYSlNT+vZCzyokM=
|
||||
github.com/fatih/color v1.16.0/go.mod h1:fL2Sau1YI5c0pdGEVCbKQbLXB6edEj1ZgiY4NijnWvE=
|
||||
github.com/go-asn1-ber/asn1-ber v1.5.8-0.20250403174932-29230038a667 h1:BP4M0CvQ4S3TGls2FvczZtj5Re/2ZzkV9VwqPHH/3Bo=
|
||||
github.com/go-asn1-ber/asn1-ber v1.5.8-0.20250403174932-29230038a667/go.mod h1:hEBeB/ic+5LoWskz+yKT7vGhhPYkProFKoKdwZRWMe0=
|
||||
github.com/go-ldap/ldap/v3 v3.4.12 h1:1b81mv7MagXZ7+1r7cLTWmyuTqVqdwbtJSjC0DAp9s4=
|
||||
github.com/go-ldap/ldap/v3 v3.4.12/go.mod h1:+SPAGcTtOfmGsCb3h1RFiq4xpp4N636G75OEace8lNo=
|
||||
github.com/gofiber/fiber/v2 v2.52.10 h1:jRHROi2BuNti6NYXmZ6gbNSfT3zj/8c0xy94GOU5elY=
|
||||
github.com/gofiber/fiber/v2 v2.52.10/go.mod h1:YEcBbO/FB+5M1IZNBP9FO3J9281zgPAreiI1oqg8nDw=
|
||||
github.com/golang-jwt/jwt/v5 v5.3.0 h1:pv4AsKCKKZuqlgs5sUmn4x8UlGa0kEVt/puTpKx9vvo=
|
||||
github.com/golang-jwt/jwt/v5 v5.3.0/go.mod h1:fxCRLWMO43lRc8nhHWY6LGqRcf+1gQWArsqaEUEa5bE=
|
||||
github.com/go-asn1-ber/asn1-ber v1.5.7 h1:DTX+lbVTWaTw1hQ+PbZPlnDZPEIs0SS/GCZAl535dDk=
|
||||
github.com/go-asn1-ber/asn1-ber v1.5.7/go.mod h1:hEBeB/ic+5LoWskz+yKT7vGhhPYkProFKoKdwZRWMe0=
|
||||
github.com/go-ldap/ldap/v3 v3.4.10 h1:ot/iwPOhfpNVgB1o+AVXljizWZ9JTp7YF5oeyONmcJU=
|
||||
github.com/go-ldap/ldap/v3 v3.4.10/go.mod h1:JXh4Uxgi40P6E9rdsYqpUtbW46D9UTjJ9QSwGRznplY=
|
||||
github.com/gofiber/fiber/v2 v2.52.6 h1:Rfp+ILPiYSvvVuIPvxrBns+HJp8qGLDnLJawAu27XVI=
|
||||
github.com/gofiber/fiber/v2 v2.52.6/go.mod h1:YEcBbO/FB+5M1IZNBP9FO3J9281zgPAreiI1oqg8nDw=
|
||||
github.com/golang-jwt/jwt/v5 v5.2.2 h1:Rl4B7itRWVtYIHFrSNd7vhTiz9UpLdi6gZhZ3wEeDy8=
|
||||
github.com/golang-jwt/jwt/v5 v5.2.2/go.mod h1:pqrtFR0X4osieyHYxtmOUWsAWrfe1Q5UVIyoH402zdk=
|
||||
github.com/golang/mock v1.6.0/go.mod h1:p6yTPP+5HYm5mzsMV8JkE6ZKdX+/wYM6Hr+LicevLPs=
|
||||
github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY=
|
||||
github.com/google/go-cmp v0.7.0 h1:wk8382ETsv4JYUZwIsn6YpYiWiBsYLSJiTsyBybVuN8=
|
||||
github.com/google/go-cmp v0.7.0/go.mod h1:pXiqmnSA92OHEEa9HXL2W4E7lf9JzCmGVUdgjX3N/iU=
|
||||
github.com/google/uuid v1.6.0 h1:NIvaJDMOsjHA8n1jAhLSgzrAzy1Hgr+hNrb57e+94F0=
|
||||
github.com/google/uuid v1.6.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
|
||||
github.com/gorilla/securecookie v1.1.1/go.mod h1:ra0sb63/xPlUeL+yeDciTfxMRAA+MP+HVt/4epWDjd4=
|
||||
github.com/gorilla/sessions v1.2.1/go.mod h1:dk2InVEVJ0sfLlnXv9EAgkf6ecYs/i80K/zI+bUmuGM=
|
||||
github.com/hashicorp/go-cleanhttp v0.5.2 h1:035FKYIWjmULyFRBKPs8TBQoi0x6d9G4xc9neXJWAZQ=
|
||||
github.com/hashicorp/go-cleanhttp v0.5.2/go.mod h1:kO/YDlP8L1346E6Sodw+PrpBSV4/SoxCXGY6BqNFT48=
|
||||
github.com/hashicorp/go-hclog v1.6.3 h1:Qr2kF+eVWjTiYmU7Y31tYlP1h0q/X3Nl3tPGdaB11/k=
|
||||
github.com/hashicorp/go-hclog v1.6.3/go.mod h1:W4Qnvbt70Wk/zYJryRzDRU/4r0kIg0PVHBcfoyhpF5M=
|
||||
github.com/hashicorp/go-retryablehttp v0.7.8 h1:ylXZWnqa7Lhqpk0L1P1LzDtGcCR0rPVUrx/c8Unxc48=
|
||||
github.com/hashicorp/go-retryablehttp v0.7.8/go.mod h1:rjiScheydd+CxvumBsIrFKlx3iS0jrZ7LvzFGFmuKbw=
|
||||
github.com/hashicorp/go-retryablehttp v0.7.7 h1:C8hUCYzor8PIfXHa4UrZkU4VvK8o9ISHxT2Q8+VepXU=
|
||||
github.com/hashicorp/go-retryablehttp v0.7.7/go.mod h1:pkQpWZeYWskR+D1tR2O5OcBFOxfA7DoAO6xtkuQnHTk=
|
||||
github.com/hashicorp/go-rootcerts v1.0.2 h1:jzhAVGtqPKbwpyCPELlgNWhE1znq+qwJtW5Oi2viEzc=
|
||||
github.com/hashicorp/go-rootcerts v1.0.2/go.mod h1:pqUvnprVnM5bf7AOirdbb01K4ccR319Vf4pU3K5EGc8=
|
||||
github.com/hashicorp/go-secure-stdlib/strutil v0.1.2 h1:kes8mmyCpxJsI7FTwtzRqEy9CdjCtrXrXGuOpxEA7Ts=
|
||||
github.com/hashicorp/go-secure-stdlib/strutil v0.1.2/go.mod h1:Gou2R9+il93BqX25LAKCLuM+y9U2T4hlwvT1yprcna4=
|
||||
github.com/hashicorp/go-uuid v1.0.2/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
|
||||
github.com/hashicorp/go-uuid v1.0.3 h1:2gKiV6YVmrJ1i2CKKa9obLvRieoRGviZFL26PcT/Co8=
|
||||
github.com/hashicorp/go-uuid v1.0.3/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
|
||||
github.com/hashicorp/vault-client-go v0.4.3 h1:zG7STGVgn/VK6rnZc0k8PGbfv2x/sJExRKHSUg3ljWc=
|
||||
@@ -115,78 +117,73 @@ github.com/jcmturner/gokrb5/v8 v8.4.4 h1:x1Sv4HaTpepFkXbt2IkL29DXRf8sOfZXo8eRKh6
|
||||
github.com/jcmturner/gokrb5/v8 v8.4.4/go.mod h1:1btQEpgT6k+unzCwX1KdWMEwPPkkgBtP+F6aCACiMrs=
|
||||
github.com/jcmturner/rpc/v2 v2.0.3 h1:7FXXj8Ti1IaVFpSAziCZWNzbNuZmnvw/i6CqLNdWfZY=
|
||||
github.com/jcmturner/rpc/v2 v2.0.3/go.mod h1:VUJYCIDm3PVOEHw8sgt091/20OJjskO/YJki3ELg/Hc=
|
||||
github.com/keybase/go-keychain v0.0.1 h1:way+bWYa6lDppZoZcgMbYsvC7GxljxrskdNInRtuthU=
|
||||
github.com/keybase/go-keychain v0.0.1/go.mod h1:PdEILRW3i9D8JcdM+FmY6RwkHGnhHxXwkPPMeUgOK1k=
|
||||
github.com/klauspost/compress v1.18.3 h1:9PJRvfbmTabkOX8moIpXPbMMbYN60bWImDDU7L+/6zw=
|
||||
github.com/klauspost/compress v1.18.3/go.mod h1:R0h/fSBs8DE4ENlcrlib3PsXS61voFxhIs2DeRhCvJ4=
|
||||
github.com/klauspost/cpuid/v2 v2.3.0 h1:S4CRMLnYUhGeDFDqkGriYKdfoFlDnMtqTiI/sFzhA9Y=
|
||||
github.com/klauspost/cpuid/v2 v2.3.0/go.mod h1:hqwkgyIinND0mEev00jJYCxPNVRVXFQeu1XKlok6oO0=
|
||||
github.com/kr/pretty v0.3.1 h1:flRD4NNwYAUpkphVc1HcthR4KEIFJ65n8Mw5qdRn3LE=
|
||||
github.com/kr/pretty v0.3.1/go.mod h1:hoEshYVHaxMs3cyo3Yncou5ZscifuDolrwPKZanG3xk=
|
||||
github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY=
|
||||
github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE=
|
||||
github.com/keybase/go-keychain v0.0.0-20231219164618-57a3676c3af6 h1:IsMZxCuZqKuao2vNdfD82fjjgPLfyHLpR41Z88viRWs=
|
||||
github.com/keybase/go-keychain v0.0.0-20231219164618-57a3676c3af6/go.mod h1:3VeWNIJaW+O5xpRQbPp0Ybqu1vJd/pm7s2F473HRrkw=
|
||||
github.com/klauspost/compress v1.15.9/go.mod h1:PhcZ0MbTNciWF3rruxRgKxI5NkcHHrHUDtV4Yw2GlzU=
|
||||
github.com/klauspost/compress v1.18.0 h1:c/Cqfb0r+Yi+JtIEq73FWXVkRonBlf0CRNYc8Zttxdo=
|
||||
github.com/klauspost/compress v1.18.0/go.mod h1:2Pp+KzxcywXVXMr50+X0Q/Lsb43OQHYWRCY2AiWywWQ=
|
||||
github.com/kylelemons/godebug v1.1.0 h1:RPNrshWIDI6G2gRW9EHilWtl7Z6Sb1BR0xunSBf0SNc=
|
||||
github.com/kylelemons/godebug v1.1.0/go.mod h1:9/0rRGxNHcop5bhtWyNeEfOS8JIWk580+fNqagV/RAw=
|
||||
github.com/mattn/go-colorable v0.1.14 h1:9A9LHSqF/7dyVVX6g0U9cwm9pG3kP9gSzcuIPHPsaIE=
|
||||
github.com/mattn/go-colorable v0.1.14/go.mod h1:6LmQG8QLFO4G5z1gPvYEzlUgJ2wF+stgPZH1UqBm1s8=
|
||||
github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
|
||||
github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
|
||||
github.com/mattn/go-runewidth v0.0.19 h1:v++JhqYnZuu5jSKrk9RbgF5v4CGUjqRfBm05byFGLdw=
|
||||
github.com/mattn/go-runewidth v0.0.19/go.mod h1:XBkDxAl56ILZc9knddidhrOlY5R/pDhgLpndooCuJAs=
|
||||
github.com/minio/crc64nvme v1.1.1 h1:8dwx/Pz49suywbO+auHCBpCtlW1OfpcLN7wYgVR6wAI=
|
||||
github.com/minio/crc64nvme v1.1.1/go.mod h1:eVfm2fAzLlxMdUGc0EEBGSMmPwmXD5XiNRpnu9J3bvg=
|
||||
github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc=
|
||||
github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
||||
github.com/mitchellh/go-homedir v1.1.0 h1:lukF9ziXFxDFPkA1vsr5zpc1XuPDn/wFntq5mG+4E0Y=
|
||||
github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
|
||||
github.com/nats-io/nats.go v1.48.0 h1:pSFyXApG+yWU/TgbKCjmm5K4wrHu86231/w84qRVR+U=
|
||||
github.com/nats-io/nats.go v1.48.0/go.mod h1:iRWIPokVIFbVijxuMQq4y9ttaBTMe0SFdlZfMDd+33g=
|
||||
github.com/nats-io/nkeys v0.4.12 h1:nssm7JKOG9/x4J8II47VWCL1Ds29avyiQDRn0ckMvDc=
|
||||
github.com/nats-io/nkeys v0.4.12/go.mod h1:MT59A1HYcjIcyQDJStTfaOY6vhy9XTUjOFo+SVsvpBg=
|
||||
github.com/nats-io/nats.go v1.41.0 h1:PzxEva7fflkd+n87OtQTXqCTyLfIIMFJBpyccHLE2Ko=
|
||||
github.com/nats-io/nats.go v1.41.0/go.mod h1:wV73x0FSI/orHPSYoyMeJB+KajMDoWyXmFaRrrYaaTo=
|
||||
github.com/nats-io/nkeys v0.4.10 h1:glmRrpCmYLHByYcePvnTBEAwawwapjCPMjy2huw20wc=
|
||||
github.com/nats-io/nkeys v0.4.10/go.mod h1:OjRrnIKnWBFl+s4YK5ChQfvHP2fxqZexrKJoVVyWB3U=
|
||||
github.com/nats-io/nuid v1.0.1 h1:5iA8DT8V7q8WK2EScv2padNa/rTESc1KdnPw4TC2paw=
|
||||
github.com/nats-io/nuid v1.0.1/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c=
|
||||
github.com/oklog/ulid/v2 v2.1.1 h1:suPZ4ARWLOJLegGFiZZ1dFAkqzhMjL3J1TzI+5wHz8s=
|
||||
github.com/oklog/ulid/v2 v2.1.1/go.mod h1:rcEKHmBBKfef9DhnvX7y1HZBYxjXb0cP5ExxNsTT1QQ=
|
||||
github.com/oklog/ulid/v2 v2.1.0 h1:+9lhoxAP56we25tyYETBBY1YLA2SaoLvUFgrP2miPJU=
|
||||
github.com/oklog/ulid/v2 v2.1.0/go.mod h1:rcEKHmBBKfef9DhnvX7y1HZBYxjXb0cP5ExxNsTT1QQ=
|
||||
github.com/pborman/getopt v0.0.0-20170112200414-7148bc3a4c30/go.mod h1:85jBQOZwpVEaDAr341tbn15RS4fCAsIst0qp7i8ex1o=
|
||||
github.com/pierrec/lz4/v4 v4.1.25 h1:kocOqRffaIbU5djlIBr7Wh+cx82C0vtFb0fOurZHqD0=
|
||||
github.com/pierrec/lz4/v4 v4.1.25/go.mod h1:EoQMVJgeeEOMsCqCzqFm2O0cJvljX2nGZjcRIPL34O4=
|
||||
github.com/pierrec/lz4/v4 v4.1.15/go.mod h1:gZWDp/Ze/IJXGXf23ltt2EXimqmTUXEy0GFuRQyBid4=
|
||||
github.com/pierrec/lz4/v4 v4.1.22 h1:cKFw6uJDK+/gfw5BcDL0JL5aBsAFdsIT18eRtLj7VIU=
|
||||
github.com/pierrec/lz4/v4 v4.1.22/go.mod h1:gZWDp/Ze/IJXGXf23ltt2EXimqmTUXEy0GFuRQyBid4=
|
||||
github.com/pkg/browser v0.0.0-20240102092130-5ac0b6a4141c h1:+mdjkGKdHQG3305AYmdv1U2eRNDiU2ErMBj1gwrq8eQ=
|
||||
github.com/pkg/browser v0.0.0-20240102092130-5ac0b6a4141c/go.mod h1:7rwL4CYBLnjLxUqIJNnCWiEdr3bn6IUYi15bNlnbCCU=
|
||||
github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pkg/xattr v0.4.12 h1:rRTkSyFNTRElv6pkA3zpjHpQ90p/OdHQC1GmGh1aTjM=
|
||||
github.com/pkg/xattr v0.4.12/go.mod h1:di8WF84zAKk8jzR1UBTEWh9AUlIZZ7M/JNt8e9B6ktU=
|
||||
github.com/pkg/xattr v0.4.10 h1:Qe0mtiNFHQZ296vRgUjRCoPHPqH7VdTOrZx3g0T+pGA=
|
||||
github.com/pkg/xattr v0.4.10/go.mod h1:di8WF84zAKk8jzR1UBTEWh9AUlIZZ7M/JNt8e9B6ktU=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/rabbitmq/amqp091-go v1.10.0 h1:STpn5XsHlHGcecLmMFCtg7mqq0RnD+zFr4uzukfVhBw=
|
||||
github.com/rabbitmq/amqp091-go v1.10.0/go.mod h1:Hy4jKW5kQART1u+JkDTF9YYOQUHXqMuhrgxOEeS7G4o=
|
||||
github.com/rogpeppe/go-internal v1.12.0 h1:exVL4IDcn6na9z1rAb56Vxr+CgyK3nn3O+epU5NdKM8=
|
||||
github.com/rogpeppe/go-internal v1.12.0/go.mod h1:E+RYuTGaKKdloAfM02xzb0FW3Paa99yedzYV+kq4uf4=
|
||||
github.com/redis/go-redis/v9 v9.7.0 h1:HhLSs+B6O021gwzl+locl0zEDnyNkxMtf/Z3NNBMa9E=
|
||||
github.com/redis/go-redis/v9 v9.7.0/go.mod h1:f6zhXITC7JUJIlPEiBOTXxJgPLdZcA93GewI7inzyWw=
|
||||
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
||||
github.com/rivo/uniseg v0.4.7 h1:WUdvkW8uEhrYfLC4ZzdpI2ztxP1I582+49Oc5Mq64VQ=
|
||||
github.com/rivo/uniseg v0.4.7/go.mod h1:FN3SvrM+Zdj16jyLfmOkMNblXMcoc8DfTHruCPUcx88=
|
||||
github.com/russross/blackfriday/v2 v2.1.0 h1:JIOH55/0cWyOuilr9/qlrm0BSXldqnqwMsf35Ld67mk=
|
||||
github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
|
||||
github.com/ryanuber/go-glob v1.0.0 h1:iQh3xXAumdQ+4Ufa5b25cRpC5TYKlno6hsv6Cb3pkBk=
|
||||
github.com/ryanuber/go-glob v1.0.0/go.mod h1:807d1WSdnB0XRJzKNil9Om6lcp/3a0v4qIHxIXzX/Yc=
|
||||
github.com/segmentio/kafka-go v0.4.50 h1:mcyC3tT5WeyWzrFbd6O374t+hmcu1NKt2Pu1L3QaXmc=
|
||||
github.com/segmentio/kafka-go v0.4.50/go.mod h1:Y1gn60kzLEEaW28YshXyk2+VCUKbJ3Qr6DrnT3i4+9E=
|
||||
github.com/segmentio/kafka-go v0.4.47 h1:IqziR4pA3vrZq7YdRxaT3w1/5fvIH5qpCwstUanQQB0=
|
||||
github.com/segmentio/kafka-go v0.4.47/go.mod h1:HjF6XbOKh0Pjlkr5GVZxt6CsjjwnmhVOfURM5KMd8qg=
|
||||
github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0=
|
||||
github.com/smira/go-statsd v1.3.4 h1:kBYWcLSGT+qC6JVbvfz48kX7mQys32fjDOPrfmsSx2c=
|
||||
github.com/smira/go-statsd v1.3.4/go.mod h1:RjdsESPgDODtg1VpVVf9MJrEW2Hw0wtRNbmB1CAhu6A=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw=
|
||||
github.com/stretchr/objx v0.5.0 h1:1zr/of2m5FGMsad5YfcqgdqdWrIhu+EBEJRhR1U7z/c=
|
||||
github.com/stretchr/objx v0.5.0/go.mod h1:Yh+to48EsGEfYuaHDzXPcE3xhTkx73EhmCGUpEOglKo=
|
||||
github.com/stretchr/objx v0.5.2 h1:xuMeJ0Sdp5ZMRXx/aWO6RZxdr3beISkG5/G/aIRr3pY=
|
||||
github.com/stretchr/objx v0.5.2/go.mod h1:FRsXN1f5AsAjCGJKqEizvkpNtU+EGNCLh3NxZ/8L+MA=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||
github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||
github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU=
|
||||
github.com/stretchr/testify v1.8.1/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4=
|
||||
github.com/stretchr/testify v1.11.1 h1:7s2iGBzp5EwR7/aIZr8ao5+dra3wiQyKjjFuvgVKu7U=
|
||||
github.com/stretchr/testify v1.11.1/go.mod h1:wZwfW3scLgRK+23gO65QZefKpKQRnfz6sD981Nm4B6U=
|
||||
github.com/urfave/cli/v2 v2.27.7 h1:bH59vdhbjLv3LAvIu6gd0usJHgoTTPhCFib8qqOwXYU=
|
||||
github.com/urfave/cli/v2 v2.27.7/go.mod h1:CyNAG/xg+iAOg0N4MPGZqVmv2rCoP267496AOXUZjA4=
|
||||
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||
github.com/urfave/cli/v2 v2.27.6 h1:VdRdS98FNhKZ8/Az8B7MTyGQmpIr36O1EHybx/LaZ4g=
|
||||
github.com/urfave/cli/v2 v2.27.6/go.mod h1:3Sevf16NykTbInEnD0yKkjDAeZDS0A6bzhBH5hrMvTQ=
|
||||
github.com/valyala/bytebufferpool v1.0.0 h1:GqA5TC/0021Y/b9FG4Oi9Mr3q7XYx6KllzawFIhcdPw=
|
||||
github.com/valyala/bytebufferpool v1.0.0/go.mod h1:6bBcMArwyJ5K/AmCkWv1jt77kVWyCJ6HpOuEn7z0Csc=
|
||||
github.com/valyala/fasthttp v1.69.0 h1:fNLLESD2SooWeh2cidsuFtOcrEi4uB4m1mPrkJMZyVI=
|
||||
github.com/valyala/fasthttp v1.69.0/go.mod h1:4wA4PfAraPlAsJ5jMSqCE2ug5tqUPwKXxVj8oNECGcw=
|
||||
github.com/versity/scoutfs-go v0.0.0-20240625221833-95fd765b760b h1:kuqsuYRMG1c6YXBAQvWO7CiurlpYtjDJWI6oZ2K/ZZE=
|
||||
github.com/versity/scoutfs-go v0.0.0-20240625221833-95fd765b760b/go.mod h1:gJsq73k+4685y+rbDIpPY8i/5GbsiwP6JFoFyUDB1fQ=
|
||||
github.com/valyala/fasthttp v1.60.0 h1:kBRYS0lOhVJ6V+bYN8PqAHELKHtXqwq9zNMLKx1MBsw=
|
||||
github.com/valyala/fasthttp v1.60.0/go.mod h1:iY4kDgV3Gc6EqhRZ8icqcmlG6bqhcDXfuHgTO4FXCvc=
|
||||
github.com/versity/scoutfs-go v0.0.0-20240325223134-38eb2f5f7d44 h1:Wx1o3pNrCzsHIIDyZ2MLRr6tF/1FhAr7HNDn80QqDWE=
|
||||
github.com/versity/scoutfs-go v0.0.0-20240325223134-38eb2f5f7d44/go.mod h1:gJsq73k+4685y+rbDIpPY8i/5GbsiwP6JFoFyUDB1fQ=
|
||||
github.com/xdg-go/pbkdf2 v1.0.0 h1:Su7DPu48wXMwC3bs7MCNG+z4FhcyEuz5dlvchbq0B0c=
|
||||
github.com/xdg-go/pbkdf2 v1.0.0/go.mod h1:jrpuAogTd400dnrH08LKmI/xc1MbPOebTwRqcT5RDeI=
|
||||
github.com/xdg-go/scram v1.1.2 h1:FHX5I5B4i4hKRVRBCFRxq1iQRej7WO3hhBuJf+UUySY=
|
||||
@@ -198,22 +195,50 @@ github.com/xrash/smetrics v0.0.0-20240521201337-686a1a2994c1/go.mod h1:Ohn+xnUBi
|
||||
github.com/xyproto/randomstring v1.0.5 h1:YtlWPoRdgMu3NZtP45drfy1GKoojuR7hmRcnhZqKjWU=
|
||||
github.com/xyproto/randomstring v1.0.5/go.mod h1:rgmS5DeNXLivK7YprL0pY+lTuhNQW3iGxZ18UQApw/E=
|
||||
github.com/yuin/goldmark v1.3.5/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k=
|
||||
go.uber.org/goleak v1.3.0 h1:2K3zAYmnTNqV73imy9J1T3WC+gmCePx2hEGkimedGto=
|
||||
go.uber.org/goleak v1.3.0/go.mod h1:CoHD4mav9JJNrW/WLlf7HGZPjdw8EucARQHekz1X6bE=
|
||||
github.com/yuin/goldmark v1.4.13/go.mod h1:6yULJ656Px+3vBD8DxQVa3kxgyrAnzto9xy5taEt/CY=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
||||
golang.org/x/crypto v0.47.0 h1:V6e3FRj+n4dbpw86FJ8Fv7XVOql7TEwpHapKoMJ/GO8=
|
||||
golang.org/x/crypto v0.47.0/go.mod h1:ff3Y9VzzKbwSSEzWqJsJVBnWmRwRSHt/6Op5n9bQc4A=
|
||||
golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
|
||||
golang.org/x/crypto v0.6.0/go.mod h1:OFC/31mSvZgRz0V1QTNCzfAI1aIRzbiufJtkMIlEp58=
|
||||
golang.org/x/crypto v0.13.0/go.mod h1:y6Z2r+Rw4iayiXXAIxJIDAJ1zMW4yaTpebo8fPOliYc=
|
||||
golang.org/x/crypto v0.14.0/go.mod h1:MVFd36DqK4CsrnJYDkBA3VC4m2GkXAM0PvzMCn4JQf4=
|
||||
golang.org/x/crypto v0.19.0/go.mod h1:Iy9bg/ha4yyC70EfRS8jz+B6ybOBKMaSxLj6P6oBDfU=
|
||||
golang.org/x/crypto v0.23.0/go.mod h1:CKFgDieR+mRhux2Lsu27y0fO304Db0wZe70UKqHu0v8=
|
||||
golang.org/x/crypto v0.31.0/go.mod h1:kDsLvtWBEx7MV9tJOj9bnXsPbxwJQ6csT/x4KIN4Ssk=
|
||||
golang.org/x/crypto v0.37.0 h1:kJNSjF/Xp7kU0iB2Z+9viTPMW4EqqsrywMXLJOOsXSE=
|
||||
golang.org/x/crypto v0.37.0/go.mod h1:vg+k43peMZ0pUMhYmVAWysMK35e6ioLh3wB8ZCAfbVc=
|
||||
golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
|
||||
golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4=
|
||||
golang.org/x/mod v0.8.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs=
|
||||
golang.org/x/mod v0.12.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs=
|
||||
golang.org/x/mod v0.15.0/go.mod h1:hTbmBsO62+eylJbnUtE2MGJUyE7QWk4xUqPFrRgJ+7c=
|
||||
golang.org/x/mod v0.17.0/go.mod h1:hTbmBsO62+eylJbnUtE2MGJUyE7QWk4xUqPFrRgJ+7c=
|
||||
golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20200114155413-6afb5195e5aa/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
|
||||
golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4/go.mod h1:p54w0d4576C0XHj96bSt6lcn1PtDYWL6XObtHCRCNQM=
|
||||
golang.org/x/net v0.49.0 h1:eeHFmOGUTtaaPSGNmjBKpbng9MulQsJURQUAfUwY++o=
|
||||
golang.org/x/net v0.49.0/go.mod h1:/ysNB2EvaqvesRkuLAyjI1ycPZlQHM3q01F02UY/MV8=
|
||||
golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c=
|
||||
golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs=
|
||||
golang.org/x/net v0.7.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs=
|
||||
golang.org/x/net v0.10.0/go.mod h1:0qNGK6F8kojg2nk9dLZ2mShWaEBan6FAoqfSigmmuDg=
|
||||
golang.org/x/net v0.15.0/go.mod h1:idbUs1IY1+zTqbi8yxTbhexhEEk5ur9LInksu6HrEpk=
|
||||
golang.org/x/net v0.17.0/go.mod h1:NxSsAGuq816PNPmqtQdLE42eU2Fs7NoRIZrHJAlaCOE=
|
||||
golang.org/x/net v0.21.0/go.mod h1:bIjVDfnllIU7BJ2DNgfnXvpSvtn8VRwhlsaeUTyUS44=
|
||||
golang.org/x/net v0.25.0/go.mod h1:JkAGAh7GEvH74S6FOH42FLoXpXbE/aqXSrIQjXgsiwM=
|
||||
golang.org/x/net v0.33.0/go.mod h1:HXLR5J+9DxmrqMwG9qjGCxZ+zKXxBru04zlTvWlWuN4=
|
||||
golang.org/x/net v0.38.0 h1:vRMAPTMaeGqVhG5QyLJHqNDwecKTomGeqbnfZyKlBI8=
|
||||
golang.org/x/net v0.38.0/go.mod h1:ivrbrMbzFq5J41QOQh0siUuly180yBYtLp+CKbEaFx8=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.19.0 h1:vV+1eWNmZ5geRlYjzm2adRgW2/mcpevXNg50YZtPCE4=
|
||||
golang.org/x/sync v0.19.0/go.mod h1:9KTHXmSnoGruLpwFjVSX0lNNA75CykiMECbovNTZqGI=
|
||||
golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.3.0/go.mod h1:FU7BRWz2tNW+3quACPkgCx/L+uEAv1htQ0V83Z9Rj+Y=
|
||||
golang.org/x/sync v0.6.0/go.mod h1:Czt+wKu1gCyEFDUtn0jG5QVvpJ6rzVqr5aXyt9drQfk=
|
||||
golang.org/x/sync v0.7.0/go.mod h1:Czt+wKu1gCyEFDUtn0jG5QVvpJ6rzVqr5aXyt9drQfk=
|
||||
golang.org/x/sync v0.10.0/go.mod h1:Czt+wKu1gCyEFDUtn0jG5QVvpJ6rzVqr5aXyt9drQfk=
|
||||
golang.org/x/sync v0.13.0 h1:AauUjRAJ9OSnvULf/ARrrVywoJDy0YS2AwQ98I37610=
|
||||
golang.org/x/sync v0.13.0/go.mod h1:1dzgHSNfp02xaA81J2MS99Qcpr2w7fw1gpm99rleRqA=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
@@ -221,27 +246,57 @@ golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7w
|
||||
golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20210330210617-4fbd30eecc44/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.0.0-20220408201424-a24fb2fb8a0f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.5.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.40.0 h1:DBZZqJ2Rkml6QMQsZywtnjnnGvHza6BTfYFWY9kjEWQ=
|
||||
golang.org/x/sys v0.40.0/go.mod h1:OgkHotnGiDImocRcuBABYBEXf8A9a87e/uXjp9XT3ks=
|
||||
golang.org/x/sys v0.8.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.12.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.13.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.17.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||
golang.org/x/sys v0.20.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||
golang.org/x/sys v0.28.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||
golang.org/x/sys v0.32.0 h1:s77OFDvIQeibCmezSnk/q6iAfkdiQaJi4VzroCFrN20=
|
||||
golang.org/x/sys v0.32.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k=
|
||||
golang.org/x/telemetry v0.0.0-20240228155512-f48c80bd79b2/go.mod h1:TeRTkGYfJXctD9OcfyVLyj2J3IxLnKwHJR8f4D8a3YE=
|
||||
golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
|
||||
golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
|
||||
golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k=
|
||||
golang.org/x/term v0.8.0/go.mod h1:xPskH00ivmX89bAKVGSKKtLOWNx2+17Eiy94tnKShWo=
|
||||
golang.org/x/term v0.12.0/go.mod h1:owVbMEjm3cBLCHdkQu9b1opXd4ETQWc3BhuQGKgXgvU=
|
||||
golang.org/x/term v0.13.0/go.mod h1:LTmsnFJwVN6bCy1rVCoS+qHT1HhALEFxKncY3WNNh4U=
|
||||
golang.org/x/term v0.17.0/go.mod h1:lLRBjIVuehSbZlaOtGMbcMncT+aqLLLmKrsjNrUguwk=
|
||||
golang.org/x/term v0.20.0/go.mod h1:8UkIAJTvZgivsXaD6/pH6U9ecQzZ45awqEOzuCvwpFY=
|
||||
golang.org/x/term v0.27.0/go.mod h1:iMsnZpn0cago0GOrHO2+Y7u7JPn5AylBrcoWkElMTSM=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
|
||||
golang.org/x/text v0.33.0 h1:B3njUFyqtHDUI5jMn1YIr5B0IE2U0qck04r6d4KPAxE=
|
||||
golang.org/x/text v0.33.0/go.mod h1:LuMebE6+rBincTi9+xWTY8TztLzKHc/9C1uBCG27+q8=
|
||||
golang.org/x/time v0.14.0 h1:MRx4UaLrDotUKUdCIqzPC48t1Y9hANFKIRpNx+Te8PI=
|
||||
golang.org/x/time v0.14.0/go.mod h1:eL/Oa2bBBK0TkX57Fyni+NgnyQQN4LitPmob2Hjnqw4=
|
||||
golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ=
|
||||
golang.org/x/text v0.3.8/go.mod h1:E6s5w1FMmriuDzIBO73fBruAKo1PCIq6d2Q6DHfQ8WQ=
|
||||
golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8=
|
||||
golang.org/x/text v0.9.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8=
|
||||
golang.org/x/text v0.13.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE=
|
||||
golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU=
|
||||
golang.org/x/text v0.15.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU=
|
||||
golang.org/x/text v0.21.0/go.mod h1:4IBbMaMmOPCJ8SecivzSH54+73PCFmPWxNTLm+vZkEQ=
|
||||
golang.org/x/text v0.24.0 h1:dd5Bzh4yt5KYA8f9CJHCP4FB4D51c2c6JvN37xJJkJ0=
|
||||
golang.org/x/text v0.24.0/go.mod h1:L8rBsPeo2pSS+xqN0d5u2ikmjtmoJbDBT1b7nHvFCdU=
|
||||
golang.org/x/time v0.11.0 h1:/bpjEDfN9tkoN/ryeYHnv5hcMlc8ncjMcM4XBk5NWV0=
|
||||
golang.org/x/time v0.11.0/go.mod h1:CDIdPxbZBQxdj6cxyCIdrNogrJKMJ7pr37NYpMcMDSg=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||
golang.org/x/tools v0.1.1/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
|
||||
golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc=
|
||||
golang.org/x/tools v0.6.0/go.mod h1:Xwgl3UAJ/d3gWutnCtw505GrjyAbvKui8lOU390QaIU=
|
||||
golang.org/x/tools v0.13.0/go.mod h1:HvlwmtVNQAhOuCjW7xxvovg8wbNq7LwfXh/k7wXUl58=
|
||||
golang.org/x/tools v0.21.1-0.20240508182429-e35e4ccd0d2d/go.mod h1:aiJjzUbINMkxbQROHiO6hDPo2LHcIPhhQsa9DLh0yGk=
|
||||
golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk=
|
||||
gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q=
|
||||
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
|
||||
@@ -24,99 +24,57 @@ var (
|
||||
)
|
||||
|
||||
var (
|
||||
ActionUndetected = "ActionUnDetected"
|
||||
ActionAbortMultipartUpload = "s3_AbortMultipartUpload"
|
||||
ActionCompleteMultipartUpload = "s3_CompleteMultipartUpload"
|
||||
ActionCopyObject = "s3_CopyObject"
|
||||
ActionCreateBucket = "s3_CreateBucket"
|
||||
ActionCreateMultipartUpload = "s3_CreateMultipartUpload"
|
||||
ActionDeleteBucket = "s3_DeleteBucket"
|
||||
ActionDeleteBucketPolicy = "s3_DeleteBucketPolicy"
|
||||
ActionDeleteBucketTagging = "s3_DeleteBucketTagging"
|
||||
ActionDeleteObject = "s3_DeleteObject"
|
||||
ActionDeleteObjectTagging = "s3_DeleteObjectTagging"
|
||||
ActionDeleteObjects = "s3_DeleteObjects"
|
||||
ActionGetBucketAcl = "s3_GetBucketAcl"
|
||||
ActionGetBucketPolicy = "s3_GetBucketPolicy"
|
||||
ActionGetBucketTagging = "s3_GetBucketTagging"
|
||||
ActionGetBucketVersioning = "s3_GetBucketVersioning"
|
||||
ActionGetObject = "s3_GetObject"
|
||||
ActionGetObjectAcl = "s3_GetObjectAcl"
|
||||
ActionGetObjectAttributes = "s3_GetObjectAttributes"
|
||||
ActionGetObjectLegalHold = "s3_GetObjectLegalHold"
|
||||
ActionGetObjectLockConfiguration = "s3_GetObjectLockConfiguration"
|
||||
ActionGetObjectRetention = "s3_GetObjectRetention"
|
||||
ActionGetObjectTagging = "s3_GetObjectTagging"
|
||||
ActionHeadBucket = "s3_HeadBucket"
|
||||
ActionHeadObject = "s3_HeadObject"
|
||||
ActionListAllMyBuckets = "s3_ListAllMyBuckets"
|
||||
ActionListMultipartUploads = "s3_ListMultipartUploads"
|
||||
ActionListObjectVersions = "s3_ListObjectVersions"
|
||||
ActionListObjects = "s3_ListObjects"
|
||||
ActionListObjectsV2 = "s3_ListObjectsV2"
|
||||
ActionListParts = "s3_ListParts"
|
||||
ActionPutBucketAcl = "s3_PutBucketAcl"
|
||||
ActionPutBucketPolicy = "s3_PutBucketPolicy"
|
||||
ActionPutBucketTagging = "s3_PutBucketTagging"
|
||||
ActionPutBucketVersioning = "s3_PutBucketVersioning"
|
||||
ActionPutObject = "s3_PutObject"
|
||||
ActionPutObjectAcl = "s3_PutObjectAcl"
|
||||
ActionPutObjectLegalHold = "s3_PutObjectLegalHold"
|
||||
ActionPutObjectLockConfiguration = "s3_PutObjectLockConfiguration"
|
||||
ActionPutObjectRetention = "s3_PutObjectRetention"
|
||||
ActionPutObjectTagging = "s3_PutObjectTagging"
|
||||
ActionRestoreObject = "s3_RestoreObject"
|
||||
ActionSelectObjectContent = "s3_SelectObjectContent"
|
||||
ActionUploadPart = "s3_UploadPart"
|
||||
ActionUploadPartCopy = "s3_UploadPartCopy"
|
||||
ActionPutBucketOwnershipControls = "s3_PutBucketOwnershipControls"
|
||||
ActionGetBucketOwnershipControls = "s3_GetBucketOwnershipControls"
|
||||
ActionDeleteBucketOwnershipControls = "s3_DeleteBucketOwnershipControls"
|
||||
ActionPutBucketCors = "s3_PutBucketCors"
|
||||
ActionGetBucketCors = "s3_GetBucketCors"
|
||||
ActionDeleteBucketCors = "s3_DeleteBucketCors"
|
||||
ActionOptions = "s3_Options"
|
||||
ActionPutBucketAnalyticsConfiguration = "s3_PutBucketAnalyticsConfiguration"
|
||||
ActionGetBucketAnalyticsConfiguration = "s3_GetBucketAnalyticsConfiguration"
|
||||
ActionListBucketAnalyticsConfigurations = "s3_ListBucketAnalyticsConfigurations"
|
||||
ActionDeleteBucketAnalyticsConfiguration = "s3_DeleteBucketAnalyticsConfiguration"
|
||||
ActionPutBucketEncryption = "s3_PutBucketEncryption"
|
||||
ActionGetBucketEncryption = "s3_GetBucketEncryption"
|
||||
ActionDeleteBucketEncryption = "s3_DeleteBucketEncryption"
|
||||
ActionPutBucketIntelligentTieringConfiguration = "s3_PutBucketIntelligentTieringConfiguration"
|
||||
ActionGetBucketIntelligentTieringConfiguration = "s3_GetBucketIntelligentTieringConfiguration"
|
||||
ActionListBucketIntelligentTieringConfigurations = "s3_ListBucketIntelligentTieringConfigurations"
|
||||
ActionDeleteBucketIntelligentTieringConfiguration = "s3_DeleteBucketIntelligentTieringConfiguration"
|
||||
ActionPutBucketInventoryConfiguration = "s3_PutBucketInventoryConfiguration"
|
||||
ActionGetBucketInventoryConfiguration = "s3_GetBucketInventoryConfiguration"
|
||||
ActionListBucketInventoryConfigurations = "s3_ListBucketInventoryConfigurations"
|
||||
ActionDeleteBucketInventoryConfiguration = "s3_DeleteBucketInventoryConfiguration"
|
||||
ActionPutBucketLifecycleConfiguration = "s3_PutBucketLifecycleConfiguration"
|
||||
ActionGetBucketLifecycleConfiguration = "s3_GetBucketLifecycleConfiguration"
|
||||
ActionDeleteBucketLifecycle = "s3_DeleteBucketLifecycle"
|
||||
ActionPutBucketLogging = "s3_PutBucketLogging"
|
||||
ActionGetBucketLogging = "s3_GetBucketLogging"
|
||||
ActionPutBucketRequestPayment = "s3_PutBucketRequestPayment"
|
||||
ActionGetBucketRequestPayment = "s3_GetBucketRequestPayment"
|
||||
ActionPutBucketMetricsConfiguration = "s3_PutBucketMetricsConfiguration"
|
||||
ActionGetBucketMetricsConfiguration = "s3_GetBucketMetricsConfiguration"
|
||||
ActionListBucketMetricsConfigurations = "s3_ListBucketMetricsConfigurations"
|
||||
ActionDeleteBucketMetricsConfiguration = "s3_DeleteBucketMetricsConfiguration"
|
||||
ActionPutBucketReplication = "s3_PutBucketReplication"
|
||||
ActionGetBucketReplication = "s3_GetBucketReplication"
|
||||
ActionDeleteBucketReplication = "s3_DeleteBucketReplication"
|
||||
ActionPutPublicAccessBlock = "s3_PutPublicAccessBlock"
|
||||
ActionGetPublicAccessBlock = "s3_GetPublicAccessBlock"
|
||||
ActionDeletePublicAccessBlock = "s3_DeletePublicAccessBlock"
|
||||
ActionPutBucketNotificationConfiguration = "s3_PutBucketNotificationConfiguration"
|
||||
ActionGetBucketNotificationConfiguration = "s3_GetBucketNotificationConfiguration"
|
||||
ActionPutBucketAccelerateConfiguration = "s3_PutBucketAccelerateConfiguration"
|
||||
ActionGetBucketAccelerateConfiguration = "s3_GetBucketAccelerateConfiguration"
|
||||
ActionPutBucketWebsite = "s3_PutBucketWebsite"
|
||||
ActionGetBucketWebsite = "s3_GetBucketWebsite"
|
||||
ActionDeleteBucketWebsite = "s3_DeleteBucketWebsite"
|
||||
ActionGetBucketPolicyStatus = "s3_GetBucketPolicyStatus"
|
||||
ActionGetBucketLocation = "s3_GetBucketLocation"
|
||||
ActionUndetected = "ActionUnDetected"
|
||||
ActionAbortMultipartUpload = "s3_AbortMultipartUpload"
|
||||
ActionCompleteMultipartUpload = "s3_CompleteMultipartUpload"
|
||||
ActionCopyObject = "s3_CopyObject"
|
||||
ActionCreateBucket = "s3_CreateBucket"
|
||||
ActionCreateMultipartUpload = "s3_CreateMultipartUpload"
|
||||
ActionDeleteBucket = "s3_DeleteBucket"
|
||||
ActionDeleteBucketPolicy = "s3_DeleteBucketPolicy"
|
||||
ActionDeleteBucketTagging = "s3_DeleteBucketTagging"
|
||||
ActionDeleteObject = "s3_DeleteObject"
|
||||
ActionDeleteObjectTagging = "s3_DeleteObjectTagging"
|
||||
ActionDeleteObjects = "s3_DeleteObjects"
|
||||
ActionGetBucketAcl = "s3_GetBucketAcl"
|
||||
ActionGetBucketPolicy = "s3_GetBucketPolicy"
|
||||
ActionGetBucketTagging = "s3_GetBucketTagging"
|
||||
ActionGetBucketVersioning = "s3_GetBucketVersioning"
|
||||
ActionGetObject = "s3_GetObject"
|
||||
ActionGetObjectAcl = "s3_GetObjectAcl"
|
||||
ActionGetObjectAttributes = "s3_GetObjectAttributes"
|
||||
ActionGetObjectLegalHold = "s3_GetObjectLegalHold"
|
||||
ActionGetObjectLockConfiguration = "s3_GetObjectLockConfiguration"
|
||||
ActionGetObjectRetention = "s3_GetObjectRetention"
|
||||
ActionGetObjectTagging = "s3_GetObjectTagging"
|
||||
ActionHeadBucket = "s3_HeadBucket"
|
||||
ActionHeadObject = "s3_HeadObject"
|
||||
ActionListAllMyBuckets = "s3_ListAllMyBuckets"
|
||||
ActionListMultipartUploads = "s3_ListMultipartUploads"
|
||||
ActionListObjectVersions = "s3_ListObjectVersions"
|
||||
ActionListObjects = "s3_ListObjects"
|
||||
ActionListObjectsV2 = "s3_ListObjectsV2"
|
||||
ActionListParts = "s3_ListParts"
|
||||
ActionPutBucketAcl = "s3_PutBucketAcl"
|
||||
ActionPutBucketPolicy = "s3_PutBucketPolicy"
|
||||
ActionPutBucketTagging = "s3_PutBucketTagging"
|
||||
ActionPutBucketVersioning = "s3_PutBucketVersioning"
|
||||
ActionPutObject = "s3_PutObject"
|
||||
ActionPutObjectAcl = "s3_PutObjectAcl"
|
||||
ActionPutObjectLegalHold = "s3_PutObjectLegalHold"
|
||||
ActionPutObjectLockConfiguration = "s3_PutObjectLockConfiguration"
|
||||
ActionPutObjectRetention = "s3_PutObjectRetention"
|
||||
ActionPutObjectTagging = "s3_PutObjectTagging"
|
||||
ActionRestoreObject = "s3_RestoreObject"
|
||||
ActionSelectObjectContent = "s3_SelectObjectContent"
|
||||
ActionUploadPart = "s3_UploadPart"
|
||||
ActionUploadPartCopy = "s3_UploadPartCopy"
|
||||
ActionPutBucketOwnershipControls = "s3_PutBucketOwnershipControls"
|
||||
ActionGetBucketOwnershipControls = "s3_GetBucketOwnershipControls"
|
||||
ActionDeleteBucketOwnershipControls = "s3_DeleteBucketOwnershipControls"
|
||||
ActionPutBucketCors = "s3_PutBucketCors"
|
||||
ActionGetBucketCors = "s3_GetBucketCors"
|
||||
ActionDeleteBucketCors = "s3_DeleteBucketCors"
|
||||
|
||||
// Admin actions
|
||||
ActionAdminCreateUser = "admin_CreateUser"
|
||||
@@ -125,7 +83,6 @@ var (
|
||||
ActionAdminChangeBucketOwner = "admin_ChangeBucketOwner"
|
||||
ActionAdminListUsers = "admin_ListUsers"
|
||||
ActionAdminListBuckets = "admin_ListBuckets"
|
||||
ActionAdminCreateBucket = "admin_CreateBucket"
|
||||
)
|
||||
|
||||
func init() {
|
||||
@@ -324,184 +281,4 @@ func init() {
|
||||
Name: "DeleteBucketCors",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketOwnershipControls] = Action{
|
||||
Name: "PutBucketOwnershipControls",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketOwnershipControls] = Action{
|
||||
Name: "GetBucketOwnershipControls",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketOwnershipControls] = Action{
|
||||
Name: "DeleteBucketOwnershipControls",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionOptions] = Action{
|
||||
Name: "Options",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketAnalyticsConfiguration] = Action{
|
||||
Name: "PutBucketAnalyticsConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketAnalyticsConfiguration] = Action{
|
||||
Name: "GetBucketAnalyticsConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionListBucketAnalyticsConfigurations] = Action{
|
||||
Name: "ListBucketAnalyticsConfigurations",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketAnalyticsConfiguration] = Action{
|
||||
Name: "DeleteBucketAnalyticsConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketEncryption] = Action{
|
||||
Name: "PutBucketEncryption",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketEncryption] = Action{
|
||||
Name: "GetBucketEncryption",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketEncryption] = Action{
|
||||
Name: "DeleteBucketEncryption",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketIntelligentTieringConfiguration] = Action{
|
||||
Name: "PutBucketIntelligentTieringConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketIntelligentTieringConfiguration] = Action{
|
||||
Name: "GetBucketIntelligentTieringConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionListBucketIntelligentTieringConfigurations] = Action{
|
||||
Name: "ListBucketIntelligentTieringConfigurations",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketIntelligentTieringConfiguration] = Action{
|
||||
Name: "DeleteBucketIntelligentTieringConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketInventoryConfiguration] = Action{
|
||||
Name: "PutBucketInventoryConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketInventoryConfiguration] = Action{
|
||||
Name: "GetBucketInventoryConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionListBucketInventoryConfigurations] = Action{
|
||||
Name: "ListBucketInventoryConfigurations",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketInventoryConfiguration] = Action{
|
||||
Name: "DeleteBucketInventoryConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketLifecycleConfiguration] = Action{
|
||||
Name: "PutBucketLifecycleConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketLifecycleConfiguration] = Action{
|
||||
Name: "GetBucketLifecycleConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketLifecycle] = Action{
|
||||
Name: "DeleteBucketLifecycle",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketLogging] = Action{
|
||||
Name: "PutBucketLogging",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketLogging] = Action{
|
||||
Name: "GetBucketLogging",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketRequestPayment] = Action{
|
||||
Name: "PutBucketRequestPayment",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketRequestPayment] = Action{
|
||||
Name: "GetBucketRequestPayment",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketMetricsConfiguration] = Action{
|
||||
Name: "PutBucketMetricsConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketMetricsConfiguration] = Action{
|
||||
Name: "GetBucketMetricsConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionListBucketMetricsConfigurations] = Action{
|
||||
Name: "ListBucketMetricsConfigurations",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketMetricsConfiguration] = Action{
|
||||
Name: "DeleteBucketMetricsConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketReplication] = Action{
|
||||
Name: "PutBucketReplication",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketReplication] = Action{
|
||||
Name: "GetBucketReplication",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketReplication] = Action{
|
||||
Name: "DeleteBucketReplication",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutPublicAccessBlock] = Action{
|
||||
Name: "PutPublicAccessBlock",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetPublicAccessBlock] = Action{
|
||||
Name: "GetPublicAccessBlock",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeletePublicAccessBlock] = Action{
|
||||
Name: "DeletePublicAccessBlock",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketNotificationConfiguration] = Action{
|
||||
Name: "PutBucketNotificationConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketNotificationConfiguration] = Action{
|
||||
Name: "GetBucketNotificationConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketAccelerateConfiguration] = Action{
|
||||
Name: "PutBucketAccelerateConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketAccelerateConfiguration] = Action{
|
||||
Name: "GetBucketAccelerateConfiguration",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionPutBucketWebsite] = Action{
|
||||
Name: "PutBucketWebsite",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketWebsite] = Action{
|
||||
Name: "GetBucketWebsite",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionDeleteBucketWebsite] = Action{
|
||||
Name: "DeleteBucketWebsite",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketPolicyStatus] = Action{
|
||||
Name: "GetBucketPolicyStatus",
|
||||
Service: "s3",
|
||||
}
|
||||
ActionMap[ActionGetBucketLocation] = Action{
|
||||
Name: "GetBucketLocation",
|
||||
Service: "s3",
|
||||
}
|
||||
}
|
||||
|
||||
@@ -41,14 +41,8 @@ type Tag struct {
|
||||
Value string
|
||||
}
|
||||
|
||||
// Manager is the interface definition for metrics manager
|
||||
type Manager interface {
|
||||
Send(ctx *fiber.Ctx, err error, action string, count int64, status int)
|
||||
Close()
|
||||
}
|
||||
|
||||
// manager is a manager of metrics plugins
|
||||
type manager struct {
|
||||
// Manager is a manager of metrics plugins
|
||||
type Manager struct {
|
||||
wg sync.WaitGroup
|
||||
ctx context.Context
|
||||
|
||||
@@ -65,7 +59,7 @@ type Config struct {
|
||||
}
|
||||
|
||||
// NewManager initializes metrics plugins and returns a new metrics manager
|
||||
func NewManager(ctx context.Context, conf Config) (Manager, error) {
|
||||
func NewManager(ctx context.Context, conf Config) (*Manager, error) {
|
||||
if len(conf.StatsdServers) == 0 && len(conf.DogStatsdServers) == 0 {
|
||||
return nil, nil
|
||||
}
|
||||
@@ -80,7 +74,7 @@ func NewManager(ctx context.Context, conf Config) (Manager, error) {
|
||||
|
||||
addDataChan := make(chan datapoint, dataItemCount)
|
||||
|
||||
mgr := &manager{
|
||||
mgr := &Manager{
|
||||
addDataChan: addDataChan,
|
||||
ctx: ctx,
|
||||
config: conf,
|
||||
@@ -118,7 +112,7 @@ func NewManager(ctx context.Context, conf Config) (Manager, error) {
|
||||
return mgr, nil
|
||||
}
|
||||
|
||||
func (m *manager) Send(ctx *fiber.Ctx, err error, action string, count int64, status int) {
|
||||
func (m *Manager) Send(ctx *fiber.Ctx, err error, action string, count int64, status int) {
|
||||
// In case of Authentication failures, url parsing ...
|
||||
if action == "" {
|
||||
action = ActionUndetected
|
||||
@@ -174,12 +168,12 @@ func (m *manager) Send(ctx *fiber.Ctx, err error, action string, count int64, st
|
||||
}
|
||||
|
||||
// increment increments the key by one
|
||||
func (m *manager) increment(key string, tags ...Tag) {
|
||||
func (m *Manager) increment(key string, tags ...Tag) {
|
||||
m.add(key, 1, tags...)
|
||||
}
|
||||
|
||||
// add adds value to key
|
||||
func (m *manager) add(key string, value int64, tags ...Tag) {
|
||||
func (m *Manager) add(key string, value int64, tags ...Tag) {
|
||||
if m.ctx.Err() != nil {
|
||||
return
|
||||
}
|
||||
@@ -198,7 +192,7 @@ func (m *manager) add(key string, value int64, tags ...Tag) {
|
||||
}
|
||||
|
||||
// Close closes metrics channels, waits for data to complete, closes all plugins
|
||||
func (m *manager) Close() {
|
||||
func (m *Manager) Close() {
|
||||
// drain the datapoint channels
|
||||
close(m.addDataChan)
|
||||
m.wg.Wait()
|
||||
@@ -215,7 +209,7 @@ type publisher interface {
|
||||
Close()
|
||||
}
|
||||
|
||||
func (m *manager) addForwarder(addChan <-chan datapoint) {
|
||||
func (m *Manager) addForwarder(addChan <-chan datapoint) {
|
||||
for data := range addChan {
|
||||
for _, s := range m.publishers {
|
||||
s.Add(data.key, data.value, data.tags...)
|
||||
|
||||
@@ -1,35 +0,0 @@
|
||||
// Copyright 2025 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package plugins
|
||||
|
||||
import "github.com/versity/versitygw/backend"
|
||||
|
||||
// BackendPlugin defines an interface for creating backend
|
||||
// implementation instances.
|
||||
// Plugins implementing this interface can be built as shared
|
||||
// libraries using Go's plugin system (to build use `go build -buildmode=plugin`).
|
||||
// The shared library should export an instance of
|
||||
// this interface in a variable named `Backend`.
|
||||
type BackendPlugin interface {
|
||||
// New creates and initializes a new backend.Backend instance.
|
||||
// The config parameter specifies the path of the file containing
|
||||
// the configuration for the backend.
|
||||
//
|
||||
// Implementations of this method should perform the necessary steps to
|
||||
// establish a connection to the underlying storage system or service
|
||||
// (e.g., network storage system, distributed storage system, cloud storage)
|
||||
// and configure it according to the provided configuration.
|
||||
New(config string) (backend.Backend, error)
|
||||
}
|
||||
11
runtests.sh
11
runtests.sh
@@ -16,6 +16,7 @@ ECHO "Generating TLS certificate and key in the cert.pem and key.pem files"
|
||||
openssl genpkey -algorithm RSA -out key.pem -pkeyopt rsa_keygen_bits:2048
|
||||
openssl req -new -x509 -key key.pem -out cert.pem -days 365 -subj "/C=US/ST=California/L=San Francisco/O=Versity/OU=Software/CN=versity.com"
|
||||
|
||||
|
||||
ECHO "Running the sdk test over http"
|
||||
# run server in background not versioning-enabled
|
||||
# port: 7070(default)
|
||||
@@ -32,7 +33,7 @@ fi
|
||||
|
||||
# run tests
|
||||
# full flow tests
|
||||
if ! ./versitygw test -a user -s pass -e http://127.0.0.1:7070 full-flow --parallel; then
|
||||
if ! ./versitygw test -a user -s pass -e http://127.0.0.1:7070 full-flow; then
|
||||
echo "full flow tests failed"
|
||||
kill $GW_PID
|
||||
exit 1
|
||||
@@ -69,7 +70,7 @@ fi
|
||||
|
||||
# run tests
|
||||
# full flow tests
|
||||
if ! ./versitygw test --allow-insecure -a user -s pass -e https://127.0.0.1:7071 full-flow --parallel; then
|
||||
if ! ./versitygw test --allow-insecure -a user -s pass -e https://127.0.0.1:7071 full-flow; then
|
||||
echo "full flow tests failed"
|
||||
kill $GW_HTTPS_PID
|
||||
exit 1
|
||||
@@ -89,6 +90,7 @@ fi
|
||||
|
||||
kill $GW_HTTPS_PID
|
||||
|
||||
|
||||
ECHO "Running the sdk test over http against the versioning-enabled gateway"
|
||||
# run server in background versioning-enabled
|
||||
# port: 7072
|
||||
@@ -106,7 +108,7 @@ fi
|
||||
|
||||
# run tests
|
||||
# full flow tests
|
||||
if ! ./versitygw test -a user -s pass -e http://127.0.0.1:7072 full-flow -vs --parallel; then
|
||||
if ! ./versitygw test -a user -s pass -e http://127.0.0.1:7072 full-flow -vs; then
|
||||
echo "versioning-enabled full-flow tests failed"
|
||||
kill $GW_VS_PID
|
||||
exit 1
|
||||
@@ -138,7 +140,7 @@ fi
|
||||
|
||||
# run tests
|
||||
# full flow tests
|
||||
if ! ./versitygw test --allow-insecure -a user -s pass -e https://127.0.0.1:7073 full-flow -vs --parallel; then
|
||||
if ! ./versitygw test --allow-insecure -a user -s pass -e https://127.0.0.1:7073 full-flow -vs; then
|
||||
echo "versioning-enabled full-flow tests failed"
|
||||
kill $GW_VS_HTTPS_PID
|
||||
exit 1
|
||||
@@ -160,3 +162,4 @@ exit 0
|
||||
# go tool covdata percent -i=/tmp/covdata
|
||||
# go tool covdata textfmt -i=/tmp/covdata -o profile.txt
|
||||
# go tool cover -html=profile.txt
|
||||
|
||||
|
||||
@@ -18,101 +18,30 @@ import (
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/metrics"
|
||||
"github.com/versity/versitygw/s3api/controllers"
|
||||
"github.com/versity/versitygw/s3api/middlewares"
|
||||
"github.com/versity/versitygw/s3log"
|
||||
)
|
||||
|
||||
type S3AdminRouter struct {
|
||||
s3api controllers.S3ApiController
|
||||
}
|
||||
type S3AdminRouter struct{}
|
||||
|
||||
func (ar *S3AdminRouter) Init(app *fiber.App, be backend.Backend, iam auth.IAMService, logger s3log.AuditLogger, root middlewares.RootUserConfig, region string, debug bool, corsAllowOrigin string) {
|
||||
ctrl := controllers.NewAdminController(iam, be, logger, ar.s3api)
|
||||
services := &controllers.Services{
|
||||
Logger: logger,
|
||||
}
|
||||
func (ar *S3AdminRouter) Init(app *fiber.App, be backend.Backend, iam auth.IAMService, logger s3log.AuditLogger) {
|
||||
controller := controllers.NewAdminController(iam, be, logger)
|
||||
|
||||
// CreateUser admin api
|
||||
app.Patch("/create-user",
|
||||
controllers.ProcessHandlers(ctrl.CreateUser, metrics.ActionAdminCreateUser, services,
|
||||
middlewares.VerifyV4Signature(root, iam, region, false, true),
|
||||
middlewares.IsAdmin(metrics.ActionAdminCreateUser),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
))
|
||||
app.Options("/create-user",
|
||||
middlewares.ApplyDefaultCORSPreflight(corsAllowOrigin),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
)
|
||||
app.Patch("/create-user", controller.CreateUser)
|
||||
|
||||
// DeleteUsers admin api
|
||||
app.Patch("/delete-user",
|
||||
controllers.ProcessHandlers(ctrl.DeleteUser, metrics.ActionAdminDeleteUser, services,
|
||||
middlewares.VerifyV4Signature(root, iam, region, false, true),
|
||||
middlewares.IsAdmin(metrics.ActionAdminDeleteUser),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
))
|
||||
app.Options("/delete-user",
|
||||
middlewares.ApplyDefaultCORSPreflight(corsAllowOrigin),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
)
|
||||
app.Patch("/delete-user", controller.DeleteUser)
|
||||
|
||||
// UpdateUser admin api
|
||||
app.Patch("/update-user",
|
||||
controllers.ProcessHandlers(ctrl.UpdateUser, metrics.ActionAdminUpdateUser, services,
|
||||
middlewares.VerifyV4Signature(root, iam, region, false, true),
|
||||
middlewares.IsAdmin(metrics.ActionAdminUpdateUser),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
))
|
||||
app.Options("/update-user",
|
||||
middlewares.ApplyDefaultCORSPreflight(corsAllowOrigin),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
)
|
||||
app.Patch("/update-user", controller.UpdateUser)
|
||||
|
||||
// ListUsers admin api
|
||||
app.Patch("/list-users",
|
||||
controllers.ProcessHandlers(ctrl.ListUsers, metrics.ActionAdminListUsers, services,
|
||||
middlewares.VerifyV4Signature(root, iam, region, false, true),
|
||||
middlewares.IsAdmin(metrics.ActionAdminListUsers),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
))
|
||||
app.Options("/list-users",
|
||||
middlewares.ApplyDefaultCORSPreflight(corsAllowOrigin),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
)
|
||||
app.Patch("/list-users", controller.ListUsers)
|
||||
|
||||
// ChangeBucketOwner admin api
|
||||
app.Patch("/change-bucket-owner",
|
||||
controllers.ProcessHandlers(ctrl.ChangeBucketOwner, metrics.ActionAdminChangeBucketOwner, services,
|
||||
middlewares.VerifyV4Signature(root, iam, region, false, true),
|
||||
middlewares.IsAdmin(metrics.ActionAdminChangeBucketOwner),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
))
|
||||
app.Options("/change-bucket-owner",
|
||||
middlewares.ApplyDefaultCORSPreflight(corsAllowOrigin),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
)
|
||||
app.Patch("/change-bucket-owner", controller.ChangeBucketOwner)
|
||||
|
||||
// ListBucketsAndOwners admin api
|
||||
app.Patch("/list-buckets",
|
||||
controllers.ProcessHandlers(ctrl.ListBuckets, metrics.ActionAdminListBuckets, services,
|
||||
middlewares.VerifyV4Signature(root, iam, region, false, true),
|
||||
middlewares.IsAdmin(metrics.ActionAdminListBuckets),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
))
|
||||
app.Options("/list-buckets",
|
||||
middlewares.ApplyDefaultCORSPreflight(corsAllowOrigin),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
)
|
||||
|
||||
app.Patch("/:bucket/create",
|
||||
controllers.ProcessHandlers(ctrl.CreateBucket, metrics.ActionAdminListBuckets, services,
|
||||
middlewares.VerifyV4Signature(root, iam, region, false, true),
|
||||
middlewares.IsAdmin(metrics.ActionAdminCreateBucket),
|
||||
))
|
||||
app.Options("/:bucket/create",
|
||||
middlewares.ApplyDefaultCORSPreflight(corsAllowOrigin),
|
||||
middlewares.ApplyDefaultCORS(corsAllowOrigin),
|
||||
)
|
||||
app.Patch("/list-buckets", controller.ListBuckets)
|
||||
}
|
||||
|
||||
@@ -15,111 +15,61 @@
|
||||
package s3api
|
||||
|
||||
import (
|
||||
"crypto/tls"
|
||||
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/gofiber/fiber/v2/middleware/logger"
|
||||
"github.com/gofiber/fiber/v2/middleware/recover"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3api/controllers"
|
||||
"github.com/versity/versitygw/s3api/middlewares"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3log"
|
||||
)
|
||||
|
||||
type S3AdminServer struct {
|
||||
app *fiber.App
|
||||
backend backend.Backend
|
||||
router *S3AdminRouter
|
||||
port string
|
||||
CertStorage *utils.CertStorage
|
||||
quiet bool
|
||||
debug bool
|
||||
corsAllowOrigin string
|
||||
app *fiber.App
|
||||
backend backend.Backend
|
||||
router *S3AdminRouter
|
||||
port string
|
||||
cert *tls.Certificate
|
||||
}
|
||||
|
||||
func NewAdminServer(be backend.Backend, root middlewares.RootUserConfig, port, region string, iam auth.IAMService, l s3log.AuditLogger, ctrl controllers.S3ApiController, opts ...AdminOpt) *S3AdminServer {
|
||||
func NewAdminServer(app *fiber.App, be backend.Backend, root middlewares.RootUserConfig, port, region string, iam auth.IAMService, l s3log.AuditLogger, opts ...AdminOpt) *S3AdminServer {
|
||||
server := &S3AdminServer{
|
||||
app: app,
|
||||
backend: be,
|
||||
router: &S3AdminRouter{
|
||||
s3api: ctrl,
|
||||
},
|
||||
port: port,
|
||||
router: new(S3AdminRouter),
|
||||
port: port,
|
||||
}
|
||||
|
||||
for _, opt := range opts {
|
||||
opt(server)
|
||||
}
|
||||
|
||||
app := fiber.New(fiber.Config{
|
||||
AppName: "versitygw",
|
||||
ServerHeader: "VERSITYGW",
|
||||
Network: fiber.NetworkTCP,
|
||||
DisableStartupMessage: true,
|
||||
ErrorHandler: globalErrorHandler,
|
||||
})
|
||||
|
||||
server.app = app
|
||||
|
||||
app.Use(recover.New(
|
||||
recover.Config{
|
||||
EnableStackTrace: true,
|
||||
StackTraceHandler: stackTraceHandler,
|
||||
}))
|
||||
|
||||
// Logging middlewares
|
||||
if !server.quiet {
|
||||
app.Use(logger.New(logger.Config{
|
||||
Format: "${time} | adm | ${status} | ${latency} | ${ip} | ${method} | ${path} | ${error} | ${queryParams}\n",
|
||||
}))
|
||||
}
|
||||
app.Use(controllers.WrapMiddleware(middlewares.DecodeURL, l, nil))
|
||||
app.Use(logger.New())
|
||||
app.Use(middlewares.DecodeURL(l, nil))
|
||||
|
||||
// initialize the debug logger in debug mode
|
||||
if debuglogger.IsDebugEnabled() {
|
||||
app.Use(middlewares.DebugLogger())
|
||||
}
|
||||
// Authentication middlewares
|
||||
app.Use(middlewares.VerifyV4Signature(root, iam, l, nil, region, false))
|
||||
app.Use(middlewares.VerifyMD5Body(l))
|
||||
|
||||
server.router.Init(app, be, iam, l, root, region, server.debug, server.corsAllowOrigin)
|
||||
// Admin role checker
|
||||
app.Use(middlewares.IsAdmin(l))
|
||||
|
||||
server.router.Init(app, be, iam, l)
|
||||
|
||||
return server
|
||||
}
|
||||
|
||||
type AdminOpt func(s *S3AdminServer)
|
||||
|
||||
func WithAdminSrvTLS(cs *utils.CertStorage) AdminOpt {
|
||||
return func(s *S3AdminServer) { s.CertStorage = cs }
|
||||
}
|
||||
|
||||
// WithQuiet silences default logging output
|
||||
func WithAdminQuiet() AdminOpt {
|
||||
return func(s *S3AdminServer) { s.quiet = true }
|
||||
}
|
||||
|
||||
// WithAdminDebug enables the debug logging
|
||||
func WithAdminDebug() AdminOpt {
|
||||
return func(s *S3AdminServer) { s.debug = true }
|
||||
}
|
||||
|
||||
// WithAdminCORSAllowOrigin sets the default CORS Access-Control-Allow-Origin value
|
||||
// for the standalone admin server.
|
||||
func WithAdminCORSAllowOrigin(origin string) AdminOpt {
|
||||
return func(s *S3AdminServer) { s.corsAllowOrigin = origin }
|
||||
func WithAdminSrvTLS(cert tls.Certificate) AdminOpt {
|
||||
return func(s *S3AdminServer) { s.cert = &cert }
|
||||
}
|
||||
|
||||
func (sa *S3AdminServer) Serve() (err error) {
|
||||
if sa.CertStorage != nil {
|
||||
ln, err := utils.NewTLSListener(sa.app.Config().Network, sa.port, sa.CertStorage.GetCertificate)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return sa.app.Listener(ln)
|
||||
if sa.cert != nil {
|
||||
return sa.app.ListenTLSWithCertificate(sa.port, *sa.cert)
|
||||
}
|
||||
return sa.app.Listen(sa.port)
|
||||
}
|
||||
|
||||
// ShutDown gracefully shuts down the server with a context timeout
|
||||
func (sa S3AdminServer) Shutdown() error {
|
||||
return sa.app.ShutdownWithTimeout(shutDownDuration)
|
||||
}
|
||||
|
||||
@@ -15,42 +15,49 @@
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"encoding/xml"
|
||||
"fmt"
|
||||
"net/http"
|
||||
"strings"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/backend"
|
||||
"github.com/versity/versitygw/metrics"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3log"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
type AdminController struct {
|
||||
iam auth.IAMService
|
||||
be backend.Backend
|
||||
l s3log.AuditLogger
|
||||
s3api S3ApiController
|
||||
iam auth.IAMService
|
||||
be backend.Backend
|
||||
l s3log.AuditLogger
|
||||
}
|
||||
|
||||
func NewAdminController(iam auth.IAMService, be backend.Backend, l s3log.AuditLogger, s3api S3ApiController) AdminController {
|
||||
return AdminController{iam: iam, be: be, l: l, s3api: s3api}
|
||||
func NewAdminController(iam auth.IAMService, be backend.Backend, l s3log.AuditLogger) AdminController {
|
||||
return AdminController{iam: iam, be: be, l: l}
|
||||
}
|
||||
|
||||
func (c AdminController) CreateUser(ctx *fiber.Ctx) (*Response, error) {
|
||||
func (c AdminController) CreateUser(ctx *fiber.Ctx) error {
|
||||
var usr auth.Account
|
||||
err := xml.Unmarshal(ctx.Body(), &usr)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
return SendResponse(ctx, s3err.GetAPIError(s3err.ErrMalformedXML),
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminCreateUser,
|
||||
})
|
||||
}
|
||||
|
||||
if !usr.Role.IsValid() {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAdminInvalidUserRole)
|
||||
return SendResponse(ctx, s3err.GetAPIError(s3err.ErrAdminInvalidUserRole),
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminCreateUser,
|
||||
})
|
||||
}
|
||||
|
||||
err = c.iam.CreateAccount(usr)
|
||||
@@ -59,142 +66,138 @@ func (c AdminController) CreateUser(ctx *fiber.Ctx) (*Response, error) {
|
||||
err = s3err.GetAPIError(s3err.ErrAdminUserExists)
|
||||
}
|
||||
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
return SendResponse(ctx, err,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminCreateUser,
|
||||
})
|
||||
}
|
||||
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
return SendResponse(ctx, nil,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminCreateUser,
|
||||
Status: http.StatusCreated,
|
||||
},
|
||||
}, nil
|
||||
})
|
||||
}
|
||||
|
||||
func (c AdminController) UpdateUser(ctx *fiber.Ctx) (*Response, error) {
|
||||
func (c AdminController) UpdateUser(ctx *fiber.Ctx) error {
|
||||
access := ctx.Query("access")
|
||||
if access == "" {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAdminMissingUserAcess)
|
||||
return SendResponse(ctx, s3err.GetAPIError(s3err.ErrAdminMissingUserAcess),
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminUpdateUser,
|
||||
})
|
||||
}
|
||||
|
||||
var props auth.MutableProps
|
||||
if err := xml.Unmarshal(ctx.Body(), &props); err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
return SendResponse(ctx, s3err.GetAPIError(s3err.ErrMalformedXML),
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminUpdateUser,
|
||||
})
|
||||
}
|
||||
|
||||
err := props.Validate()
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAdminInvalidUserRole)
|
||||
}
|
||||
|
||||
err = c.iam.UpdateUserAccount(access, props)
|
||||
err := c.iam.UpdateUserAccount(access, props)
|
||||
if err != nil {
|
||||
if strings.Contains(err.Error(), "user not found") {
|
||||
err = s3err.GetAPIError(s3err.ErrAdminUserNotFound)
|
||||
}
|
||||
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
return SendResponse(ctx, err,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminUpdateUser,
|
||||
})
|
||||
}
|
||||
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, nil
|
||||
return SendResponse(ctx, nil,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminUpdateUser,
|
||||
})
|
||||
}
|
||||
|
||||
func (c AdminController) DeleteUser(ctx *fiber.Ctx) (*Response, error) {
|
||||
func (c AdminController) DeleteUser(ctx *fiber.Ctx) error {
|
||||
access := ctx.Query("access")
|
||||
if access == "" {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAdminMissingUserAcess)
|
||||
}
|
||||
|
||||
err := c.iam.DeleteUserAccount(access)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
return SendResponse(ctx, err,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminDeleteUser,
|
||||
})
|
||||
}
|
||||
|
||||
func (c AdminController) ListUsers(ctx *fiber.Ctx) (*Response, error) {
|
||||
func (c AdminController) ListUsers(ctx *fiber.Ctx) error {
|
||||
accs, err := c.iam.ListUserAccounts()
|
||||
return &Response{
|
||||
Data: auth.ListUserAccountsResult{Accounts: accs},
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
return SendXMLResponse(ctx,
|
||||
auth.ListUserAccountsResult{
|
||||
Accounts: accs,
|
||||
}, err,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminListUsers,
|
||||
})
|
||||
}
|
||||
|
||||
func (c AdminController) ChangeBucketOwner(ctx *fiber.Ctx) (*Response, error) {
|
||||
func (c AdminController) ChangeBucketOwner(ctx *fiber.Ctx) error {
|
||||
owner := ctx.Query("owner")
|
||||
bucket := ctx.Query("bucket")
|
||||
|
||||
accs, err := auth.CheckIfAccountsExist([]string{owner}, c.iam)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
return SendResponse(ctx, err,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminChangeBucketOwner,
|
||||
})
|
||||
}
|
||||
if len(accs) > 0 {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAdminUserNotFound)
|
||||
return SendResponse(ctx, s3err.GetAPIError(s3err.ErrAdminUserNotFound),
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminChangeBucketOwner,
|
||||
})
|
||||
}
|
||||
|
||||
err = c.be.ChangeBucketOwner(ctx.Context(), bucket, owner)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
acl := auth.ACL{
|
||||
Owner: owner,
|
||||
Grantees: []auth.Grantee{
|
||||
{
|
||||
Permission: auth.PermissionFullControl,
|
||||
Access: owner,
|
||||
Type: types.TypeCanonicalUser,
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
aclParsed, err := json.Marshal(acl)
|
||||
if err != nil {
|
||||
return SendResponse(ctx, fmt.Errorf("failed to marshal the bucket acl: %w", err),
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminChangeBucketOwner,
|
||||
})
|
||||
}
|
||||
|
||||
err = c.be.ChangeBucketOwner(ctx.Context(), bucket, aclParsed)
|
||||
return SendResponse(ctx, err,
|
||||
&MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminChangeBucketOwner,
|
||||
})
|
||||
}
|
||||
|
||||
func (c AdminController) ListBuckets(ctx *fiber.Ctx) (*Response, error) {
|
||||
func (c AdminController) ListBuckets(ctx *fiber.Ctx) error {
|
||||
buckets, err := c.be.ListBucketsAndOwners(ctx.Context())
|
||||
return &Response{
|
||||
Data: s3response.ListBucketsResult{
|
||||
return SendXMLResponse(ctx,
|
||||
s3response.ListBucketsResult{
|
||||
Buckets: buckets,
|
||||
},
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c AdminController) CreateBucket(ctx *fiber.Ctx) (*Response, error) {
|
||||
owner := ctx.Get("x-vgw-owner")
|
||||
if owner == "" {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAdminEmptyBucketOwnerHeader)
|
||||
}
|
||||
|
||||
acc, err := c.iam.GetUserAccount(owner)
|
||||
if err != nil {
|
||||
if err == auth.ErrNoSuchUser {
|
||||
err = s3err.GetAPIError(s3err.ErrAdminUserNotFound)
|
||||
}
|
||||
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
}
|
||||
|
||||
// store the owner access key id in context
|
||||
ctx.Context().SetUserValue("bucket-owner", acc)
|
||||
|
||||
_, err = c.s3api.CreateBucket(ctx)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, err
|
||||
}
|
||||
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
Status: http.StatusCreated,
|
||||
},
|
||||
}, nil
|
||||
}, err, &MetaOpts{
|
||||
Logger: c.l,
|
||||
Action: metrics.ActionAdminListBuckets,
|
||||
})
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -26,13 +26,13 @@ var _ backend.Backend = &BackendMock{}
|
||||
// AbortMultipartUploadFunc: func(contextMoqParam context.Context, abortMultipartUploadInput *s3.AbortMultipartUploadInput) error {
|
||||
// panic("mock out the AbortMultipartUpload method")
|
||||
// },
|
||||
// ChangeBucketOwnerFunc: func(contextMoqParam context.Context, bucket string, owner string) error {
|
||||
// ChangeBucketOwnerFunc: func(contextMoqParam context.Context, bucket string, acl []byte) error {
|
||||
// panic("mock out the ChangeBucketOwner method")
|
||||
// },
|
||||
// CompleteMultipartUploadFunc: func(contextMoqParam context.Context, completeMultipartUploadInput *s3.CompleteMultipartUploadInput) (s3response.CompleteMultipartUploadResult, string, error) {
|
||||
// CompleteMultipartUploadFunc: func(contextMoqParam context.Context, completeMultipartUploadInput *s3.CompleteMultipartUploadInput) (*s3.CompleteMultipartUploadOutput, error) {
|
||||
// panic("mock out the CompleteMultipartUpload method")
|
||||
// },
|
||||
// CopyObjectFunc: func(contextMoqParam context.Context, copyObjectInput s3response.CopyObjectInput) (s3response.CopyObjectOutput, error) {
|
||||
// CopyObjectFunc: func(contextMoqParam context.Context, copyObjectInput s3response.CopyObjectInput) (*s3.CopyObjectOutput, error) {
|
||||
// panic("mock out the CopyObject method")
|
||||
// },
|
||||
// CreateBucketFunc: func(contextMoqParam context.Context, createBucketInput *s3.CreateBucketInput, defaultACL []byte) error {
|
||||
@@ -59,7 +59,7 @@ var _ backend.Backend = &BackendMock{}
|
||||
// DeleteObjectFunc: func(contextMoqParam context.Context, deleteObjectInput *s3.DeleteObjectInput) (*s3.DeleteObjectOutput, error) {
|
||||
// panic("mock out the DeleteObject method")
|
||||
// },
|
||||
// DeleteObjectTaggingFunc: func(contextMoqParam context.Context, bucket string, object string, versionId string) error {
|
||||
// DeleteObjectTaggingFunc: func(contextMoqParam context.Context, bucket string, object string) error {
|
||||
// panic("mock out the DeleteObjectTagging method")
|
||||
// },
|
||||
// DeleteObjectsFunc: func(contextMoqParam context.Context, deleteObjectsInput *s3.DeleteObjectsInput) (s3response.DeleteResult, error) {
|
||||
@@ -101,7 +101,7 @@ var _ backend.Backend = &BackendMock{}
|
||||
// GetObjectRetentionFunc: func(contextMoqParam context.Context, bucket string, object string, versionId string) ([]byte, error) {
|
||||
// panic("mock out the GetObjectRetention method")
|
||||
// },
|
||||
// GetObjectTaggingFunc: func(contextMoqParam context.Context, bucket string, object string, versionId string) (map[string]string, error) {
|
||||
// GetObjectTaggingFunc: func(contextMoqParam context.Context, bucket string, object string) (map[string]string, error) {
|
||||
// panic("mock out the GetObjectTagging method")
|
||||
// },
|
||||
// HeadBucketFunc: func(contextMoqParam context.Context, headBucketInput *s3.HeadBucketInput) (*s3.HeadBucketOutput, error) {
|
||||
@@ -134,7 +134,7 @@ var _ backend.Backend = &BackendMock{}
|
||||
// PutBucketAclFunc: func(contextMoqParam context.Context, bucket string, data []byte) error {
|
||||
// panic("mock out the PutBucketAcl method")
|
||||
// },
|
||||
// PutBucketCorsFunc: func(contextMoqParam context.Context, bucket string, cors []byte) error {
|
||||
// PutBucketCorsFunc: func(contextMoqParam context.Context, bytes []byte) error {
|
||||
// panic("mock out the PutBucketCors method")
|
||||
// },
|
||||
// PutBucketOwnershipControlsFunc: func(contextMoqParam context.Context, bucket string, ownership types.ObjectOwnership) error {
|
||||
@@ -161,10 +161,10 @@ var _ backend.Backend = &BackendMock{}
|
||||
// PutObjectLockConfigurationFunc: func(contextMoqParam context.Context, bucket string, config []byte) error {
|
||||
// panic("mock out the PutObjectLockConfiguration method")
|
||||
// },
|
||||
// PutObjectRetentionFunc: func(contextMoqParam context.Context, bucket string, object string, versionId string, retention []byte) error {
|
||||
// PutObjectRetentionFunc: func(contextMoqParam context.Context, bucket string, object string, versionId string, bypass bool, retention []byte) error {
|
||||
// panic("mock out the PutObjectRetention method")
|
||||
// },
|
||||
// PutObjectTaggingFunc: func(contextMoqParam context.Context, bucket string, object string, versionId string, tags map[string]string) error {
|
||||
// PutObjectTaggingFunc: func(contextMoqParam context.Context, bucket string, object string, tags map[string]string) error {
|
||||
// panic("mock out the PutObjectTagging method")
|
||||
// },
|
||||
// RestoreObjectFunc: func(contextMoqParam context.Context, restoreObjectInput *s3.RestoreObjectInput) error {
|
||||
@@ -196,13 +196,13 @@ type BackendMock struct {
|
||||
AbortMultipartUploadFunc func(contextMoqParam context.Context, abortMultipartUploadInput *s3.AbortMultipartUploadInput) error
|
||||
|
||||
// ChangeBucketOwnerFunc mocks the ChangeBucketOwner method.
|
||||
ChangeBucketOwnerFunc func(contextMoqParam context.Context, bucket string, owner string) error
|
||||
ChangeBucketOwnerFunc func(contextMoqParam context.Context, bucket string, acl []byte) error
|
||||
|
||||
// CompleteMultipartUploadFunc mocks the CompleteMultipartUpload method.
|
||||
CompleteMultipartUploadFunc func(contextMoqParam context.Context, completeMultipartUploadInput *s3.CompleteMultipartUploadInput) (s3response.CompleteMultipartUploadResult, string, error)
|
||||
CompleteMultipartUploadFunc func(contextMoqParam context.Context, completeMultipartUploadInput *s3.CompleteMultipartUploadInput) (*s3.CompleteMultipartUploadOutput, error)
|
||||
|
||||
// CopyObjectFunc mocks the CopyObject method.
|
||||
CopyObjectFunc func(contextMoqParam context.Context, copyObjectInput s3response.CopyObjectInput) (s3response.CopyObjectOutput, error)
|
||||
CopyObjectFunc func(contextMoqParam context.Context, copyObjectInput s3response.CopyObjectInput) (*s3.CopyObjectOutput, error)
|
||||
|
||||
// CreateBucketFunc mocks the CreateBucket method.
|
||||
CreateBucketFunc func(contextMoqParam context.Context, createBucketInput *s3.CreateBucketInput, defaultACL []byte) error
|
||||
@@ -229,7 +229,7 @@ type BackendMock struct {
|
||||
DeleteObjectFunc func(contextMoqParam context.Context, deleteObjectInput *s3.DeleteObjectInput) (*s3.DeleteObjectOutput, error)
|
||||
|
||||
// DeleteObjectTaggingFunc mocks the DeleteObjectTagging method.
|
||||
DeleteObjectTaggingFunc func(contextMoqParam context.Context, bucket string, object string, versionId string) error
|
||||
DeleteObjectTaggingFunc func(contextMoqParam context.Context, bucket string, object string) error
|
||||
|
||||
// DeleteObjectsFunc mocks the DeleteObjects method.
|
||||
DeleteObjectsFunc func(contextMoqParam context.Context, deleteObjectsInput *s3.DeleteObjectsInput) (s3response.DeleteResult, error)
|
||||
@@ -271,7 +271,7 @@ type BackendMock struct {
|
||||
GetObjectRetentionFunc func(contextMoqParam context.Context, bucket string, object string, versionId string) ([]byte, error)
|
||||
|
||||
// GetObjectTaggingFunc mocks the GetObjectTagging method.
|
||||
GetObjectTaggingFunc func(contextMoqParam context.Context, bucket string, object string, versionId string) (map[string]string, error)
|
||||
GetObjectTaggingFunc func(contextMoqParam context.Context, bucket string, object string) (map[string]string, error)
|
||||
|
||||
// HeadBucketFunc mocks the HeadBucket method.
|
||||
HeadBucketFunc func(contextMoqParam context.Context, headBucketInput *s3.HeadBucketInput) (*s3.HeadBucketOutput, error)
|
||||
@@ -304,7 +304,7 @@ type BackendMock struct {
|
||||
PutBucketAclFunc func(contextMoqParam context.Context, bucket string, data []byte) error
|
||||
|
||||
// PutBucketCorsFunc mocks the PutBucketCors method.
|
||||
PutBucketCorsFunc func(contextMoqParam context.Context, bucket string, cors []byte) error
|
||||
PutBucketCorsFunc func(contextMoqParam context.Context, bytes []byte) error
|
||||
|
||||
// PutBucketOwnershipControlsFunc mocks the PutBucketOwnershipControls method.
|
||||
PutBucketOwnershipControlsFunc func(contextMoqParam context.Context, bucket string, ownership types.ObjectOwnership) error
|
||||
@@ -331,10 +331,10 @@ type BackendMock struct {
|
||||
PutObjectLockConfigurationFunc func(contextMoqParam context.Context, bucket string, config []byte) error
|
||||
|
||||
// PutObjectRetentionFunc mocks the PutObjectRetention method.
|
||||
PutObjectRetentionFunc func(contextMoqParam context.Context, bucket string, object string, versionId string, retention []byte) error
|
||||
PutObjectRetentionFunc func(contextMoqParam context.Context, bucket string, object string, versionId string, bypass bool, retention []byte) error
|
||||
|
||||
// PutObjectTaggingFunc mocks the PutObjectTagging method.
|
||||
PutObjectTaggingFunc func(contextMoqParam context.Context, bucket string, object string, versionId string, tags map[string]string) error
|
||||
PutObjectTaggingFunc func(contextMoqParam context.Context, bucket string, object string, tags map[string]string) error
|
||||
|
||||
// RestoreObjectFunc mocks the RestoreObject method.
|
||||
RestoreObjectFunc func(contextMoqParam context.Context, restoreObjectInput *s3.RestoreObjectInput) error
|
||||
@@ -369,8 +369,8 @@ type BackendMock struct {
|
||||
ContextMoqParam context.Context
|
||||
// Bucket is the bucket argument value.
|
||||
Bucket string
|
||||
// Owner is the owner argument value.
|
||||
Owner string
|
||||
// ACL is the acl argument value.
|
||||
ACL []byte
|
||||
}
|
||||
// CompleteMultipartUpload holds details about calls to the CompleteMultipartUpload method.
|
||||
CompleteMultipartUpload []struct {
|
||||
@@ -452,8 +452,6 @@ type BackendMock struct {
|
||||
Bucket string
|
||||
// Object is the object argument value.
|
||||
Object string
|
||||
// VersionId is the versionId argument value.
|
||||
VersionId string
|
||||
}
|
||||
// DeleteObjects holds details about calls to the DeleteObjects method.
|
||||
DeleteObjects []struct {
|
||||
@@ -562,8 +560,6 @@ type BackendMock struct {
|
||||
Bucket string
|
||||
// Object is the object argument value.
|
||||
Object string
|
||||
// VersionId is the versionId argument value.
|
||||
VersionId string
|
||||
}
|
||||
// HeadBucket holds details about calls to the HeadBucket method.
|
||||
HeadBucket []struct {
|
||||
@@ -639,10 +635,8 @@ type BackendMock struct {
|
||||
PutBucketCors []struct {
|
||||
// ContextMoqParam is the contextMoqParam argument value.
|
||||
ContextMoqParam context.Context
|
||||
// Bucket is the bucket argument value.
|
||||
Bucket string
|
||||
// Cors is the cors argument value.
|
||||
Cors []byte
|
||||
// Bytes is the bytes argument value.
|
||||
Bytes []byte
|
||||
}
|
||||
// PutBucketOwnershipControls holds details about calls to the PutBucketOwnershipControls method.
|
||||
PutBucketOwnershipControls []struct {
|
||||
@@ -726,6 +720,8 @@ type BackendMock struct {
|
||||
Object string
|
||||
// VersionId is the versionId argument value.
|
||||
VersionId string
|
||||
// Bypass is the bypass argument value.
|
||||
Bypass bool
|
||||
// Retention is the retention argument value.
|
||||
Retention []byte
|
||||
}
|
||||
@@ -737,8 +733,6 @@ type BackendMock struct {
|
||||
Bucket string
|
||||
// Object is the object argument value.
|
||||
Object string
|
||||
// VersionId is the versionId argument value.
|
||||
VersionId string
|
||||
// Tags is the tags argument value.
|
||||
Tags map[string]string
|
||||
}
|
||||
@@ -870,23 +864,23 @@ func (mock *BackendMock) AbortMultipartUploadCalls() []struct {
|
||||
}
|
||||
|
||||
// ChangeBucketOwner calls ChangeBucketOwnerFunc.
|
||||
func (mock *BackendMock) ChangeBucketOwner(contextMoqParam context.Context, bucket string, owner string) error {
|
||||
func (mock *BackendMock) ChangeBucketOwner(contextMoqParam context.Context, bucket string, acl []byte) error {
|
||||
if mock.ChangeBucketOwnerFunc == nil {
|
||||
panic("BackendMock.ChangeBucketOwnerFunc: method is nil but Backend.ChangeBucketOwner was just called")
|
||||
}
|
||||
callInfo := struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Owner string
|
||||
ACL []byte
|
||||
}{
|
||||
ContextMoqParam: contextMoqParam,
|
||||
Bucket: bucket,
|
||||
Owner: owner,
|
||||
ACL: acl,
|
||||
}
|
||||
mock.lockChangeBucketOwner.Lock()
|
||||
mock.calls.ChangeBucketOwner = append(mock.calls.ChangeBucketOwner, callInfo)
|
||||
mock.lockChangeBucketOwner.Unlock()
|
||||
return mock.ChangeBucketOwnerFunc(contextMoqParam, bucket, owner)
|
||||
return mock.ChangeBucketOwnerFunc(contextMoqParam, bucket, acl)
|
||||
}
|
||||
|
||||
// ChangeBucketOwnerCalls gets all the calls that were made to ChangeBucketOwner.
|
||||
@@ -896,12 +890,12 @@ func (mock *BackendMock) ChangeBucketOwner(contextMoqParam context.Context, buck
|
||||
func (mock *BackendMock) ChangeBucketOwnerCalls() []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Owner string
|
||||
ACL []byte
|
||||
} {
|
||||
var calls []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Owner string
|
||||
ACL []byte
|
||||
}
|
||||
mock.lockChangeBucketOwner.RLock()
|
||||
calls = mock.calls.ChangeBucketOwner
|
||||
@@ -910,7 +904,7 @@ func (mock *BackendMock) ChangeBucketOwnerCalls() []struct {
|
||||
}
|
||||
|
||||
// CompleteMultipartUpload calls CompleteMultipartUploadFunc.
|
||||
func (mock *BackendMock) CompleteMultipartUpload(contextMoqParam context.Context, completeMultipartUploadInput *s3.CompleteMultipartUploadInput) (s3response.CompleteMultipartUploadResult, string, error) {
|
||||
func (mock *BackendMock) CompleteMultipartUpload(contextMoqParam context.Context, completeMultipartUploadInput *s3.CompleteMultipartUploadInput) (*s3.CompleteMultipartUploadOutput, error) {
|
||||
if mock.CompleteMultipartUploadFunc == nil {
|
||||
panic("BackendMock.CompleteMultipartUploadFunc: method is nil but Backend.CompleteMultipartUpload was just called")
|
||||
}
|
||||
@@ -946,7 +940,7 @@ func (mock *BackendMock) CompleteMultipartUploadCalls() []struct {
|
||||
}
|
||||
|
||||
// CopyObject calls CopyObjectFunc.
|
||||
func (mock *BackendMock) CopyObject(contextMoqParam context.Context, copyObjectInput s3response.CopyObjectInput) (s3response.CopyObjectOutput, error) {
|
||||
func (mock *BackendMock) CopyObject(contextMoqParam context.Context, copyObjectInput s3response.CopyObjectInput) (*s3.CopyObjectOutput, error) {
|
||||
if mock.CopyObjectFunc == nil {
|
||||
panic("BackendMock.CopyObjectFunc: method is nil but Backend.CopyObject was just called")
|
||||
}
|
||||
@@ -1274,7 +1268,7 @@ func (mock *BackendMock) DeleteObjectCalls() []struct {
|
||||
}
|
||||
|
||||
// DeleteObjectTagging calls DeleteObjectTaggingFunc.
|
||||
func (mock *BackendMock) DeleteObjectTagging(contextMoqParam context.Context, bucket string, object string, versionId string) error {
|
||||
func (mock *BackendMock) DeleteObjectTagging(contextMoqParam context.Context, bucket string, object string) error {
|
||||
if mock.DeleteObjectTaggingFunc == nil {
|
||||
panic("BackendMock.DeleteObjectTaggingFunc: method is nil but Backend.DeleteObjectTagging was just called")
|
||||
}
|
||||
@@ -1282,17 +1276,15 @@ func (mock *BackendMock) DeleteObjectTagging(contextMoqParam context.Context, bu
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
}{
|
||||
ContextMoqParam: contextMoqParam,
|
||||
Bucket: bucket,
|
||||
Object: object,
|
||||
VersionId: versionId,
|
||||
}
|
||||
mock.lockDeleteObjectTagging.Lock()
|
||||
mock.calls.DeleteObjectTagging = append(mock.calls.DeleteObjectTagging, callInfo)
|
||||
mock.lockDeleteObjectTagging.Unlock()
|
||||
return mock.DeleteObjectTaggingFunc(contextMoqParam, bucket, object, versionId)
|
||||
return mock.DeleteObjectTaggingFunc(contextMoqParam, bucket, object)
|
||||
}
|
||||
|
||||
// DeleteObjectTaggingCalls gets all the calls that were made to DeleteObjectTagging.
|
||||
@@ -1303,13 +1295,11 @@ func (mock *BackendMock) DeleteObjectTaggingCalls() []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
} {
|
||||
var calls []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
}
|
||||
mock.lockDeleteObjectTagging.RLock()
|
||||
calls = mock.calls.DeleteObjectTagging
|
||||
@@ -1802,7 +1792,7 @@ func (mock *BackendMock) GetObjectRetentionCalls() []struct {
|
||||
}
|
||||
|
||||
// GetObjectTagging calls GetObjectTaggingFunc.
|
||||
func (mock *BackendMock) GetObjectTagging(contextMoqParam context.Context, bucket string, object string, versionId string) (map[string]string, error) {
|
||||
func (mock *BackendMock) GetObjectTagging(contextMoqParam context.Context, bucket string, object string) (map[string]string, error) {
|
||||
if mock.GetObjectTaggingFunc == nil {
|
||||
panic("BackendMock.GetObjectTaggingFunc: method is nil but Backend.GetObjectTagging was just called")
|
||||
}
|
||||
@@ -1810,17 +1800,15 @@ func (mock *BackendMock) GetObjectTagging(contextMoqParam context.Context, bucke
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
}{
|
||||
ContextMoqParam: contextMoqParam,
|
||||
Bucket: bucket,
|
||||
Object: object,
|
||||
VersionId: versionId,
|
||||
}
|
||||
mock.lockGetObjectTagging.Lock()
|
||||
mock.calls.GetObjectTagging = append(mock.calls.GetObjectTagging, callInfo)
|
||||
mock.lockGetObjectTagging.Unlock()
|
||||
return mock.GetObjectTaggingFunc(contextMoqParam, bucket, object, versionId)
|
||||
return mock.GetObjectTaggingFunc(contextMoqParam, bucket, object)
|
||||
}
|
||||
|
||||
// GetObjectTaggingCalls gets all the calls that were made to GetObjectTagging.
|
||||
@@ -1831,13 +1819,11 @@ func (mock *BackendMock) GetObjectTaggingCalls() []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
} {
|
||||
var calls []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
}
|
||||
mock.lockGetObjectTagging.RLock()
|
||||
calls = mock.calls.GetObjectTagging
|
||||
@@ -2206,23 +2192,21 @@ func (mock *BackendMock) PutBucketAclCalls() []struct {
|
||||
}
|
||||
|
||||
// PutBucketCors calls PutBucketCorsFunc.
|
||||
func (mock *BackendMock) PutBucketCors(contextMoqParam context.Context, bucket string, cors []byte) error {
|
||||
func (mock *BackendMock) PutBucketCors(contextMoqParam context.Context, bytes []byte) error {
|
||||
if mock.PutBucketCorsFunc == nil {
|
||||
panic("BackendMock.PutBucketCorsFunc: method is nil but Backend.PutBucketCors was just called")
|
||||
}
|
||||
callInfo := struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Cors []byte
|
||||
Bytes []byte
|
||||
}{
|
||||
ContextMoqParam: contextMoqParam,
|
||||
Bucket: bucket,
|
||||
Cors: cors,
|
||||
Bytes: bytes,
|
||||
}
|
||||
mock.lockPutBucketCors.Lock()
|
||||
mock.calls.PutBucketCors = append(mock.calls.PutBucketCors, callInfo)
|
||||
mock.lockPutBucketCors.Unlock()
|
||||
return mock.PutBucketCorsFunc(contextMoqParam, bucket, cors)
|
||||
return mock.PutBucketCorsFunc(contextMoqParam, bytes)
|
||||
}
|
||||
|
||||
// PutBucketCorsCalls gets all the calls that were made to PutBucketCors.
|
||||
@@ -2231,13 +2215,11 @@ func (mock *BackendMock) PutBucketCors(contextMoqParam context.Context, bucket s
|
||||
// len(mockedBackend.PutBucketCorsCalls())
|
||||
func (mock *BackendMock) PutBucketCorsCalls() []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Cors []byte
|
||||
Bytes []byte
|
||||
} {
|
||||
var calls []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Cors []byte
|
||||
Bytes []byte
|
||||
}
|
||||
mock.lockPutBucketCors.RLock()
|
||||
calls = mock.calls.PutBucketCors
|
||||
@@ -2566,7 +2548,7 @@ func (mock *BackendMock) PutObjectLockConfigurationCalls() []struct {
|
||||
}
|
||||
|
||||
// PutObjectRetention calls PutObjectRetentionFunc.
|
||||
func (mock *BackendMock) PutObjectRetention(contextMoqParam context.Context, bucket string, object string, versionId string, retention []byte) error {
|
||||
func (mock *BackendMock) PutObjectRetention(contextMoqParam context.Context, bucket string, object string, versionId string, bypass bool, retention []byte) error {
|
||||
if mock.PutObjectRetentionFunc == nil {
|
||||
panic("BackendMock.PutObjectRetentionFunc: method is nil but Backend.PutObjectRetention was just called")
|
||||
}
|
||||
@@ -2575,18 +2557,20 @@ func (mock *BackendMock) PutObjectRetention(contextMoqParam context.Context, buc
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
Bypass bool
|
||||
Retention []byte
|
||||
}{
|
||||
ContextMoqParam: contextMoqParam,
|
||||
Bucket: bucket,
|
||||
Object: object,
|
||||
VersionId: versionId,
|
||||
Bypass: bypass,
|
||||
Retention: retention,
|
||||
}
|
||||
mock.lockPutObjectRetention.Lock()
|
||||
mock.calls.PutObjectRetention = append(mock.calls.PutObjectRetention, callInfo)
|
||||
mock.lockPutObjectRetention.Unlock()
|
||||
return mock.PutObjectRetentionFunc(contextMoqParam, bucket, object, versionId, retention)
|
||||
return mock.PutObjectRetentionFunc(contextMoqParam, bucket, object, versionId, bypass, retention)
|
||||
}
|
||||
|
||||
// PutObjectRetentionCalls gets all the calls that were made to PutObjectRetention.
|
||||
@@ -2598,6 +2582,7 @@ func (mock *BackendMock) PutObjectRetentionCalls() []struct {
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
Bypass bool
|
||||
Retention []byte
|
||||
} {
|
||||
var calls []struct {
|
||||
@@ -2605,6 +2590,7 @@ func (mock *BackendMock) PutObjectRetentionCalls() []struct {
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
Bypass bool
|
||||
Retention []byte
|
||||
}
|
||||
mock.lockPutObjectRetention.RLock()
|
||||
@@ -2614,7 +2600,7 @@ func (mock *BackendMock) PutObjectRetentionCalls() []struct {
|
||||
}
|
||||
|
||||
// PutObjectTagging calls PutObjectTaggingFunc.
|
||||
func (mock *BackendMock) PutObjectTagging(contextMoqParam context.Context, bucket string, object string, versionId string, tags map[string]string) error {
|
||||
func (mock *BackendMock) PutObjectTagging(contextMoqParam context.Context, bucket string, object string, tags map[string]string) error {
|
||||
if mock.PutObjectTaggingFunc == nil {
|
||||
panic("BackendMock.PutObjectTaggingFunc: method is nil but Backend.PutObjectTagging was just called")
|
||||
}
|
||||
@@ -2622,19 +2608,17 @@ func (mock *BackendMock) PutObjectTagging(contextMoqParam context.Context, bucke
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
Tags map[string]string
|
||||
}{
|
||||
ContextMoqParam: contextMoqParam,
|
||||
Bucket: bucket,
|
||||
Object: object,
|
||||
VersionId: versionId,
|
||||
Tags: tags,
|
||||
}
|
||||
mock.lockPutObjectTagging.Lock()
|
||||
mock.calls.PutObjectTagging = append(mock.calls.PutObjectTagging, callInfo)
|
||||
mock.lockPutObjectTagging.Unlock()
|
||||
return mock.PutObjectTaggingFunc(contextMoqParam, bucket, object, versionId, tags)
|
||||
return mock.PutObjectTaggingFunc(contextMoqParam, bucket, object, tags)
|
||||
}
|
||||
|
||||
// PutObjectTaggingCalls gets all the calls that were made to PutObjectTagging.
|
||||
@@ -2645,14 +2629,12 @@ func (mock *BackendMock) PutObjectTaggingCalls() []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
Tags map[string]string
|
||||
} {
|
||||
var calls []struct {
|
||||
ContextMoqParam context.Context
|
||||
Bucket string
|
||||
Object string
|
||||
VersionId string
|
||||
Tags map[string]string
|
||||
}
|
||||
mock.lockPutObjectTagging.RLock()
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
@@ -1,194 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"net/http"
|
||||
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
)
|
||||
|
||||
func (c S3ApiController) DeleteBucketTagging(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
IsBucketPublic := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketTaggingAction,
|
||||
IsPublicRequest: IsBucketPublic,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.DeleteBucketTagging(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) DeleteBucketOwnershipControls(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketOwnershipControlsAction,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.DeleteBucketOwnershipControls(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) DeleteBucketPolicy(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.DeleteBucketPolicyAction,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.DeleteBucketPolicy(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) DeleteBucketCors(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
IsBucketPublic := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketCorsAction,
|
||||
IsPublicRequest: IsBucketPublic,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.DeleteBucketCors(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) DeleteBucket(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
IsBucketPublic := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.DeleteBucketAction,
|
||||
IsPublicRequest: IsBucketPublic,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.DeleteBucket(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
@@ -1,413 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net/http"
|
||||
"testing"
|
||||
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func TestS3ApiController_DeleteBucketTagging(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "verify access fails",
|
||||
input: testInput{
|
||||
locals: accessDeniedLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAccessDenied),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beErr: s3err.GetAPIError(s3err.ErrAclNotSupported),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAclNotSupported),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
DeleteBucketTaggingFunc: func(_ context.Context, _ string) error {
|
||||
return tt.input.beErr
|
||||
},
|
||||
GetBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.DeleteBucketTagging,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestS3ApiController_DeleteBucketOwnershipControls(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "verify access fails",
|
||||
input: testInput{
|
||||
locals: accessDeniedLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAccessDenied),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beErr: s3err.GetAPIError(s3err.ErrInvalidAccessKeyID),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrInvalidAccessKeyID),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
DeleteBucketOwnershipControlsFunc: func(contextMoqParam context.Context, bucket string) error {
|
||||
return tt.input.beErr
|
||||
},
|
||||
GetBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.DeleteBucketOwnershipControls,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestS3ApiController_DeleteBucketPolicy(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "verify access fails",
|
||||
input: testInput{
|
||||
locals: accessDeniedLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAccessDenied),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beErr: s3err.GetAPIError(s3err.ErrInvalidDigest),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrInvalidDigest),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
DeleteBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) error {
|
||||
return tt.input.beErr
|
||||
},
|
||||
GetBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.DeleteBucketPolicy,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestS3ApiController_DeleteBucketCors(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "verify access fails",
|
||||
input: testInput{
|
||||
locals: accessDeniedLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAccessDenied),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beErr: s3err.GetAPIError(s3err.ErrAdminMethodNotSupported),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAdminMethodNotSupported),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
DeleteBucketCorsFunc: func(contextMoqParam context.Context, bucket string) error {
|
||||
return tt.input.beErr
|
||||
},
|
||||
GetBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.DeleteBucketCors,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestS3ApiController_DeleteBucket(t *testing.T) {
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "verify access fails",
|
||||
input: testInput{
|
||||
locals: accessDeniedLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAccessDenied),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beErr: s3err.GetAPIError(s3err.ErrInvalidDigest),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrInvalidDigest),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
DeleteBucketFunc: func(contextMoqParam context.Context, bucket string) error {
|
||||
return tt.input.beErr
|
||||
},
|
||||
GetBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.DeleteBucket,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -1,674 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"strings"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
func (c S3ApiController) GetBucketTagging(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketTaggingAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
tags, err := c.be.GetBucketTagging(ctx.Context(), bucket)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
resp := s3response.Tagging{
|
||||
TagSet: s3response.TagSet{
|
||||
Tags: make([]s3response.Tag, 0, len(tags)),
|
||||
},
|
||||
}
|
||||
|
||||
for key, val := range tags {
|
||||
resp.TagSet.Tags = append(resp.TagSet.Tags,
|
||||
s3response.Tag{Key: key, Value: val})
|
||||
}
|
||||
|
||||
return &Response{
|
||||
Data: resp,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) GetBucketOwnershipControls(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketOwnershipControlsAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
data, err := c.be.GetBucketOwnershipControls(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
Data: s3response.OwnershipControls{
|
||||
Rules: []types.OwnershipControlsRule{
|
||||
{
|
||||
ObjectOwnership: data,
|
||||
},
|
||||
},
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) GetBucketVersioning(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketVersioningAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
// Only admin users and the bucket owner are allowed to get the versioning state of a bucket.
|
||||
if err := auth.IsAdminOrOwner(acct, isRoot, parsedAcl); err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
data, err := c.be.GetBucketVersioning(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
Data: data,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) GetBucketCors(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketCorsAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
data, err := c.be.GetBucketCors(ctx.Context(), bucket)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
output, err := auth.ParseCORSOutput(data)
|
||||
return &Response{
|
||||
Data: output,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) GetBucketPolicy(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketPolicyAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
data, err := c.be.GetBucketPolicy(ctx.Context(), bucket)
|
||||
return &Response{
|
||||
Data: data,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) GetBucketPolicyStatus(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketPolicyStatusAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
policyRaw, err := c.be.GetBucketPolicy(ctx.Context(), bucket)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
policy, err := auth.ParsePolicyDocument(policyRaw)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
isPublic := policy.IsPublic()
|
||||
|
||||
return &Response{
|
||||
Data: types.PolicyStatus{
|
||||
IsPublic: &isPublic,
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, nil
|
||||
}
|
||||
|
||||
func (c S3ApiController) ListObjectVersions(ctx *fiber.Ctx) (*Response, error) {
|
||||
// url values
|
||||
bucket := ctx.Params("bucket")
|
||||
prefix := ctx.Query("prefix")
|
||||
delimiter := ctx.Query("delimiter")
|
||||
maxkeysStr := ctx.Query("max-keys")
|
||||
keyMarker := ctx.Query("key-marker")
|
||||
versionIdMarker := ctx.Query("version-id-marker")
|
||||
// context keys
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.ListBucketVersionsAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
maxkeys, err := utils.ParseUint(maxkeysStr)
|
||||
if err != nil {
|
||||
debuglogger.Logf("error parsing max keys %q: %v",
|
||||
maxkeysStr, err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidMaxKeys)
|
||||
}
|
||||
|
||||
data, err := c.be.ListObjectVersions(ctx.Context(),
|
||||
&s3.ListObjectVersionsInput{
|
||||
Bucket: &bucket,
|
||||
Delimiter: &delimiter,
|
||||
KeyMarker: &keyMarker,
|
||||
MaxKeys: &maxkeys,
|
||||
Prefix: &prefix,
|
||||
VersionIdMarker: &versionIdMarker,
|
||||
})
|
||||
return &Response{
|
||||
Data: data,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) GetObjectLockConfiguration(ctx *fiber.Ctx) (*Response, error) {
|
||||
// url values
|
||||
bucket := ctx.Params("bucket")
|
||||
// context keys
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketObjectLockConfigurationAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
data, err := c.be.GetObjectLockConfiguration(ctx.Context(), bucket)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
resp, err := auth.ParseBucketLockConfigurationOutput(data)
|
||||
return &Response{
|
||||
Data: resp,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) GetBucketAcl(ctx *fiber.Ctx) (*Response, error) {
|
||||
// url values
|
||||
bucket := ctx.Params("bucket")
|
||||
// context keys
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionReadAcp,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketAclAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
data, err := c.be.GetBucketAcl(ctx.Context(),
|
||||
&s3.GetBucketAclInput{Bucket: &bucket})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
res, err := auth.ParseACLOutput(data, parsedAcl.Owner)
|
||||
return &Response{
|
||||
Data: res,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) ListMultipartUploads(ctx *fiber.Ctx) (*Response, error) {
|
||||
// url values
|
||||
bucket := ctx.Params("bucket")
|
||||
prefix := ctx.Query("prefix")
|
||||
delimiter := ctx.Query("delimiter")
|
||||
keyMarker := ctx.Query("key-marker")
|
||||
maxUploadsStr := ctx.Query("max-uploads")
|
||||
uploadIdMarker := ctx.Query("upload-id-marker")
|
||||
// context keys
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.ListBucketMultipartUploadsAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
maxUploads, err := utils.ParseUint(maxUploadsStr)
|
||||
if err != nil {
|
||||
debuglogger.Logf("error parsing max uploads %q: %v",
|
||||
maxUploadsStr, err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidMaxUploads)
|
||||
}
|
||||
res, err := c.be.ListMultipartUploads(ctx.Context(),
|
||||
&s3.ListMultipartUploadsInput{
|
||||
Bucket: &bucket,
|
||||
Delimiter: &delimiter,
|
||||
Prefix: &prefix,
|
||||
UploadIdMarker: &uploadIdMarker,
|
||||
MaxUploads: &maxUploads,
|
||||
KeyMarker: &keyMarker,
|
||||
})
|
||||
return &Response{
|
||||
Data: res,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) ListObjectsV2(ctx *fiber.Ctx) (*Response, error) {
|
||||
// url values
|
||||
bucket := ctx.Params("bucket")
|
||||
prefix := ctx.Query("prefix")
|
||||
cToken := ctx.Query("continuation-token")
|
||||
sAfter := ctx.Query("start-after")
|
||||
delimiter := ctx.Query("delimiter")
|
||||
maxkeysStr := ctx.Query("max-keys")
|
||||
fetchOwner := strings.EqualFold(ctx.Query("fetch-owner"), "true")
|
||||
// context locals
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.ListBucketAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
maxkeys, err := utils.ParseUint(maxkeysStr)
|
||||
if err != nil {
|
||||
debuglogger.Logf("error parsing max keys %q: %v",
|
||||
maxkeysStr, err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidMaxKeys)
|
||||
}
|
||||
|
||||
res, err := c.be.ListObjectsV2(ctx.Context(),
|
||||
&s3.ListObjectsV2Input{
|
||||
Bucket: &bucket,
|
||||
Prefix: &prefix,
|
||||
ContinuationToken: &cToken,
|
||||
Delimiter: &delimiter,
|
||||
MaxKeys: &maxkeys,
|
||||
StartAfter: &sAfter,
|
||||
FetchOwner: &fetchOwner,
|
||||
})
|
||||
return &Response{
|
||||
Data: res,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) ListObjects(ctx *fiber.Ctx) (*Response, error) {
|
||||
// url values
|
||||
bucket := ctx.Params("bucket")
|
||||
prefix := ctx.Query("prefix")
|
||||
marker := ctx.Query("marker")
|
||||
delimiter := ctx.Query("delimiter")
|
||||
maxkeysStr := ctx.Query("max-keys")
|
||||
// context locals
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.ListBucketAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
maxkeys, err := utils.ParseUint(maxkeysStr)
|
||||
if err != nil {
|
||||
debuglogger.Logf("error parsing max keys %q: %v",
|
||||
maxkeysStr, err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidMaxKeys)
|
||||
}
|
||||
|
||||
res, err := c.be.ListObjects(ctx.Context(),
|
||||
&s3.ListObjectsInput{
|
||||
Bucket: &bucket,
|
||||
Prefix: &prefix,
|
||||
Marker: &marker,
|
||||
Delimiter: &delimiter,
|
||||
MaxKeys: &maxkeys,
|
||||
})
|
||||
return &Response{
|
||||
Data: res,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
// GetBucketLocation handles GET /:bucket?location
|
||||
func (c S3ApiController) GetBucketLocation(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.GetBucketLocationAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
// verify bucket existence/access via backend HeadBucket
|
||||
_, err = c.be.HeadBucket(ctx.Context(), &s3.HeadBucketInput{Bucket: &bucket})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
// pick up configured region from locals (set by router middleware)
|
||||
region, _ := ctx.Locals("region").(string)
|
||||
value := ®ion
|
||||
if region == "us-east-1" {
|
||||
value = nil
|
||||
}
|
||||
|
||||
return &Response{
|
||||
Data: s3response.LocationConstraint{
|
||||
Value: value,
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, nil
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,90 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"errors"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func (c S3ApiController) HeadBucket(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
region := utils.ContextKeyRegion.Get(ctx).(string)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionRead,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.ListBucketAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
Headers: map[string]*string{
|
||||
"x-amz-bucket-region": utils.GetStringPtr(region),
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
_, err = c.be.HeadBucket(ctx.Context(),
|
||||
&s3.HeadBucketInput{
|
||||
Bucket: &bucket,
|
||||
})
|
||||
|
||||
if err != nil {
|
||||
if errors.Is(err, s3err.GetAPIError(s3err.ErrAccessDenied)) {
|
||||
return &Response{
|
||||
// access denied for head object still returns region header
|
||||
Headers: map[string]*string{
|
||||
"x-amz-bucket-region": utils.GetStringPtr(region),
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
return &Response{
|
||||
Headers: map[string]*string{
|
||||
"x-amz-access-point-alias": utils.GetStringPtr("false"),
|
||||
"x-amz-bucket-region": utils.GetStringPtr(region),
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, nil
|
||||
}
|
||||
@@ -1,139 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"context"
|
||||
"testing"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func TestS3ApiController_HeadBucket(t *testing.T) {
|
||||
region := "us-east-1"
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "verify access fails",
|
||||
input: testInput{
|
||||
locals: map[utils.ContextKey]any{
|
||||
utils.ContextKeyIsRoot: false,
|
||||
utils.ContextKeyParsedAcl: auth.ACL{
|
||||
Owner: "root",
|
||||
},
|
||||
utils.ContextKeyAccount: auth.Account{
|
||||
Access: "user",
|
||||
Role: auth.RoleUser,
|
||||
},
|
||||
utils.ContextKeyRegion: region,
|
||||
},
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
Headers: map[string]*string{
|
||||
"x-amz-bucket-region": utils.GetStringPtr(region),
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAccessDenied),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: map[utils.ContextKey]any{
|
||||
utils.ContextKeyIsRoot: true,
|
||||
utils.ContextKeyParsedAcl: auth.ACL{
|
||||
Owner: "root",
|
||||
},
|
||||
utils.ContextKeyAccount: auth.Account{
|
||||
Access: "root",
|
||||
Role: auth.RoleAdmin,
|
||||
},
|
||||
utils.ContextKeyRegion: region,
|
||||
},
|
||||
beErr: s3err.GetAPIError(s3err.ErrInvalidAccessKeyID),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrInvalidAccessKeyID),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: map[utils.ContextKey]any{
|
||||
utils.ContextKeyIsRoot: true,
|
||||
utils.ContextKeyParsedAcl: auth.ACL{
|
||||
Owner: "root",
|
||||
},
|
||||
utils.ContextKeyAccount: auth.Account{
|
||||
Access: "root",
|
||||
Role: auth.RoleAdmin,
|
||||
},
|
||||
utils.ContextKeyRegion: region,
|
||||
},
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
Headers: map[string]*string{
|
||||
"x-amz-access-point-alias": utils.GetStringPtr("false"),
|
||||
"x-amz-bucket-region": utils.GetStringPtr(region),
|
||||
},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
HeadBucketFunc: func(contextMoqParam context.Context, headBucketInput *s3.HeadBucketInput) (*s3.HeadBucketOutput, error) {
|
||||
return &s3.HeadBucketOutput{}, tt.input.beErr
|
||||
},
|
||||
GetBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.HeadBucket,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -1,69 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"strconv"
|
||||
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
func (c S3ApiController) ListBuckets(ctx *fiber.Ctx) (*Response, error) {
|
||||
cToken := ctx.Query("continuation-token")
|
||||
prefix := ctx.Query("prefix")
|
||||
maxBucketsStr := ctx.Query("max-buckets")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
region, ok := utils.ContextKeyRegion.Get(ctx).(string)
|
||||
if !ok {
|
||||
region = defaultRegion
|
||||
}
|
||||
|
||||
maxBuckets := defaultMaxBuckets
|
||||
if maxBucketsStr != "" {
|
||||
maxBucketsParsed, err := strconv.ParseInt(maxBucketsStr, 10, 32)
|
||||
if err != nil || maxBucketsParsed < 0 || maxBucketsParsed > int64(defaultMaxBuckets) {
|
||||
debuglogger.Logf("error parsing max-buckets %q: %v", maxBucketsStr, err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidMaxBuckets)
|
||||
}
|
||||
maxBuckets = int32(maxBucketsParsed)
|
||||
}
|
||||
|
||||
res, err := c.be.ListBuckets(ctx.Context(),
|
||||
s3response.ListBucketsInput{
|
||||
Owner: acct.Access,
|
||||
IsAdmin: acct.Role == auth.RoleAdmin,
|
||||
MaxBuckets: maxBuckets,
|
||||
ContinuationToken: cToken,
|
||||
Prefix: prefix,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{}, err
|
||||
}
|
||||
|
||||
for i := range res.Buckets.Bucket {
|
||||
res.Buckets.Bucket[i].BucketRegion = region
|
||||
}
|
||||
|
||||
return &Response{
|
||||
Data: res,
|
||||
}, nil
|
||||
}
|
||||
@@ -1,108 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"context"
|
||||
"testing"
|
||||
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
func TestS3ApiController_ListBuckets(t *testing.T) {
|
||||
validRes := s3response.ListAllMyBucketsResult{
|
||||
Owner: s3response.CanonicalUser{
|
||||
ID: "root",
|
||||
},
|
||||
Buckets: s3response.ListAllMyBucketsList{
|
||||
Bucket: []s3response.ListAllMyBucketsEntry{
|
||||
{Name: "test"},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "invalid max buckets",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
queries: map[string]string{
|
||||
"max-buckets": "-1",
|
||||
},
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrInvalidMaxBuckets),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beErr: s3err.GetAPIError(s3err.ErrNoSuchBucket),
|
||||
beRes: s3response.ListAllMyBucketsResult{},
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{},
|
||||
err: s3err.GetAPIError(s3err.ErrNoSuchBucket),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beRes: validRes,
|
||||
queries: map[string]string{
|
||||
"max-buckets": "3",
|
||||
},
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
Data: validRes,
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
ListBucketsFunc: func(contextMoqParam context.Context, listBucketsInput s3response.ListBucketsInput) (s3response.ListAllMyBucketsResult, error) {
|
||||
return tt.input.beRes.(s3response.ListAllMyBucketsResult), tt.input.beErr
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.ListBuckets,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
queries: tt.input.queries,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -1,94 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"encoding/xml"
|
||||
"strings"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3event"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
func (c S3ApiController) DeleteObjects(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
bypass := strings.EqualFold(ctx.Get("X-Amz-Bypass-Governance-Retention"), "true")
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
IsBucketPublic := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.DeleteObjectAction,
|
||||
IsPublicRequest: IsBucketPublic,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
var dObj s3response.DeleteObjects
|
||||
err = xml.Unmarshal(ctx.Body(), &dObj)
|
||||
if err != nil {
|
||||
debuglogger.Logf("error unmarshalling delete objects: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidRequest)
|
||||
}
|
||||
|
||||
err = auth.CheckObjectAccess(ctx.Context(), bucket, acct.Access, dObj.Objects, bypass, IsBucketPublic, c.be, false)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
res, err := c.be.DeleteObjects(ctx.Context(),
|
||||
&s3.DeleteObjectsInput{
|
||||
Bucket: &bucket,
|
||||
Delete: &types.Delete{
|
||||
Objects: dObj.Objects,
|
||||
},
|
||||
})
|
||||
return &Response{
|
||||
Data: res,
|
||||
MetaOpts: &MetaOptions{
|
||||
ObjectCount: int64(len(dObj.Objects)),
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
EventName: s3event.EventObjectRemovedDeleteObjects,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
@@ -1,165 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/xml"
|
||||
"testing"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3event"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
func TestS3ApiController_DeleteObjects(t *testing.T) {
|
||||
validBody, err := xml.Marshal(s3response.DeleteObjects{
|
||||
Objects: []types.ObjectIdentifier{
|
||||
{Key: utils.GetStringPtr("obj")},
|
||||
},
|
||||
})
|
||||
assert.NoError(t, err)
|
||||
|
||||
validRes := s3response.DeleteResult{
|
||||
Deleted: []types.DeletedObject{
|
||||
{Key: utils.GetStringPtr("key")},
|
||||
},
|
||||
}
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
input testInput
|
||||
output testOutput
|
||||
}{
|
||||
{
|
||||
name: "verify access fails",
|
||||
input: testInput{
|
||||
locals: accessDeniedLocals,
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrAccessDenied),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "invalid request body",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
body: []byte("invalid_body"),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrInvalidRequest),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "check object access returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
body: validBody,
|
||||
extraMockErr: s3err.GetAPIError(s3err.ErrObjectLocked),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrObjectLocked),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "backend returns error",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
beRes: s3response.DeleteResult{},
|
||||
beErr: s3err.GetAPIError(s3err.ErrNoSuchBucket),
|
||||
body: validBody,
|
||||
extraMockErr: s3err.GetAPIError(s3err.ErrObjectLockConfigurationNotFound),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
Data: s3response.DeleteResult{},
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
EventName: s3event.EventObjectRemovedDeleteObjects,
|
||||
ObjectCount: 1,
|
||||
},
|
||||
},
|
||||
err: s3err.GetAPIError(s3err.ErrNoSuchBucket),
|
||||
},
|
||||
},
|
||||
{
|
||||
name: "successful response",
|
||||
input: testInput{
|
||||
locals: defaultLocals,
|
||||
body: validBody,
|
||||
beRes: validRes,
|
||||
extraMockErr: s3err.GetAPIError(s3err.ErrObjectLockConfigurationNotFound),
|
||||
},
|
||||
output: testOutput{
|
||||
response: &Response{
|
||||
Data: validRes,
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: "root",
|
||||
EventName: s3event.EventObjectRemovedDeleteObjects,
|
||||
ObjectCount: 1,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
be := &BackendMock{
|
||||
DeleteObjectsFunc: func(contextMoqParam context.Context, deleteObjectsInput *s3.DeleteObjectsInput) (s3response.DeleteResult, error) {
|
||||
return tt.input.beRes.(s3response.DeleteResult), tt.input.beErr
|
||||
},
|
||||
GetBucketPolicyFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
},
|
||||
GetObjectLockConfigurationFunc: func(contextMoqParam context.Context, bucket string) ([]byte, error) {
|
||||
return nil, tt.input.extraMockErr
|
||||
},
|
||||
}
|
||||
|
||||
ctrl := S3ApiController{
|
||||
be: be,
|
||||
}
|
||||
|
||||
testController(
|
||||
t,
|
||||
ctrl.DeleteObjects,
|
||||
tt.output.response,
|
||||
tt.output.err,
|
||||
ctxInputs{
|
||||
locals: tt.input.locals,
|
||||
body: tt.input.body,
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -1,627 +0,0 @@
|
||||
// Copyright 2023 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"encoding/xml"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net/http"
|
||||
"strings"
|
||||
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3"
|
||||
"github.com/aws/aws-sdk-go-v2/service/s3/types"
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/auth"
|
||||
"github.com/versity/versitygw/debuglogger"
|
||||
"github.com/versity/versitygw/s3api/utils"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
"github.com/versity/versitygw/s3response"
|
||||
)
|
||||
|
||||
func (c S3ApiController) PutBucketTagging(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketTaggingAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
tagging, err := utils.ParseTagging(ctx.Body(), utils.TagLimitBucket)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.PutBucketTagging(ctx.Context(), bucket, tagging)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) PutBucketOwnershipControls(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
|
||||
if err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketOwnershipControlsAction,
|
||||
}); err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
var ownershipControls s3response.OwnershipControls
|
||||
if err := xml.Unmarshal(ctx.Body(), &ownershipControls); err != nil {
|
||||
debuglogger.Logf("failed to unmarshal request body: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
rulesCount := len(ownershipControls.Rules)
|
||||
isValidOwnership := utils.IsValidOwnership(ownershipControls.Rules[0].ObjectOwnership)
|
||||
if rulesCount != 1 || !isValidOwnership {
|
||||
if rulesCount != 1 {
|
||||
debuglogger.Logf("ownership control rules should be 1, got %v", rulesCount)
|
||||
}
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
err := c.be.PutBucketOwnershipControls(ctx.Context(), bucket, ownershipControls.Rules[0].ObjectOwnership)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) PutBucketVersioning(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketVersioningAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
var versioningConf types.VersioningConfiguration
|
||||
err = xml.Unmarshal(ctx.Body(), &versioningConf)
|
||||
if err != nil {
|
||||
debuglogger.Logf("error unmarshalling versioning configuration: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidRequest)
|
||||
}
|
||||
|
||||
if versioningConf.Status != types.BucketVersioningStatusEnabled &&
|
||||
versioningConf.Status != types.BucketVersioningStatusSuspended {
|
||||
debuglogger.Logf("invalid versioning configuration status: %v", versioningConf.Status)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
err = c.be.PutBucketVersioning(ctx.Context(), bucket, versioningConf.Status)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) PutObjectLockConfiguration(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
if err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketObjectLockConfigurationAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
}); err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
config, err := auth.ParseBucketLockConfigurationInput(ctx.Body())
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.PutObjectLockConfiguration(ctx.Context(), bucket, config)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) PutBucketCors(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
isPublicBucket := utils.ContextKeyPublicBucket.IsSet(ctx)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketCorsAction,
|
||||
IsPublicRequest: isPublicBucket,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
body := ctx.Body()
|
||||
|
||||
var corsConfig auth.CORSConfiguration
|
||||
err = xml.Unmarshal(body, &corsConfig)
|
||||
if err != nil {
|
||||
debuglogger.Logf("invalid CORS request body: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
// validate the CORS configuration rules
|
||||
err = corsConfig.Validate()
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.PutBucketCors(ctx.Context(), bucket, body)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) PutBucketPolicy(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be, auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWrite,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketPolicyAction,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = auth.ValidatePolicyDocument(ctx.Body(), bucket, c.iam)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.PutBucketPolicy(ctx.Context(), bucket, ctx.Body())
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
Status: http.StatusNoContent,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) PutBucketAcl(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acl := ctx.Get("X-Amz-Acl")
|
||||
grantFullControl := ctx.Get("X-Amz-Grant-Full-Control")
|
||||
grantRead := ctx.Get("X-Amz-Grant-Read")
|
||||
grantReadACP := ctx.Get("X-Amz-Grant-Read-Acp")
|
||||
grantWrite := ctx.Get("X-Amz-Grant-Write")
|
||||
grantWriteACP := ctx.Get("X-Amz-Grant-Write-Acp")
|
||||
// context locals
|
||||
parsedAcl := utils.ContextKeyParsedAcl.Get(ctx).(auth.ACL)
|
||||
acct := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
isRoot := utils.ContextKeyIsRoot.Get(ctx).(bool)
|
||||
|
||||
grants := grantFullControl + grantRead + grantReadACP + grantWrite + grantWriteACP
|
||||
var input *auth.PutBucketAclInput
|
||||
|
||||
err := auth.VerifyAccess(ctx.Context(), c.be,
|
||||
auth.AccessOptions{
|
||||
Readonly: c.readonly,
|
||||
Acl: parsedAcl,
|
||||
AclPermission: auth.PermissionWriteAcp,
|
||||
IsRoot: isRoot,
|
||||
Acc: acct,
|
||||
Bucket: bucket,
|
||||
Action: auth.PutBucketAclAction,
|
||||
})
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = auth.ValidateCannedACL(acl)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
ownership, err := c.be.GetBucketOwnershipControls(ctx.Context(), bucket)
|
||||
if err != nil && !errors.Is(err, s3err.GetAPIError(s3err.ErrOwnershipControlsNotFound)) {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
if ownership == types.ObjectOwnershipBucketOwnerEnforced {
|
||||
debuglogger.Logf("bucket acls are disabled")
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrAclNotSupported)
|
||||
}
|
||||
|
||||
if len(ctx.Body()) > 0 {
|
||||
var accessControlPolicy auth.AccessControlPolicy
|
||||
err := xml.Unmarshal(ctx.Body(), &accessControlPolicy)
|
||||
if err != nil {
|
||||
debuglogger.Logf("error unmarshalling access control policy: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedACL)
|
||||
}
|
||||
|
||||
err = accessControlPolicy.Validate()
|
||||
if err != nil {
|
||||
debuglogger.Logf("invalid access control policy: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
if *accessControlPolicy.Owner.ID != parsedAcl.Owner {
|
||||
debuglogger.Logf("invalid access control policy owner id: %v, expected %v", *accessControlPolicy.Owner.ID, parsedAcl.Owner)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.APIError{
|
||||
Code: "InvalidArgument",
|
||||
Description: "Invalid id",
|
||||
HTTPStatusCode: http.StatusBadRequest,
|
||||
}
|
||||
}
|
||||
|
||||
if grants+acl != "" {
|
||||
debuglogger.Logf("invalid request: %q (grants) %q (acl)",
|
||||
grants, acl)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrUnexpectedContent)
|
||||
}
|
||||
|
||||
input = &auth.PutBucketAclInput{
|
||||
Bucket: &bucket,
|
||||
AccessControlPolicy: &accessControlPolicy,
|
||||
}
|
||||
} else if acl != "" {
|
||||
if grants != "" {
|
||||
debuglogger.Logf("invalid request: %q (grants) %q (acl)",
|
||||
grants, acl)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrBothCannedAndHeaderGrants)
|
||||
}
|
||||
|
||||
input = &auth.PutBucketAclInput{
|
||||
Bucket: &bucket,
|
||||
ACL: types.BucketCannedACL(acl),
|
||||
}
|
||||
} else if grants != "" {
|
||||
input = &auth.PutBucketAclInput{
|
||||
Bucket: &bucket,
|
||||
GrantFullControl: &grantFullControl,
|
||||
GrantRead: &grantRead,
|
||||
GrantReadACP: &grantReadACP,
|
||||
GrantWrite: &grantWrite,
|
||||
GrantWriteACP: &grantWriteACP,
|
||||
}
|
||||
} else {
|
||||
debuglogger.Logf("none of the bucket acl options has been specified: canned, req headers, req body")
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrMissingSecurityHeader)
|
||||
}
|
||||
|
||||
updAcl, err := auth.UpdateACL(input, parsedAcl, c.iam)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.PutBucketAcl(ctx.Context(), bucket, updAcl)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: parsedAcl.Owner,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
func (c S3ApiController) CreateBucket(ctx *fiber.Ctx) (*Response, error) {
|
||||
bucket := ctx.Params("bucket")
|
||||
acl := ctx.Get("X-Amz-Acl")
|
||||
grantFullControl := ctx.Get("X-Amz-Grant-Full-Control")
|
||||
grantRead := ctx.Get("X-Amz-Grant-Read")
|
||||
grantReadACP := ctx.Get("X-Amz-Grant-Read-Acp")
|
||||
grantWrite := ctx.Get("X-Amz-Grant-Write")
|
||||
grantWriteACP := ctx.Get("X-Amz-Grant-Write-Acp")
|
||||
lockEnabled := strings.EqualFold(ctx.Get("X-Amz-Bucket-Object-Lock-Enabled"), "true")
|
||||
grants := grantFullControl + grantRead + grantReadACP + grantWrite + grantWriteACP
|
||||
objectOwnership := types.ObjectOwnership(
|
||||
ctx.Get("X-Amz-Object-Ownership", string(types.ObjectOwnershipBucketOwnerEnforced)),
|
||||
)
|
||||
|
||||
if c.readonly {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
creator := utils.ContextKeyAccount.Get(ctx).(auth.Account)
|
||||
if !utils.ContextKeyBucketOwner.IsSet(ctx) {
|
||||
utils.ContextKeyBucketOwner.Set(ctx, creator)
|
||||
}
|
||||
bucketOwner := utils.ContextKeyBucketOwner.Get(ctx).(auth.Account)
|
||||
|
||||
if creator.Role != auth.RoleAdmin && creator.Role != auth.RoleUserPlus {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{},
|
||||
}, s3err.GetAPIError(s3err.ErrAccessDenied)
|
||||
}
|
||||
|
||||
// validate the bucket name
|
||||
if ok := utils.IsValidBucketName(bucket); !ok {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidBucketName)
|
||||
}
|
||||
|
||||
// validate bucket canned acl
|
||||
err := auth.ValidateCannedACL(acl)
|
||||
if err != nil {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
// validate the object ownership value
|
||||
if ok := utils.IsValidOwnership(objectOwnership); !ok {
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, s3err.APIError{
|
||||
Code: "InvalidArgument",
|
||||
Description: fmt.Sprintf("Invalid x-amz-object-ownership header: %v", objectOwnership),
|
||||
HTTPStatusCode: http.StatusBadRequest,
|
||||
}
|
||||
}
|
||||
|
||||
if acl+grants != "" && objectOwnership == types.ObjectOwnershipBucketOwnerEnforced {
|
||||
debuglogger.Logf("bucket acls are disabled for %v object ownership", objectOwnership)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidBucketAclWithObjectOwnership)
|
||||
}
|
||||
|
||||
if acl != "" && grants != "" {
|
||||
debuglogger.Logf("invalid request: %q (grants) %q (acl)", grants, acl)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrBothCannedAndHeaderGrants)
|
||||
}
|
||||
|
||||
var body s3response.CreateBucketConfiguration
|
||||
if len(ctx.Body()) != 0 {
|
||||
// request body is optional for CreateBucket
|
||||
err := xml.Unmarshal(ctx.Body(), &body)
|
||||
if err != nil {
|
||||
debuglogger.Logf("failed to parse the request body: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrMalformedXML)
|
||||
}
|
||||
|
||||
if body.LocationConstraint != nil {
|
||||
region := utils.ContextKeyRegion.Get(ctx).(string)
|
||||
if *body.LocationConstraint != region || *body.LocationConstraint == "us-east-1" {
|
||||
debuglogger.Logf("invalid location constraint: %s", *body.LocationConstraint)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, s3err.GetAPIError(s3err.ErrInvalidLocationConstraint)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
defACL := auth.ACL{
|
||||
Owner: bucketOwner.Access,
|
||||
}
|
||||
|
||||
updAcl, err := auth.UpdateACL(&auth.PutBucketAclInput{
|
||||
GrantFullControl: &grantFullControl,
|
||||
GrantRead: &grantRead,
|
||||
GrantReadACP: &grantReadACP,
|
||||
GrantWrite: &grantWrite,
|
||||
GrantWriteACP: &grantWriteACP,
|
||||
AccessControlPolicy: &auth.AccessControlPolicy{
|
||||
Owner: &types.Owner{
|
||||
ID: &bucketOwner.Access,
|
||||
}},
|
||||
ACL: types.BucketCannedACL(acl),
|
||||
}, defACL, c.iam)
|
||||
if err != nil {
|
||||
debuglogger.Logf("failed to update bucket acl: %v", err)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
|
||||
err = c.be.CreateBucket(ctx.Context(), &s3.CreateBucketInput{
|
||||
Bucket: &bucket,
|
||||
ObjectOwnership: objectOwnership,
|
||||
ObjectLockEnabledForBucket: &lockEnabled,
|
||||
CreateBucketConfiguration: &types.CreateBucketConfiguration{
|
||||
Tags: body.TagSet,
|
||||
},
|
||||
}, updAcl)
|
||||
return &Response{
|
||||
MetaOpts: &MetaOptions{
|
||||
BucketOwner: bucketOwner.Access,
|
||||
},
|
||||
}, err
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,92 +0,0 @@
|
||||
// Copyright 2026 Versity Software
|
||||
// This file is licensed under the Apache License, Version 2.0
|
||||
// (the "License"); you may not use this file except in compliance
|
||||
// with the License. You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing,
|
||||
// software distributed under the License is distributed on an
|
||||
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||
// KIND, either express or implied. See the License for the
|
||||
// specific language governing permissions and limitations
|
||||
// under the License.
|
||||
|
||||
package controllers
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net/http"
|
||||
"testing"
|
||||
|
||||
"github.com/gofiber/fiber/v2"
|
||||
"github.com/versity/versitygw/s3api/middlewares"
|
||||
"github.com/versity/versitygw/s3err"
|
||||
)
|
||||
|
||||
func TestApplyBucketCORS_FallbackOrigin_NoBucketCors_NoRequestOrigin(t *testing.T) {
|
||||
origin := "https://example.com"
|
||||
|
||||
mockedBackend := &BackendMock{
|
||||
GetBucketCorsFunc: func(ctx context.Context, bucket string) ([]byte, error) {
|
||||
return nil, s3err.GetAPIError(s3err.ErrNoSuchCORSConfiguration)
|
||||
},
|
||||
}
|
||||
|
||||
app := fiber.New()
|
||||
app.Get("/:bucket/test",
|
||||
middlewares.ApplyBucketCORS(mockedBackend, origin),
|
||||
func(c *fiber.Ctx) error {
|
||||
return c.SendStatus(http.StatusOK)
|
||||
},
|
||||
)
|
||||
|
||||
req, err := http.NewRequest(http.MethodGet, "/mybucket/test", nil)
|
||||
if err != nil {
|
||||
t.Fatalf("new request: %v", err)
|
||||
}
|
||||
|
||||
resp, err := app.Test(req)
|
||||
if err != nil {
|
||||
t.Fatalf("app.Test: %v", err)
|
||||
}
|
||||
|
||||
if got := resp.Header.Get("Access-Control-Allow-Origin"); got != origin {
|
||||
t.Fatalf("expected Access-Control-Allow-Origin to be set to fallback, got %q", got)
|
||||
}
|
||||
if got := resp.Header.Get("Access-Control-Expose-Headers"); got != "ETag" {
|
||||
t.Fatalf("expected Access-Control-Expose-Headers to include ETag, got %q", got)
|
||||
}
|
||||
}
|
||||
|
||||
func TestApplyBucketCORS_FallbackOrigin_NotAppliedWhenBucketCorsExists(t *testing.T) {
|
||||
origin := "https://example.com"
|
||||
|
||||
mockedBackend := &BackendMock{
|
||||
GetBucketCorsFunc: func(ctx context.Context, bucket string) ([]byte, error) {
|
||||
return []byte("not-parsed"), nil
|
||||
},
|
||||
}
|
||||
|
||||
app := fiber.New()
|
||||
app.Get("/:bucket/test",
|
||||
middlewares.ApplyBucketCORS(mockedBackend, origin),
|
||||
func(c *fiber.Ctx) error {
|
||||
return c.SendStatus(http.StatusOK)
|
||||
},
|
||||
)
|
||||
|
||||
req, err := http.NewRequest(http.MethodGet, "/mybucket/test", nil)
|
||||
if err != nil {
|
||||
t.Fatalf("new request: %v", err)
|
||||
}
|
||||
|
||||
resp, err := app.Test(req)
|
||||
if err != nil {
|
||||
t.Fatalf("app.Test: %v", err)
|
||||
}
|
||||
|
||||
if got := resp.Header.Get("Access-Control-Allow-Origin"); got != "" {
|
||||
t.Fatalf("expected no Access-Control-Allow-Origin when bucket CORS exists, got %q", got)
|
||||
}
|
||||
}
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user